From f8c4d4166e2dacf4a736fbb9e8711b7d222801e3 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 11:57:52 -0700 Subject: [PATCH 01/24] cleanup graphics.landscape --- jcvi/graphics/landscape.py | 59 +++++++++++++++++++------------------- 1 file changed, 29 insertions(+), 30 deletions(-) diff --git a/jcvi/graphics/landscape.py b/jcvi/graphics/landscape.py index e28b96e6..b28f889e 100644 --- a/jcvi/graphics/landscape.py +++ b/jcvi/graphics/landscape.py @@ -9,17 +9,19 @@ import os.path as op import sys -import logging + +from collections import Counter, OrderedDict, defaultdict import numpy as np -from collections import defaultdict, OrderedDict +from ..algorithms.matrix import moving_sum +from ..apps.base import OptionParser, ActionDispatcher, logger +from ..formats.base import BaseFile, DictFile, LineFile, must_open +from ..formats.bed import Bed, bins +from ..formats.sizes import Sizes +from ..utils.cbook import human_size, autoscale -from jcvi.formats.sizes import Sizes -from jcvi.formats.base import BaseFile, DictFile, LineFile, must_open -from jcvi.formats.bed import Bed, bins -from jcvi.algorithms.matrix import moving_sum -from jcvi.graphics.base import ( +from .base import ( plt, Rectangle, CirclePolygon, @@ -32,8 +34,6 @@ normalize_axes, adjust_spines, ) -from jcvi.utils.cbook import human_size, autoscale -from jcvi.apps.base import OptionParser, ActionDispatcher # Colors picked from Schmutz soybean genome paper using ColorPic @@ -148,15 +148,13 @@ def parse_distfile(filename): Args: filename (str): Path to the file. """ - from collections import defaultdict, Counter - dists = defaultdict(Counter) with must_open(filename) as fp: for row in fp: chromosome, start, end, depth = row.split() depth = int(float(depth)) dists[chromosome][depth] += 1 - logging.debug("Loaded {} seqids".format(len(dists))) + logger.debug("Loaded %d seqids", len(dists)) return dists @@ -176,7 +174,7 @@ def parse_groupsfile(filename): for row in fp: chrs, colors = row.split() groups.append((chrs.split(","), colors.split(","))) - logging.debug("Loaded {} groups".format(len(groups))) + logger.debug("Loaded %d groups", len(groups)) return groups @@ -221,7 +219,7 @@ def mosdepth(args): # Construct a composite figure with N tracks indicated in the groups fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) + root = fig.add_axes((0, 0, 1, 1)) rows = len(groups) ypad = 0.05 @@ -230,10 +228,10 @@ def mosdepth(args): for group_idx, (chrs, colors) in enumerate(groups): yy -= yinterval - ax = fig.add_axes([0.15, yy, 0.7, yinterval * 0.85]) + ax = fig.add_axes((0.15, yy, 0.7, yinterval * 0.85)) for c, color in zip(chrs, colors): cdata = dists[c].items() - logging.debug("Importing {} records for {}".format(len(cdata), c)) + logger.debug("Importing %d records for %s", len(cdata), c) cx, cy = zip(*sorted(cdata)) ax.plot(cx, cy, "-", color=color) if logscale: @@ -334,7 +332,7 @@ def draw_depth( s=8, lw=0, ) - logging.debug("Obtained {} data points with depth data".format(len(data))) + logger.debug("Obtained %d data points with depth data", len(data)) # Per seqid median medians = {} @@ -459,7 +457,7 @@ def depth(args): titleinfo = TitleInfoFile(opts.titleinfo) if opts.titleinfo else {} fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) + root = fig.add_axes((0, 0, 1, 1)) npanels = len(bedfiles) yinterval = 1.0 / npanels @@ -468,8 +466,8 @@ def depth(args): pf = op.basename(bedfile).split(".", 1)[0] bed = Bed(bedfile) - panel_root = root if npanels == 1 else fig.add_axes([0, ypos, 1, yinterval]) - panel_ax = fig.add_axes([0.1, ypos + 0.2 * yinterval, 0.8, 0.65 * yinterval]) + panel_root = root if npanels == 1 else fig.add_axes((0, ypos, 1, yinterval)) + panel_ax = fig.add_axes((0.1, ypos + 0.2 * yinterval, 0.8, 0.65 * yinterval)) if ypos > 0.001: root.plot((0, 1), (ypos, ypos), "-", lw=2, color="lightslategray") @@ -514,10 +512,11 @@ def check_window_options(opts): shift = opts.shift subtract = opts.subtract assert window % shift == 0, "--window must be divisible by --shift" - logging.debug( - "Line/stack-plot options: window={0} shift={1} subtract={2}".format( - window, shift, subtract - ) + logger.debug( + "Line/stack-plot options: window=%d shift=%d subtract=%d", + window, + shift, + subtract, ) merge = not opts.nomerge @@ -641,7 +640,7 @@ def composite(args): plt.rcParams["ytick.major.size"] = 0 fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) + root = fig.add_axes((0, 0, 1, 1)) root.text(0.5, 0.95, chr, ha="center", color="darkslategray") @@ -649,7 +648,7 @@ def composite(args): xlen = xend - xstart ratio = xlen / clen # Line plots - ax = fig.add_axes([xstart, 0.6, xlen, 0.3]) + ax = fig.add_axes((xstart, 0.6, xlen, 0.3)) lineplot(ax, linebins, nbins, chr, window, shift) # Bar plots @@ -822,7 +821,7 @@ def heatmap(args): clen = Sizes(fastafile).mapping[chr] fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) + root = fig.add_axes((0, 0, 1, 1)) # Gauge ratio = draw_gauge(root, margin, clen, rightmargin=4 * margin) @@ -837,7 +836,7 @@ def heatmap(args): cc = ca[0].upper() + cb root.add_patch(Rectangle((xx, yy), xlen, yinterval - inner, color=gray)) - ax = fig.add_axes([xx, yy, xlen, yinterval - inner]) + ax = fig.add_axes((xx, yy, xlen, yinterval - inner)) nbins = get_nbins(clen, shift) @@ -1028,7 +1027,7 @@ def stack(args): pf = fastafile.rsplit(".", 1)[0] fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) + root = fig.add_axes((0, 0, 1, 1)) # Gauge ratio = draw_gauge(root, margin, maxl) @@ -1049,7 +1048,7 @@ def stack(args): cc = "\n".join((cc, "({0})".format(switch[cc]))) root.add_patch(Rectangle((xx, yy), xlen, yinterval - inner, color=gray)) - ax = fig.add_axes([xx, yy, xlen, yinterval - inner]) + ax = fig.add_axes((xx, yy, xlen, yinterval - inner)) nbins = clen / shift if clen % shift: From 522b68978028573f4b666d2ce9480ab9b6738de2 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 12:02:37 -0700 Subject: [PATCH 02/24] Add params --- jcvi/graphics/landscape.py | 29 +++++++++++++++-------------- 1 file changed, 15 insertions(+), 14 deletions(-) diff --git a/jcvi/graphics/landscape.py b/jcvi/graphics/landscape.py index b28f889e..0c97e4be 100644 --- a/jcvi/graphics/landscape.py +++ b/jcvi/graphics/landscape.py @@ -11,6 +11,7 @@ import sys from collections import Counter, OrderedDict, defaultdict +from typing import Optional import numpy as np @@ -22,17 +23,17 @@ from ..utils.cbook import human_size, autoscale from .base import ( - plt, - Rectangle, CirclePolygon, - savefig, - ticker, + Rectangle, + adjust_spines, human_readable_base, latex, markup, - set_human_axis, normalize_axes, - adjust_spines, + plt, + savefig, + set_human_axis, + ticker, ) @@ -269,14 +270,14 @@ def mosdepth(args): def draw_depth( root, ax, - bed, - chrinfo={}, - defaultcolor="k", - sepcolor="w", - ylim=100, - logscale=False, - title=None, - subtitle=None, + bed: Bed, + chrinfo: dict = {}, + defaultcolor: str = "k", + sepcolor: str = "w", + ylim: int = 100, + logscale: bool = False, + title: Optional[str] = None, + subtitle: Optional[str] = None, ): """Draw depth plot on the given axes, using data from bed From 592baea1418421123f8ccb07e052f7ff21b36baa Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 12:15:44 -0700 Subject: [PATCH 03/24] Add an arrow to the right --- jcvi/graphics/landscape.py | 9 +++++++++ 1 file changed, 9 insertions(+) diff --git a/jcvi/graphics/landscape.py b/jcvi/graphics/landscape.py index 0c97e4be..3521d40e 100644 --- a/jcvi/graphics/landscape.py +++ b/jcvi/graphics/landscape.py @@ -379,6 +379,15 @@ def draw_depth( va="center", ) + # Add an arrow to the right of the plot, indicating these are median depths + root.text( + 0.91, + 0.88, + r"$\leftarrow$median", + color="lightslategray", + va="center", + ) + if title: root.text( 0.95, From 29fdefe155add15b6dac8d722cfe99d1ff94e58e Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 12:54:43 -0700 Subject: [PATCH 04/24] Move ks and pedigree into compara --- jcvi/{apps => compara}/ks.py | 0 jcvi/{apps => compara}/pedigree.py | 0 2 files changed, 0 insertions(+), 0 deletions(-) rename jcvi/{apps => compara}/ks.py (100%) rename jcvi/{apps => compara}/pedigree.py (100%) diff --git a/jcvi/apps/ks.py b/jcvi/compara/ks.py similarity index 100% rename from jcvi/apps/ks.py rename to jcvi/compara/ks.py diff --git a/jcvi/apps/pedigree.py b/jcvi/compara/pedigree.py similarity index 100% rename from jcvi/apps/pedigree.py rename to jcvi/compara/pedigree.py From 2dd51d45b01d8efa90f33018f785bd181f8a7d73 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 14:57:36 -0700 Subject: [PATCH 05/24] Check pedigree contains valid nodes --- jcvi/compara/pedigree.py | 63 +++++++++++++++++++++++++++------------- 1 file changed, 43 insertions(+), 20 deletions(-) diff --git a/jcvi/compara/pedigree.py b/jcvi/compara/pedigree.py index 62c9a305..b68bfefe 100644 --- a/jcvi/compara/pedigree.py +++ b/jcvi/compara/pedigree.py @@ -70,23 +70,42 @@ def __init__(self, pedfile: str): mom = mom if mom != "0" else None s = Sample(name, dad, mom) self[s.name] = s + self._check() - def to_graph(self, inbreeding: Dict[str, SampleInbreeding]) -> nx.DiGraph: + def _check(self): + """ + # Check if all nodes are assigned, including the roots + """ + terminal_nodes = set() + for s in self: + dad, mom = self[s].dad, self[s].mom + if dad and dad not in self: + terminal_nodes.add(dad) + if mom and mom not in self: + terminal_nodes.add(mom) + for s in terminal_nodes: + logger.info("Adding %s to pedigree", s) + self[s] = Sample(s, None, None) + self.terminal_nodes = terminal_nodes + + def to_graph(self, inbreeding_dict: Dict[str, SampleInbreeding]) -> nx.DiGraph: """ Convert the pedigree to a graph. """ - G = nx.DiGraph() + graph_styles = {"splines": "curved"} + edge_styles = {"color": "lightslategray", "arrowhead": "none"} + G = nx.DiGraph(**graph_styles) for s in self: dad, mom = self[s].dad, self[s].mom if dad: - G.add_edge(dad, s, color="lightslategray", arrowhead="none") + G.add_edge(dad, s, **edge_styles) if mom: - G.add_edge(mom, s, color="lightslategray", arrowhead="none") + G.add_edge(mom, s, **edge_styles) # Map colors to terminal nodes terminal_nodes = [s for s in self if self[s].is_terminal] colors = dict(zip(terminal_nodes, set3_n(len(terminal_nodes)))) for s in self: - inb = inbreeding[s] + inb = inbreeding_dict[s] label = s if inb.mean_inbreeding > 0.01: label += f"\n(F={inb.mean_inbreeding:.2f})" @@ -98,16 +117,20 @@ def to_graph(self, inbreeding: Dict[str, SampleInbreeding]) -> nx.DiGraph: fillcolor += ":white" else: fillcolor = fillcolor.rsplit(";", 1)[0] - G._node[s]["label"] = label - G._node[s]["shape"] = "circle" - G._node[s]["fixedsize"] = "true" - G._node[s]["width"] = "0.6" - G._node[s]["height"] = "0.6" - G._node[s]["style"] = "wedged" - G._node[s]["fillcolor"] = fillcolor - G._node[s]["color"] = "none" - G._node[s]["fontsize"] = "10" - G._node[s]["fontname"] = "Helvetica" + node_styles = { + "color": "none", + "fillcolor": fillcolor, + "fixedsize": "true", + "fontname": "Helvetica", + "fontsize": "10", + "height": "0.6", + "label": label, + "shape": "circle", + "style": "wedged", + "width": "0.6", + } + for k, v in node_styles.items(): + G._node[s][k] = v return G @@ -206,13 +229,13 @@ def calculate_inbreeding( return results -def inbreeding(args): +def pedigree(args): """ - %prog inbreeding pedfile + %prog pedigree pedfile - Calculate inbreeding coefficients from a pedigree file. + Plot pedigree and calculate pedigree coefficients from a pedigree file. """ - p = OptionParser(inbreeding.__doc__) + p = OptionParser(pedigree.__doc__) p.add_option("--ploidy", default=2, type="int", help="Ploidy") p.add_option("--N", default=10000, type="int", help="Number of samples") opts, args = p.parse_args(args) @@ -237,7 +260,7 @@ def inbreeding(args): def main(): - actions = (("inbreeding", "calculate inbreeding coefficients"),) + actions = (("pedigree", "Plot pedigree and calculate inbreeding coefficients"),) p = ActionDispatcher(actions) p.dispatch(globals()) From a12ce372f316efdcb38851c96dd1fd12dcbbff8f Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 15:07:00 -0700 Subject: [PATCH 06/24] Add graph title --- jcvi/compara/pedigree.py | 11 +++++++---- 1 file changed, 7 insertions(+), 4 deletions(-) diff --git a/jcvi/compara/pedigree.py b/jcvi/compara/pedigree.py index b68bfefe..b4592fb7 100644 --- a/jcvi/compara/pedigree.py +++ b/jcvi/compara/pedigree.py @@ -88,12 +88,14 @@ def _check(self): self[s] = Sample(s, None, None) self.terminal_nodes = terminal_nodes - def to_graph(self, inbreeding_dict: Dict[str, SampleInbreeding]) -> nx.DiGraph: + def to_graph( + self, inbreeding_dict: Dict[str, SampleInbreeding], title: str = "" + ) -> nx.DiGraph: """ Convert the pedigree to a graph. """ - graph_styles = {"splines": "curved"} - edge_styles = {"color": "lightslategray", "arrowhead": "none"} + graph_styles = {"labelloc": "b", "label": title, "splines": "curved"} + edge_styles = {"arrowhead": "none", "color": "lightslategray"} G = nx.DiGraph(**graph_styles) for s in self: dad, mom = self[s].dad, self[s].mom @@ -238,6 +240,7 @@ def pedigree(args): p = OptionParser(pedigree.__doc__) p.add_option("--ploidy", default=2, type="int", help="Ploidy") p.add_option("--N", default=10000, type="int", help="Number of samples") + p.add_option("--title", default="", help="Title of the graph") opts, args = p.parse_args(args) if len(args) != 1: @@ -250,7 +253,7 @@ def pedigree(args): for _, v in inb.items(): print(v) - G = ped.to_graph(inb) + G = ped.to_graph(inb, title=opts.title) dotfile = f"{pedfile}.dot" nx.nx_agraph.write_dot(G, dotfile) pdf_file = dotfile + ".pdf" From be04faf07894d2b9e4ae94a06be06aa2049a389c Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 15:15:21 -0700 Subject: [PATCH 07/24] Deprecate alfalfa.py and pistachio.py --- jcvi/projects/alfalfa.py | 62 ---------------------------- jcvi/projects/misc.py | 1 - jcvi/projects/pistachio.py | 83 -------------------------------------- 3 files changed, 146 deletions(-) delete mode 100644 jcvi/projects/alfalfa.py delete mode 100644 jcvi/projects/pistachio.py diff --git a/jcvi/projects/alfalfa.py b/jcvi/projects/alfalfa.py deleted file mode 100644 index 3a67b7c3..00000000 --- a/jcvi/projects/alfalfa.py +++ /dev/null @@ -1,62 +0,0 @@ -#!/usr/bin/env python -# -*- coding: UTF-8 -*- - -""" -Random collection of scripts associated with alfalfa assembly. -""" - -import sys - -from jcvi.formats.bed import Bed, fastaFromBed -from jcvi.graphics.mummerplot import main as mummerplot_main -from jcvi.apps.base import OptionParser, ActionDispatcher, sh - - -def main(): - - actions = (("nucmer", "select specific chromosome region based on MTR mapping"),) - p = ActionDispatcher(actions) - p.dispatch(globals()) - - -def nucmer(args): - """ - %prog nucmer mappings.bed MTR.fasta assembly.fasta chr1 3 - - Select specific chromosome region based on MTR mapping. The above command - will extract chr1:2,000,001-3,000,000. - """ - p = OptionParser(nucmer.__doc__) - opts, args = p.parse_args(args) - - if len(args) != 5: - sys.exit(not p.print_help()) - - mapbed, mtrfasta, asmfasta, chr, idx = args - idx = int(idx) - m1 = 1000000 - bedfile = "sample.bed" - bed = Bed() - bed.add("\t".join(str(x) for x in (chr, (idx - 1) * m1, idx * m1))) - bed.print_to_file(bedfile) - - cmd = "intersectBed -a {0} -b {1} -nonamecheck -sorted | cut -f4".format( - mapbed, bedfile - ) - idsfile = "query.ids" - sh(cmd, outfile=idsfile) - - sfasta = fastaFromBed(bedfile, mtrfasta) - qfasta = "query.fasta" - cmd = "faSomeRecords {0} {1} {2}".format(asmfasta, idsfile, qfasta) - sh(cmd) - - cmd = "nucmer {0} {1}".format(sfasta, qfasta) - sh(cmd) - - mummerplot_main(["out.delta", "--refcov=0"]) - sh("mv out.pdf {0}.{1}.pdf".format(chr, idx)) - - -if __name__ == "__main__": - main() diff --git a/jcvi/projects/misc.py b/jcvi/projects/misc.py index 0a287434..2f4b8114 100644 --- a/jcvi/projects/misc.py +++ b/jcvi/projects/misc.py @@ -33,7 +33,6 @@ def main(): ("oropetium", "plot oropetium micro-synteny (requires data)"), # Pomegranate paper (Qin et al., 2017 Plant Journal) ("pomegranate", "plot pomegranate macro- and micro-synteny (requires data)"), - # Unpublished ("birch", "plot birch macro-synteny (requires data)"), ("litchi", "plot litchi micro-synteny (requires data)"), ("utricularia", "plot utricularia micro-synteny (requires data)"), diff --git a/jcvi/projects/pistachio.py b/jcvi/projects/pistachio.py deleted file mode 100644 index 83e1ca93..00000000 --- a/jcvi/projects/pistachio.py +++ /dev/null @@ -1,83 +0,0 @@ -#!/usr/bin/env python -# -*- coding: UTF-8 -*- - -""" -Functions related to processing of the pistachio genome. -""" -import sys - -from jcvi.apps.base import OptionParser, ActionDispatcher - - -def main(): - - actions = (("agp", "convert from the table file to agp format"),) - p = ActionDispatcher(actions) - p.dispatch(globals()) - - -def agp(args): - """ - %prog agp Siirt_Female_pistachio_23May2017_table.txt - - The table file, as prepared by Dovetail Genomics, is not immediately useful - to convert gene model coordinates, as assumed by formats.chain.fromagp(). - This is a quick script to do such conversion. The file structure of this - table file is described in the .manifest file shipped in the same package:: - - pistachio_b_23May2017_MeyIy.table.txt - Tab-delimited table describing positions of input assembly scaffolds - in the Hirise scaffolds. The table has the following format: - - 1. HiRise scaffold name - 2. Input sequence name - 3. Starting base (zero-based) of the input sequence - 4. Ending base of the input sequence - 5. Strand (- or +) of the input sequence in the scaffold - 6. Starting base (zero-based) in the HiRise scaffold - 7. Ending base in the HiRise scaffold - - where '-' in the strand column indicates that the sequence is reverse - complemented relative to the input assembly. - - CAUTION: This is NOT a proper AGP format since it does not have gaps in - them. - """ - p = OptionParser(agp.__doc__) - opts, args = p.parse_args(args) - - if len(args) != 1: - sys.exit(not p.print_help()) - - (tablefile,) = args - fp = open(tablefile) - for row in fp: - atoms = row.split() - hr = atoms[0] - scaf = atoms[1] - scaf_start = int(atoms[2]) + 1 - scaf_end = int(atoms[3]) - strand = atoms[4] - hr_start = int(atoms[5]) + 1 - hr_end = int(atoms[6]) - - print( - "\t".join( - str(x) - for x in ( - hr, - hr_start, - hr_end, - 1, - "W", - scaf, - scaf_start, - scaf_end, - strand, - ) - ) - ) - - -if __name__ == "__main__": - main() From 3022ccac348a1405acbc16ca59591fab1d2d4b1b Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 15:30:42 -0700 Subject: [PATCH 08/24] Deprecate graph.py --- jcvi/graphics/base.py | 4 +- jcvi/graphics/graph.py | 92 ------------------------------------------ jcvi/projects/jcvi.py | 32 +++++++++++++++ 3 files changed, 33 insertions(+), 95 deletions(-) delete mode 100755 jcvi/graphics/graph.py create mode 100644 jcvi/projects/jcvi.py diff --git a/jcvi/graphics/base.py b/jcvi/graphics/base.py index ab9d1eed..40b2f9b7 100644 --- a/jcvi/graphics/base.py +++ b/jcvi/graphics/base.py @@ -420,14 +420,12 @@ def setup_theme( usetex: bool = True, ): try: - import seaborn as sns - extra_rc = { "lines.linewidth": 1, "lines.markeredgewidth": 1, "patch.edgecolor": "k", } - sns.set(context=context, style=style, palette=palette, rc=extra_rc) + sns.set_theme(context=context, style=style, palette=palette, rc=extra_rc) except (ImportError, SyntaxError): pass diff --git a/jcvi/graphics/graph.py b/jcvi/graphics/graph.py deleted file mode 100755 index 205fdd07..00000000 --- a/jcvi/graphics/graph.py +++ /dev/null @@ -1,92 +0,0 @@ -#!/usr/bin/env python -# -*- coding: UTF-8 -*- - - -""" -Script to plot diagrams of assembly graph in polyploids. -""" - -from collections import defaultdict -from random import choice, sample - -from brewer2mpl import get_map -from graphviz import Graph -from matplotlib.colors import to_hex -from more_itertools import pairwise - - -def make_sequence(seq, name="S"): - """ - Make unique nodes for sequence graph. - """ - return ["{}_{}_{}".format(name, i, x) for i, x in enumerate(seq)] - - -def sequence_to_graph(G, seq, color="black"): - """ - Automatically construct graph given a sequence of characters. - """ - for x in seq: - if x.endswith("_1"): # Mutation - G.node(x, color=color, width="0.1", shape="circle", label="") - else: - G.node(x, color=color) - for a, b in pairwise(seq): - G.edge(a, b, color=color) - - -def zip_sequences(G, allseqs): - """ - Fuse certain nodes together, if they contain same data except for the - sequence name. - """ - for s in zip(*allseqs): - groups = defaultdict(list) - for x in s: - part = x.split("_", 1)[1] - groups[part].append(x) - for part, g in groups.items(): - with G.subgraph(name="cluster_" + part) as c: - for x in g: - c.node(x) - c.attr(style="invis") - - -def main(): - SIZE = 20 - PLOIDY = 2 - MUTATIONS = 2 - - indices = range(SIZE) - # Build fake data - seqA = list("0" * SIZE) - allseqs = [seqA[:] for x in range(PLOIDY)] # Hexaploid - for s in allseqs: - for i in [choice(indices) for x in range(MUTATIONS)]: - s[i] = "1" - - allseqs = [ - make_sequence(s, name=name) - for (s, name) in zip(allseqs, [str(x) for x in range(PLOIDY)]) - ] - - # Build graph structure - G = Graph("Assembly graph", filename="graph") - G.attr(rankdir="LR", fontname="Helvetica", splines="true") - G.attr(ranksep=".2", nodesep="0.02") - G.attr("node", shape="point") - G.attr("edge", dir="none", penwidth="4") - - colorset = get_map("Set2", "qualitative", 8).mpl_colors - colorset = [to_hex(x) for x in colorset] - colors = sample(colorset, PLOIDY) - for s, color in zip(allseqs, colors): - sequence_to_graph(G, s, color=color) - zip_sequences(G, allseqs) - - # Output graph - G.view() - - -if __name__ == "__main__": - main() diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py new file mode 100644 index 00000000..d24d1de4 --- /dev/null +++ b/jcvi/projects/jcvi.py @@ -0,0 +1,32 @@ +#!/usr/bin/env python +# -*- coding: UTF-8 -*- + +""" +Functions in this script produce figures in the JCVI manuscript. +""" + +from ..apps.base import ActionDispatcher, OptionParser, logger + + +def genomebuild(args): + """ + %prog genomebuild + + Plot genome build composite figure. + """ + p = OptionParser(genomebuild.__doc__) + _, args, iopts = p.set_image_options(args, figsize="12x9") + + +def main(): + + actions = ( + ("genomebuild", "Plot genome build composite figure"), + ("diversity", "Plot diversity composite figure"), + ) + p = ActionDispatcher(actions) + p.dispatch(globals()) + + +if __name__ == "__main__": + main() From 4a4f99ba6e542db6bf0fefe51bb6c964fd497bd4 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 15:50:05 -0700 Subject: [PATCH 09/24] Revert set_ticks() --- jcvi/assembly/hic.py | 7 +++++-- jcvi/graphics/base.py | 2 -- 2 files changed, 5 insertions(+), 4 deletions(-) diff --git a/jcvi/assembly/hic.py b/jcvi/assembly/hic.py index ca8cf367..2f24f402 100644 --- a/jcvi/assembly/hic.py +++ b/jcvi/assembly/hic.py @@ -716,7 +716,7 @@ def heatmap(args): help="Do not plot breaks (esp. if contigs are small)", ) opts, args, iopts = p.set_image_options( - args, figsize="11x11", style="white", cmap="coolwarm", format="png", dpi=120 + args, figsize="11x11", style="white", cmap="coolwarm", dpi=120 ) if len(args) != 2: @@ -740,6 +740,9 @@ def heatmap(args): contig_size = header["sizes"][contig] contig_end = contig_start + contig_size A = A[contig_start:contig_end, contig_start:contig_end] + else: + total_bins = header["total_bins"] + A = A[:total_bins, :total_bins] # Convert seqids to positions for each group new_groups = [] @@ -778,7 +781,7 @@ def heatmap(args): ax = fig.add_axes((0.05, 0.05, 0.9, 0.9)) # just the heatmap breaks = list(header["starts"].values()) - breaks += [header["total_bins"]] # This is actually discarded + breaks += [total_bins] # This is actually discarded breaks = sorted(breaks)[1:] if contig or opts.nobreaks: breaks = [] diff --git a/jcvi/graphics/base.py b/jcvi/graphics/base.py index 40b2f9b7..ce176a33 100644 --- a/jcvi/graphics/base.py +++ b/jcvi/graphics/base.py @@ -547,8 +547,6 @@ def simplify_seqid(seqid): ax.set_xlim(xlim) ax.set_ylim((xlim[1], xlim[0])) # Flip the y-axis so the origin is at the top - ax.set_xticks(ax.get_xticks()) - ax.set_yticks(ax.get_yticks()) ax.set_xticklabels(ax.get_xticks(), family="Helvetica", color="gray") ax.set_yticklabels(ax.get_yticks(), family="Helvetica", color="gray", rotation=90) ax.tick_params(left=True, bottom=True, labelleft=True, labelbottom=True) From 3f1c37785b1651104757ed31db2b3699d7ab81af Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 15:54:23 -0700 Subject: [PATCH 10/24] Move total_bins out --- jcvi/assembly/hic.py | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/jcvi/assembly/hic.py b/jcvi/assembly/hic.py index 2f24f402..1e787c19 100644 --- a/jcvi/assembly/hic.py +++ b/jcvi/assembly/hic.py @@ -733,6 +733,7 @@ def heatmap(args): logger.debug("Resolution set to %d", resolution) # Load the matrix A = np.load(npyfile) + total_bins = header["total_bins"] # Select specific submatrix if contig: @@ -741,7 +742,6 @@ def heatmap(args): contig_end = contig_start + contig_size A = A[contig_start:contig_end, contig_start:contig_end] else: - total_bins = header["total_bins"] A = A[:total_bins, :total_bins] # Convert seqids to positions for each group From ad86bf63fcd3e455bdd8893991285ea4a376599b Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 16:04:44 -0700 Subject: [PATCH 11/24] Refactor into read_matrix() --- jcvi/assembly/hic.py | 111 ++++++++++++++++++++++++------------------- 1 file changed, 63 insertions(+), 48 deletions(-) diff --git a/jcvi/assembly/hic.py b/jcvi/assembly/hic.py index 1e787c19..5ccb66d1 100644 --- a/jcvi/assembly/hic.py +++ b/jcvi/assembly/hic.py @@ -10,9 +10,11 @@ import os import os.path as op import sys + from collections import defaultdict from functools import partial from multiprocessing import Pool +from typing import List, Tuple import numpy as np @@ -683,6 +685,65 @@ def generate_groups(groupsfile): yield seqids, color +def read_matrix( + npyfile: str, header: dict, contig: str, groups: List[Tuple[str, str]], opts +): + """ + Read the matrix from the npy file and apply log transformation and thresholding. + """ + # Load the matrix + A = np.load(npyfile) + total_bins = header["total_bins"] + + # Select specific submatrix + if contig: + contig_start = header["starts"][contig] + contig_size = header["sizes"][contig] + contig_end = contig_start + contig_size + A = A[contig_start:contig_end, contig_start:contig_end] + else: + A = A[:total_bins, :total_bins] + + # Convert seqids to positions for each group + new_groups = [] + for seqids, color in groups: + seqids = seqids.split(",") + assert all( + x in header["starts"] for x in seqids + ), f"{seqids} contain ids not found in starts" + assert all( + x in header["sizes"] for x in seqids + ), f"{seqids} contain ids not found in sizes" + start = min(header["starts"][x] for x in seqids) + end = max(header["starts"][x] + header["sizes"][x] for x in seqids) + position_seqids = [] + for seqid in seqids: + seqid_start = header["starts"][seqid] + seqid_size = header["sizes"][seqid] + position_seqids.append((seqid_start + seqid_size / 2, seqid)) + new_groups.append((start, end, position_seqids, color)) + + # Several concerns in practice: + # The diagonal counts may be too strong, this can either be resolved by + # masking them. Or perform a log transform on the entire heatmap. + B = A.astype("float64") + B += 1.0 + B = np.log(B) + vmin, vmax = opts.vmin, opts.vmax + B[B < vmin] = vmin + B[B > vmax] = vmax + print(B) + logger.debug("Matrix log-transformation and thresholding (%d-%d) done", vmin, vmax) + + breaks = list(header["starts"].values()) + breaks += [total_bins] # This is actually discarded + breaks = sorted(breaks)[1:] + if contig or opts.nobreaks: + breaks = [] + + return B, new_groups, breaks + + def heatmap(args): """ %prog heatmap input.npy genome.json @@ -727,64 +788,18 @@ def heatmap(args): groups = list(generate_groups(opts.groups)) if opts.groups else [] # Load contig/chromosome starts and sizes - header = json.loads(open(jsonfile).read()) + header = json.loads(open(jsonfile, encoding="utf-8").read()) resolution = header.get("resolution") assert resolution is not None, "`resolution` not found in `{}`".format(jsonfile) logger.debug("Resolution set to %d", resolution) - # Load the matrix - A = np.load(npyfile) - total_bins = header["total_bins"] - - # Select specific submatrix - if contig: - contig_start = header["starts"][contig] - contig_size = header["sizes"][contig] - contig_end = contig_start + contig_size - A = A[contig_start:contig_end, contig_start:contig_end] - else: - A = A[:total_bins, :total_bins] - - # Convert seqids to positions for each group - new_groups = [] - for seqids, color in groups: - seqids = seqids.split(",") - assert all( - x in header["starts"] for x in seqids - ), f"{seqids} contain ids not found in starts" - assert all( - x in header["sizes"] for x in seqids - ), f"{seqids} contain ids not found in sizes" - start = min(header["starts"][x] for x in seqids) - end = max(header["starts"][x] + header["sizes"][x] for x in seqids) - position_seqids = [] - for seqid in seqids: - seqid_start = header["starts"][seqid] - seqid_size = header["sizes"][seqid] - position_seqids.append((seqid_start + seqid_size / 2, seqid)) - new_groups.append((start, end, position_seqids, color)) - # Several concerns in practice: - # The diagonal counts may be too strong, this can either be resolved by - # masking them. Or perform a log transform on the entire heatmap. - B = A.astype("float64") - B += 1.0 - B = np.log(B) - vmin, vmax = opts.vmin, opts.vmax - B[B < vmin] = vmin - B[B > vmax] = vmax - print(B) - logger.debug("Matrix log-transformation and thresholding (%d-%d) done", vmin, vmax) + B, new_groups, breaks = read_matrix(npyfile, header, contig, groups, opts) # Canvas fig = plt.figure(1, (iopts.w, iopts.h)) root = fig.add_axes((0, 0, 1, 1)) # whole canvas ax = fig.add_axes((0.05, 0.05, 0.9, 0.9)) # just the heatmap - breaks = list(header["starts"].values()) - breaks += [total_bins] # This is actually discarded - breaks = sorted(breaks)[1:] - if contig or opts.nobreaks: - breaks = [] plot_heatmap(ax, B, breaks, groups=new_groups, binsize=resolution) # Title From 36e8eda2e97dc253bbea2298bfca6dc3beab9fba Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 16:25:10 -0700 Subject: [PATCH 12/24] Refactor to plot_nbinom_fit() --- jcvi/assembly/kmer.py | 119 +++++++++++++++++++----------------------- 1 file changed, 54 insertions(+), 65 deletions(-) diff --git a/jcvi/assembly/kmer.py b/jcvi/assembly/kmer.py index b1846eff..61558962 100644 --- a/jcvi/assembly/kmer.py +++ b/jcvi/assembly/kmer.py @@ -270,9 +270,7 @@ def run_optimization(termination=0.999, maxiter=100): copy_num = start if start == end else "{}-{}".format(start, end) g_copies = int(round(g * mid * (end - start + 1))) copy_series.append((mid, copy_num, g_copies, g)) - copy_message = "CN {}: {:.1f} Mb ({:.1f} percent)".format( - copy_num, g_copies / 1e6, g_copies * 100 / genome_size - ) + copy_message = f"CN {copy_num}: {g_copies / 1e6:.1f} Mb ({ g_copies * 100 / genome_size:.1f} %)" copy_messages.append(copy_message) m += copy_message + "\n" @@ -280,15 +278,13 @@ def run_optimization(termination=0.999, maxiter=100): g_copies = genome_size - inferred_genome_size copy_num = "{}+".format(end + 1) copy_series.append((end + 1, copy_num, g_copies, g_copies / (end + 1))) - m += "CN {}: {:.1f} Mb ({:.1f} percent)\n".format( - copy_num, g_copies / 1e6, g_copies * 100 / genome_size - ) + m += f"CN {copy_num}: {g_copies / 1e6:.1f} Mb ({ g_copies * 100 / genome_size:.1f} %)\n" # Determine ploidy def determine_ploidy(copy_series, threshold=0.15): counts_so_far = 1 ploidy_so_far = 0 - for mid, copy_num, g_copies, g in copy_series: + for mid, _, g_copies, _ in copy_series: if g_copies / counts_so_far < threshold: break counts_so_far += g_copies @@ -304,7 +300,7 @@ def determine_ploidy(copy_series, threshold=0.15): # Repeat content def calc_repeats(copy_series, ploidy, genome_size): unique = 0 - for mid, copy_num, g_copies, g in copy_series: + for mid, _, g_copies, _ in copy_series: if mid <= ploidy: unique += g_copies else: @@ -1241,6 +1237,39 @@ def multihistogram(args): savefig(imagename, dpi=iopts.dpi, iopts=iopts) +def plot_nbinom_fit(ax, ks: KmerSpectrum, ymax: float, method_info: dict): + """ + Plot the negative binomial fit. + """ + generative_model = method_info["generative_model"] + GG = method_info["Gbins"] + ll = method_info["lambda"] + rr = method_info["rho"] + kf_range = method_info["kf_range"] + stacked = generative_model(GG, ll, rr) + ax.plot( + kf_range, + stacked, + ":", + color="#6a3d9a", + lw=2, + ) + # Plot multiple CN locations, CN1, CN2, ... up to ploidy + cn_color = "#a6cee3" + for i in range(1, ks.ploidy + 1): + x = i * ks.lambda_ + ax.plot((x, x), (0, ymax), "-.", color=cn_color) + ax.text( + x, + ymax * 0.95, + f"CN{i}", + ha="right", + va="center", + color=cn_color, + rotation=90, + ) + + def histogram(args): """ %prog histogram meryl.histogram species K @@ -1263,12 +1292,6 @@ def histogram(args): type="int", help="maximum value, inclusive", ) - p.add_option( - "--pdf", - default=False, - action="store_true", - help="Print PDF instead of ASCII plot", - ) p.add_option( "--method", choices=("nbinom", "allpaths"), @@ -1298,7 +1321,6 @@ def histogram(args): histfile, species, N = args method = opts.method vmin, vmax = opts.vmin, opts.vmax - ascii = not opts.pdf peaks = not opts.nopeaks and method == "allpaths" N = int(N) @@ -1320,35 +1342,22 @@ def histogram(args): Repetitive_msg = ks.repetitive SNPrate_msg = ks.snprate - for msg in (Total_Kmers_msg, Kmer_coverage_msg, Genome_size_msg): + messages = [ + Total_Kmers_msg, + Kmer_coverage_msg, + Genome_size_msg, + Repetitive_msg, + SNPrate_msg, + ] + for msg in messages: print(msg, file=sys.stderr) x, y = ks.get_xy(vmin, vmax) title = "{0} {1}-mer histogram".format(species, N) - if ascii: - asciiplot(x, y, title=title) - return Genome_size - - plt.figure(1, (iopts.w, iopts.h)) - plt.bar(x, y, fc="#b2df8a", lw=0) - # Plot the negative binomial fit - if method == "nbinom": - generative_model = method_info["generative_model"] - GG = method_info["Gbins"] - ll = method_info["lambda"] - rr = method_info["rho"] - kf_range = method_info["kf_range"] - stacked = generative_model(GG, ll, rr) - plt.plot( - kf_range, - stacked, - ":", - color="#6a3d9a", - lw=2, - ) - - ax = plt.gca() + fig = plt.figure(1, (iopts.w, iopts.h)) + ax = fig.add_axes((0.1, 0.1, 0.8, 0.8)) + ax.bar(x, y, fc="#b2df8a", lw=0) if peaks: # Only works for method 'allpaths' t = (ks.min1, ks.max1, ks.min2, ks.max2, ks.min3) @@ -1356,37 +1365,17 @@ def histogram(args): if tcounts: x, y = zip(*tcounts) tcounts = dict(tcounts) - plt.plot(x, y, "ko", lw=3, mec="k", mfc="w") + ax.plot(x, y, "ko", lw=3, mec="k", mfc="w") ax.text(ks.max1, tcounts[ks.max1], "SNP peak") ax.text(ks.max2, tcounts[ks.max2], "Main peak") - ymin, ymax = ax.get_ylim() - ymax = ymax * 7 / 6 - if method == "nbinom": - # Plot multiple CN locations, CN1, CN2, ... up to ploidy - cn_color = "#a6cee3" - for i in range(1, ks.ploidy + 1): - x = i * ks.lambda_ - plt.plot((x, x), (0, ymax), "-.", color=cn_color) - plt.text( - x, - ymax * 0.95, - "CN{}".format(i), - ha="right", - va="center", - color=cn_color, - rotation=90, - ) - - messages = [ - Total_Kmers_msg, - Kmer_coverage_msg, - Genome_size_msg, - Repetitive_msg, - SNPrate_msg, - ] + _, ymax = ax.get_ylim() + ymax *= 7 / 6 + # Plot the negative binomial fit if method == "nbinom": + plot_nbinom_fit(ax, ks, ymax, method_info) messages += [ks.ploidy_message] + ks.copy_messages + write_messages(ax, messages) ax.set_title(markup(title)) From f8784ad7c001129ef9595a792c66aaedbd492999 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 16:27:02 -0700 Subject: [PATCH 13/24] Revert back to percent --- jcvi/assembly/kmer.py | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/jcvi/assembly/kmer.py b/jcvi/assembly/kmer.py index 61558962..c51fc918 100644 --- a/jcvi/assembly/kmer.py +++ b/jcvi/assembly/kmer.py @@ -270,7 +270,7 @@ def run_optimization(termination=0.999, maxiter=100): copy_num = start if start == end else "{}-{}".format(start, end) g_copies = int(round(g * mid * (end - start + 1))) copy_series.append((mid, copy_num, g_copies, g)) - copy_message = f"CN {copy_num}: {g_copies / 1e6:.1f} Mb ({ g_copies * 100 / genome_size:.1f} %)" + copy_message = f"CN {copy_num}: {g_copies / 1e6:.1f} Mb ({ g_copies * 100 / genome_size:.1f} percent)" copy_messages.append(copy_message) m += copy_message + "\n" @@ -278,7 +278,7 @@ def run_optimization(termination=0.999, maxiter=100): g_copies = genome_size - inferred_genome_size copy_num = "{}+".format(end + 1) copy_series.append((end + 1, copy_num, g_copies, g_copies / (end + 1))) - m += f"CN {copy_num}: {g_copies / 1e6:.1f} Mb ({ g_copies * 100 / genome_size:.1f} %)\n" + m += f"CN {copy_num}: {g_copies / 1e6:.1f} Mb ({ g_copies * 100 / genome_size:.1f} percent)\n" # Determine ploidy def determine_ploidy(copy_series, threshold=0.15): From 2d1ee97469b94f39a18cddc249b2c7a4fc595605 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 16:34:20 -0700 Subject: [PATCH 14/24] logging => logger --- jcvi/assembly/kmer.py | 72 ++++++++++++++++++++++++------------------- 1 file changed, 41 insertions(+), 31 deletions(-) diff --git a/jcvi/assembly/kmer.py b/jcvi/assembly/kmer.py index c51fc918..fae7eb9f 100644 --- a/jcvi/assembly/kmer.py +++ b/jcvi/assembly/kmer.py @@ -6,7 +6,6 @@ """ import os.path as op import sys -import logging import math import numpy as np @@ -14,24 +13,32 @@ from more_itertools import chunked from typing import List -from jcvi.graphics.base import ( - plt, +from ..apps.grid import MakeManager +from ..apps.base import ( + ActionDispatcher, + OptionParser, + PIPE, + Popen, + logger, + need_update, + sh, +) +from ..formats.fasta import Fasta +from ..formats.base import BaseFile, must_open, get_number +from ..graphics.base import ( adjust_spines, asciiplot, - set_human_axis, - savefig, markup, - panel_labels, normalize_axes, + panel_labels, + plt, + savefig, + set_human_axis, set_ticklabels_helvetica, write_messages, ) -from jcvi.formats.fasta import Fasta -from jcvi.formats.base import BaseFile, must_open, get_number -from jcvi.utils.cbook import thousands, percentage -from jcvi.assembly.automaton import iter_project -from jcvi.apps.grid import MakeManager -from jcvi.apps.base import OptionParser, ActionDispatcher, sh, need_update, Popen, PIPE +from ..utils.cbook import thousands, percentage +from .automaton import iter_project KMERYL, KSOAP, KALLPATHS = range(3) @@ -48,7 +55,7 @@ def load_data(self, histfile): self.hist = {} kformat = self.guess_format(histfile) kformats = ("Meryl", "Soap", "AllPaths") - logging.debug("Guessed format: {0}".format(kformats[kformat])) + logger.debug("Guessed format: %s", kformats[kformat]) fp = open(histfile) for rowno, row in enumerate(fp): @@ -351,9 +358,10 @@ def analyze_allpaths(self, ploidy=2, K=23, covmax=1000000): kf_ceil = max(K for (K, c) in data) if kf_ceil > covmax: exceeds = sum(1 for (K, c) in data if K > covmax) - logging.debug( - "A total of {0} distinct K-mers appear > " - "{1} times. Ignored ...".format(exceeds, covmax) + logger.debug( + "A total of %d distinct K-mers appear > %d times. Ignored ...", + exceeds, + covmax, ) kf_ceil = covmax @@ -509,7 +517,7 @@ def write( # Divide indices into batches batches = [] batchsize = (len(self.indices) + batch - 1) // batch - logging.debug("Use batchsize of %d", batchsize) + logger.debug("Use batchsize of %d", batchsize) for i, indices in enumerate(chunked(self.indices, batchsize)): filename_i = filename.format(i + 1) outfile_i = outfile + ".{}".format(i + 1) @@ -656,7 +664,7 @@ def bed(args): KMERS.add(kmer_rc) K = len(kmer) - logging.debug("Imported {} {}-mers".format(len(KMERS), K)) + logger.debug("Imported %d %d-mers", len(KMERS), K) for name, seq in parse_fasta(fastafile): name = name.split()[0] @@ -719,7 +727,7 @@ def kmcop(args): indices = [x for x in indices if x.rsplit(".", 2)[0] not in exclude_ids] after = set(indices) if before > after: - logging.debug( + logger.debug( "Excluded accessions %d → %d (%s)", len(before), len(after), @@ -964,7 +972,7 @@ def count(args): kmers = list(make_kmers(rec.seq, K)) print("\n".join(kmers), file=proc.stdin) proc.stdin.close() - logging.debug(cmd) + logger.debug(cmd) proc.wait() a = bitarray() @@ -975,18 +983,20 @@ def count(args): c = row.strip() a.append(int(c)) a.tofile(fw) - logging.debug("Serialize {0} bits to `{1}`.".format(len(a), binfile)) + logger.debug("Serialize %d bits to `%s`.", len(a), binfile) fw.close() sh("rm {0}".format(t.name)) - logging.debug( - "Shared K-mers (K={0}) between `{1}` and `{2}` written to `{3}`.".format( - K, fastafile, jfdb, binfile - ) + logger.debug( + "Shared K-mers (K=%d) between `%s` and `%s` written to `%s`.", + K, + fastafile, + jfdb, + binfile, ) cntfile = ".".join((fastafile, jfdb, "cnt")) bincount([fastafile, binfile, "-o", cntfile, "-K {0}".format(K)]) - logging.debug("Shared K-mer counts written to `{0}`.".format(cntfile)) + logger.debug("Shared K-mer counts written to `%s`.", cntfile) def bincount(args): @@ -1120,10 +1130,10 @@ def jellyfish(args): gzip = fq.endswith(".gz") hashsize = totalfilesize / coverage - logging.debug( - "Total file size: {0}, hashsize (-s): {1}".format( - human_size(totalfilesize, a_kilobyte_is_1024_bytes=True), hashsize - ) + logger.debug( + "Total file size: %s, hashsize (-s): %d", + human_size(totalfilesize, a_kilobyte_is_1024_bytes=True), + hashsize, ) jfpf = "{0}-K{1}".format(pf, K) @@ -1325,7 +1335,7 @@ def histogram(args): N = int(N) if histfile.rsplit(".", 1)[-1] in ("mcdat", "mcidx"): - logging.debug("CA kmer index found") + logger.debug("CA kmer index found") histfile = merylhistogram(histfile) ks = KmerSpectrum(histfile) From 33e0ae8dad34dd71d7a9db2bb9d914851b3db645 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 17:01:10 -0700 Subject: [PATCH 15/24] Refactor into read_subsampled_matrix() --- jcvi/assembly/geneticmap.py | 49 ++++++++++++++++++++++--------------- jcvi/assembly/kmer.py | 5 ++-- jcvi/projects/jcvi.py | 37 +++++++++++++++++++++++++--- 3 files changed, 66 insertions(+), 25 deletions(-) diff --git a/jcvi/assembly/geneticmap.py b/jcvi/assembly/geneticmap.py index 35fe7ec5..d642941a 100644 --- a/jcvi/assembly/geneticmap.py +++ b/jcvi/assembly/geneticmap.py @@ -10,6 +10,7 @@ from itertools import combinations, groupby from random import sample +from typing import Tuple import numpy as np import seaborn as sns @@ -336,30 +337,12 @@ def dotplot(args): fig.clear() -def heatmap(args): +def read_subsampled_matrix(mstmap: str, subsample: int) -> Tuple[np.ndarray, str, int]: """ - %prog heatmap map - - Calculate pairwise linkage disequilibrium given MSTmap. + Read the subsampled matrix from file if it exists, otherwise calculate it. """ - p = OptionParser(heatmap.__doc__) - p.add_option( - "--subsample", - default=1000, - type="int", - help="Subsample markers to speed up", - ) - opts, args, iopts = p.set_image_options(args, figsize="8x8") - - if len(args) != 1: - sys.exit(not p.print_help()) - - (mstmap,) = args - subsample = opts.subsample data = MSTMap(mstmap) - markerbedfile = mstmap + ".subsample.bed" - ldmatrix = mstmap + ".subsample.matrix" # Take random subsample while keeping marker order if subsample < data.nmarkers: data = [data[x] for x in sorted(sample(range(len(data)), subsample))] @@ -367,6 +350,8 @@ def heatmap(args): logger.debug("Use all markers, --subsample ignored") nmarkers = len(data) + markerbedfile = mstmap + ".subsample.bed" + ldmatrix = mstmap + ".subsample.matrix" if need_update(mstmap, (ldmatrix, markerbedfile)): with open(markerbedfile, "w", encoding="utf-8") as fw: print("\n".join(x.bedline for x in data), file=fw) @@ -389,6 +374,30 @@ def heatmap(args): M = np.fromfile(ldmatrix, dtype="float").reshape(nmarkers, nmarkers) logger.debug("LD matrix `%s` exists (%dx%d).", ldmatrix, nmarkers, nmarkers) + return M, markerbedfile, nmarkers + + +def heatmap(args): + """ + %prog heatmap map + + Calculate pairwise linkage disequilibrium given MSTmap. + """ + p = OptionParser(heatmap.__doc__) + p.add_option( + "--subsample", + default=1000, + type="int", + help="Subsample markers to speed up", + ) + opts, args, iopts = p.set_image_options(args, figsize="8x8") + + if len(args) != 1: + sys.exit(not p.print_help()) + + (mstmap,) = args + M, markerbedfile, nmarkers = read_subsampled_matrix(mstmap, opts.subsample) + plt.rcParams["axes.linewidth"] = 0 fig = plt.figure(1, (iopts.w, iopts.h)) diff --git a/jcvi/assembly/kmer.py b/jcvi/assembly/kmer.py index fae7eb9f..3e388442 100644 --- a/jcvi/assembly/kmer.py +++ b/jcvi/assembly/kmer.py @@ -7,12 +7,13 @@ import os.path as op import sys import math -import numpy as np from collections import defaultdict -from more_itertools import chunked from typing import List +import numpy as np +from more_itertools import chunked + from ..apps.grid import MakeManager from ..apps.base import ( ActionDispatcher, diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index d24d1de4..b0652350 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -6,16 +6,47 @@ """ from ..apps.base import ActionDispatcher, OptionParser, logger +from ..graphics.base import normalize_axes, panel_labels, plt, savefig def genomebuild(args): """ - %prog genomebuild + %prog genomebuild reads.histo geneticmap.matrix hic.resolution_500000.npy hic.resolution_500000.json - Plot genome build composite figure. + Plot genome build composite figure, including: + A. Read kmer histogram + B. Genetic map concordance + C. Hi-C contact map concordance """ p = OptionParser(genomebuild.__doc__) - _, args, iopts = p.set_image_options(args, figsize="12x9") + _, args, iopts = p.set_image_options(args, figsize="15x5") + + if len(args) != 4: + sys.exit(not p.print_help()) + + reads_histo, geneticmap_matrix, hic_matrix, hic_json = args + + fig = plt.figure(1, (iopts.w, iopts.h)) + root = fig.add_axes((0, 0, 1, 1)) + ax1 = fig.add_axes((0.1, 0.1, 0.32, 0.8)) + ax2 = fig.add_axes((0.1, 0.1, 0.34, 0.8)) + ax3 = fig.add_axes((0.1, 0.1, 0.34, 0.8)) + + # Panel A + logger.info("Plotting read kmer histogram") + + # Panel B + logger.info("Plotting genetic map concordance") + + # Panel C + logger.info("Plotting Hi-C contact map concordance") + + labels = ((0.05, 0.95, "A"), (0.37, 0.95, "B"), (0.71, 0.95, "C")) + panel_labels(root, labels) + normalize_axes([root, ax1, ax2, ax3]) + + image_name = "genomebuild.pdf" + savefig(image_name, dpi=iopts.dpi, iopts=iopts) def main(): From fca4a3943635464d48b015f08ca384916a0fe235 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 17:07:08 -0700 Subject: [PATCH 16/24] Refactor to draw_geneticmap_heatmap() --- jcvi/assembly/geneticmap.py | 59 +++++++++++++++++++++---------------- 1 file changed, 34 insertions(+), 25 deletions(-) diff --git a/jcvi/assembly/geneticmap.py b/jcvi/assembly/geneticmap.py index d642941a..9d8d5eee 100644 --- a/jcvi/assembly/geneticmap.py +++ b/jcvi/assembly/geneticmap.py @@ -377,32 +377,11 @@ def read_subsampled_matrix(mstmap: str, subsample: int) -> Tuple[np.ndarray, str return M, markerbedfile, nmarkers -def heatmap(args): +def draw_geneticmap_heatmap(root, ax, mstmap: str, subsample: int): """ - %prog heatmap map - - Calculate pairwise linkage disequilibrium given MSTmap. + Draw the heatmap of the genetic map. """ - p = OptionParser(heatmap.__doc__) - p.add_option( - "--subsample", - default=1000, - type="int", - help="Subsample markers to speed up", - ) - opts, args, iopts = p.set_image_options(args, figsize="8x8") - - if len(args) != 1: - sys.exit(not p.print_help()) - - (mstmap,) = args - M, markerbedfile, nmarkers = read_subsampled_matrix(mstmap, opts.subsample) - - plt.rcParams["axes.linewidth"] = 0 - - fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes((0, 0, 1, 1)) - ax = fig.add_axes((0.1, 0.1, 0.8, 0.8)) # the heatmap + M, markerbedfile, nmarkers = read_subsampled_matrix(mstmap, subsample) # Plot chromosomes breaks bed = Bed(markerbedfile) @@ -447,7 +426,37 @@ def heatmap(args): root.set_ylim(0, 1) root.set_axis_off() - image_name = m + ".subsample" + "." + iopts.format + +def heatmap(args): + """ + %prog heatmap map + + Calculate pairwise linkage disequilibrium given MSTmap. + """ + p = OptionParser(heatmap.__doc__) + p.add_option( + "--subsample", + default=1000, + type="int", + help="Subsample markers to speed up", + ) + opts, args, iopts = p.set_image_options(args, figsize="8x8") + + if len(args) != 1: + sys.exit(not p.print_help()) + + (mstmap,) = args + + plt.rcParams["axes.linewidth"] = 0 + + fig = plt.figure(1, (iopts.w, iopts.h)) + root = fig.add_axes((0, 0, 1, 1)) + ax = fig.add_axes((0.1, 0.1, 0.8, 0.8)) # the heatmap + + draw_geneticmap_heatmap(root, ax, mstmap, opts.subsample) + + pf = mstmap.split(".")[0] + image_name = pf + ".subsample" + "." + iopts.format savefig(image_name, dpi=iopts.dpi, iopts=iopts) From f279ccf57bb318dd706ef0b9b60d6347ae787243 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 17:27:23 -0700 Subject: [PATCH 17/24] dev sync --- jcvi/assembly/geneticmap.py | 11 +++++------ jcvi/projects/jcvi.py | 21 ++++++++++++++------- 2 files changed, 19 insertions(+), 13 deletions(-) diff --git a/jcvi/assembly/geneticmap.py b/jcvi/assembly/geneticmap.py index 9d8d5eee..4658e386 100644 --- a/jcvi/assembly/geneticmap.py +++ b/jcvi/assembly/geneticmap.py @@ -23,6 +23,7 @@ from ..graphics.base import ( Rectangle, draw_cmap, + normalize_axes, plt, plot_heatmap, savefig, @@ -384,14 +385,14 @@ def draw_geneticmap_heatmap(root, ax, mstmap: str, subsample: int): M, markerbedfile, nmarkers = read_subsampled_matrix(mstmap, subsample) # Plot chromosomes breaks - bed = Bed(markerbedfile) - xsize = len(bed) + b = Bed(markerbedfile) + xsize = len(b) extent = (0, nmarkers) chr_labels = [] ignore_size = 20 breaks = [] - for seqid, beg, end in bed.get_breaks(): + for seqid, beg, end in b.get_breaks(): ignore = abs(end - beg) < ignore_size pos = (beg + end) / 2 chr_labels.append((seqid, pos, ignore)) @@ -422,9 +423,7 @@ def draw_geneticmap_heatmap(root, ax, mstmap: str, subsample: int): m = mstmap.split(".")[0] root.text(0.5, 0.06, f"Linkage Disequilibrium between {m} markers", ha="center") - root.set_xlim(0, 1) - root.set_ylim(0, 1) - root.set_axis_off() + normalize_axes(root) def heatmap(args): diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index b0652350..cb79bb4c 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -5,7 +5,10 @@ Functions in this script produce figures in the JCVI manuscript. """ +import sys + from ..apps.base import ActionDispatcher, OptionParser, logger +from ..assembly.geneticmap import draw_geneticmap_heatmap from ..graphics.base import normalize_axes, panel_labels, plt, savefig @@ -19,31 +22,35 @@ def genomebuild(args): C. Hi-C contact map concordance """ p = OptionParser(genomebuild.__doc__) - _, args, iopts = p.set_image_options(args, figsize="15x5") + _, args, iopts = p.set_image_options(args, figsize="21x7") if len(args) != 4: sys.exit(not p.print_help()) - reads_histo, geneticmap_matrix, hic_matrix, hic_json = args + reads_histo, mstmap, hic_matrix, hic_json = args fig = plt.figure(1, (iopts.w, iopts.h)) root = fig.add_axes((0, 0, 1, 1)) - ax1 = fig.add_axes((0.1, 0.1, 0.32, 0.8)) - ax2 = fig.add_axes((0.1, 0.1, 0.34, 0.8)) - ax3 = fig.add_axes((0.1, 0.1, 0.34, 0.8)) + ax1_root = fig.add_axes((0, 0, 0.32, 1)) + ax2_root = fig.add_axes((0.32, 0, 0.34, 1)) + ax3_root = fig.add_axes((0.66, 0, 0.34, 1)) + ax1 = fig.add_axes((0.03, 0.1, 0.23, 0.8)) + ax2 = fig.add_axes((0.35, 0.1, 0.27, 0.8)) + ax3 = fig.add_axes((0.69, 0.1, 0.27, 0.8)) # Panel A logger.info("Plotting read kmer histogram") # Panel B logger.info("Plotting genetic map concordance") + draw_geneticmap_heatmap(ax2_root, ax2, mstmap, 1000) # Panel C logger.info("Plotting Hi-C contact map concordance") - labels = ((0.05, 0.95, "A"), (0.37, 0.95, "B"), (0.71, 0.95, "C")) + labels = ((0.05, 0.95, "A"), (0.35, 0.95, "B"), (0.7, 0.95, "C")) panel_labels(root, labels) - normalize_axes([root, ax1, ax2, ax3]) + normalize_axes([root, ax1_root, ax2_root, ax3_root, ax1, ax2, ax3]) image_name = "genomebuild.pdf" savefig(image_name, dpi=iopts.dpi, iopts=iopts) From 3d9dd23a03582b6e737588ceb87c0c0afb239e0b Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 18:47:19 -0700 Subject: [PATCH 18/24] Refactor --- jcvi/assembly/hic.py | 100 +++++++++++++++++++++++++++++------------- jcvi/projects/jcvi.py | 33 ++++++++++---- 2 files changed, 94 insertions(+), 39 deletions(-) diff --git a/jcvi/assembly/hic.py b/jcvi/assembly/hic.py index 5ccb66d1..b1e2911c 100644 --- a/jcvi/assembly/hic.py +++ b/jcvi/assembly/hic.py @@ -14,7 +14,7 @@ from collections import defaultdict from functools import partial from multiprocessing import Pool -from typing import List, Tuple +from typing import List, Optional, Tuple import numpy as np @@ -686,7 +686,13 @@ def generate_groups(groupsfile): def read_matrix( - npyfile: str, header: dict, contig: str, groups: List[Tuple[str, str]], opts + npyfile: str, + header: dict, + contig: str, + groups: List[Tuple[str, str]], + vmin: int, + vmax: int, + breaks: bool, ): """ Read the matrix from the npy file and apply log transformation and thresholding. @@ -729,7 +735,6 @@ def read_matrix( B = A.astype("float64") B += 1.0 B = np.log(B) - vmin, vmax = opts.vmin, opts.vmax B[B < vmin] = vmin B[B > vmax] = vmax print(B) @@ -738,12 +743,60 @@ def read_matrix( breaks = list(header["starts"].values()) breaks += [total_bins] # This is actually discarded breaks = sorted(breaks)[1:] - if contig or opts.nobreaks: + if contig or not breaks: breaks = [] return B, new_groups, breaks +def draw_hic_heatmap( + root, + ax, + npyfile: str, + jsonfile: str, + contig: Optional[str], + groups_file: str, + title: str, + vmin: int, + vmax: int, + breaks: bool, +): + """ + Draw heatmap based on .npy file. The .npy file stores a square matrix with + bins of genome, and cells inside the matrix represent number of links + between bin i and bin j. The `genome.json` contains the offsets of each + contig/chr so that we know where to draw boundary lines, or extract per + contig/chromosome heatmap. + """ + groups = list(generate_groups(groups_file)) if groups_file else [] + + # Load contig/chromosome starts and sizes + header = json.loads(open(jsonfile, encoding="utf-8").read()) + resolution = header.get("resolution") + assert resolution is not None, "`resolution` not found in `{}`".format(jsonfile) + logger.debug("Resolution set to %d", resolution) + + B, new_groups, breaks = read_matrix( + npyfile, header, contig, groups, vmin, vmax, breaks + ) + plot_heatmap(ax, B, breaks, groups=new_groups, binsize=resolution) + + # Title + if contig: + title += "-{}".format(contig) + root.text( + 0.5, + 0.98, + markup(title), + color="darkslategray", + size=18, + ha="center", + va="center", + ) + + normalize_axes(root) + + def heatmap(args): """ %prog heatmap input.npy genome.json @@ -784,40 +837,25 @@ def heatmap(args): sys.exit(not p.print_help()) npyfile, jsonfile = args - contig = opts.chr - groups = list(generate_groups(opts.groups)) if opts.groups else [] - - # Load contig/chromosome starts and sizes - header = json.loads(open(jsonfile, encoding="utf-8").read()) - resolution = header.get("resolution") - assert resolution is not None, "`resolution` not found in `{}`".format(jsonfile) - logger.debug("Resolution set to %d", resolution) - - B, new_groups, breaks = read_matrix(npyfile, header, contig, groups, opts) - # Canvas fig = plt.figure(1, (iopts.w, iopts.h)) root = fig.add_axes((0, 0, 1, 1)) # whole canvas ax = fig.add_axes((0.05, 0.05, 0.9, 0.9)) # just the heatmap - plot_heatmap(ax, B, breaks, groups=new_groups, binsize=resolution) - - # Title - pf = npyfile.rsplit(".", 1)[0] - title = opts.title - if contig: - title += "-{}".format(contig) - root.text( - 0.5, - 0.98, - markup(title), - color="darkslategray", - size=18, - ha="center", - va="center", + draw_hic_heatmap( + root, + ax, + npyfile, + jsonfile, + contig=opts.chr, + groups_file=opts.groups, + title=opts.title, + vmin=opts.vmin, + vmax=opts.vmax, + breaks=not opts.nobreaks, ) - normalize_axes(root) + pf = npyfile.rsplit(".", 1)[0] image_name = pf + "." + iopts.format # macOS sometimes has way too verbose output savefig(image_name, dpi=iopts.dpi, iopts=iopts) diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index cb79bb4c..e280faab 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -9,6 +9,7 @@ from ..apps.base import ActionDispatcher, OptionParser, logger from ..assembly.geneticmap import draw_geneticmap_heatmap +from ..assembly.hic import draw_hic_heatmap from ..graphics.base import normalize_axes, panel_labels, plt, savefig @@ -31,12 +32,12 @@ def genomebuild(args): fig = plt.figure(1, (iopts.w, iopts.h)) root = fig.add_axes((0, 0, 1, 1)) - ax1_root = fig.add_axes((0, 0, 0.32, 1)) - ax2_root = fig.add_axes((0.32, 0, 0.34, 1)) - ax3_root = fig.add_axes((0.66, 0, 0.34, 1)) - ax1 = fig.add_axes((0.03, 0.1, 0.23, 0.8)) - ax2 = fig.add_axes((0.35, 0.1, 0.27, 0.8)) - ax3 = fig.add_axes((0.69, 0.1, 0.27, 0.8)) + ax1_root = fig.add_axes((0, 0, 1 / 3, 1)) + ax2_root = fig.add_axes((1 / 3, 0, 1 / 3, 1)) + ax3_root = fig.add_axes((2 / 3, 0, 1 / 3, 1)) + ax1 = fig.add_axes((1 / 3 * 0.1, 0.1, 1 / 3 * 0.8, 0.8)) + ax2 = fig.add_axes((1 / 3 * 1.1, 0.1, 1 / 3 * 0.8, 0.8)) + ax3 = fig.add_axes((1 / 3 * 2.1, 0.1, 1 / 3 * 0.8, 0.8)) # Panel A logger.info("Plotting read kmer histogram") @@ -47,10 +48,26 @@ def genomebuild(args): # Panel C logger.info("Plotting Hi-C contact map concordance") + draw_hic_heatmap( + ax3_root, + ax3, + hic_matrix, + hic_json, + contig=None, + groups_file="groups", + title="*S. species* Hi-C contact map", + vmin=1, + vmax=6, + breaks=True, + ) - labels = ((0.05, 0.95, "A"), (0.35, 0.95, "B"), (0.7, 0.95, "C")) + labels = ( + (1 / 3 * 0.1, 0.95, "A"), + (1 / 3 * 1.1, 0.95, "B"), + (1 / 3 * 2.1, 0.95, "C"), + ) panel_labels(root, labels) - normalize_axes([root, ax1_root, ax2_root, ax3_root, ax1, ax2, ax3]) + normalize_axes([root, ax1_root, ax2_root, ax3_root]) image_name = "genomebuild.pdf" savefig(image_name, dpi=iopts.dpi, iopts=iopts) From 0d2e569b3de7297b906013e0597ec0728d2a406c Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 20:04:45 -0700 Subject: [PATCH 19/24] breaks => plot_breaks --- jcvi/assembly/hic.py | 17 ++++++++--------- jcvi/projects/jcvi.py | 2 +- 2 files changed, 9 insertions(+), 10 deletions(-) diff --git a/jcvi/assembly/hic.py b/jcvi/assembly/hic.py index b1e2911c..4ad12b37 100644 --- a/jcvi/assembly/hic.py +++ b/jcvi/assembly/hic.py @@ -688,11 +688,11 @@ def generate_groups(groupsfile): def read_matrix( npyfile: str, header: dict, - contig: str, + contig: Optional[str], groups: List[Tuple[str, str]], vmin: int, vmax: int, - breaks: bool, + plot_breaks: bool, ): """ Read the matrix from the npy file and apply log transformation and thresholding. @@ -743,7 +743,7 @@ def read_matrix( breaks = list(header["starts"].values()) breaks += [total_bins] # This is actually discarded breaks = sorted(breaks)[1:] - if contig or not breaks: + if contig or not plot_breaks: breaks = [] return B, new_groups, breaks @@ -759,7 +759,7 @@ def draw_hic_heatmap( title: str, vmin: int, vmax: int, - breaks: bool, + plot_breaks: bool, ): """ Draw heatmap based on .npy file. The .npy file stores a square matrix with @@ -777,19 +777,18 @@ def draw_hic_heatmap( logger.debug("Resolution set to %d", resolution) B, new_groups, breaks = read_matrix( - npyfile, header, contig, groups, vmin, vmax, breaks + npyfile, header, contig, groups, vmin, vmax, plot_breaks ) plot_heatmap(ax, B, breaks, groups=new_groups, binsize=resolution) # Title if contig: - title += "-{}".format(contig) + title += f"-{contig}" root.text( 0.5, - 0.98, + 0.96, markup(title), color="darkslategray", - size=18, ha="center", va="center", ) @@ -852,7 +851,7 @@ def heatmap(args): title=opts.title, vmin=opts.vmin, vmax=opts.vmax, - breaks=not opts.nobreaks, + plot_breaks=not opts.nobreaks, ) pf = npyfile.rsplit(".", 1)[0] diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index e280faab..b40783fa 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -58,7 +58,7 @@ def genomebuild(args): title="*S. species* Hi-C contact map", vmin=1, vmax=6, - breaks=True, + plot_breaks=True, ) labels = ( From a844acbe9dece00f31381644a75c36618ea51cda Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 20:30:00 -0700 Subject: [PATCH 20/24] Refactor to draw_ks_histogram() --- jcvi/assembly/kmer.py | 165 ++++++++++++++++++++++-------------------- jcvi/projects/jcvi.py | 13 ++++ 2 files changed, 98 insertions(+), 80 deletions(-) diff --git a/jcvi/assembly/kmer.py b/jcvi/assembly/kmer.py index 3e388442..9c4b43a5 100644 --- a/jcvi/assembly/kmer.py +++ b/jcvi/assembly/kmer.py @@ -1163,20 +1163,6 @@ def jellyfish(args): sh(cmd) -def merylhistogram(merylfile): - """ - Run meryl to dump histogram to be used in kmer.histogram(). The merylfile - are the files ending in .mcidx or .mcdat. - """ - pf, sf = op.splitext(merylfile) - outfile = pf + ".histogram" - if need_update(merylfile, outfile): - cmd = "meryl -Dh -s {0}".format(pf) - sh(cmd, outfile=outfile) - - return outfile - - def multihistogram(args): """ %prog multihistogram *.histogram species @@ -1197,9 +1183,9 @@ def multihistogram(args): histfiles = args[:-1] species = args[-1] fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) - A = fig.add_axes([0.08, 0.12, 0.38, 0.76]) - B = fig.add_axes([0.58, 0.12, 0.38, 0.76]) + root = fig.add_axes((0, 0, 1, 1)) + A = fig.add_axes((0.08, 0.12, 0.38, 0.76)) + B = fig.add_axes((0.58, 0.12, 0.38, 0.76)) lines = [] legends = [] @@ -1281,25 +1267,99 @@ def plot_nbinom_fit(ax, ks: KmerSpectrum, ymax: float, method_info: dict): ) +def draw_ks_histogram( + ax, + histfile: str, + method: str, + coverage: int, + vmin: int, + vmax: int, + species: str, + K: int, + maxiter: int, + peaks: bool, +) -> int: + """ + Draw the K-mer histogram. + """ + ks = KmerSpectrum(histfile) + method_info = ks.analyze(K=K, maxiter=maxiter, method=method) + + Total_Kmers = int(ks.totalKmers) + Kmer_coverage = ks.lambda_ if not coverage else coverage + Genome_size = int(round(Total_Kmers * 1.0 / Kmer_coverage)) + + Total_Kmers_msg = f"Total {K}-mers: {thousands(Total_Kmers)}" + Kmer_coverage_msg = f"{K}-mer coverage: {Kmer_coverage:.1f}x" + Genome_size_msg = f"Estimated genome size: {Genome_size / 1e6:.1f} Mb" + Repetitive_msg = ks.repetitive + SNPrate_msg = ks.snprate + + messages = [ + Total_Kmers_msg, + Kmer_coverage_msg, + Genome_size_msg, + Repetitive_msg, + SNPrate_msg, + ] + for msg in messages: + print(msg, file=sys.stderr) + + x, y = ks.get_xy(vmin, vmax) + title = f"{species} {K}-mer histogram" + + ax.bar(x, y, fc="#b2df8a", lw=0) + + if peaks: # Only works for method 'allpaths' + t = (ks.min1, ks.max1, ks.min2, ks.max2, ks.min3) + tcounts = [(x, y) for x, y in ks.counts if x in t] + if tcounts: + x, y = zip(*tcounts) + tcounts = dict(tcounts) + ax.plot(x, y, "ko", lw=3, mec="k", mfc="w") + ax.text(ks.max1, tcounts[ks.max1], "SNP peak") + ax.text(ks.max2, tcounts[ks.max2], "Main peak") + + _, ymax = ax.get_ylim() + ymax *= 7 / 6 + # Plot the negative binomial fit + if method == "nbinom": + plot_nbinom_fit(ax, ks, ymax, method_info) + messages += [ks.ploidy_message] + ks.copy_messages + + write_messages(ax, messages) + + ax.set_title(markup(title)) + ax.set_xlim((0, vmax)) + ax.set_ylim((0, ymax)) + adjust_spines(ax, ["left", "bottom"], outward=True) + xlabel, ylabel = "Coverage (X)", "Counts" + ax.set_xlabel(xlabel) + ax.set_ylabel(ylabel) + set_human_axis(ax) + + return Genome_size + + def histogram(args): """ %prog histogram meryl.histogram species K - Plot the histogram based on meryl K-mer distribution, species and N are + Plot the histogram based on Jellyfish or meryl K-mer distribution, species and N are only used to annotate the graphic. """ p = OptionParser(histogram.__doc__) p.add_option( "--vmin", dest="vmin", - default=1, + default=2, type="int", help="minimum value, inclusive", ) p.add_option( "--vmax", dest="vmax", - default=100, + default=200, type="int", help="maximum value, inclusive", ) @@ -1307,7 +1367,8 @@ def histogram(args): "--method", choices=("nbinom", "allpaths"), default="nbinom", - help="'nbinom' - slow but more accurate for het or polyploid genome; 'allpaths' - fast and works for homozygous enomes", + help="'nbinom' - slow but more accurate for het or polyploid genome; " + + "'allpaths' - fast and works for homozygous enomes", ) p.add_option( "--maxiter", @@ -1335,68 +1396,12 @@ def histogram(args): peaks = not opts.nopeaks and method == "allpaths" N = int(N) - if histfile.rsplit(".", 1)[-1] in ("mcdat", "mcidx"): - logger.debug("CA kmer index found") - histfile = merylhistogram(histfile) - - ks = KmerSpectrum(histfile) - method_info = ks.analyze(K=N, maxiter=opts.maxiter, method=method) - - Total_Kmers = int(ks.totalKmers) - coverage = opts.coverage - Kmer_coverage = ks.lambda_ if not coverage else coverage - Genome_size = int(round(Total_Kmers * 1.0 / Kmer_coverage)) - - Total_Kmers_msg = "Total {0}-mers: {1}".format(N, thousands(Total_Kmers)) - Kmer_coverage_msg = "{0}-mer coverage: {1:.1f}x".format(N, Kmer_coverage) - Genome_size_msg = "Estimated genome size: {0:.1f} Mb".format(Genome_size / 1e6) - Repetitive_msg = ks.repetitive - SNPrate_msg = ks.snprate - - messages = [ - Total_Kmers_msg, - Kmer_coverage_msg, - Genome_size_msg, - Repetitive_msg, - SNPrate_msg, - ] - for msg in messages: - print(msg, file=sys.stderr) - - x, y = ks.get_xy(vmin, vmax) - title = "{0} {1}-mer histogram".format(species, N) - fig = plt.figure(1, (iopts.w, iopts.h)) ax = fig.add_axes((0.1, 0.1, 0.8, 0.8)) - ax.bar(x, y, fc="#b2df8a", lw=0) - if peaks: # Only works for method 'allpaths' - t = (ks.min1, ks.max1, ks.min2, ks.max2, ks.min3) - tcounts = [(x, y) for x, y in ks.counts if x in t] - if tcounts: - x, y = zip(*tcounts) - tcounts = dict(tcounts) - ax.plot(x, y, "ko", lw=3, mec="k", mfc="w") - ax.text(ks.max1, tcounts[ks.max1], "SNP peak") - ax.text(ks.max2, tcounts[ks.max2], "Main peak") - - _, ymax = ax.get_ylim() - ymax *= 7 / 6 - # Plot the negative binomial fit - if method == "nbinom": - plot_nbinom_fit(ax, ks, ymax, method_info) - messages += [ks.ploidy_message] + ks.copy_messages - - write_messages(ax, messages) - - ax.set_title(markup(title)) - ax.set_xlim((0, vmax)) - ax.set_ylim((0, ymax)) - adjust_spines(ax, ["left", "bottom"], outward=True) - xlabel, ylabel = "Coverage (X)", "Counts" - ax.set_xlabel(xlabel) - ax.set_ylabel(ylabel) - set_human_axis(ax) + Genome_size = draw_ks_histogram( + ax, histfile, method, opts.coverage, vmin, vmax, species, N, opts.maxiter, peaks + ) imagename = histfile.split(".")[0] + "." + iopts.format savefig(imagename, dpi=100) diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index b40783fa..f0a97999 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -10,6 +10,7 @@ from ..apps.base import ActionDispatcher, OptionParser, logger from ..assembly.geneticmap import draw_geneticmap_heatmap from ..assembly.hic import draw_hic_heatmap +from ..assembly.kmer import draw_ks_histogram from ..graphics.base import normalize_axes, panel_labels, plt, savefig @@ -41,6 +42,18 @@ def genomebuild(args): # Panel A logger.info("Plotting read kmer histogram") + _ = draw_ks_histogram( + ax1, + reads_histo, + method="nbinom", + coverage=0, + vmin=2, + vmax=200, + species="*S. species* ‘Variety 1’", + K=21, + maxiter=100, + peaks=False, + ) # Panel B logger.info("Plotting genetic map concordance") From 9388f91dc3609a59c432b1e25aaed1c1d78b4b4c Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 20:49:21 -0700 Subject: [PATCH 21/24] Add diversity() --- jcvi/compara/pedigree.py | 14 ++++++-------- jcvi/projects/jcvi.py | 12 ++++++++++++ 2 files changed, 18 insertions(+), 8 deletions(-) diff --git a/jcvi/compara/pedigree.py b/jcvi/compara/pedigree.py index b4592fb7..249e71b0 100644 --- a/jcvi/compara/pedigree.py +++ b/jcvi/compara/pedigree.py @@ -12,7 +12,7 @@ import networkx as nx import numpy as np -from ..apps.base import OptionParser, ActionDispatcher, logger, sh +from ..apps.base import OptionParser, ActionDispatcher, logger from ..formats.base import BaseFile from ..graphics.base import set3_n @@ -241,7 +241,7 @@ def pedigree(args): p.add_option("--ploidy", default=2, type="int", help="Ploidy") p.add_option("--N", default=10000, type="int", help="Number of samples") p.add_option("--title", default="", help="Title of the graph") - opts, args = p.parse_args(args) + opts, args, iopts = p.set_image_options(args) if len(args) != 1: sys.exit(not p.print_help()) @@ -254,12 +254,10 @@ def pedigree(args): print(v) G = ped.to_graph(inb, title=opts.title) - dotfile = f"{pedfile}.dot" - nx.nx_agraph.write_dot(G, dotfile) - pdf_file = dotfile + ".pdf" - file_format = pdf_file.split(".")[-1] - sh(f"dot -T{file_format} {dotfile} -o {pdf_file}") - logger.info("Pedigree graph written to `%s`", pdf_file) + A = nx.nx_agraph.to_agraph(G) + image_file = f"{pedfile}.{iopts.format}" + A.draw(image_file, prog="dot") + logger.info("Pedigree graph written to `%s`", image_file) def main(): diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index f0a97999..9a828843 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -86,6 +86,18 @@ def genomebuild(args): savefig(image_name, dpi=iopts.dpi, iopts=iopts) +def diversity(args): + """ + %prog diversity pedigree.ped VAR?_srtd.wgs.regions.bed.gz + + Plot diversity composite figure, including: + A. Pedigree + B. Depth distribution across genomes + """ + p = OptionParser(diversity.__doc__) + _, args, iopts = p.set_image_options(args, figsize="14x7") + + def main(): actions = ( From 9490bcc7e6efb3dd5ea2714fdfea76e7e609a9bb Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 21:15:41 -0700 Subject: [PATCH 22/24] panels in diversity() --- jcvi/graphics/landscape.py | 100 +++++++++++++++++++++++++------------ jcvi/projects/jcvi.py | 51 +++++++++++++++++++ 2 files changed, 118 insertions(+), 33 deletions(-) diff --git a/jcvi/graphics/landscape.py b/jcvi/graphics/landscape.py index 3521d40e..822de122 100644 --- a/jcvi/graphics/landscape.py +++ b/jcvi/graphics/landscape.py @@ -11,7 +11,7 @@ import sys from collections import Counter, OrderedDict, defaultdict -from typing import Optional +from typing import List, Optional import numpy as np @@ -93,7 +93,7 @@ def __init__(self, row, delimiter=","): class ChrInfoFile(BaseFile, OrderedDict): def __init__(self, filename, delimiter=","): super(ChrInfoFile, self).__init__(filename) - with open(filename) as fp: + with open(filename, encoding="utf-8") as fp: for row in fp: if row[0] == "#": continue @@ -114,7 +114,7 @@ def __init__(self, row, delimiter=","): class TitleInfoFile(BaseFile, OrderedDict): def __init__(self, filename, delimiter=","): super(TitleInfoFile, self).__init__(filename) - with open(filename) as fp: + with open(filename, encoding="utf-8") as fp: for row in fp: if row[0] == "#": continue @@ -274,7 +274,7 @@ def draw_depth( chrinfo: dict = {}, defaultcolor: str = "k", sepcolor: str = "w", - ylim: int = 100, + maxdepth: int = 100, logscale: bool = False, title: Optional[str] = None, subtitle: Optional[str] = None, @@ -288,7 +288,7 @@ def draw_depth( chrinfo (ChrInfoFile): seqid => color, new name defaultcolor (str): matplotlib-compatible color for data points sepcolor (str): matplotlib-compatible color for chromosome breaks - ylim (int): Upper limit of the y-axis (depth) + maxdepth (int): Upper limit of the y-axis (depth) title (str): Title of the figure, to the right of the axis subtitle (str): Subtitle of the figure, just below title """ @@ -354,7 +354,7 @@ def draw_depth( # vertical lines for all the breaks for pos in starts.values(): - ax.plot((pos, pos), (0, ylim), "-", lw=1, color=sepcolor) + ax.plot((pos, pos), (0, maxdepth), "-", lw=1, color=sepcolor) # beautify the numeric axis for tick in ax.get_xticklines() + ax.get_yticklines(): @@ -413,7 +413,7 @@ def draw_depth( ax.set_xlim(0, xsize) if logscale: ax.set_yscale("log", basey=2) - ax.set_ylim(1 if logscale else 0, ylim) + ax.set_ylim(1 if logscale else 0, maxdepth) ax.set_ylabel("Depth") set_human_axis(ax) @@ -421,6 +421,52 @@ def draw_depth( normalize_axes(root) +def draw_multi_depth( + root, + panel_roots, + panel_axes, + bedfiles: List[str], + chrinfo_file: str, + titleinfo_file: str, + maxdepth: int, + logscale: bool, +): + """ + Draw multiple depth plots on the same canvas. + """ + chrinfo = ChrInfoFile(chrinfo_file) if chrinfo_file else {} + titleinfo = TitleInfoFile(titleinfo_file) if titleinfo_file else {} + npanels = len(bedfiles) + yinterval = 1.0 / npanels + ypos = 1 - yinterval + for bedfile, panel_root, panel_ax in zip(bedfiles, panel_roots, panel_axes): + pf = op.basename(bedfile).split(".", 1)[0] + bed = Bed(bedfile) + + if ypos > 0.001: + root.plot((0, 1), (ypos, ypos), "-", lw=2, color="lightslategray") + + title = titleinfo.get(bedfile, pf.split("_", 1)[0]) + subtitle = None + if isinstance(title, TitleInfoLine): + subtitle = title.subtitle + title = title.title + + draw_depth( + panel_root, + panel_ax, + bed, + chrinfo=chrinfo, + maxdepth=maxdepth, + logscale=logscale, + title=title, + subtitle=subtitle, + ) + ypos -= yinterval + + normalize_axes(root) + + def depth(args): """ %prog depth *.regions.bed.gz @@ -463,8 +509,6 @@ def depth(args): sys.exit(not p.print_help()) bedfiles = args - chrinfo = ChrInfoFile(opts.chrinfo) if opts.chrinfo else {} - titleinfo = TitleInfoFile(opts.titleinfo) if opts.titleinfo else {} fig = plt.figure(1, (iopts.w, iopts.h)) root = fig.add_axes((0, 0, 1, 1)) @@ -472,34 +516,24 @@ def depth(args): npanels = len(bedfiles) yinterval = 1.0 / npanels ypos = 1 - yinterval - for bedfile in bedfiles: - pf = op.basename(bedfile).split(".", 1)[0] - bed = Bed(bedfile) - + panel_roots, panel_axes = [], [] + for _ in range(npanels): panel_root = root if npanels == 1 else fig.add_axes((0, ypos, 1, yinterval)) panel_ax = fig.add_axes((0.1, ypos + 0.2 * yinterval, 0.8, 0.65 * yinterval)) - if ypos > 0.001: - root.plot((0, 1), (ypos, ypos), "-", lw=2, color="lightslategray") - - title = titleinfo.get(bedfile, pf.split("_", 1)[0]) - subtitle = None - if isinstance(title, TitleInfoLine): - subtitle = title.subtitle - title = title.title - - draw_depth( - panel_root, - panel_ax, - bed, - chrinfo=chrinfo, - ylim=opts.maxdepth, - logscale=opts.logscale, - title=title, - subtitle=subtitle, - ) + panel_roots.append(panel_root) + panel_axes.append(panel_ax) ypos -= yinterval - normalize_axes(root) + draw_multi_depth( + root, + panel_roots, + panel_axes, + bedfiles, + opts.chrinfo, + opts.titleinfo, + opts.maxdepth, + opts.logscale, + ) if npanels > 1: pf = op.commonprefix(bedfiles) diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index 9a828843..659e2bbe 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -12,6 +12,7 @@ from ..assembly.hic import draw_hic_heatmap from ..assembly.kmer import draw_ks_histogram from ..graphics.base import normalize_axes, panel_labels, plt, savefig +from ..graphics.landscape import draw_multi_depth def genomebuild(args): @@ -97,6 +98,56 @@ def diversity(args): p = OptionParser(diversity.__doc__) _, args, iopts = p.set_image_options(args, figsize="14x7") + if len(args) < 2: + sys.exit(not p.print_help()) + + pedfile, bedfiles = args[0], args[1:] + + fig = plt.figure(1, (iopts.w, iopts.h)) + root = fig.add_axes((0, 0, 1, 1)) + + ax1_root = fig.add_axes((0, 0, 0.25, 1)) + ax2_root = fig.add_axes((0.25, 0, 0.75, 1)) + + # Panel A + logger.info("Plotting pedigree") + + # Panel B + logger.info("Plotting depth distribution across genomes") + npanels = len(bedfiles) + yinterval = 1.0 / npanels + ypos = 1 - yinterval + panel_roots, panel_axes = [], [] + for _ in range(npanels): + panel_root = root if npanels == 1 else fig.add_axes((0.25, ypos, 1, yinterval)) + panel_ax = fig.add_axes( + (0.25 + 0.1 * 0.75, ypos + 0.2 * yinterval, 0.8 * 0.75, 0.65 * yinterval) + ) + panel_roots.append(panel_root) + panel_axes.append(panel_ax) + ypos -= yinterval + + draw_multi_depth( + ax2_root, + panel_roots, + panel_axes, + bedfiles, + chrinfo_file="chrinfo.txt", + titleinfo_file="titleinfo.txt", + maxdepth=100, + logscale=False, + ) + + labels = ( + (0.25 * 0.1, 0.95, "A"), + (0.25 + 0.25 * 0.1, 0.95, "B"), + ) + panel_labels(root, labels) + normalize_axes([root, ax1_root, ax2_root]) + + image_name = "diversity.pdf" + savefig(image_name, dpi=iopts.dpi, iopts=iopts) + def main(): From cc3f3bfaae82126547b0eef35a96a7bd258f8d01 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 21:53:37 -0700 Subject: [PATCH 23/24] diversity complete --- jcvi/graphics/base.py | 11 +++++++++-- jcvi/graphics/landscape.py | 6 +++--- jcvi/projects/jcvi.py | 26 +++++++++++++++++++++++--- jcvi/projects/misc.py | 2 +- 4 files changed, 36 insertions(+), 9 deletions(-) diff --git a/jcvi/graphics/base.py b/jcvi/graphics/base.py index ce176a33..11f82031 100644 --- a/jcvi/graphics/base.py +++ b/jcvi/graphics/base.py @@ -4,6 +4,7 @@ import copy import os.path as op from os import remove + import sys import logging @@ -12,6 +13,7 @@ logging.getLogger("PIL").setLevel(logging.INFO) from functools import partial +from typing import Optional, List, Tuple, Union import numpy as np import matplotlib as mpl @@ -35,7 +37,6 @@ FancyArrowPatch, FancyBboxPatch, ) -from typing import Optional, List, Tuple, Union from ..apps.base import datadir, glob, listify, logger, sample_N, which from ..formats.base import LineFile @@ -275,6 +276,9 @@ def prettyplot(): def normalize_axes(axes): + """ + Normalize the axes to have the same scale. + """ axes = listify(axes) for ax in axes: ax.set_xlim(0, 1) @@ -282,7 +286,10 @@ def normalize_axes(axes): ax.set_axis_off() -def panel_labels(ax, labels, size=16): +def panel_labels(ax, labels, size: int = 16): + """ + Add panel labels (A, B, ...) to a figure. + """ for xx, yy, panel_label in labels: if rcParams["text.usetex"]: panel_label = r"$\textbf{{{0}}}$".format(panel_label) diff --git a/jcvi/graphics/landscape.py b/jcvi/graphics/landscape.py index 822de122..b0322b6a 100644 --- a/jcvi/graphics/landscape.py +++ b/jcvi/graphics/landscape.py @@ -352,11 +352,11 @@ def draw_depth( alpha=0.5, ) - # vertical lines for all the breaks + # Vertical lines for all the breaks for pos in starts.values(): ax.plot((pos, pos), (0, maxdepth), "-", lw=1, color=sepcolor) - # beautify the numeric axis + # Beautify the numeric axis for tick in ax.get_xticklines() + ax.get_yticklines(): tick.set_visible(False) @@ -444,7 +444,7 @@ def draw_multi_depth( bed = Bed(bedfile) if ypos > 0.001: - root.plot((0, 1), (ypos, ypos), "-", lw=2, color="lightslategray") + root.plot((0.02, 0.98), (ypos, ypos), "-", lw=2, color="lightslategray") title = titleinfo.get(bedfile, pf.split("_", 1)[0]) subtitle = None diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index 659e2bbe..2d7623a7 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -7,10 +7,13 @@ import sys +import networkx as nx + from ..apps.base import ActionDispatcher, OptionParser, logger from ..assembly.geneticmap import draw_geneticmap_heatmap from ..assembly.hic import draw_hic_heatmap from ..assembly.kmer import draw_ks_histogram +from ..compara.pedigree import Pedigree, calculate_inbreeding from ..graphics.base import normalize_axes, panel_labels, plt, savefig from ..graphics.landscape import draw_multi_depth @@ -111,6 +114,23 @@ def diversity(args): # Panel A logger.info("Plotting pedigree") + ped = Pedigree(pedfile) + pngfile = f"{pedfile}.png" + inb = calculate_inbreeding(ped, ploidy=4, N=10000) + + G = ped.to_graph(inb, title="Pedigree of Variety1") + A = nx.nx_agraph.to_agraph(G) + dpi = 300 + A.draw(pngfile, prog="dot", args=f"-Gdpi={dpi}") + logger.info("Pedigree graph written to `%s`", pngfile) + + M = plt.imread(pngfile) + width, height = M.shape[1] / dpi, M.shape[0] / dpi + logger.info("Image size: %.2f x %.2f (dpi=%d)", width, height, dpi) + + # Force aspect ratio to be equal + ax1_root.imshow(M) + ax1_root.set_axis_off() # Panel B logger.info("Plotting depth distribution across genomes") @@ -119,7 +139,7 @@ def diversity(args): ypos = 1 - yinterval panel_roots, panel_axes = [], [] for _ in range(npanels): - panel_root = root if npanels == 1 else fig.add_axes((0.25, ypos, 1, yinterval)) + panel_root = fig.add_axes((0.25, ypos, 0.75, yinterval)) panel_ax = fig.add_axes( (0.25 + 0.1 * 0.75, ypos + 0.2 * yinterval, 0.8 * 0.75, 0.65 * yinterval) ) @@ -139,11 +159,11 @@ def diversity(args): ) labels = ( - (0.25 * 0.1, 0.95, "A"), + (0.02, 0.95, "A"), (0.25 + 0.25 * 0.1, 0.95, "B"), ) panel_labels(root, labels) - normalize_axes([root, ax1_root, ax2_root]) + normalize_axes([root, ax2_root]) image_name = "diversity.pdf" savefig(image_name, dpi=iopts.dpi, iopts=iopts) diff --git a/jcvi/projects/misc.py b/jcvi/projects/misc.py index 2f4b8114..7c074ac3 100644 --- a/jcvi/projects/misc.py +++ b/jcvi/projects/misc.py @@ -75,7 +75,7 @@ def waterlilyGOM(args): pf = datafile.rsplit(".", 1)[0] fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) + root = fig.add_axes((0, 0, 1, 1)) margin, rmargin = 0.15, 0.19 # Left and right margin leafinfo = LeafInfoFile("leafinfo.csv").cache From 10e2705df0caec908ba76950f014bc45261b3a04 Mon Sep 17 00:00:00 2001 From: Haibao Tang Date: Sun, 28 Apr 2024 23:04:58 -0700 Subject: [PATCH 24/24] Add landscape() --- jcvi/graphics/chromosome.py | 26 ++--- jcvi/projects/jcvi.py | 224 +++++++++++++++++++++++------------- 2 files changed, 158 insertions(+), 92 deletions(-) diff --git a/jcvi/graphics/chromosome.py b/jcvi/graphics/chromosome.py index 5f590283..ef9ce000 100644 --- a/jcvi/graphics/chromosome.py +++ b/jcvi/graphics/chromosome.py @@ -6,9 +6,10 @@ from the script used in the Tang et al. PNAS 2010 paper, sigma figure. """ import sys + from itertools import groupby from math import ceil -from typing import Tuple +from typing import Optional, Tuple import numpy as np @@ -24,6 +25,7 @@ Rectangle, latex, markup, + normalize_axes, plt, savefig, set1_n, @@ -480,7 +482,7 @@ class will get assigned a unique color. `id_mappings` file is optional (if mappingfile = args[1] fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes([0, 0, 1, 1]) + root = fig.add_axes((0, 0, 1, 1)) draw_chromosomes( root, @@ -497,9 +499,7 @@ class will get assigned a unique color. `id_mappings` file is optional (if title=opts.title, ) - root.set_xlim(0, 1) - root.set_ylim(0, 1) - root.set_axis_off() + normalize_axes(root) prefix = bedfile.rsplit(".", 1)[0] figname = prefix + "." + opts.format @@ -511,14 +511,14 @@ def draw_chromosomes( bedfile, sizes, iopts, - mergedist, - winsize, - imagemap, - mappingfile=None, - gauge=False, - legend=True, - empty=False, - title=None, + mergedist: int, + winsize: int, + imagemap: bool = False, + mappingfile: Optional[str] = None, + gauge: bool = False, + legend: bool = True, + empty: bool = False, + title: Optional[str] = None, ): bed = Bed(bedfile) prefix = bedfile.rsplit(".", 1)[0] diff --git a/jcvi/projects/jcvi.py b/jcvi/projects/jcvi.py index 2d7623a7..dc38dd02 100644 --- a/jcvi/projects/jcvi.py +++ b/jcvi/projects/jcvi.py @@ -15,81 +15,10 @@ from ..assembly.kmer import draw_ks_histogram from ..compara.pedigree import Pedigree, calculate_inbreeding from ..graphics.base import normalize_axes, panel_labels, plt, savefig +from ..graphics.chromosome import draw_chromosomes from ..graphics.landscape import draw_multi_depth -def genomebuild(args): - """ - %prog genomebuild reads.histo geneticmap.matrix hic.resolution_500000.npy hic.resolution_500000.json - - Plot genome build composite figure, including: - A. Read kmer histogram - B. Genetic map concordance - C. Hi-C contact map concordance - """ - p = OptionParser(genomebuild.__doc__) - _, args, iopts = p.set_image_options(args, figsize="21x7") - - if len(args) != 4: - sys.exit(not p.print_help()) - - reads_histo, mstmap, hic_matrix, hic_json = args - - fig = plt.figure(1, (iopts.w, iopts.h)) - root = fig.add_axes((0, 0, 1, 1)) - ax1_root = fig.add_axes((0, 0, 1 / 3, 1)) - ax2_root = fig.add_axes((1 / 3, 0, 1 / 3, 1)) - ax3_root = fig.add_axes((2 / 3, 0, 1 / 3, 1)) - ax1 = fig.add_axes((1 / 3 * 0.1, 0.1, 1 / 3 * 0.8, 0.8)) - ax2 = fig.add_axes((1 / 3 * 1.1, 0.1, 1 / 3 * 0.8, 0.8)) - ax3 = fig.add_axes((1 / 3 * 2.1, 0.1, 1 / 3 * 0.8, 0.8)) - - # Panel A - logger.info("Plotting read kmer histogram") - _ = draw_ks_histogram( - ax1, - reads_histo, - method="nbinom", - coverage=0, - vmin=2, - vmax=200, - species="*S. species* ‘Variety 1’", - K=21, - maxiter=100, - peaks=False, - ) - - # Panel B - logger.info("Plotting genetic map concordance") - draw_geneticmap_heatmap(ax2_root, ax2, mstmap, 1000) - - # Panel C - logger.info("Plotting Hi-C contact map concordance") - draw_hic_heatmap( - ax3_root, - ax3, - hic_matrix, - hic_json, - contig=None, - groups_file="groups", - title="*S. species* Hi-C contact map", - vmin=1, - vmax=6, - plot_breaks=True, - ) - - labels = ( - (1 / 3 * 0.1, 0.95, "A"), - (1 / 3 * 1.1, 0.95, "B"), - (1 / 3 * 2.1, 0.95, "C"), - ) - panel_labels(root, labels) - normalize_axes([root, ax1_root, ax2_root, ax3_root]) - - image_name = "genomebuild.pdf" - savefig(image_name, dpi=iopts.dpi, iopts=iopts) - - def diversity(args): """ %prog diversity pedigree.ped VAR?_srtd.wgs.regions.bed.gz @@ -124,12 +53,8 @@ def diversity(args): A.draw(pngfile, prog="dot", args=f"-Gdpi={dpi}") logger.info("Pedigree graph written to `%s`", pngfile) - M = plt.imread(pngfile) - width, height = M.shape[1] / dpi, M.shape[0] / dpi - logger.info("Image size: %.2f x %.2f (dpi=%d)", width, height, dpi) - - # Force aspect ratio to be equal - ax1_root.imshow(M) + # Show the image as is + ax1_root.imshow(plt.imread(pngfile)) ax1_root.set_axis_off() # Panel B @@ -169,11 +94,152 @@ def diversity(args): savefig(image_name, dpi=iopts.dpi, iopts=iopts) +def landscape(args): + """ + %prog landscape features.bed athaliana.sizes Fig5.png + + Plot landscape composite figure, including: + A. Example genomic features painted on Arabidopsis genome + B. Landscape of genomic features across the genome + """ + p = OptionParser(landscape.__doc__) + _, args, iopts = p.set_image_options(args, figsize="10x7") + + if len(args) != 3: + sys.exit(not p.print_help()) + + bedfile, sizesfile, pngfile = args + + fig = plt.figure(1, (iopts.w, iopts.h)) + root = fig.add_axes((0, 0, 1, 1)) + aspect_ratio = iopts.w / iopts.h + ax1_root = fig.add_axes((0, 1 / 4, 0.4, 0.5 * aspect_ratio)) + ax2_root = fig.add_axes((0.4, 0.43, 0.54, 0.57)) + ax3_root = fig.add_axes((0.43, -0.13, 0.54, 0.57)) + + # Panel A + logger.info("Plotting example genomic features painted on Arabidopsis genome") + draw_chromosomes( + ax1_root, + bedfile, + sizesfile, + iopts=iopts, + mergedist=0, + winsize=50000, + gauge=True, + legend=True, + empty=False, + title="*Arabidopsis* genome features", + ) + + # Panel B + logger.info("Plotting landscape of genomic features across the genome") + M = plt.imread(pngfile) + width, height = M.shape[1], M.shape[0] + # Split the image into left and right parts + mid = width // 2 - 10 + left_cut = right_cut = 900 + logger.info("Image size: %dx%d", width, height) + logger.info("Splitting image at %d", mid) + + LM, RM = M[:left_cut, :mid], M[:right_cut, mid:] + logger.info("Left image size: %dx%d", LM.shape[1], LM.shape[0]) + logger.info("Right image size: %dx%d", RM.shape[1], RM.shape[0]) + + ax2_root.imshow(LM, extent=(0.4, 1, 0.5, 1), aspect="auto") + ax3_root.imshow(RM, extent=(0.4, 1, 0, 0.5), aspect="auto") + ax2_root.set_axis_off() + ax3_root.set_axis_off() + + labels = ( + (0.02, 0.95, "A"), + (0.42, 0.95, "B"), + ) + panel_labels(root, labels) + normalize_axes([root, ax1_root]) + + image_name = "landscape.pdf" + savefig(image_name, dpi=iopts.dpi, iopts=iopts) + + +def genomebuild(args): + """ + %prog genomebuild reads.histo geneticmap.matrix hic.resolution_500000.npy hic.resolution_500000.json + + Plot genome build composite figure, including: + A. Read kmer histogram + B. Genetic map concordance + C. Hi-C contact map concordance + """ + p = OptionParser(genomebuild.__doc__) + _, args, iopts = p.set_image_options(args, figsize="21x7") + + if len(args) != 4: + sys.exit(not p.print_help()) + + reads_histo, mstmap, hic_matrix, hic_json = args + + fig = plt.figure(1, (iopts.w, iopts.h)) + root = fig.add_axes((0, 0, 1, 1)) + ax1_root = fig.add_axes((0, 0, 1 / 3, 1)) + ax2_root = fig.add_axes((1 / 3, 0, 1 / 3, 1)) + ax3_root = fig.add_axes((2 / 3, 0, 1 / 3, 1)) + ax1 = fig.add_axes((1 / 3 * 0.1, 0.1, 1 / 3 * 0.8, 0.8)) + ax2 = fig.add_axes((1 / 3 * 1.1, 0.1, 1 / 3 * 0.8, 0.8)) + ax3 = fig.add_axes((1 / 3 * 2.1, 0.1, 1 / 3 * 0.8, 0.8)) + + # Panel A + logger.info("Plotting read kmer histogram") + _ = draw_ks_histogram( + ax1, + reads_histo, + method="nbinom", + coverage=0, + vmin=2, + vmax=200, + species="*S. species* ‘Variety 1’", + K=21, + maxiter=100, + peaks=False, + ) + + # Panel B + logger.info("Plotting genetic map concordance") + draw_geneticmap_heatmap(ax2_root, ax2, mstmap, 1000) + + # Panel C + logger.info("Plotting Hi-C contact map concordance") + draw_hic_heatmap( + ax3_root, + ax3, + hic_matrix, + hic_json, + contig=None, + groups_file="groups", + title="*S. species* Hi-C contact map", + vmin=1, + vmax=6, + plot_breaks=True, + ) + + labels = ( + (1 / 3 * 0.1, 0.95, "A"), + (1 / 3 * 1.1, 0.95, "B"), + (1 / 3 * 2.1, 0.95, "C"), + ) + panel_labels(root, labels) + normalize_axes([root, ax1_root, ax2_root, ax3_root]) + + image_name = "genomebuild.pdf" + savefig(image_name, dpi=iopts.dpi, iopts=iopts) + + def main(): actions = ( - ("genomebuild", "Plot genome build composite figure"), ("diversity", "Plot diversity composite figure"), + ("genomebuild", "Plot genome build composite figure"), + ("landscape", "Plot landscape composite figure"), ) p = ActionDispatcher(actions) p.dispatch(globals())