From b68641bdd85433b12ec8d0acb0ddfc5cd5cbc584 Mon Sep 17 00:00:00 2001 From: Jai Jariwala Date: Fri, 20 Sep 2024 13:10:20 -0400 Subject: [PATCH 1/2] still working on it --- .env | 1 + node_modules/.bin/mime | 1 + node_modules/.package-lock.json | 1094 + node_modules/accepts/HISTORY.md | 243 + node_modules/accepts/LICENSE | 23 + node_modules/accepts/README.md | 140 + node_modules/accepts/index.js | 238 + node_modules/accepts/package.json | 47 + node_modules/array-flatten/LICENSE | 21 + node_modules/array-flatten/README.md | 43 + node_modules/array-flatten/array-flatten.js | 64 + node_modules/array-flatten/package.json | 39 + node_modules/base64url/LICENSE | 20 + node_modules/base64url/dist/.gitkeep | 0 node_modules/base64url/dist/base64url.d.ts | 11 + node_modules/base64url/dist/base64url.js | 37 + node_modules/base64url/dist/pad-string.d.ts | 1 + node_modules/base64url/dist/pad-string.js | 20 + node_modules/base64url/index.js | 2 + node_modules/base64url/package.json | 35 + node_modules/base64url/readme.md | 127 + node_modules/bl/.jshintrc | 60 + node_modules/bl/.travis.yml | 15 + node_modules/bl/LICENSE.md | 13 + node_modules/bl/README.md | 218 + node_modules/bl/bl.js | 392 + node_modules/bl/package.json | 35 + node_modules/bl/test/indexOf.js | 463 + node_modules/bl/test/test.js | 782 + node_modules/body-parser/HISTORY.md | 672 + node_modules/body-parser/LICENSE | 23 + node_modules/body-parser/README.md | 476 + node_modules/body-parser/SECURITY.md | 25 + node_modules/body-parser/index.js | 156 + node_modules/body-parser/lib/read.js | 205 + node_modules/body-parser/lib/types/json.js | 247 + node_modules/body-parser/lib/types/raw.js | 101 + node_modules/body-parser/lib/types/text.js | 121 + .../body-parser/lib/types/urlencoded.js | 307 + node_modules/body-parser/package.json | 56 + node_modules/bson/HISTORY.md | 301 + node_modules/bson/LICENSE.md | 201 + node_modules/bson/README.md | 170 + node_modules/bson/bower.json | 26 + node_modules/bson/browser_build/bson.js | 18218 ++++++++++++++++ node_modules/bson/browser_build/package.json | 8 + node_modules/bson/index.js | 46 + node_modules/bson/lib/bson/binary.js | 384 + node_modules/bson/lib/bson/bson.js | 386 + node_modules/bson/lib/bson/code.js | 24 + node_modules/bson/lib/bson/db_ref.js | 32 + node_modules/bson/lib/bson/decimal128.js | 820 + node_modules/bson/lib/bson/double.js | 33 + node_modules/bson/lib/bson/float_parser.js | 124 + node_modules/bson/lib/bson/int_32.js | 33 + node_modules/bson/lib/bson/long.js | 865 + node_modules/bson/lib/bson/map.js | 128 + node_modules/bson/lib/bson/max_key.js | 14 + node_modules/bson/lib/bson/min_key.js | 14 + node_modules/bson/lib/bson/objectid.js | 392 + .../bson/lib/bson/parser/calculate_size.js | 255 + .../bson/lib/bson/parser/deserializer.js | 782 + .../bson/lib/bson/parser/serializer.js | 1194 + node_modules/bson/lib/bson/parser/utils.js | 28 + node_modules/bson/lib/bson/regexp.js | 33 + node_modules/bson/lib/bson/symbol.js | 50 + node_modules/bson/lib/bson/timestamp.js | 854 + node_modules/bson/package.json | 58 + node_modules/bytes/History.md | 97 + node_modules/bytes/LICENSE | 23 + node_modules/bytes/Readme.md | 152 + node_modules/bytes/index.js | 170 + node_modules/bytes/package.json | 42 + node_modules/call-bind/.eslintignore | 1 + node_modules/call-bind/.eslintrc | 16 + node_modules/call-bind/.github/FUNDING.yml | 12 + node_modules/call-bind/.nycrc | 9 + node_modules/call-bind/CHANGELOG.md | 93 + node_modules/call-bind/LICENSE | 21 + node_modules/call-bind/README.md | 64 + node_modules/call-bind/callBound.js | 15 + node_modules/call-bind/index.js | 35 + node_modules/call-bind/package.json | 95 + node_modules/call-bind/test/callBound.js | 54 + node_modules/call-bind/test/index.js | 80 + node_modules/content-disposition/HISTORY.md | 60 + node_modules/content-disposition/LICENSE | 22 + node_modules/content-disposition/README.md | 142 + node_modules/content-disposition/index.js | 458 + node_modules/content-disposition/package.json | 44 + node_modules/content-type/HISTORY.md | 29 + node_modules/content-type/LICENSE | 22 + node_modules/content-type/README.md | 94 + node_modules/content-type/index.js | 225 + node_modules/content-type/package.json | 42 + node_modules/cookie-signature/.npmignore | 4 + node_modules/cookie-signature/History.md | 38 + node_modules/cookie-signature/Readme.md | 42 + node_modules/cookie-signature/index.js | 51 + node_modules/cookie-signature/package.json | 18 + node_modules/cookie/HISTORY.md | 147 + node_modules/cookie/LICENSE | 24 + node_modules/cookie/README.md | 317 + node_modules/cookie/SECURITY.md | 25 + node_modules/cookie/index.js | 274 + node_modules/cookie/package.json | 44 + node_modules/core-util-is/LICENSE | 19 + node_modules/core-util-is/README.md | 3 + node_modules/core-util-is/lib/util.js | 107 + node_modules/core-util-is/package.json | 38 + node_modules/debug/.coveralls.yml | 1 + node_modules/debug/.eslintrc | 11 + node_modules/debug/.npmignore | 9 + node_modules/debug/.travis.yml | 14 + node_modules/debug/CHANGELOG.md | 362 + node_modules/debug/LICENSE | 19 + node_modules/debug/Makefile | 50 + node_modules/debug/README.md | 312 + node_modules/debug/component.json | 19 + node_modules/debug/karma.conf.js | 70 + node_modules/debug/node.js | 1 + node_modules/debug/package.json | 49 + node_modules/debug/src/browser.js | 185 + node_modules/debug/src/debug.js | 202 + node_modules/debug/src/index.js | 10 + node_modules/debug/src/inspector-log.js | 15 + node_modules/debug/src/node.js | 248 + node_modules/define-data-property/.eslintrc | 24 + .../define-data-property/.github/FUNDING.yml | 12 + node_modules/define-data-property/.nycrc | 13 + .../define-data-property/CHANGELOG.md | 70 + node_modules/define-data-property/LICENSE | 21 + node_modules/define-data-property/README.md | 67 + node_modules/define-data-property/index.d.ts | 12 + node_modules/define-data-property/index.js | 56 + .../define-data-property/package.json | 106 + .../define-data-property/test/index.js | 392 + .../define-data-property/tsconfig.json | 59 + node_modules/denque/CHANGELOG.md | 8 + node_modules/denque/LICENSE | 13 + node_modules/denque/README.md | 77 + node_modules/denque/index.d.ts | 31 + node_modules/denque/index.js | 443 + node_modules/denque/package.json | 55 + node_modules/depd/History.md | 103 + node_modules/depd/LICENSE | 22 + node_modules/depd/Readme.md | 280 + node_modules/depd/index.js | 538 + node_modules/depd/lib/browser/index.js | 77 + node_modules/depd/package.json | 45 + node_modules/destroy/LICENSE | 23 + node_modules/destroy/README.md | 63 + node_modules/destroy/index.js | 209 + node_modules/destroy/package.json | 48 + node_modules/dotenv/CHANGELOG.md | 475 + node_modules/dotenv/LICENSE | 23 + node_modules/dotenv/README-es.md | 448 + node_modules/dotenv/README.md | 728 + node_modules/dotenv/config.d.ts | 1 + node_modules/dotenv/config.js | 9 + node_modules/dotenv/lib/cli-options.js | 11 + node_modules/dotenv/lib/env-options.js | 24 + node_modules/dotenv/lib/main.d.ts | 153 + node_modules/dotenv/lib/main.js | 361 + node_modules/dotenv/package.json | 65 + node_modules/ee-first/LICENSE | 22 + node_modules/ee-first/README.md | 80 + node_modules/ee-first/index.js | 95 + node_modules/ee-first/package.json | 29 + node_modules/encodeurl/LICENSE | 22 + node_modules/encodeurl/README.md | 109 + node_modules/encodeurl/index.js | 60 + node_modules/encodeurl/package.json | 40 + node_modules/es-define-property/.eslintrc | 13 + .../es-define-property/.github/FUNDING.yml | 12 + node_modules/es-define-property/.nycrc | 9 + node_modules/es-define-property/CHANGELOG.md | 15 + node_modules/es-define-property/LICENSE | 21 + node_modules/es-define-property/README.md | 49 + node_modules/es-define-property/index.d.ts | 3 + node_modules/es-define-property/index.js | 16 + node_modules/es-define-property/package.json | 81 + node_modules/es-define-property/test/index.js | 55 + node_modules/es-define-property/tsconfig.json | 50 + node_modules/es-errors/.eslintrc | 5 + node_modules/es-errors/.github/FUNDING.yml | 12 + node_modules/es-errors/CHANGELOG.md | 40 + node_modules/es-errors/LICENSE | 21 + node_modules/es-errors/README.md | 55 + node_modules/es-errors/eval.d.ts | 3 + node_modules/es-errors/eval.js | 4 + node_modules/es-errors/index.d.ts | 3 + node_modules/es-errors/index.js | 4 + node_modules/es-errors/package.json | 80 + node_modules/es-errors/range.d.ts | 3 + node_modules/es-errors/range.js | 4 + node_modules/es-errors/ref.d.ts | 3 + node_modules/es-errors/ref.js | 4 + node_modules/es-errors/syntax.d.ts | 3 + node_modules/es-errors/syntax.js | 4 + node_modules/es-errors/test/index.js | 19 + node_modules/es-errors/tsconfig.json | 49 + node_modules/es-errors/type.d.ts | 3 + node_modules/es-errors/type.js | 4 + node_modules/es-errors/uri.d.ts | 3 + node_modules/es-errors/uri.js | 4 + node_modules/escape-html/LICENSE | 24 + node_modules/escape-html/Readme.md | 43 + node_modules/escape-html/index.js | 78 + node_modules/escape-html/package.json | 24 + node_modules/etag/HISTORY.md | 83 + node_modules/etag/LICENSE | 22 + node_modules/etag/README.md | 159 + node_modules/etag/index.js | 131 + node_modules/etag/package.json | 47 + node_modules/express-session/HISTORY.md | 456 + node_modules/express-session/LICENSE | 24 + node_modules/express-session/README.md | 1032 + node_modules/express-session/index.js | 693 + .../node_modules/cookie-signature/History.md | 42 + .../node_modules/cookie-signature/Readme.md | 42 + .../node_modules/cookie-signature/index.js | 51 + .../cookie-signature/package.json | 18 + node_modules/express-session/package.json | 47 + .../express-session/session/cookie.js | 152 + .../express-session/session/memory.js | 187 + .../express-session/session/session.js | 143 + node_modules/express-session/session/store.js | 102 + node_modules/express/History.md | 3642 +++ node_modules/express/LICENSE | 24 + node_modules/express/Readme.md | 260 + node_modules/express/index.js | 11 + node_modules/express/lib/application.js | 661 + node_modules/express/lib/express.js | 116 + node_modules/express/lib/middleware/init.js | 43 + node_modules/express/lib/middleware/query.js | 47 + node_modules/express/lib/request.js | 525 + node_modules/express/lib/response.js | 1179 + node_modules/express/lib/router/index.js | 673 + node_modules/express/lib/router/layer.js | 181 + node_modules/express/lib/router/route.js | 230 + node_modules/express/lib/utils.js | 303 + node_modules/express/lib/view.js | 182 + node_modules/express/package.json | 98 + node_modules/finalhandler/HISTORY.md | 210 + node_modules/finalhandler/LICENSE | 22 + node_modules/finalhandler/README.md | 147 + node_modules/finalhandler/SECURITY.md | 25 + node_modules/finalhandler/index.js | 341 + node_modules/finalhandler/package.json | 47 + node_modules/forwarded/HISTORY.md | 21 + node_modules/forwarded/LICENSE | 22 + node_modules/forwarded/README.md | 57 + node_modules/forwarded/index.js | 90 + node_modules/forwarded/package.json | 45 + node_modules/fresh/HISTORY.md | 70 + node_modules/fresh/LICENSE | 23 + node_modules/fresh/README.md | 119 + node_modules/fresh/index.js | 137 + node_modules/fresh/package.json | 46 + node_modules/function-bind/.eslintrc | 21 + .../function-bind/.github/FUNDING.yml | 12 + .../function-bind/.github/SECURITY.md | 3 + node_modules/function-bind/.nycrc | 13 + node_modules/function-bind/CHANGELOG.md | 136 + node_modules/function-bind/LICENSE | 20 + node_modules/function-bind/README.md | 46 + node_modules/function-bind/implementation.js | 84 + node_modules/function-bind/index.js | 5 + node_modules/function-bind/package.json | 87 + node_modules/function-bind/test/.eslintrc | 9 + node_modules/function-bind/test/index.js | 252 + node_modules/get-intrinsic/.eslintrc | 38 + .../get-intrinsic/.github/FUNDING.yml | 12 + node_modules/get-intrinsic/.nycrc | 9 + node_modules/get-intrinsic/CHANGELOG.md | 143 + node_modules/get-intrinsic/LICENSE | 21 + node_modules/get-intrinsic/README.md | 71 + node_modules/get-intrinsic/index.js | 359 + node_modules/get-intrinsic/package.json | 93 + .../get-intrinsic/test/GetIntrinsic.js | 274 + node_modules/gopd/.eslintrc | 16 + node_modules/gopd/.github/FUNDING.yml | 12 + node_modules/gopd/CHANGELOG.md | 25 + node_modules/gopd/LICENSE | 21 + node_modules/gopd/README.md | 40 + node_modules/gopd/index.js | 16 + node_modules/gopd/package.json | 71 + node_modules/gopd/test/index.js | 35 + .../has-property-descriptors/.eslintrc | 13 + .../.github/FUNDING.yml | 12 + node_modules/has-property-descriptors/.nycrc | 9 + .../has-property-descriptors/CHANGELOG.md | 35 + node_modules/has-property-descriptors/LICENSE | 21 + .../has-property-descriptors/README.md | 43 + .../has-property-descriptors/index.js | 22 + .../has-property-descriptors/package.json | 77 + .../has-property-descriptors/test/index.js | 57 + node_modules/has-proto/.eslintrc | 5 + node_modules/has-proto/.github/FUNDING.yml | 12 + node_modules/has-proto/CHANGELOG.md | 38 + node_modules/has-proto/LICENSE | 21 + node_modules/has-proto/README.md | 38 + node_modules/has-proto/index.d.ts | 3 + node_modules/has-proto/index.js | 15 + node_modules/has-proto/package.json | 78 + node_modules/has-proto/test/index.js | 19 + node_modules/has-proto/tsconfig.json | 49 + node_modules/has-symbols/.eslintrc | 11 + node_modules/has-symbols/.github/FUNDING.yml | 12 + node_modules/has-symbols/.nycrc | 9 + node_modules/has-symbols/CHANGELOG.md | 75 + node_modules/has-symbols/LICENSE | 21 + node_modules/has-symbols/README.md | 46 + node_modules/has-symbols/index.js | 13 + node_modules/has-symbols/package.json | 101 + node_modules/has-symbols/shams.js | 42 + node_modules/has-symbols/test/index.js | 22 + .../has-symbols/test/shams/core-js.js | 28 + .../test/shams/get-own-property-symbols.js | 28 + node_modules/has-symbols/test/tests.js | 56 + node_modules/hasown/.eslintrc | 5 + node_modules/hasown/.github/FUNDING.yml | 12 + node_modules/hasown/.nycrc | 13 + node_modules/hasown/CHANGELOG.md | 40 + node_modules/hasown/LICENSE | 21 + node_modules/hasown/README.md | 40 + node_modules/hasown/index.d.ts | 3 + node_modules/hasown/index.js | 8 + node_modules/hasown/package.json | 92 + node_modules/hasown/tsconfig.json | 6 + node_modules/http-errors/HISTORY.md | 180 + node_modules/http-errors/LICENSE | 23 + node_modules/http-errors/README.md | 169 + node_modules/http-errors/index.js | 289 + node_modules/http-errors/package.json | 50 + node_modules/iconv-lite/Changelog.md | 162 + node_modules/iconv-lite/LICENSE | 21 + node_modules/iconv-lite/README.md | 156 + .../iconv-lite/encodings/dbcs-codec.js | 555 + .../iconv-lite/encodings/dbcs-data.js | 176 + node_modules/iconv-lite/encodings/index.js | 22 + node_modules/iconv-lite/encodings/internal.js | 188 + .../iconv-lite/encodings/sbcs-codec.js | 72 + .../encodings/sbcs-data-generated.js | 451 + .../iconv-lite/encodings/sbcs-data.js | 174 + .../encodings/tables/big5-added.json | 122 + .../iconv-lite/encodings/tables/cp936.json | 264 + .../iconv-lite/encodings/tables/cp949.json | 273 + .../iconv-lite/encodings/tables/cp950.json | 177 + .../iconv-lite/encodings/tables/eucjp.json | 182 + .../encodings/tables/gb18030-ranges.json | 1 + .../encodings/tables/gbk-added.json | 55 + .../iconv-lite/encodings/tables/shiftjis.json | 125 + node_modules/iconv-lite/encodings/utf16.js | 177 + node_modules/iconv-lite/encodings/utf7.js | 290 + node_modules/iconv-lite/lib/bom-handling.js | 52 + node_modules/iconv-lite/lib/extend-node.js | 217 + node_modules/iconv-lite/lib/index.d.ts | 24 + node_modules/iconv-lite/lib/index.js | 153 + node_modules/iconv-lite/lib/streams.js | 121 + node_modules/iconv-lite/package.json | 46 + node_modules/inherits/LICENSE | 16 + node_modules/inherits/README.md | 42 + node_modules/inherits/inherits.js | 9 + node_modules/inherits/inherits_browser.js | 27 + node_modules/inherits/package.json | 29 + node_modules/ipaddr.js/LICENSE | 19 + node_modules/ipaddr.js/README.md | 233 + node_modules/ipaddr.js/ipaddr.min.js | 1 + node_modules/ipaddr.js/lib/ipaddr.js | 673 + node_modules/ipaddr.js/lib/ipaddr.js.d.ts | 68 + node_modules/ipaddr.js/package.json | 35 + node_modules/isarray/.npmignore | 1 + node_modules/isarray/.travis.yml | 4 + node_modules/isarray/Makefile | 6 + node_modules/isarray/README.md | 60 + node_modules/isarray/component.json | 19 + node_modules/isarray/index.js | 5 + node_modules/isarray/package.json | 45 + node_modules/isarray/test.js | 20 + node_modules/media-typer/HISTORY.md | 22 + node_modules/media-typer/LICENSE | 22 + node_modules/media-typer/README.md | 81 + node_modules/media-typer/index.js | 270 + node_modules/media-typer/package.json | 26 + node_modules/memory-pager/.travis.yml | 4 + node_modules/memory-pager/LICENSE | 21 + node_modules/memory-pager/README.md | 65 + node_modules/memory-pager/index.js | 160 + node_modules/memory-pager/package.json | 24 + node_modules/memory-pager/test.js | 80 + node_modules/merge-descriptors/HISTORY.md | 21 + node_modules/merge-descriptors/LICENSE | 23 + node_modules/merge-descriptors/README.md | 49 + node_modules/merge-descriptors/index.js | 60 + node_modules/merge-descriptors/package.json | 39 + node_modules/methods/HISTORY.md | 29 + node_modules/methods/LICENSE | 24 + node_modules/methods/README.md | 51 + node_modules/methods/index.js | 69 + node_modules/methods/package.json | 36 + node_modules/mime-db/HISTORY.md | 507 + node_modules/mime-db/LICENSE | 23 + node_modules/mime-db/README.md | 100 + node_modules/mime-db/db.json | 8519 ++++++++ node_modules/mime-db/index.js | 12 + node_modules/mime-db/package.json | 60 + node_modules/mime-types/HISTORY.md | 397 + node_modules/mime-types/LICENSE | 23 + node_modules/mime-types/README.md | 113 + node_modules/mime-types/index.js | 188 + node_modules/mime-types/package.json | 44 + node_modules/mime/.npmignore | 0 node_modules/mime/CHANGELOG.md | 164 + node_modules/mime/LICENSE | 21 + node_modules/mime/README.md | 90 + node_modules/mime/cli.js | 8 + node_modules/mime/mime.js | 108 + node_modules/mime/package.json | 44 + node_modules/mime/src/build.js | 53 + node_modules/mime/src/test.js | 60 + node_modules/mime/types.json | 1 + node_modules/mongodb/LICENSE.md | 201 + node_modules/mongodb/README.md | 493 + node_modules/mongodb/index.js | 77 + node_modules/mongodb/lib/admin.js | 296 + .../mongodb/lib/aggregation_cursor.js | 369 + node_modules/mongodb/lib/apm.js | 31 + node_modules/mongodb/lib/async/.eslintrc | 5 + .../mongodb/lib/async/async_iterator.js | 33 + node_modules/mongodb/lib/bulk/common.js | 1401 ++ node_modules/mongodb/lib/bulk/ordered.js | 110 + node_modules/mongodb/lib/bulk/unordered.js | 131 + node_modules/mongodb/lib/change_stream.js | 623 + node_modules/mongodb/lib/cmap/connection.js | 416 + .../mongodb/lib/cmap/connection_pool.js | 593 + node_modules/mongodb/lib/cmap/errors.js | 35 + node_modules/mongodb/lib/cmap/events.js | 154 + .../mongodb/lib/cmap/message_stream.js | 196 + .../mongodb/lib/cmap/stream_description.js | 45 + node_modules/mongodb/lib/collection.js | 2249 ++ node_modules/mongodb/lib/command_cursor.js | 269 + node_modules/mongodb/lib/command_utils.js | 124 + node_modules/mongodb/lib/constants.js | 10 + .../mongodb/lib/core/auth/auth_provider.js | 55 + .../lib/core/auth/defaultAuthProviders.js | 29 + node_modules/mongodb/lib/core/auth/gssapi.js | 151 + .../lib/core/auth/mongo_credentials.js | 110 + node_modules/mongodb/lib/core/auth/mongocr.js | 45 + .../mongodb/lib/core/auth/mongodb_aws.js | 258 + node_modules/mongodb/lib/core/auth/plain.js | 28 + node_modules/mongodb/lib/core/auth/scram.js | 348 + node_modules/mongodb/lib/core/auth/x509.js | 35 + .../mongodb/lib/core/connection/apm.js | 138 + .../lib/core/connection/command_result.js | 36 + .../mongodb/lib/core/connection/commands.js | 516 + .../mongodb/lib/core/connection/connect.js | 372 + .../mongodb/lib/core/connection/connection.js | 716 + .../mongodb/lib/core/connection/logger.js | 252 + .../mongodb/lib/core/connection/msg.js | 233 + .../mongodb/lib/core/connection/pool.js | 1286 ++ .../mongodb/lib/core/connection/utils.js | 85 + node_modules/mongodb/lib/core/cursor.js | 881 + node_modules/mongodb/lib/core/error.js | 356 + node_modules/mongodb/lib/core/index.js | 60 + node_modules/mongodb/lib/core/sdam/common.js | 67 + node_modules/mongodb/lib/core/sdam/events.js | 124 + node_modules/mongodb/lib/core/sdam/monitor.js | 428 + node_modules/mongodb/lib/core/sdam/server.js | 573 + .../lib/core/sdam/server_description.js | 231 + .../mongodb/lib/core/sdam/server_selection.js | 238 + .../mongodb/lib/core/sdam/srv_polling.js | 135 + .../mongodb/lib/core/sdam/topology.js | 1161 + .../lib/core/sdam/topology_description.js | 460 + node_modules/mongodb/lib/core/sessions.js | 784 + .../mongodb/lib/core/tools/smoke_plugin.js | 62 + .../mongodb/lib/core/topologies/mongos.js | 1398 ++ .../lib/core/topologies/read_preference.js | 267 + .../mongodb/lib/core/topologies/replset.js | 1566 ++ .../lib/core/topologies/replset_state.js | 1123 + .../mongodb/lib/core/topologies/server.js | 996 + .../mongodb/lib/core/topologies/shared.js | 459 + node_modules/mongodb/lib/core/transactions.js | 183 + node_modules/mongodb/lib/core/uri_parser.js | 747 + node_modules/mongodb/lib/core/utils.js | 295 + .../mongodb/lib/core/wireprotocol/command.js | 206 + .../lib/core/wireprotocol/compression.js | 73 + .../lib/core/wireprotocol/constants.js | 13 + .../mongodb/lib/core/wireprotocol/get_more.js | 95 + .../mongodb/lib/core/wireprotocol/index.js | 18 + .../lib/core/wireprotocol/kill_cursors.js | 76 + .../mongodb/lib/core/wireprotocol/query.js | 240 + .../mongodb/lib/core/wireprotocol/shared.js | 116 + .../lib/core/wireprotocol/write_command.js | 59 + node_modules/mongodb/lib/cursor.js | 1151 + node_modules/mongodb/lib/db.js | 1065 + node_modules/mongodb/lib/dynamic_loaders.js | 32 + node_modules/mongodb/lib/encrypter.js | 168 + node_modules/mongodb/lib/error.js | 44 + node_modules/mongodb/lib/error_codes.js | 36 + node_modules/mongodb/lib/explain.js | 48 + .../mongodb/lib/gridfs-stream/download.js | 433 + .../mongodb/lib/gridfs-stream/index.js | 374 + .../mongodb/lib/gridfs-stream/upload.js | 548 + node_modules/mongodb/lib/gridfs/chunk.js | 236 + node_modules/mongodb/lib/gridfs/grid_store.js | 1925 ++ node_modules/mongodb/lib/mongo_client.js | 522 + .../mongodb/lib/operations/add_user.js | 99 + .../mongodb/lib/operations/admin_ops.js | 62 + .../mongodb/lib/operations/aggregate.js | 104 + .../mongodb/lib/operations/bulk_write.js | 79 + .../mongodb/lib/operations/collection_ops.js | 353 + .../mongodb/lib/operations/collections.js | 55 + .../mongodb/lib/operations/command.js | 122 + .../mongodb/lib/operations/command_v2.js | 125 + .../lib/operations/common_functions.js | 399 + .../mongodb/lib/operations/connect.js | 784 + node_modules/mongodb/lib/operations/count.js | 68 + .../mongodb/lib/operations/count_documents.js | 41 + .../lib/operations/create_collection.js | 102 + .../mongodb/lib/operations/create_indexes.js | 137 + .../mongodb/lib/operations/cursor_ops.js | 167 + node_modules/mongodb/lib/operations/db_ops.js | 474 + .../mongodb/lib/operations/delete_many.js | 38 + .../mongodb/lib/operations/delete_one.js | 38 + .../mongodb/lib/operations/distinct.js | 93 + node_modules/mongodb/lib/operations/drop.js | 53 + .../mongodb/lib/operations/drop_index.js | 42 + .../mongodb/lib/operations/drop_indexes.js | 23 + .../operations/estimated_document_count.js | 87 + .../operations/execute_db_admin_command.js | 34 + .../lib/operations/execute_operation.js | 164 + node_modules/mongodb/lib/operations/find.js | 49 + .../mongodb/lib/operations/find_and_modify.js | 128 + .../mongodb/lib/operations/find_one.js | 41 + .../lib/operations/find_one_and_delete.js | 21 + .../lib/operations/find_one_and_replace.js | 37 + .../lib/operations/find_one_and_update.js | 37 + .../lib/operations/geo_haystack_search.js | 79 + .../mongodb/lib/operations/index_exists.js | 39 + .../lib/operations/index_information.js | 23 + .../mongodb/lib/operations/indexes.js | 22 + .../mongodb/lib/operations/insert_many.js | 59 + .../mongodb/lib/operations/insert_one.js | 39 + .../mongodb/lib/operations/is_capped.js | 19 + .../lib/operations/list_collections.js | 106 + .../mongodb/lib/operations/list_databases.js | 38 + .../mongodb/lib/operations/list_indexes.js | 42 + .../mongodb/lib/operations/map_reduce.js | 209 + .../mongodb/lib/operations/operation.js | 76 + .../lib/operations/options_operation.js | 32 + .../mongodb/lib/operations/profiling_level.js | 31 + .../mongodb/lib/operations/re_index.js | 33 + .../mongodb/lib/operations/remove_user.js | 52 + node_modules/mongodb/lib/operations/rename.js | 61 + .../mongodb/lib/operations/replace_one.js | 54 + .../mongodb/lib/operations/run_command.js | 19 + .../lib/operations/set_profiling_level.js | 48 + node_modules/mongodb/lib/operations/stats.js | 45 + .../mongodb/lib/operations/update_many.js | 55 + .../mongodb/lib/operations/update_one.js | 55 + .../lib/operations/validate_collection.js | 39 + node_modules/mongodb/lib/read_concern.js | 61 + node_modules/mongodb/lib/topologies/mongos.js | 446 + .../mongodb/lib/topologies/native_topology.js | 82 + .../mongodb/lib/topologies/replset.js | 490 + node_modules/mongodb/lib/topologies/server.js | 449 + .../mongodb/lib/topologies/topology_base.js | 417 + node_modules/mongodb/lib/url_parser.js | 637 + node_modules/mongodb/lib/utils.js | 997 + node_modules/mongodb/lib/write_concern.js | 94 + node_modules/mongodb/package.json | 111 + node_modules/ms/index.js | 152 + node_modules/ms/license.md | 21 + node_modules/ms/package.json | 37 + node_modules/ms/readme.md | 51 + node_modules/negotiator/HISTORY.md | 108 + node_modules/negotiator/LICENSE | 24 + node_modules/negotiator/README.md | 203 + node_modules/negotiator/index.js | 82 + node_modules/negotiator/lib/charset.js | 169 + node_modules/negotiator/lib/encoding.js | 184 + node_modules/negotiator/lib/language.js | 179 + node_modules/negotiator/lib/mediaType.js | 294 + node_modules/negotiator/package.json | 42 + node_modules/oauth/LICENSE | 8 + node_modules/oauth/Makefile | 7 + node_modules/oauth/Readme.md | 193 + .../oauth/examples/express-gdata/server.js | 168 + .../express-gdata/views/google_calendars.ejs | 21 + .../express-gdata/views/google_contacts.ejs | 24 + .../examples/express-gdata/views/layout.ejs | 9 + node_modules/oauth/examples/github-example.js | 73 + .../oauth/examples/term.ie.oauth-HMAC-SHA1.js | 31 + .../oauth/examples/twitter-example.js | 75 + node_modules/oauth/index.js | 3 + node_modules/oauth/lib/_utils.js | 4 + node_modules/oauth/lib/oauth.js | 581 + node_modules/oauth/lib/oauth2.js | 233 + node_modules/oauth/lib/sha1.js | 334 + node_modules/oauth/package.json | 21 + node_modules/oauth/tests/oauth2tests.js | 304 + node_modules/oauth/tests/oauthtests.js | 1064 + node_modules/oauth/tests/sha1tests.js | 13 + node_modules/oauth/tests/shared.js | 26 + node_modules/object-inspect/.eslintrc | 53 + .../object-inspect/.github/FUNDING.yml | 12 + node_modules/object-inspect/.nycrc | 13 + node_modules/object-inspect/CHANGELOG.md | 404 + node_modules/object-inspect/LICENSE | 21 + node_modules/object-inspect/example/all.js | 23 + .../object-inspect/example/circular.js | 6 + node_modules/object-inspect/example/fn.js | 5 + .../object-inspect/example/inspect.js | 10 + node_modules/object-inspect/index.js | 527 + .../object-inspect/package-support.json | 20 + node_modules/object-inspect/package.json | 104 + node_modules/object-inspect/readme.markdown | 84 + node_modules/object-inspect/test-core-js.js | 26 + node_modules/object-inspect/test/bigint.js | 58 + .../object-inspect/test/browser/dom.js | 15 + node_modules/object-inspect/test/circular.js | 16 + node_modules/object-inspect/test/deep.js | 12 + node_modules/object-inspect/test/element.js | 53 + node_modules/object-inspect/test/err.js | 48 + node_modules/object-inspect/test/fakes.js | 29 + node_modules/object-inspect/test/fn.js | 76 + node_modules/object-inspect/test/global.js | 17 + node_modules/object-inspect/test/has.js | 15 + node_modules/object-inspect/test/holes.js | 15 + .../object-inspect/test/indent-option.js | 271 + node_modules/object-inspect/test/inspect.js | 139 + node_modules/object-inspect/test/lowbyte.js | 12 + node_modules/object-inspect/test/number.js | 58 + .../object-inspect/test/quoteStyle.js | 17 + .../object-inspect/test/toStringTag.js | 40 + node_modules/object-inspect/test/undef.js | 12 + node_modules/object-inspect/test/values.js | 211 + node_modules/object-inspect/util.inspect.js | 1 + node_modules/on-finished/HISTORY.md | 98 + node_modules/on-finished/LICENSE | 23 + node_modules/on-finished/README.md | 162 + node_modules/on-finished/index.js | 234 + node_modules/on-finished/package.json | 39 + node_modules/on-headers/HISTORY.md | 21 + node_modules/on-headers/LICENSE | 22 + node_modules/on-headers/README.md | 81 + node_modules/on-headers/index.js | 132 + node_modules/on-headers/package.json | 42 + node_modules/optional-require/README.md | 89 + node_modules/optional-require/dist/index.d.ts | 138 + node_modules/optional-require/dist/index.js | 204 + .../optional-require/dist/index.js.map | 1 + node_modules/optional-require/index.d.ts | 5 + node_modules/optional-require/index.js | 32 + node_modules/optional-require/package.json | 38 + node_modules/parseurl/HISTORY.md | 58 + node_modules/parseurl/LICENSE | 24 + node_modules/parseurl/README.md | 133 + node_modules/parseurl/index.js | 158 + node_modules/parseurl/package.json | 40 + .../.github/ISSUE_TEMPLATE.md | 54 + .../.github/PULL_REQUEST_TEMPLATE.md | 41 + .../passport-google-oauth20/.npmignore | 8 + .../passport-google-oauth20/CONTRIBUTING.md | 20 + node_modules/passport-google-oauth20/LICENSE | 20 + .../passport-google-oauth20/README.md | 108 + .../lib/errors/googleplusapierror.js | 25 + .../lib/errors/userinfoerror.js | 22 + .../passport-google-oauth20/lib/index.js | 9 + .../lib/profile/googleplus.js | 47 + .../lib/profile/openid.js | 40 + .../passport-google-oauth20/lib/strategy.js | 199 + .../passport-google-oauth20/package.json | 48 + .../passport-oauth2/.github/FUNDING.yml | 1 + node_modules/passport-oauth2/CHANGELOG.md | 36 + node_modules/passport-oauth2/LICENSE | 20 + node_modules/passport-oauth2/README.md | 129 + .../lib/errors/authorizationerror.js | 44 + .../lib/errors/internaloautherror.js | 49 + .../passport-oauth2/lib/errors/tokenerror.js | 36 + node_modules/passport-oauth2/lib/index.js | 16 + .../passport-oauth2/lib/state/null.js | 13 + .../passport-oauth2/lib/state/pkcesession.js | 89 + .../passport-oauth2/lib/state/session.js | 85 + .../passport-oauth2/lib/state/store.js | 88 + node_modules/passport-oauth2/lib/strategy.js | 429 + node_modules/passport-oauth2/lib/utils.js | 32 + node_modules/passport-oauth2/package.json | 59 + node_modules/passport-strategy/.jshintrc | 20 + node_modules/passport-strategy/.travis.yml | 15 + node_modules/passport-strategy/LICENSE | 20 + node_modules/passport-strategy/README.md | 61 + node_modules/passport-strategy/lib/index.js | 15 + .../passport-strategy/lib/strategy.js | 28 + node_modules/passport-strategy/package.json | 50 + node_modules/passport/CHANGELOG.md | 82 + node_modules/passport/LICENSE | 20 + node_modules/passport/README.md | 185 + node_modules/passport/etc/jsdoc.json | 3 + node_modules/passport/lib/authenticator.js | 486 + .../lib/errors/authenticationerror.js | 20 + .../passport/lib/framework/connect.js | 22 + node_modules/passport/lib/http/request.js | 92 + node_modules/passport/lib/index.js | 24 + .../passport/lib/middleware/authenticate.js | 381 + .../passport/lib/middleware/initialize.js | 100 + node_modules/passport/lib/sessionmanager.js | 96 + .../passport/lib/strategies/session.js | 131 + node_modules/passport/package.json | 56 + .../passport/sponsors/descope-dark.svg | 79 + node_modules/passport/sponsors/descope.svg | 89 + node_modules/passport/sponsors/fusionauth.png | Bin 0 -> 43250 bytes node_modules/passport/sponsors/fusionauth.svg | 171 + .../passport/sponsors/loginradius.png | Bin 0 -> 10888 bytes node_modules/passport/sponsors/snyk.png | Bin 0 -> 11285 bytes node_modules/passport/sponsors/workos.png | Bin 0 -> 6854 bytes node_modules/path-to-regexp/LICENSE | 21 + node_modules/path-to-regexp/Readme.md | 35 + node_modules/path-to-regexp/index.js | 146 + node_modules/path-to-regexp/package.json | 30 + node_modules/pause/.npmignore | 4 + node_modules/pause/History.md | 5 + node_modules/pause/Makefile | 7 + node_modules/pause/Readme.md | 29 + node_modules/pause/index.js | 29 + node_modules/pause/package.json | 13 + node_modules/process-nextick-args/index.js | 45 + node_modules/process-nextick-args/license.md | 19 + .../process-nextick-args/package.json | 25 + node_modules/process-nextick-args/readme.md | 18 + node_modules/proxy-addr/HISTORY.md | 161 + node_modules/proxy-addr/LICENSE | 22 + node_modules/proxy-addr/README.md | 139 + node_modules/proxy-addr/index.js | 327 + node_modules/proxy-addr/package.json | 47 + node_modules/qs/.editorconfig | 46 + node_modules/qs/.eslintrc | 38 + node_modules/qs/.github/FUNDING.yml | 12 + node_modules/qs/.nycrc | 13 + node_modules/qs/CHANGELOG.md | 600 + node_modules/qs/LICENSE.md | 29 + node_modules/qs/README.md | 709 + node_modules/qs/dist/qs.js | 90 + node_modules/qs/lib/formats.js | 23 + node_modules/qs/lib/index.js | 11 + node_modules/qs/lib/parse.js | 296 + node_modules/qs/lib/stringify.js | 351 + node_modules/qs/lib/utils.js | 265 + node_modules/qs/package.json | 91 + node_modules/qs/test/empty-keys-cases.js | 267 + node_modules/qs/test/parse.js | 1170 + node_modules/qs/test/stringify.js | 1298 ++ node_modules/qs/test/utils.js | 136 + node_modules/random-bytes/HISTORY.md | 4 + node_modules/random-bytes/LICENSE | 21 + node_modules/random-bytes/README.md | 77 + node_modules/random-bytes/index.js | 101 + node_modules/random-bytes/package.json | 36 + node_modules/range-parser/HISTORY.md | 56 + node_modules/range-parser/LICENSE | 23 + node_modules/range-parser/README.md | 84 + node_modules/range-parser/index.js | 162 + node_modules/range-parser/package.json | 44 + node_modules/raw-body/HISTORY.md | 308 + node_modules/raw-body/LICENSE | 22 + node_modules/raw-body/README.md | 223 + node_modules/raw-body/SECURITY.md | 24 + node_modules/raw-body/index.d.ts | 87 + node_modules/raw-body/index.js | 336 + node_modules/raw-body/package.json | 49 + node_modules/readable-stream/.travis.yml | 34 + node_modules/readable-stream/CONTRIBUTING.md | 38 + node_modules/readable-stream/GOVERNANCE.md | 136 + node_modules/readable-stream/LICENSE | 47 + node_modules/readable-stream/README.md | 58 + .../doc/wg-meetings/2015-01-30.md | 60 + .../readable-stream/duplex-browser.js | 1 + node_modules/readable-stream/duplex.js | 1 + .../readable-stream/lib/_stream_duplex.js | 131 + .../lib/_stream_passthrough.js | 47 + .../readable-stream/lib/_stream_readable.js | 1019 + .../readable-stream/lib/_stream_transform.js | 214 + .../readable-stream/lib/_stream_writable.js | 685 + .../lib/internal/streams/BufferList.js | 78 + .../lib/internal/streams/destroy.js | 84 + .../lib/internal/streams/stream-browser.js | 1 + .../lib/internal/streams/stream.js | 1 + .../node_modules/safe-buffer/LICENSE | 21 + .../node_modules/safe-buffer/README.md | 584 + .../node_modules/safe-buffer/index.d.ts | 187 + .../node_modules/safe-buffer/index.js | 62 + .../node_modules/safe-buffer/package.json | 37 + node_modules/readable-stream/package.json | 52 + node_modules/readable-stream/passthrough.js | 1 + .../readable-stream/readable-browser.js | 7 + node_modules/readable-stream/readable.js | 19 + node_modules/readable-stream/transform.js | 1 + .../readable-stream/writable-browser.js | 1 + node_modules/readable-stream/writable.js | 8 + node_modules/require-at/README.md | 85 + node_modules/require-at/create-require.js | 43 + node_modules/require-at/package.json | 30 + node_modules/require-at/require-at.js | 40 + node_modules/safe-buffer/LICENSE | 21 + node_modules/safe-buffer/README.md | 584 + node_modules/safe-buffer/index.d.ts | 187 + node_modules/safe-buffer/index.js | 65 + node_modules/safe-buffer/package.json | 51 + node_modules/safer-buffer/LICENSE | 21 + node_modules/safer-buffer/Porting-Buffer.md | 268 + node_modules/safer-buffer/Readme.md | 156 + node_modules/safer-buffer/dangerous.js | 58 + node_modules/safer-buffer/package.json | 34 + node_modules/safer-buffer/safer.js | 77 + node_modules/safer-buffer/tests.js | 406 + node_modules/saslprep/.editorconfig | 10 + node_modules/saslprep/.gitattributes | 1 + node_modules/saslprep/.travis.yml | 10 + node_modules/saslprep/CHANGELOG.md | 19 + node_modules/saslprep/LICENSE | 22 + node_modules/saslprep/code-points.mem | Bin 0 -> 419864 bytes node_modules/saslprep/generate-code-points.js | 51 + node_modules/saslprep/index.js | 157 + node_modules/saslprep/lib/code-points.js | 996 + .../saslprep/lib/memory-code-points.js | 39 + node_modules/saslprep/lib/util.js | 21 + node_modules/saslprep/package.json | 72 + node_modules/saslprep/readme.md | 31 + node_modules/saslprep/test/index.js | 76 + node_modules/saslprep/test/util.js | 16 + node_modules/send/HISTORY.md | 526 + node_modules/send/LICENSE | 23 + node_modules/send/README.md | 327 + node_modules/send/SECURITY.md | 24 + node_modules/send/index.js | 1142 + .../send/node_modules/encodeurl/HISTORY.md | 14 + .../send/node_modules/encodeurl/LICENSE | 22 + .../send/node_modules/encodeurl/README.md | 128 + .../send/node_modules/encodeurl/index.js | 60 + .../send/node_modules/encodeurl/package.json | 40 + node_modules/send/node_modules/ms/index.js | 162 + node_modules/send/node_modules/ms/license.md | 21 + .../send/node_modules/ms/package.json | 38 + node_modules/send/node_modules/ms/readme.md | 59 + node_modules/send/package.json | 62 + node_modules/serve-static/HISTORY.md | 487 + node_modules/serve-static/LICENSE | 25 + node_modules/serve-static/README.md | 257 + node_modules/serve-static/index.js | 209 + node_modules/serve-static/package.json | 42 + node_modules/set-function-length/.eslintrc | 27 + .../set-function-length/.github/FUNDING.yml | 12 + node_modules/set-function-length/.nycrc | 13 + node_modules/set-function-length/CHANGELOG.md | 70 + node_modules/set-function-length/LICENSE | 21 + node_modules/set-function-length/README.md | 56 + node_modules/set-function-length/env.d.ts | 9 + node_modules/set-function-length/env.js | 25 + node_modules/set-function-length/index.d.ts | 7 + node_modules/set-function-length/index.js | 42 + node_modules/set-function-length/package.json | 102 + .../set-function-length/tsconfig.json | 9 + node_modules/setprototypeof/LICENSE | 13 + node_modules/setprototypeof/README.md | 31 + node_modules/setprototypeof/index.d.ts | 2 + node_modules/setprototypeof/index.js | 17 + node_modules/setprototypeof/package.json | 38 + node_modules/setprototypeof/test/index.js | 24 + node_modules/side-channel/.editorconfig | 9 + node_modules/side-channel/.eslintrc | 11 + node_modules/side-channel/.github/FUNDING.yml | 12 + node_modules/side-channel/.nycrc | 13 + node_modules/side-channel/CHANGELOG.md | 95 + node_modules/side-channel/LICENSE | 21 + node_modules/side-channel/README.md | 2 + node_modules/side-channel/index.d.ts | 27 + node_modules/side-channel/index.js | 129 + node_modules/side-channel/package.json | 84 + node_modules/side-channel/test/index.js | 83 + node_modules/side-channel/tsconfig.json | 50 + node_modules/sparse-bitfield/.npmignore | 1 + node_modules/sparse-bitfield/.travis.yml | 6 + node_modules/sparse-bitfield/LICENSE | 21 + node_modules/sparse-bitfield/README.md | 62 + node_modules/sparse-bitfield/index.js | 95 + node_modules/sparse-bitfield/package.json | 27 + node_modules/sparse-bitfield/test.js | 79 + node_modules/statuses/HISTORY.md | 82 + node_modules/statuses/LICENSE | 23 + node_modules/statuses/README.md | 136 + node_modules/statuses/codes.json | 65 + node_modules/statuses/index.js | 146 + node_modules/statuses/package.json | 49 + node_modules/string_decoder/.travis.yml | 50 + node_modules/string_decoder/LICENSE | 48 + node_modules/string_decoder/README.md | 47 + .../string_decoder/lib/string_decoder.js | 296 + .../node_modules/safe-buffer/LICENSE | 21 + .../node_modules/safe-buffer/README.md | 584 + .../node_modules/safe-buffer/index.d.ts | 187 + .../node_modules/safe-buffer/index.js | 62 + .../node_modules/safe-buffer/package.json | 37 + node_modules/string_decoder/package.json | 31 + node_modules/toidentifier/HISTORY.md | 9 + node_modules/toidentifier/LICENSE | 21 + node_modules/toidentifier/README.md | 61 + node_modules/toidentifier/index.js | 32 + node_modules/toidentifier/package.json | 38 + node_modules/type-is/HISTORY.md | 259 + node_modules/type-is/LICENSE | 23 + node_modules/type-is/README.md | 170 + node_modules/type-is/index.js | 266 + node_modules/type-is/package.json | 45 + node_modules/uid-safe/HISTORY.md | 61 + node_modules/uid-safe/LICENSE | 22 + node_modules/uid-safe/README.md | 77 + node_modules/uid-safe/index.js | 107 + node_modules/uid-safe/package.json | 46 + node_modules/uid2/HISTORY.md | 21 + node_modules/uid2/LICENSE | 21 + node_modules/uid2/README.md | 32 + node_modules/uid2/index.js | 55 + node_modules/uid2/package.json | 12 + node_modules/unpipe/HISTORY.md | 4 + node_modules/unpipe/LICENSE | 22 + node_modules/unpipe/README.md | 43 + node_modules/unpipe/index.js | 69 + node_modules/unpipe/package.json | 27 + node_modules/util-deprecate/History.md | 16 + node_modules/util-deprecate/LICENSE | 24 + node_modules/util-deprecate/README.md | 53 + node_modules/util-deprecate/browser.js | 67 + node_modules/util-deprecate/node.js | 6 + node_modules/util-deprecate/package.json | 27 + node_modules/utils-merge/.npmignore | 9 + node_modules/utils-merge/LICENSE | 20 + node_modules/utils-merge/README.md | 34 + node_modules/utils-merge/index.js | 23 + node_modules/utils-merge/package.json | 40 + node_modules/vary/HISTORY.md | 39 + node_modules/vary/LICENSE | 22 + node_modules/vary/README.md | 101 + node_modules/vary/index.js | 149 + node_modules/vary/package.json | 43 + package-lock.json | 1107 + package.json | 19 + public/css/main.css | 34 + public/index.html | 52 + public/js/main.js | 66 + public/login.html | 24 + public/register.html | 27 + server.js | 108 + 954 files changed, 158275 insertions(+) create mode 100644 .env create mode 120000 node_modules/.bin/mime create mode 100644 node_modules/.package-lock.json create mode 100644 node_modules/accepts/HISTORY.md create mode 100644 node_modules/accepts/LICENSE create mode 100644 node_modules/accepts/README.md create mode 100644 node_modules/accepts/index.js create mode 100644 node_modules/accepts/package.json create mode 100644 node_modules/array-flatten/LICENSE create mode 100644 node_modules/array-flatten/README.md create mode 100644 node_modules/array-flatten/array-flatten.js create mode 100644 node_modules/array-flatten/package.json create mode 100644 node_modules/base64url/LICENSE create mode 100644 node_modules/base64url/dist/.gitkeep create mode 100644 node_modules/base64url/dist/base64url.d.ts create mode 100644 node_modules/base64url/dist/base64url.js create mode 100644 node_modules/base64url/dist/pad-string.d.ts create mode 100644 node_modules/base64url/dist/pad-string.js create mode 100644 node_modules/base64url/index.js create mode 100644 node_modules/base64url/package.json create mode 100644 node_modules/base64url/readme.md create mode 100644 node_modules/bl/.jshintrc create mode 100644 node_modules/bl/.travis.yml create mode 100644 node_modules/bl/LICENSE.md create mode 100644 node_modules/bl/README.md create mode 100644 node_modules/bl/bl.js create mode 100644 node_modules/bl/package.json create mode 100644 node_modules/bl/test/indexOf.js create mode 100644 node_modules/bl/test/test.js create mode 100644 node_modules/body-parser/HISTORY.md create mode 100644 node_modules/body-parser/LICENSE create mode 100644 node_modules/body-parser/README.md create mode 100644 node_modules/body-parser/SECURITY.md create mode 100644 node_modules/body-parser/index.js create mode 100644 node_modules/body-parser/lib/read.js create mode 100644 node_modules/body-parser/lib/types/json.js create mode 100644 node_modules/body-parser/lib/types/raw.js create mode 100644 node_modules/body-parser/lib/types/text.js create mode 100644 node_modules/body-parser/lib/types/urlencoded.js create mode 100644 node_modules/body-parser/package.json create mode 100644 node_modules/bson/HISTORY.md create mode 100644 node_modules/bson/LICENSE.md create mode 100644 node_modules/bson/README.md create mode 100644 node_modules/bson/bower.json create mode 100644 node_modules/bson/browser_build/bson.js create mode 100644 node_modules/bson/browser_build/package.json create mode 100644 node_modules/bson/index.js create mode 100644 node_modules/bson/lib/bson/binary.js create mode 100644 node_modules/bson/lib/bson/bson.js create mode 100644 node_modules/bson/lib/bson/code.js create mode 100644 node_modules/bson/lib/bson/db_ref.js create mode 100644 node_modules/bson/lib/bson/decimal128.js create mode 100644 node_modules/bson/lib/bson/double.js create mode 100644 node_modules/bson/lib/bson/float_parser.js create mode 100644 node_modules/bson/lib/bson/int_32.js create mode 100644 node_modules/bson/lib/bson/long.js create mode 100644 node_modules/bson/lib/bson/map.js create mode 100644 node_modules/bson/lib/bson/max_key.js create mode 100644 node_modules/bson/lib/bson/min_key.js create mode 100644 node_modules/bson/lib/bson/objectid.js create mode 100644 node_modules/bson/lib/bson/parser/calculate_size.js create mode 100644 node_modules/bson/lib/bson/parser/deserializer.js create mode 100644 node_modules/bson/lib/bson/parser/serializer.js create mode 100644 node_modules/bson/lib/bson/parser/utils.js create mode 100644 node_modules/bson/lib/bson/regexp.js create mode 100644 node_modules/bson/lib/bson/symbol.js create mode 100644 node_modules/bson/lib/bson/timestamp.js create mode 100644 node_modules/bson/package.json create mode 100644 node_modules/bytes/History.md create mode 100644 node_modules/bytes/LICENSE create mode 100644 node_modules/bytes/Readme.md create mode 100644 node_modules/bytes/index.js create mode 100644 node_modules/bytes/package.json create mode 100644 node_modules/call-bind/.eslintignore create mode 100644 node_modules/call-bind/.eslintrc create mode 100644 node_modules/call-bind/.github/FUNDING.yml create mode 100644 node_modules/call-bind/.nycrc create mode 100644 node_modules/call-bind/CHANGELOG.md create mode 100644 node_modules/call-bind/LICENSE create mode 100644 node_modules/call-bind/README.md create mode 100644 node_modules/call-bind/callBound.js create mode 100644 node_modules/call-bind/index.js create mode 100644 node_modules/call-bind/package.json create mode 100644 node_modules/call-bind/test/callBound.js create mode 100644 node_modules/call-bind/test/index.js create mode 100644 node_modules/content-disposition/HISTORY.md create mode 100644 node_modules/content-disposition/LICENSE create mode 100644 node_modules/content-disposition/README.md create mode 100644 node_modules/content-disposition/index.js create mode 100644 node_modules/content-disposition/package.json create mode 100644 node_modules/content-type/HISTORY.md create mode 100644 node_modules/content-type/LICENSE create mode 100644 node_modules/content-type/README.md create mode 100644 node_modules/content-type/index.js create mode 100644 node_modules/content-type/package.json create mode 100644 node_modules/cookie-signature/.npmignore create mode 100644 node_modules/cookie-signature/History.md create mode 100644 node_modules/cookie-signature/Readme.md create mode 100644 node_modules/cookie-signature/index.js create mode 100644 node_modules/cookie-signature/package.json create mode 100644 node_modules/cookie/HISTORY.md create mode 100644 node_modules/cookie/LICENSE create mode 100644 node_modules/cookie/README.md create mode 100644 node_modules/cookie/SECURITY.md create mode 100644 node_modules/cookie/index.js create mode 100644 node_modules/cookie/package.json create mode 100644 node_modules/core-util-is/LICENSE create mode 100644 node_modules/core-util-is/README.md create mode 100644 node_modules/core-util-is/lib/util.js create mode 100644 node_modules/core-util-is/package.json create mode 100644 node_modules/debug/.coveralls.yml create mode 100644 node_modules/debug/.eslintrc create mode 100644 node_modules/debug/.npmignore create mode 100644 node_modules/debug/.travis.yml create mode 100644 node_modules/debug/CHANGELOG.md create mode 100644 node_modules/debug/LICENSE create mode 100644 node_modules/debug/Makefile create mode 100644 node_modules/debug/README.md create mode 100644 node_modules/debug/component.json create mode 100644 node_modules/debug/karma.conf.js create mode 100644 node_modules/debug/node.js create mode 100644 node_modules/debug/package.json create mode 100644 node_modules/debug/src/browser.js create mode 100644 node_modules/debug/src/debug.js create mode 100644 node_modules/debug/src/index.js create mode 100644 node_modules/debug/src/inspector-log.js create mode 100644 node_modules/debug/src/node.js create mode 100644 node_modules/define-data-property/.eslintrc create mode 100644 node_modules/define-data-property/.github/FUNDING.yml create mode 100644 node_modules/define-data-property/.nycrc create mode 100644 node_modules/define-data-property/CHANGELOG.md create mode 100644 node_modules/define-data-property/LICENSE create mode 100644 node_modules/define-data-property/README.md create mode 100644 node_modules/define-data-property/index.d.ts create mode 100644 node_modules/define-data-property/index.js create mode 100644 node_modules/define-data-property/package.json create mode 100644 node_modules/define-data-property/test/index.js create mode 100644 node_modules/define-data-property/tsconfig.json create mode 100644 node_modules/denque/CHANGELOG.md create mode 100644 node_modules/denque/LICENSE create mode 100644 node_modules/denque/README.md create mode 100644 node_modules/denque/index.d.ts create mode 100644 node_modules/denque/index.js create mode 100644 node_modules/denque/package.json create mode 100644 node_modules/depd/History.md create mode 100644 node_modules/depd/LICENSE create mode 100644 node_modules/depd/Readme.md create mode 100644 node_modules/depd/index.js create mode 100644 node_modules/depd/lib/browser/index.js create mode 100644 node_modules/depd/package.json create mode 100644 node_modules/destroy/LICENSE create mode 100644 node_modules/destroy/README.md create mode 100644 node_modules/destroy/index.js create mode 100644 node_modules/destroy/package.json create mode 100644 node_modules/dotenv/CHANGELOG.md create mode 100644 node_modules/dotenv/LICENSE create mode 100644 node_modules/dotenv/README-es.md create mode 100644 node_modules/dotenv/README.md create mode 100644 node_modules/dotenv/config.d.ts create mode 100644 node_modules/dotenv/config.js create mode 100644 node_modules/dotenv/lib/cli-options.js create mode 100644 node_modules/dotenv/lib/env-options.js create mode 100644 node_modules/dotenv/lib/main.d.ts create mode 100644 node_modules/dotenv/lib/main.js create mode 100644 node_modules/dotenv/package.json create mode 100644 node_modules/ee-first/LICENSE create mode 100644 node_modules/ee-first/README.md create mode 100644 node_modules/ee-first/index.js create mode 100644 node_modules/ee-first/package.json create mode 100644 node_modules/encodeurl/LICENSE create mode 100644 node_modules/encodeurl/README.md create mode 100644 node_modules/encodeurl/index.js create mode 100644 node_modules/encodeurl/package.json create mode 100644 node_modules/es-define-property/.eslintrc create mode 100644 node_modules/es-define-property/.github/FUNDING.yml create mode 100644 node_modules/es-define-property/.nycrc create mode 100644 node_modules/es-define-property/CHANGELOG.md create mode 100644 node_modules/es-define-property/LICENSE create mode 100644 node_modules/es-define-property/README.md create mode 100644 node_modules/es-define-property/index.d.ts create mode 100644 node_modules/es-define-property/index.js create mode 100644 node_modules/es-define-property/package.json create mode 100644 node_modules/es-define-property/test/index.js create mode 100644 node_modules/es-define-property/tsconfig.json create mode 100644 node_modules/es-errors/.eslintrc create mode 100644 node_modules/es-errors/.github/FUNDING.yml create mode 100644 node_modules/es-errors/CHANGELOG.md create mode 100644 node_modules/es-errors/LICENSE create mode 100644 node_modules/es-errors/README.md create mode 100644 node_modules/es-errors/eval.d.ts create mode 100644 node_modules/es-errors/eval.js create mode 100644 node_modules/es-errors/index.d.ts create mode 100644 node_modules/es-errors/index.js create mode 100644 node_modules/es-errors/package.json create mode 100644 node_modules/es-errors/range.d.ts create mode 100644 node_modules/es-errors/range.js create mode 100644 node_modules/es-errors/ref.d.ts create mode 100644 node_modules/es-errors/ref.js create mode 100644 node_modules/es-errors/syntax.d.ts create mode 100644 node_modules/es-errors/syntax.js create mode 100644 node_modules/es-errors/test/index.js create mode 100644 node_modules/es-errors/tsconfig.json create mode 100644 node_modules/es-errors/type.d.ts create mode 100644 node_modules/es-errors/type.js create mode 100644 node_modules/es-errors/uri.d.ts create mode 100644 node_modules/es-errors/uri.js create mode 100644 node_modules/escape-html/LICENSE create mode 100644 node_modules/escape-html/Readme.md create mode 100644 node_modules/escape-html/index.js create mode 100644 node_modules/escape-html/package.json create mode 100644 node_modules/etag/HISTORY.md create mode 100644 node_modules/etag/LICENSE create mode 100644 node_modules/etag/README.md create mode 100644 node_modules/etag/index.js create mode 100644 node_modules/etag/package.json create mode 100644 node_modules/express-session/HISTORY.md create mode 100644 node_modules/express-session/LICENSE create mode 100644 node_modules/express-session/README.md create mode 100644 node_modules/express-session/index.js create mode 100644 node_modules/express-session/node_modules/cookie-signature/History.md create mode 100644 node_modules/express-session/node_modules/cookie-signature/Readme.md create mode 100644 node_modules/express-session/node_modules/cookie-signature/index.js create mode 100644 node_modules/express-session/node_modules/cookie-signature/package.json create mode 100644 node_modules/express-session/package.json create mode 100644 node_modules/express-session/session/cookie.js create mode 100644 node_modules/express-session/session/memory.js create mode 100644 node_modules/express-session/session/session.js create mode 100644 node_modules/express-session/session/store.js create mode 100644 node_modules/express/History.md create mode 100644 node_modules/express/LICENSE create mode 100644 node_modules/express/Readme.md create mode 100644 node_modules/express/index.js create mode 100644 node_modules/express/lib/application.js create mode 100644 node_modules/express/lib/express.js create mode 100644 node_modules/express/lib/middleware/init.js create mode 100644 node_modules/express/lib/middleware/query.js create mode 100644 node_modules/express/lib/request.js create mode 100644 node_modules/express/lib/response.js create mode 100644 node_modules/express/lib/router/index.js create mode 100644 node_modules/express/lib/router/layer.js create mode 100644 node_modules/express/lib/router/route.js create mode 100644 node_modules/express/lib/utils.js create mode 100644 node_modules/express/lib/view.js create mode 100644 node_modules/express/package.json create mode 100644 node_modules/finalhandler/HISTORY.md create mode 100644 node_modules/finalhandler/LICENSE create mode 100644 node_modules/finalhandler/README.md create mode 100644 node_modules/finalhandler/SECURITY.md create mode 100644 node_modules/finalhandler/index.js create mode 100644 node_modules/finalhandler/package.json create mode 100644 node_modules/forwarded/HISTORY.md create mode 100644 node_modules/forwarded/LICENSE create mode 100644 node_modules/forwarded/README.md create mode 100644 node_modules/forwarded/index.js create mode 100644 node_modules/forwarded/package.json create mode 100644 node_modules/fresh/HISTORY.md create mode 100644 node_modules/fresh/LICENSE create mode 100644 node_modules/fresh/README.md create mode 100644 node_modules/fresh/index.js create mode 100644 node_modules/fresh/package.json create mode 100644 node_modules/function-bind/.eslintrc create mode 100644 node_modules/function-bind/.github/FUNDING.yml create mode 100644 node_modules/function-bind/.github/SECURITY.md create mode 100644 node_modules/function-bind/.nycrc create mode 100644 node_modules/function-bind/CHANGELOG.md create mode 100644 node_modules/function-bind/LICENSE create mode 100644 node_modules/function-bind/README.md create mode 100644 node_modules/function-bind/implementation.js create mode 100644 node_modules/function-bind/index.js create mode 100644 node_modules/function-bind/package.json create mode 100644 node_modules/function-bind/test/.eslintrc create mode 100644 node_modules/function-bind/test/index.js create mode 100644 node_modules/get-intrinsic/.eslintrc create mode 100644 node_modules/get-intrinsic/.github/FUNDING.yml create mode 100644 node_modules/get-intrinsic/.nycrc create mode 100644 node_modules/get-intrinsic/CHANGELOG.md create mode 100644 node_modules/get-intrinsic/LICENSE create mode 100644 node_modules/get-intrinsic/README.md create mode 100644 node_modules/get-intrinsic/index.js create mode 100644 node_modules/get-intrinsic/package.json create mode 100644 node_modules/get-intrinsic/test/GetIntrinsic.js create mode 100644 node_modules/gopd/.eslintrc create mode 100644 node_modules/gopd/.github/FUNDING.yml create mode 100644 node_modules/gopd/CHANGELOG.md create mode 100644 node_modules/gopd/LICENSE create mode 100644 node_modules/gopd/README.md create mode 100644 node_modules/gopd/index.js create mode 100644 node_modules/gopd/package.json create mode 100644 node_modules/gopd/test/index.js create mode 100644 node_modules/has-property-descriptors/.eslintrc create mode 100644 node_modules/has-property-descriptors/.github/FUNDING.yml create mode 100644 node_modules/has-property-descriptors/.nycrc create mode 100644 node_modules/has-property-descriptors/CHANGELOG.md create mode 100644 node_modules/has-property-descriptors/LICENSE create mode 100644 node_modules/has-property-descriptors/README.md create mode 100644 node_modules/has-property-descriptors/index.js create mode 100644 node_modules/has-property-descriptors/package.json create mode 100644 node_modules/has-property-descriptors/test/index.js create mode 100644 node_modules/has-proto/.eslintrc create mode 100644 node_modules/has-proto/.github/FUNDING.yml create mode 100644 node_modules/has-proto/CHANGELOG.md create mode 100644 node_modules/has-proto/LICENSE create mode 100644 node_modules/has-proto/README.md create mode 100644 node_modules/has-proto/index.d.ts create mode 100644 node_modules/has-proto/index.js create mode 100644 node_modules/has-proto/package.json create mode 100644 node_modules/has-proto/test/index.js create mode 100644 node_modules/has-proto/tsconfig.json create mode 100644 node_modules/has-symbols/.eslintrc create mode 100644 node_modules/has-symbols/.github/FUNDING.yml create mode 100644 node_modules/has-symbols/.nycrc create mode 100644 node_modules/has-symbols/CHANGELOG.md create mode 100644 node_modules/has-symbols/LICENSE create mode 100644 node_modules/has-symbols/README.md create mode 100644 node_modules/has-symbols/index.js create mode 100644 node_modules/has-symbols/package.json create mode 100644 node_modules/has-symbols/shams.js create mode 100644 node_modules/has-symbols/test/index.js create mode 100644 node_modules/has-symbols/test/shams/core-js.js create mode 100644 node_modules/has-symbols/test/shams/get-own-property-symbols.js create mode 100644 node_modules/has-symbols/test/tests.js create mode 100644 node_modules/hasown/.eslintrc create mode 100644 node_modules/hasown/.github/FUNDING.yml create mode 100644 node_modules/hasown/.nycrc create mode 100644 node_modules/hasown/CHANGELOG.md create mode 100644 node_modules/hasown/LICENSE create mode 100644 node_modules/hasown/README.md create mode 100644 node_modules/hasown/index.d.ts create mode 100644 node_modules/hasown/index.js create mode 100644 node_modules/hasown/package.json create mode 100644 node_modules/hasown/tsconfig.json create mode 100644 node_modules/http-errors/HISTORY.md create mode 100644 node_modules/http-errors/LICENSE create mode 100644 node_modules/http-errors/README.md create mode 100644 node_modules/http-errors/index.js create mode 100644 node_modules/http-errors/package.json create mode 100644 node_modules/iconv-lite/Changelog.md create mode 100644 node_modules/iconv-lite/LICENSE create mode 100644 node_modules/iconv-lite/README.md create mode 100644 node_modules/iconv-lite/encodings/dbcs-codec.js create mode 100644 node_modules/iconv-lite/encodings/dbcs-data.js create mode 100644 node_modules/iconv-lite/encodings/index.js create mode 100644 node_modules/iconv-lite/encodings/internal.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-codec.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-data-generated.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-data.js create mode 100644 node_modules/iconv-lite/encodings/tables/big5-added.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp936.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp949.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp950.json create mode 100644 node_modules/iconv-lite/encodings/tables/eucjp.json create mode 100644 node_modules/iconv-lite/encodings/tables/gb18030-ranges.json create mode 100644 node_modules/iconv-lite/encodings/tables/gbk-added.json create mode 100644 node_modules/iconv-lite/encodings/tables/shiftjis.json create mode 100644 node_modules/iconv-lite/encodings/utf16.js create mode 100644 node_modules/iconv-lite/encodings/utf7.js create mode 100644 node_modules/iconv-lite/lib/bom-handling.js create mode 100644 node_modules/iconv-lite/lib/extend-node.js create mode 100644 node_modules/iconv-lite/lib/index.d.ts create mode 100644 node_modules/iconv-lite/lib/index.js create mode 100644 node_modules/iconv-lite/lib/streams.js create mode 100644 node_modules/iconv-lite/package.json create mode 100644 node_modules/inherits/LICENSE create mode 100644 node_modules/inherits/README.md create mode 100644 node_modules/inherits/inherits.js create mode 100644 node_modules/inherits/inherits_browser.js create mode 100644 node_modules/inherits/package.json create mode 100644 node_modules/ipaddr.js/LICENSE create mode 100644 node_modules/ipaddr.js/README.md create mode 100644 node_modules/ipaddr.js/ipaddr.min.js create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js.d.ts create mode 100644 node_modules/ipaddr.js/package.json create mode 100644 node_modules/isarray/.npmignore create mode 100644 node_modules/isarray/.travis.yml create mode 100644 node_modules/isarray/Makefile create mode 100644 node_modules/isarray/README.md create mode 100644 node_modules/isarray/component.json create mode 100644 node_modules/isarray/index.js create mode 100644 node_modules/isarray/package.json create mode 100644 node_modules/isarray/test.js create mode 100644 node_modules/media-typer/HISTORY.md create mode 100644 node_modules/media-typer/LICENSE create mode 100644 node_modules/media-typer/README.md create mode 100644 node_modules/media-typer/index.js create mode 100644 node_modules/media-typer/package.json create mode 100644 node_modules/memory-pager/.travis.yml create mode 100644 node_modules/memory-pager/LICENSE create mode 100644 node_modules/memory-pager/README.md create mode 100644 node_modules/memory-pager/index.js create mode 100644 node_modules/memory-pager/package.json create mode 100644 node_modules/memory-pager/test.js create mode 100644 node_modules/merge-descriptors/HISTORY.md create mode 100644 node_modules/merge-descriptors/LICENSE create mode 100644 node_modules/merge-descriptors/README.md create mode 100644 node_modules/merge-descriptors/index.js create mode 100644 node_modules/merge-descriptors/package.json create mode 100644 node_modules/methods/HISTORY.md create mode 100644 node_modules/methods/LICENSE create mode 100644 node_modules/methods/README.md create mode 100644 node_modules/methods/index.js create mode 100644 node_modules/methods/package.json create mode 100644 node_modules/mime-db/HISTORY.md create mode 100644 node_modules/mime-db/LICENSE create mode 100644 node_modules/mime-db/README.md create mode 100644 node_modules/mime-db/db.json create mode 100644 node_modules/mime-db/index.js create mode 100644 node_modules/mime-db/package.json create mode 100644 node_modules/mime-types/HISTORY.md create mode 100644 node_modules/mime-types/LICENSE create mode 100644 node_modules/mime-types/README.md create mode 100644 node_modules/mime-types/index.js create mode 100644 node_modules/mime-types/package.json create mode 100644 node_modules/mime/.npmignore create mode 100644 node_modules/mime/CHANGELOG.md create mode 100644 node_modules/mime/LICENSE create mode 100644 node_modules/mime/README.md create mode 100755 node_modules/mime/cli.js create mode 100644 node_modules/mime/mime.js create mode 100644 node_modules/mime/package.json create mode 100755 node_modules/mime/src/build.js create mode 100644 node_modules/mime/src/test.js create mode 100644 node_modules/mime/types.json create mode 100644 node_modules/mongodb/LICENSE.md create mode 100644 node_modules/mongodb/README.md create mode 100644 node_modules/mongodb/index.js create mode 100644 node_modules/mongodb/lib/admin.js create mode 100644 node_modules/mongodb/lib/aggregation_cursor.js create mode 100644 node_modules/mongodb/lib/apm.js create mode 100644 node_modules/mongodb/lib/async/.eslintrc create mode 100644 node_modules/mongodb/lib/async/async_iterator.js create mode 100644 node_modules/mongodb/lib/bulk/common.js create mode 100644 node_modules/mongodb/lib/bulk/ordered.js create mode 100644 node_modules/mongodb/lib/bulk/unordered.js create mode 100644 node_modules/mongodb/lib/change_stream.js create mode 100644 node_modules/mongodb/lib/cmap/connection.js create mode 100644 node_modules/mongodb/lib/cmap/connection_pool.js create mode 100644 node_modules/mongodb/lib/cmap/errors.js create mode 100644 node_modules/mongodb/lib/cmap/events.js create mode 100644 node_modules/mongodb/lib/cmap/message_stream.js create mode 100644 node_modules/mongodb/lib/cmap/stream_description.js create mode 100644 node_modules/mongodb/lib/collection.js create mode 100644 node_modules/mongodb/lib/command_cursor.js create mode 100644 node_modules/mongodb/lib/command_utils.js create mode 100644 node_modules/mongodb/lib/constants.js create mode 100644 node_modules/mongodb/lib/core/auth/auth_provider.js create mode 100644 node_modules/mongodb/lib/core/auth/defaultAuthProviders.js create mode 100644 node_modules/mongodb/lib/core/auth/gssapi.js create mode 100644 node_modules/mongodb/lib/core/auth/mongo_credentials.js create mode 100644 node_modules/mongodb/lib/core/auth/mongocr.js create mode 100644 node_modules/mongodb/lib/core/auth/mongodb_aws.js create mode 100644 node_modules/mongodb/lib/core/auth/plain.js create mode 100644 node_modules/mongodb/lib/core/auth/scram.js create mode 100644 node_modules/mongodb/lib/core/auth/x509.js create mode 100644 node_modules/mongodb/lib/core/connection/apm.js create mode 100644 node_modules/mongodb/lib/core/connection/command_result.js create mode 100644 node_modules/mongodb/lib/core/connection/commands.js create mode 100644 node_modules/mongodb/lib/core/connection/connect.js create mode 100644 node_modules/mongodb/lib/core/connection/connection.js create mode 100644 node_modules/mongodb/lib/core/connection/logger.js create mode 100644 node_modules/mongodb/lib/core/connection/msg.js create mode 100644 node_modules/mongodb/lib/core/connection/pool.js create mode 100644 node_modules/mongodb/lib/core/connection/utils.js create mode 100644 node_modules/mongodb/lib/core/cursor.js create mode 100644 node_modules/mongodb/lib/core/error.js create mode 100644 node_modules/mongodb/lib/core/index.js create mode 100644 node_modules/mongodb/lib/core/sdam/common.js create mode 100644 node_modules/mongodb/lib/core/sdam/events.js create mode 100644 node_modules/mongodb/lib/core/sdam/monitor.js create mode 100644 node_modules/mongodb/lib/core/sdam/server.js create mode 100644 node_modules/mongodb/lib/core/sdam/server_description.js create mode 100644 node_modules/mongodb/lib/core/sdam/server_selection.js create mode 100644 node_modules/mongodb/lib/core/sdam/srv_polling.js create mode 100644 node_modules/mongodb/lib/core/sdam/topology.js create mode 100644 node_modules/mongodb/lib/core/sdam/topology_description.js create mode 100644 node_modules/mongodb/lib/core/sessions.js create mode 100644 node_modules/mongodb/lib/core/tools/smoke_plugin.js create mode 100644 node_modules/mongodb/lib/core/topologies/mongos.js create mode 100644 node_modules/mongodb/lib/core/topologies/read_preference.js create mode 100644 node_modules/mongodb/lib/core/topologies/replset.js create mode 100644 node_modules/mongodb/lib/core/topologies/replset_state.js create mode 100644 node_modules/mongodb/lib/core/topologies/server.js create mode 100644 node_modules/mongodb/lib/core/topologies/shared.js create mode 100644 node_modules/mongodb/lib/core/transactions.js create mode 100644 node_modules/mongodb/lib/core/uri_parser.js create mode 100644 node_modules/mongodb/lib/core/utils.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/command.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/compression.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/constants.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/get_more.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/index.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/kill_cursors.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/query.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/shared.js create mode 100644 node_modules/mongodb/lib/core/wireprotocol/write_command.js create mode 100644 node_modules/mongodb/lib/cursor.js create mode 100644 node_modules/mongodb/lib/db.js create mode 100644 node_modules/mongodb/lib/dynamic_loaders.js create mode 100644 node_modules/mongodb/lib/encrypter.js create mode 100644 node_modules/mongodb/lib/error.js create mode 100644 node_modules/mongodb/lib/error_codes.js create mode 100644 node_modules/mongodb/lib/explain.js create mode 100644 node_modules/mongodb/lib/gridfs-stream/download.js create mode 100644 node_modules/mongodb/lib/gridfs-stream/index.js create mode 100644 node_modules/mongodb/lib/gridfs-stream/upload.js create mode 100644 node_modules/mongodb/lib/gridfs/chunk.js create mode 100644 node_modules/mongodb/lib/gridfs/grid_store.js create mode 100644 node_modules/mongodb/lib/mongo_client.js create mode 100644 node_modules/mongodb/lib/operations/add_user.js create mode 100644 node_modules/mongodb/lib/operations/admin_ops.js create mode 100644 node_modules/mongodb/lib/operations/aggregate.js create mode 100644 node_modules/mongodb/lib/operations/bulk_write.js create mode 100644 node_modules/mongodb/lib/operations/collection_ops.js create mode 100644 node_modules/mongodb/lib/operations/collections.js create mode 100644 node_modules/mongodb/lib/operations/command.js create mode 100644 node_modules/mongodb/lib/operations/command_v2.js create mode 100644 node_modules/mongodb/lib/operations/common_functions.js create mode 100644 node_modules/mongodb/lib/operations/connect.js create mode 100644 node_modules/mongodb/lib/operations/count.js create mode 100644 node_modules/mongodb/lib/operations/count_documents.js create mode 100644 node_modules/mongodb/lib/operations/create_collection.js create mode 100644 node_modules/mongodb/lib/operations/create_indexes.js create mode 100644 node_modules/mongodb/lib/operations/cursor_ops.js create mode 100644 node_modules/mongodb/lib/operations/db_ops.js create mode 100644 node_modules/mongodb/lib/operations/delete_many.js create mode 100644 node_modules/mongodb/lib/operations/delete_one.js create mode 100644 node_modules/mongodb/lib/operations/distinct.js create mode 100644 node_modules/mongodb/lib/operations/drop.js create mode 100644 node_modules/mongodb/lib/operations/drop_index.js create mode 100644 node_modules/mongodb/lib/operations/drop_indexes.js create mode 100644 node_modules/mongodb/lib/operations/estimated_document_count.js create mode 100644 node_modules/mongodb/lib/operations/execute_db_admin_command.js create mode 100644 node_modules/mongodb/lib/operations/execute_operation.js create mode 100644 node_modules/mongodb/lib/operations/find.js create mode 100644 node_modules/mongodb/lib/operations/find_and_modify.js create mode 100644 node_modules/mongodb/lib/operations/find_one.js create mode 100644 node_modules/mongodb/lib/operations/find_one_and_delete.js create mode 100644 node_modules/mongodb/lib/operations/find_one_and_replace.js create mode 100644 node_modules/mongodb/lib/operations/find_one_and_update.js create mode 100644 node_modules/mongodb/lib/operations/geo_haystack_search.js create mode 100644 node_modules/mongodb/lib/operations/index_exists.js create mode 100644 node_modules/mongodb/lib/operations/index_information.js create mode 100644 node_modules/mongodb/lib/operations/indexes.js create mode 100644 node_modules/mongodb/lib/operations/insert_many.js create mode 100644 node_modules/mongodb/lib/operations/insert_one.js create mode 100644 node_modules/mongodb/lib/operations/is_capped.js create mode 100644 node_modules/mongodb/lib/operations/list_collections.js create mode 100644 node_modules/mongodb/lib/operations/list_databases.js create mode 100644 node_modules/mongodb/lib/operations/list_indexes.js create mode 100644 node_modules/mongodb/lib/operations/map_reduce.js create mode 100644 node_modules/mongodb/lib/operations/operation.js create mode 100644 node_modules/mongodb/lib/operations/options_operation.js create mode 100644 node_modules/mongodb/lib/operations/profiling_level.js create mode 100644 node_modules/mongodb/lib/operations/re_index.js create mode 100644 node_modules/mongodb/lib/operations/remove_user.js create mode 100644 node_modules/mongodb/lib/operations/rename.js create mode 100644 node_modules/mongodb/lib/operations/replace_one.js create mode 100644 node_modules/mongodb/lib/operations/run_command.js create mode 100644 node_modules/mongodb/lib/operations/set_profiling_level.js create mode 100644 node_modules/mongodb/lib/operations/stats.js create mode 100644 node_modules/mongodb/lib/operations/update_many.js create mode 100644 node_modules/mongodb/lib/operations/update_one.js create mode 100644 node_modules/mongodb/lib/operations/validate_collection.js create mode 100644 node_modules/mongodb/lib/read_concern.js create mode 100644 node_modules/mongodb/lib/topologies/mongos.js create mode 100644 node_modules/mongodb/lib/topologies/native_topology.js create mode 100644 node_modules/mongodb/lib/topologies/replset.js create mode 100644 node_modules/mongodb/lib/topologies/server.js create mode 100644 node_modules/mongodb/lib/topologies/topology_base.js create mode 100644 node_modules/mongodb/lib/url_parser.js create mode 100644 node_modules/mongodb/lib/utils.js create mode 100644 node_modules/mongodb/lib/write_concern.js create mode 100644 node_modules/mongodb/package.json create mode 100644 node_modules/ms/index.js create mode 100644 node_modules/ms/license.md create mode 100644 node_modules/ms/package.json create mode 100644 node_modules/ms/readme.md create mode 100644 node_modules/negotiator/HISTORY.md create mode 100644 node_modules/negotiator/LICENSE create mode 100644 node_modules/negotiator/README.md create mode 100644 node_modules/negotiator/index.js create mode 100644 node_modules/negotiator/lib/charset.js create mode 100644 node_modules/negotiator/lib/encoding.js create mode 100644 node_modules/negotiator/lib/language.js create mode 100644 node_modules/negotiator/lib/mediaType.js create mode 100644 node_modules/negotiator/package.json create mode 100644 node_modules/oauth/LICENSE create mode 100644 node_modules/oauth/Makefile create mode 100644 node_modules/oauth/Readme.md create mode 100644 node_modules/oauth/examples/express-gdata/server.js create mode 100644 node_modules/oauth/examples/express-gdata/views/google_calendars.ejs create mode 100644 node_modules/oauth/examples/express-gdata/views/google_contacts.ejs create mode 100644 node_modules/oauth/examples/express-gdata/views/layout.ejs create mode 100644 node_modules/oauth/examples/github-example.js create mode 100644 node_modules/oauth/examples/term.ie.oauth-HMAC-SHA1.js create mode 100644 node_modules/oauth/examples/twitter-example.js create mode 100644 node_modules/oauth/index.js create mode 100644 node_modules/oauth/lib/_utils.js create mode 100644 node_modules/oauth/lib/oauth.js create mode 100644 node_modules/oauth/lib/oauth2.js create mode 100644 node_modules/oauth/lib/sha1.js create mode 100644 node_modules/oauth/package.json create mode 100644 node_modules/oauth/tests/oauth2tests.js create mode 100644 node_modules/oauth/tests/oauthtests.js create mode 100644 node_modules/oauth/tests/sha1tests.js create mode 100644 node_modules/oauth/tests/shared.js create mode 100644 node_modules/object-inspect/.eslintrc create mode 100644 node_modules/object-inspect/.github/FUNDING.yml create mode 100644 node_modules/object-inspect/.nycrc create mode 100644 node_modules/object-inspect/CHANGELOG.md create mode 100644 node_modules/object-inspect/LICENSE create mode 100644 node_modules/object-inspect/example/all.js create mode 100644 node_modules/object-inspect/example/circular.js create mode 100644 node_modules/object-inspect/example/fn.js create mode 100644 node_modules/object-inspect/example/inspect.js create mode 100644 node_modules/object-inspect/index.js create mode 100644 node_modules/object-inspect/package-support.json create mode 100644 node_modules/object-inspect/package.json create mode 100644 node_modules/object-inspect/readme.markdown create mode 100644 node_modules/object-inspect/test-core-js.js create mode 100644 node_modules/object-inspect/test/bigint.js create mode 100644 node_modules/object-inspect/test/browser/dom.js create mode 100644 node_modules/object-inspect/test/circular.js create mode 100644 node_modules/object-inspect/test/deep.js create mode 100644 node_modules/object-inspect/test/element.js create mode 100644 node_modules/object-inspect/test/err.js create mode 100644 node_modules/object-inspect/test/fakes.js create mode 100644 node_modules/object-inspect/test/fn.js create mode 100644 node_modules/object-inspect/test/global.js create mode 100644 node_modules/object-inspect/test/has.js create mode 100644 node_modules/object-inspect/test/holes.js create mode 100644 node_modules/object-inspect/test/indent-option.js create mode 100644 node_modules/object-inspect/test/inspect.js create mode 100644 node_modules/object-inspect/test/lowbyte.js create mode 100644 node_modules/object-inspect/test/number.js create mode 100644 node_modules/object-inspect/test/quoteStyle.js create mode 100644 node_modules/object-inspect/test/toStringTag.js create mode 100644 node_modules/object-inspect/test/undef.js create mode 100644 node_modules/object-inspect/test/values.js create mode 100644 node_modules/object-inspect/util.inspect.js create mode 100644 node_modules/on-finished/HISTORY.md create mode 100644 node_modules/on-finished/LICENSE create mode 100644 node_modules/on-finished/README.md create mode 100644 node_modules/on-finished/index.js create mode 100644 node_modules/on-finished/package.json create mode 100644 node_modules/on-headers/HISTORY.md create mode 100644 node_modules/on-headers/LICENSE create mode 100644 node_modules/on-headers/README.md create mode 100644 node_modules/on-headers/index.js create mode 100644 node_modules/on-headers/package.json create mode 100644 node_modules/optional-require/README.md create mode 100644 node_modules/optional-require/dist/index.d.ts create mode 100644 node_modules/optional-require/dist/index.js create mode 100644 node_modules/optional-require/dist/index.js.map create mode 100644 node_modules/optional-require/index.d.ts create mode 100644 node_modules/optional-require/index.js create mode 100644 node_modules/optional-require/package.json create mode 100644 node_modules/parseurl/HISTORY.md create mode 100644 node_modules/parseurl/LICENSE create mode 100644 node_modules/parseurl/README.md create mode 100644 node_modules/parseurl/index.js create mode 100644 node_modules/parseurl/package.json create mode 100644 node_modules/passport-google-oauth20/.github/ISSUE_TEMPLATE.md create mode 100644 node_modules/passport-google-oauth20/.github/PULL_REQUEST_TEMPLATE.md create mode 100644 node_modules/passport-google-oauth20/.npmignore create mode 100644 node_modules/passport-google-oauth20/CONTRIBUTING.md create mode 100644 node_modules/passport-google-oauth20/LICENSE create mode 100644 node_modules/passport-google-oauth20/README.md create mode 100644 node_modules/passport-google-oauth20/lib/errors/googleplusapierror.js create mode 100644 node_modules/passport-google-oauth20/lib/errors/userinfoerror.js create mode 100644 node_modules/passport-google-oauth20/lib/index.js create mode 100644 node_modules/passport-google-oauth20/lib/profile/googleplus.js create mode 100644 node_modules/passport-google-oauth20/lib/profile/openid.js create mode 100644 node_modules/passport-google-oauth20/lib/strategy.js create mode 100644 node_modules/passport-google-oauth20/package.json create mode 100644 node_modules/passport-oauth2/.github/FUNDING.yml create mode 100644 node_modules/passport-oauth2/CHANGELOG.md create mode 100644 node_modules/passport-oauth2/LICENSE create mode 100644 node_modules/passport-oauth2/README.md create mode 100644 node_modules/passport-oauth2/lib/errors/authorizationerror.js create mode 100644 node_modules/passport-oauth2/lib/errors/internaloautherror.js create mode 100644 node_modules/passport-oauth2/lib/errors/tokenerror.js create mode 100644 node_modules/passport-oauth2/lib/index.js create mode 100644 node_modules/passport-oauth2/lib/state/null.js create mode 100644 node_modules/passport-oauth2/lib/state/pkcesession.js create mode 100644 node_modules/passport-oauth2/lib/state/session.js create mode 100644 node_modules/passport-oauth2/lib/state/store.js create mode 100644 node_modules/passport-oauth2/lib/strategy.js create mode 100644 node_modules/passport-oauth2/lib/utils.js create mode 100644 node_modules/passport-oauth2/package.json create mode 100644 node_modules/passport-strategy/.jshintrc create mode 100644 node_modules/passport-strategy/.travis.yml create mode 100644 node_modules/passport-strategy/LICENSE create mode 100644 node_modules/passport-strategy/README.md create mode 100644 node_modules/passport-strategy/lib/index.js create mode 100644 node_modules/passport-strategy/lib/strategy.js create mode 100644 node_modules/passport-strategy/package.json create mode 100644 node_modules/passport/CHANGELOG.md create mode 100644 node_modules/passport/LICENSE create mode 100644 node_modules/passport/README.md create mode 100644 node_modules/passport/etc/jsdoc.json create mode 100644 node_modules/passport/lib/authenticator.js create mode 100644 node_modules/passport/lib/errors/authenticationerror.js create mode 100644 node_modules/passport/lib/framework/connect.js create mode 100644 node_modules/passport/lib/http/request.js create mode 100644 node_modules/passport/lib/index.js create mode 100644 node_modules/passport/lib/middleware/authenticate.js create mode 100644 node_modules/passport/lib/middleware/initialize.js create mode 100644 node_modules/passport/lib/sessionmanager.js create mode 100644 node_modules/passport/lib/strategies/session.js create mode 100644 node_modules/passport/package.json create mode 100644 node_modules/passport/sponsors/descope-dark.svg create mode 100644 node_modules/passport/sponsors/descope.svg create mode 100644 node_modules/passport/sponsors/fusionauth.png create mode 100644 node_modules/passport/sponsors/fusionauth.svg create mode 100644 node_modules/passport/sponsors/loginradius.png create mode 100644 node_modules/passport/sponsors/snyk.png create mode 100644 node_modules/passport/sponsors/workos.png create mode 100644 node_modules/path-to-regexp/LICENSE create mode 100644 node_modules/path-to-regexp/Readme.md create mode 100644 node_modules/path-to-regexp/index.js create mode 100644 node_modules/path-to-regexp/package.json create mode 100644 node_modules/pause/.npmignore create mode 100644 node_modules/pause/History.md create mode 100644 node_modules/pause/Makefile create mode 100644 node_modules/pause/Readme.md create mode 100644 node_modules/pause/index.js create mode 100644 node_modules/pause/package.json create mode 100644 node_modules/process-nextick-args/index.js create mode 100644 node_modules/process-nextick-args/license.md create mode 100644 node_modules/process-nextick-args/package.json create mode 100644 node_modules/process-nextick-args/readme.md create mode 100644 node_modules/proxy-addr/HISTORY.md create mode 100644 node_modules/proxy-addr/LICENSE create mode 100644 node_modules/proxy-addr/README.md create mode 100644 node_modules/proxy-addr/index.js create mode 100644 node_modules/proxy-addr/package.json create mode 100644 node_modules/qs/.editorconfig create mode 100644 node_modules/qs/.eslintrc create mode 100644 node_modules/qs/.github/FUNDING.yml create mode 100644 node_modules/qs/.nycrc create mode 100644 node_modules/qs/CHANGELOG.md create mode 100644 node_modules/qs/LICENSE.md create mode 100644 node_modules/qs/README.md create mode 100644 node_modules/qs/dist/qs.js create mode 100644 node_modules/qs/lib/formats.js create mode 100644 node_modules/qs/lib/index.js create mode 100644 node_modules/qs/lib/parse.js create mode 100644 node_modules/qs/lib/stringify.js create mode 100644 node_modules/qs/lib/utils.js create mode 100644 node_modules/qs/package.json create mode 100644 node_modules/qs/test/empty-keys-cases.js create mode 100644 node_modules/qs/test/parse.js create mode 100644 node_modules/qs/test/stringify.js create mode 100644 node_modules/qs/test/utils.js create mode 100644 node_modules/random-bytes/HISTORY.md create mode 100644 node_modules/random-bytes/LICENSE create mode 100644 node_modules/random-bytes/README.md create mode 100644 node_modules/random-bytes/index.js create mode 100644 node_modules/random-bytes/package.json create mode 100644 node_modules/range-parser/HISTORY.md create mode 100644 node_modules/range-parser/LICENSE create mode 100644 node_modules/range-parser/README.md create mode 100644 node_modules/range-parser/index.js create mode 100644 node_modules/range-parser/package.json create mode 100644 node_modules/raw-body/HISTORY.md create mode 100644 node_modules/raw-body/LICENSE create mode 100644 node_modules/raw-body/README.md create mode 100644 node_modules/raw-body/SECURITY.md create mode 100644 node_modules/raw-body/index.d.ts create mode 100644 node_modules/raw-body/index.js create mode 100644 node_modules/raw-body/package.json create mode 100644 node_modules/readable-stream/.travis.yml create mode 100644 node_modules/readable-stream/CONTRIBUTING.md create mode 100644 node_modules/readable-stream/GOVERNANCE.md create mode 100644 node_modules/readable-stream/LICENSE create mode 100644 node_modules/readable-stream/README.md create mode 100644 node_modules/readable-stream/doc/wg-meetings/2015-01-30.md create mode 100644 node_modules/readable-stream/duplex-browser.js create mode 100644 node_modules/readable-stream/duplex.js create mode 100644 node_modules/readable-stream/lib/_stream_duplex.js create mode 100644 node_modules/readable-stream/lib/_stream_passthrough.js create mode 100644 node_modules/readable-stream/lib/_stream_readable.js create mode 100644 node_modules/readable-stream/lib/_stream_transform.js create mode 100644 node_modules/readable-stream/lib/_stream_writable.js create mode 100644 node_modules/readable-stream/lib/internal/streams/BufferList.js create mode 100644 node_modules/readable-stream/lib/internal/streams/destroy.js create mode 100644 node_modules/readable-stream/lib/internal/streams/stream-browser.js create mode 100644 node_modules/readable-stream/lib/internal/streams/stream.js create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/LICENSE create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/README.md create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/index.d.ts create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/index.js create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/package.json create mode 100644 node_modules/readable-stream/package.json create mode 100644 node_modules/readable-stream/passthrough.js create mode 100644 node_modules/readable-stream/readable-browser.js create mode 100644 node_modules/readable-stream/readable.js create mode 100644 node_modules/readable-stream/transform.js create mode 100644 node_modules/readable-stream/writable-browser.js create mode 100644 node_modules/readable-stream/writable.js create mode 100644 node_modules/require-at/README.md create mode 100644 node_modules/require-at/create-require.js create mode 100644 node_modules/require-at/package.json create mode 100644 node_modules/require-at/require-at.js create mode 100644 node_modules/safe-buffer/LICENSE create mode 100644 node_modules/safe-buffer/README.md create mode 100644 node_modules/safe-buffer/index.d.ts create mode 100644 node_modules/safe-buffer/index.js create mode 100644 node_modules/safe-buffer/package.json create mode 100644 node_modules/safer-buffer/LICENSE create mode 100644 node_modules/safer-buffer/Porting-Buffer.md create mode 100644 node_modules/safer-buffer/Readme.md create mode 100644 node_modules/safer-buffer/dangerous.js create mode 100644 node_modules/safer-buffer/package.json create mode 100644 node_modules/safer-buffer/safer.js create mode 100644 node_modules/safer-buffer/tests.js create mode 100644 node_modules/saslprep/.editorconfig create mode 100644 node_modules/saslprep/.gitattributes create mode 100644 node_modules/saslprep/.travis.yml create mode 100644 node_modules/saslprep/CHANGELOG.md create mode 100644 node_modules/saslprep/LICENSE create mode 100644 node_modules/saslprep/code-points.mem create mode 100644 node_modules/saslprep/generate-code-points.js create mode 100644 node_modules/saslprep/index.js create mode 100644 node_modules/saslprep/lib/code-points.js create mode 100644 node_modules/saslprep/lib/memory-code-points.js create mode 100644 node_modules/saslprep/lib/util.js create mode 100644 node_modules/saslprep/package.json create mode 100644 node_modules/saslprep/readme.md create mode 100644 node_modules/saslprep/test/index.js create mode 100644 node_modules/saslprep/test/util.js create mode 100644 node_modules/send/HISTORY.md create mode 100644 node_modules/send/LICENSE create mode 100644 node_modules/send/README.md create mode 100644 node_modules/send/SECURITY.md create mode 100644 node_modules/send/index.js create mode 100644 node_modules/send/node_modules/encodeurl/HISTORY.md create mode 100644 node_modules/send/node_modules/encodeurl/LICENSE create mode 100644 node_modules/send/node_modules/encodeurl/README.md create mode 100644 node_modules/send/node_modules/encodeurl/index.js create mode 100644 node_modules/send/node_modules/encodeurl/package.json create mode 100644 node_modules/send/node_modules/ms/index.js create mode 100644 node_modules/send/node_modules/ms/license.md create mode 100644 node_modules/send/node_modules/ms/package.json create mode 100644 node_modules/send/node_modules/ms/readme.md create mode 100644 node_modules/send/package.json create mode 100644 node_modules/serve-static/HISTORY.md create mode 100644 node_modules/serve-static/LICENSE create mode 100644 node_modules/serve-static/README.md create mode 100644 node_modules/serve-static/index.js create mode 100644 node_modules/serve-static/package.json create mode 100644 node_modules/set-function-length/.eslintrc create mode 100644 node_modules/set-function-length/.github/FUNDING.yml create mode 100644 node_modules/set-function-length/.nycrc create mode 100644 node_modules/set-function-length/CHANGELOG.md create mode 100644 node_modules/set-function-length/LICENSE create mode 100644 node_modules/set-function-length/README.md create mode 100644 node_modules/set-function-length/env.d.ts create mode 100644 node_modules/set-function-length/env.js create mode 100644 node_modules/set-function-length/index.d.ts create mode 100644 node_modules/set-function-length/index.js create mode 100644 node_modules/set-function-length/package.json create mode 100644 node_modules/set-function-length/tsconfig.json create mode 100644 node_modules/setprototypeof/LICENSE create mode 100644 node_modules/setprototypeof/README.md create mode 100644 node_modules/setprototypeof/index.d.ts create mode 100644 node_modules/setprototypeof/index.js create mode 100644 node_modules/setprototypeof/package.json create mode 100644 node_modules/setprototypeof/test/index.js create mode 100644 node_modules/side-channel/.editorconfig create mode 100644 node_modules/side-channel/.eslintrc create mode 100644 node_modules/side-channel/.github/FUNDING.yml create mode 100644 node_modules/side-channel/.nycrc create mode 100644 node_modules/side-channel/CHANGELOG.md create mode 100644 node_modules/side-channel/LICENSE create mode 100644 node_modules/side-channel/README.md create mode 100644 node_modules/side-channel/index.d.ts create mode 100644 node_modules/side-channel/index.js create mode 100644 node_modules/side-channel/package.json create mode 100644 node_modules/side-channel/test/index.js create mode 100644 node_modules/side-channel/tsconfig.json create mode 100644 node_modules/sparse-bitfield/.npmignore create mode 100644 node_modules/sparse-bitfield/.travis.yml create mode 100644 node_modules/sparse-bitfield/LICENSE create mode 100644 node_modules/sparse-bitfield/README.md create mode 100644 node_modules/sparse-bitfield/index.js create mode 100644 node_modules/sparse-bitfield/package.json create mode 100644 node_modules/sparse-bitfield/test.js create mode 100644 node_modules/statuses/HISTORY.md create mode 100644 node_modules/statuses/LICENSE create mode 100644 node_modules/statuses/README.md create mode 100644 node_modules/statuses/codes.json create mode 100644 node_modules/statuses/index.js create mode 100644 node_modules/statuses/package.json create mode 100644 node_modules/string_decoder/.travis.yml create mode 100644 node_modules/string_decoder/LICENSE create mode 100644 node_modules/string_decoder/README.md create mode 100644 node_modules/string_decoder/lib/string_decoder.js create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/LICENSE create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/README.md create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/index.d.ts create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/index.js create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/package.json create mode 100644 node_modules/string_decoder/package.json create mode 100644 node_modules/toidentifier/HISTORY.md create mode 100644 node_modules/toidentifier/LICENSE create mode 100644 node_modules/toidentifier/README.md create mode 100644 node_modules/toidentifier/index.js create mode 100644 node_modules/toidentifier/package.json create mode 100644 node_modules/type-is/HISTORY.md create mode 100644 node_modules/type-is/LICENSE create mode 100644 node_modules/type-is/README.md create mode 100644 node_modules/type-is/index.js create mode 100644 node_modules/type-is/package.json create mode 100644 node_modules/uid-safe/HISTORY.md create mode 100644 node_modules/uid-safe/LICENSE create mode 100644 node_modules/uid-safe/README.md create mode 100644 node_modules/uid-safe/index.js create mode 100644 node_modules/uid-safe/package.json create mode 100644 node_modules/uid2/HISTORY.md create mode 100644 node_modules/uid2/LICENSE create mode 100644 node_modules/uid2/README.md create mode 100644 node_modules/uid2/index.js create mode 100644 node_modules/uid2/package.json create mode 100644 node_modules/unpipe/HISTORY.md create mode 100644 node_modules/unpipe/LICENSE create mode 100644 node_modules/unpipe/README.md create mode 100644 node_modules/unpipe/index.js create mode 100644 node_modules/unpipe/package.json create mode 100644 node_modules/util-deprecate/History.md create mode 100644 node_modules/util-deprecate/LICENSE create mode 100644 node_modules/util-deprecate/README.md create mode 100644 node_modules/util-deprecate/browser.js create mode 100644 node_modules/util-deprecate/node.js create mode 100644 node_modules/util-deprecate/package.json create mode 100644 node_modules/utils-merge/.npmignore create mode 100644 node_modules/utils-merge/LICENSE create mode 100644 node_modules/utils-merge/README.md create mode 100644 node_modules/utils-merge/index.js create mode 100644 node_modules/utils-merge/package.json create mode 100644 node_modules/vary/HISTORY.md create mode 100644 node_modules/vary/LICENSE create mode 100644 node_modules/vary/README.md create mode 100644 node_modules/vary/index.js create mode 100644 node_modules/vary/package.json create mode 100644 package-lock.json create mode 100644 package.json create mode 100644 public/css/main.css create mode 100644 public/index.html create mode 100644 public/js/main.js create mode 100644 public/login.html create mode 100644 public/register.html create mode 100644 server.js diff --git a/.env b/.env new file mode 100644 index 00000000..3d73414b --- /dev/null +++ b/.env @@ -0,0 +1 @@ +SESSION_SECRET="!@#$%^&*()QWERTYUIOPASDFGHJKLZXCVBNM" diff --git a/node_modules/.bin/mime b/node_modules/.bin/mime new file mode 120000 index 00000000..fbb7ee0e --- /dev/null +++ b/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/node_modules/.package-lock.json b/node_modules/.package-lock.json new file mode 100644 index 00000000..42c8bb70 --- /dev/null +++ b/node_modules/.package-lock.json @@ -0,0 +1,1094 @@ +{ + "name": "journal-entry-website", + "version": "1.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "node_modules/accepts": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz", + "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==", + "license": "MIT", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==", + "license": "MIT" + }, + "node_modules/base64url": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/base64url/-/base64url-3.0.1.tgz", + "integrity": "sha512-ir1UPr3dkwexU7FdV8qBBbNDRUhMmIekYMFZfi+C/sLNnRESKPl23nB9b2pltqfOQNnGzsDdId90AEtG5tCx4A==", + "license": "MIT", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/bl": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/bl/-/bl-2.2.1.tgz", + "integrity": "sha512-6Pesp1w0DEX1N550i/uGV/TqucVL4AM/pgThFSN/Qq9si1/DF9aIHs1BxD8V/QU0HoeHO6cQRTAuYnLPKq1e4g==", + "license": "MIT", + "dependencies": { + "readable-stream": "^2.3.5", + "safe-buffer": "^5.1.1" + } + }, + "node_modules/body-parser": { + "version": "1.20.3", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.3.tgz", + "integrity": "sha512-7rAxByjUMqQ3/bHJy7D6OGXvx/MMc4IqBn/X0fcM1QUcAItpZrBEYhWGem+tzXH90c+G01ypMcYJBO9Y30203g==", + "license": "MIT", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.5", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.13.0", + "raw-body": "2.5.2", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/bson": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/bson/-/bson-1.1.6.tgz", + "integrity": "sha512-EvVNVeGo4tHxwi8L6bPj3y3itEvStdwvvlojVxxbyYfoaxJ6keLgrTuKdyfEAszFK+H3olzBuafE0yoh0D1gdg==", + "license": "Apache-2.0", + "engines": { + "node": ">=0.6.19" + } + }, + "node_modules/bytes": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/call-bind": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.7.tgz", + "integrity": "sha512-GHTSNSYICQ7scH7sZ+M2rFopRoLh8t2bLSW6BbgrtLsahOIB5iyAVJf9GjWK3cYTDaMj4XdBpM1cA6pIS0Kv2w==", + "license": "MIT", + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "set-function-length": "^1.2.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/content-disposition": { + "version": "0.5.4", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz", + "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==", + "license": "MIT", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/content-type": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz", + "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.6.0.tgz", + "integrity": "sha512-U71cyTamuh1CRNCfpGY6to28lxvNwPG4Guz/EVjgf3Jmzv0vlDp1atT9eS5dDjMYHucpHbWns6Lwf3BKz6svdw==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ==", + "license": "MIT" + }, + "node_modules/core-util-is": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.3.tgz", + "integrity": "sha512-ZQBvi1DcpJ4GDqanjucZ2Hj3wEO5pZDS89BWbkcrvdxksJorwUDDZamX9ldFkp9aw2lmBDLgkObEA4DWNJ9FYQ==", + "license": "MIT" + }, + "node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/define-data-property": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.4.tgz", + "integrity": "sha512-rBMvIzlpA8v6E+SJZoo++HAYqsLrkg7MSfIinMPFhmkorw7X+dOXVJQs+QT69zGkzMyfDnIMN2Wid1+NbL3T+A==", + "license": "MIT", + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "gopd": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/denque": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/denque/-/denque-1.5.1.tgz", + "integrity": "sha512-XwE+iZ4D6ZUB7mfYRMb5wByE8L74HCn30FBN7sWnXksWc1LO1bPDl67pBR9o/kC4z/xSNAwkMYcGgqDV3BE3Hw==", + "license": "Apache-2.0", + "engines": { + "node": ">=0.10" + } + }, + "node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/destroy": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz", + "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==", + "license": "MIT", + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/dotenv": { + "version": "16.4.5", + "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.4.5.tgz", + "integrity": "sha512-ZmdL2rui+eB2YwhsWzjInR8LldtZHGDoQ1ugH85ppHKwpUHL7j7rN0Ti9NCnGiQbhaZ11FpR+7ao1dNsmduNUg==", + "license": "BSD-2-Clause", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://dotenvx.com" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==", + "license": "MIT" + }, + "node_modules/encodeurl": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz", + "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/es-define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.0.tgz", + "integrity": "sha512-jxayLKShrEqqzJ0eumQbVhTYQM27CfT1T35+gCgDFoL82JLsXqTJ76zv6A0YLOgEnLUMvLzsDsGIrl8NFpT2gQ==", + "license": "MIT", + "dependencies": { + "get-intrinsic": "^1.2.4" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-errors": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz", + "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==", + "license": "MIT" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/express": { + "version": "4.21.0", + "resolved": "https://registry.npmjs.org/express/-/express-4.21.0.tgz", + "integrity": "sha512-VqcNGcj/Id5ZT1LZ/cfihi3ttTn+NJmkli2eZADigjq29qTlWi/hAQ43t/VLPq8+UX06FCEx3ByOYet6ZFblng==", + "license": "MIT", + "dependencies": { + "accepts": "~1.3.8", + "array-flatten": "1.1.1", + "body-parser": "1.20.3", + "content-disposition": "0.5.4", + "content-type": "~1.0.4", + "cookie": "0.6.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "2.0.0", + "encodeurl": "~2.0.0", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "1.3.1", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "merge-descriptors": "1.0.3", + "methods": "~1.1.2", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.10", + "proxy-addr": "~2.0.7", + "qs": "6.13.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.2.1", + "send": "0.19.0", + "serve-static": "1.16.2", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/express-session": { + "version": "1.18.0", + "resolved": "https://registry.npmjs.org/express-session/-/express-session-1.18.0.tgz", + "integrity": "sha512-m93QLWr0ju+rOwApSsyso838LQwgfs44QtOP/WBiwtAgPIo/SAh1a5c6nn2BR6mFNZehTpqKDESzP+fRHVbxwQ==", + "license": "MIT", + "dependencies": { + "cookie": "0.6.0", + "cookie-signature": "1.0.7", + "debug": "2.6.9", + "depd": "~2.0.0", + "on-headers": "~1.0.2", + "parseurl": "~1.3.3", + "safe-buffer": "5.2.1", + "uid-safe": "~2.1.5" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/express-session/node_modules/cookie-signature": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.7.tgz", + "integrity": "sha512-NXdYc3dLr47pBkpUCHtKSwIOQXLVn8dZEuywboCOJY/osA0wFSLlSawr3KN8qXJEyX66FcONTH8EIlVuK0yyFA==", + "license": "MIT" + }, + "node_modules/finalhandler": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.3.1.tgz", + "integrity": "sha512-6BN9trH7bp3qvnrRyzsBz+g3lZxTNZTbVO2EV1CS0WIcDbawYVdYvGflME/9QP0h0pYlCDBCTjYa9nZzMDpyxQ==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~2.0.0", + "escape-html": "~1.0.3", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "statuses": "2.0.1", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/forwarded": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz", + "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "license": "MIT", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-intrinsic": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.4.tgz", + "integrity": "sha512-5uYhsJH8VJBTv7oslg4BznJYhDoRI6waYCxMmCdnTrcCrHA/fCFKoTFz2JKKE0HdDFUF7/oQuhzumXJK7paBRQ==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "has-proto": "^1.0.1", + "has-symbols": "^1.0.3", + "hasown": "^2.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gopd": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz", + "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==", + "license": "MIT", + "dependencies": { + "get-intrinsic": "^1.1.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-property-descriptors": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.2.tgz", + "integrity": "sha512-55JNKuIW+vq4Ke1BjOTjM2YctQIvCT7GFzHwmfZPGo5wnrgkid0YQtnAleFSqumZm4az3n2BS+erby5ipJdgrg==", + "license": "MIT", + "dependencies": { + "es-define-property": "^1.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-proto": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.3.tgz", + "integrity": "sha512-SJ1amZAJUiZS+PhsVLf5tGydlaVB8EdFpaSO4gmiUKUOxk8qzn5AIy4ZeJUmh22znIdk/uMAUT2pl3FxzVUH+Q==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-symbols": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz", + "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/hasown": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", + "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", + "license": "MIT", + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/http-errors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz", + "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==", + "license": "MIT", + "dependencies": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "license": "MIT", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "license": "ISC" + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "license": "MIT", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/isarray": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", + "integrity": "sha512-VLghIWNM6ELQzo7zwmcg0NmTVyWKYjvIeM83yjp0wRDTmUnrM678fQbcKBo6n2CJEF0szoG//ytg+TKla89ALQ==", + "license": "MIT" + }, + "node_modules/media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/memory-pager": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/memory-pager/-/memory-pager-1.5.0.tgz", + "integrity": "sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg==", + "license": "MIT", + "optional": true + }, + "node_modules/merge-descriptors": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.3.tgz", + "integrity": "sha512-gaNvAS7TZ897/rVaZ0nMtAyxNyi/pdbjbAwUpFQpN70GqnVfOiXpeUUMKRBmzXaSQ8DdTX4/0ms62r2K+hE6mQ==", + "license": "MIT", + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "license": "MIT", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "license": "MIT", + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mongodb": { + "version": "3.7.4", + "resolved": "https://registry.npmjs.org/mongodb/-/mongodb-3.7.4.tgz", + "integrity": "sha512-K5q8aBqEXMwWdVNh94UQTwZ6BejVbFhh1uB6c5FKtPE9eUMZPUO3sRZdgIEcHSrAWmxzpG/FeODDKL388sqRmw==", + "license": "Apache-2.0", + "dependencies": { + "bl": "^2.2.1", + "bson": "^1.1.4", + "denque": "^1.4.1", + "optional-require": "^1.1.8", + "safe-buffer": "^5.1.2" + }, + "engines": { + "node": ">=4" + }, + "optionalDependencies": { + "saslprep": "^1.0.0" + }, + "peerDependenciesMeta": { + "aws4": { + "optional": true + }, + "bson-ext": { + "optional": true + }, + "kerberos": { + "optional": true + }, + "mongodb-client-encryption": { + "optional": true + }, + "mongodb-extjson": { + "optional": true + }, + "snappy": { + "optional": true + } + } + }, + "node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==", + "license": "MIT" + }, + "node_modules/negotiator": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz", + "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/oauth": { + "version": "0.10.0", + "resolved": "https://registry.npmjs.org/oauth/-/oauth-0.10.0.tgz", + "integrity": "sha512-1orQ9MT1vHFGQxhuy7E/0gECD3fd2fCC+PIX+/jgmU/gI3EpRocXtmtvxCO5x3WZ443FLTLFWNDjl5MPJf9u+Q==", + "license": "MIT" + }, + "node_modules/object-inspect": { + "version": "1.13.2", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.2.tgz", + "integrity": "sha512-IRZSRuzJiynemAXPYtPe5BoI/RESNYR7TYm50MC5Mqbd3Jmw5y790sErYw3V6SryFJD64b74qQQs9wn5Bg/k3g==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "license": "MIT", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/on-headers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.2.tgz", + "integrity": "sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/optional-require": { + "version": "1.1.8", + "resolved": "https://registry.npmjs.org/optional-require/-/optional-require-1.1.8.tgz", + "integrity": "sha512-jq83qaUb0wNg9Krv1c5OQ+58EK+vHde6aBPzLvPPqJm89UQWsvSuFy9X/OSNJnFeSOKo7btE0n8Nl2+nE+z5nA==", + "license": "Apache-2.0", + "dependencies": { + "require-at": "^1.0.6" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/passport": { + "version": "0.7.0", + "resolved": "https://registry.npmjs.org/passport/-/passport-0.7.0.tgz", + "integrity": "sha512-cPLl+qZpSc+ireUvt+IzqbED1cHHkDoVYMo30jbJIdOOjQ1MQYZBPiNvmi8UM6lJuOpTPXJGZQk0DtC4y61MYQ==", + "license": "MIT", + "dependencies": { + "passport-strategy": "1.x.x", + "pause": "0.0.1", + "utils-merge": "^1.0.1" + }, + "engines": { + "node": ">= 0.4.0" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/jaredhanson" + } + }, + "node_modules/passport-google-oauth20": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/passport-google-oauth20/-/passport-google-oauth20-2.0.0.tgz", + "integrity": "sha512-KSk6IJ15RoxuGq7D1UKK/8qKhNfzbLeLrG3gkLZ7p4A6DBCcv7xpyQwuXtWdpyR0+E0mwkpjY1VfPOhxQrKzdQ==", + "license": "MIT", + "dependencies": { + "passport-oauth2": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/passport-oauth2": { + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/passport-oauth2/-/passport-oauth2-1.8.0.tgz", + "integrity": "sha512-cjsQbOrXIDE4P8nNb3FQRCCmJJ/utnFKEz2NX209f7KOHPoX18gF7gBzBbLLsj2/je4KrgiwLLGjf0lm9rtTBA==", + "license": "MIT", + "dependencies": { + "base64url": "3.x.x", + "oauth": "0.10.x", + "passport-strategy": "1.x.x", + "uid2": "0.0.x", + "utils-merge": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/jaredhanson" + } + }, + "node_modules/passport-strategy": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/passport-strategy/-/passport-strategy-1.0.0.tgz", + "integrity": "sha512-CB97UUvDKJde2V0KDWWB3lyf6PC3FaZP7YxZ2G8OAtn9p4HI9j9JLP9qjOGZFvyl8uwNT8qM+hGnz/n16NI7oA==", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/path-to-regexp": { + "version": "0.1.10", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.10.tgz", + "integrity": "sha512-7lf7qcQidTku0Gu3YDPc8DJ1q7OOucfa/BSsIwjuh56VU7katFvuM8hULfkwB3Fns/rsVF7PwPKVw1sl5KQS9w==", + "license": "MIT" + }, + "node_modules/pause": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/pause/-/pause-0.0.1.tgz", + "integrity": "sha512-KG8UEiEVkR3wGEb4m5yZkVCzigAD+cVEJck2CzYZO37ZGJfctvVptVO192MwrtPhzONn6go8ylnOdMhKqi4nfg==" + }, + "node_modules/process-nextick-args": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", + "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==", + "license": "MIT" + }, + "node_modules/proxy-addr": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz", + "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==", + "license": "MIT", + "dependencies": { + "forwarded": "0.2.0", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/qs": { + "version": "6.13.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.13.0.tgz", + "integrity": "sha512-+38qI9SOr8tfZ4QmJNplMUxqjbe7LKvvZgWdExBOmd+egZTtjLB67Gu0HRX3u/XOq7UU2Nx6nsjvS16Z9uwfpg==", + "license": "BSD-3-Clause", + "dependencies": { + "side-channel": "^1.0.6" + }, + "engines": { + "node": ">=0.6" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/random-bytes": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/random-bytes/-/random-bytes-1.0.0.tgz", + "integrity": "sha512-iv7LhNVO047HzYR3InF6pUcUsPQiHTM1Qal51DcGSuZFBil1aBBWG5eHPNek7bvILMaYJ/8RU1e8w1AMdHmLQQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.2.tgz", + "integrity": "sha512-8zGqypfENjCIqGhgXToC8aB2r7YrBX+AQAfIPs/Mlk+BtPTztOvTS01NRW/3Eh60J+a48lt8qsCzirQ6loCVfA==", + "license": "MIT", + "dependencies": { + "bytes": "3.1.2", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/readable-stream": { + "version": "2.3.8", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.8.tgz", + "integrity": "sha512-8p0AUk4XODgIewSi0l8Epjs+EVnWiK7NoDIEGU0HhE7+ZyY8D1IMY7odu5lRrFXGg71L15KG8QrPmum45RTtdA==", + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/readable-stream/node_modules/safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "license": "MIT" + }, + "node_modules/require-at": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/require-at/-/require-at-1.0.6.tgz", + "integrity": "sha512-7i1auJbMUrXEAZCOQ0VNJgmcT2VOKPRl2YGJwgpHpC9CE91Mv4/4UYIUm4chGJaI381ZDq1JUicFii64Hapd8g==", + "license": "Apache-2.0", + "engines": { + "node": ">=4" + } + }, + "node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT" + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==", + "license": "MIT" + }, + "node_modules/saslprep": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/saslprep/-/saslprep-1.0.3.tgz", + "integrity": "sha512-/MY/PEMbk2SuY5sScONwhUDsV2p77Znkb/q3nSVstq/yQzYJOH/Azh29p9oJLsl3LnQwSvZDKagDGBsBwSooag==", + "license": "MIT", + "optional": true, + "dependencies": { + "sparse-bitfield": "^3.0.3" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/send": { + "version": "0.19.0", + "resolved": "https://registry.npmjs.org/send/-/send-0.19.0.tgz", + "integrity": "sha512-dW41u5VfLXu8SJh5bwRmyYUbAoSB3c9uQh6L8h/KtsFREPWpbX1lrljJo186Jc4nmci/sGUZ9a0a0J2zgfq2hw==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "mime": "1.6.0", + "ms": "2.1.3", + "on-finished": "2.4.1", + "range-parser": "~1.2.1", + "statuses": "2.0.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/send/node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/serve-static": { + "version": "1.16.2", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.16.2.tgz", + "integrity": "sha512-VqpjJZKadQB/PEbEwvFdO43Ax5dFBZ2UECszz8bQ7pi7wt//PWe1P6MN7eCnjsatYtBT6EuiClbjSWP2WrIoTw==", + "license": "MIT", + "dependencies": { + "encodeurl": "~2.0.0", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.19.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/set-function-length": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.2.2.tgz", + "integrity": "sha512-pgRc4hJ4/sNjWCSS9AmnS40x3bNMDTknHgL5UaMBTMyJnU90EgWh1Rz+MC9eFu4BuN/UwZjKQuY/1v3rM7HMfg==", + "license": "MIT", + "dependencies": { + "define-data-property": "^1.1.4", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==", + "license": "ISC" + }, + "node_modules/side-channel": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.6.tgz", + "integrity": "sha512-fDW/EZ6Q9RiO8eFG8Hj+7u/oW+XrPTIChwCOM2+th2A6OblDtYYIpve9m+KvI9Z4C9qSEXlaGR6bTEYHReuglA==", + "license": "MIT", + "dependencies": { + "call-bind": "^1.0.7", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.4", + "object-inspect": "^1.13.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/sparse-bitfield": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/sparse-bitfield/-/sparse-bitfield-3.0.3.tgz", + "integrity": "sha512-kvzhi7vqKTfkh0PZU+2D2PIllw2ymqJKujUcyPMd9Y75Nv4nPbGJZXNhxsgdQab2BmlDct1YnfQCguEvHr7VsQ==", + "license": "MIT", + "optional": true, + "dependencies": { + "memory-pager": "^1.0.2" + } + }, + "node_modules/statuses": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz", + "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/string_decoder/node_modules/safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "license": "MIT" + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "license": "MIT", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "license": "MIT", + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/uid-safe": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/uid-safe/-/uid-safe-2.1.5.tgz", + "integrity": "sha512-KPHm4VL5dDXKz01UuEd88Df+KzynaohSL9fBh096KWAxSKZQDI2uBrVqtvRM4rwrIrRRKsdLNML/lnaaVSRioA==", + "license": "MIT", + "dependencies": { + "random-bytes": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/uid2": { + "version": "0.0.4", + "resolved": "https://registry.npmjs.org/uid2/-/uid2-0.0.4.tgz", + "integrity": "sha512-IevTus0SbGwQzYh3+fRsAMTVVPOoIVufzacXcHPmdlle1jUpq7BRL+mw3dgeLanvGZdwwbWhRV6XrcFNdBmjWA==", + "license": "MIT" + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", + "license": "MIT" + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==", + "license": "MIT", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + } + } +} diff --git a/node_modules/accepts/HISTORY.md b/node_modules/accepts/HISTORY.md new file mode 100644 index 00000000..cb5990c7 --- /dev/null +++ b/node_modules/accepts/HISTORY.md @@ -0,0 +1,243 @@ +1.3.8 / 2022-02-02 +================== + + * deps: mime-types@~2.1.34 + - deps: mime-db@~1.51.0 + * deps: negotiator@0.6.3 + +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/node_modules/accepts/LICENSE b/node_modules/accepts/LICENSE new file mode 100644 index 00000000..06166077 --- /dev/null +++ b/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/accepts/README.md b/node_modules/accepts/README.md new file mode 100644 index 00000000..82680c53 --- /dev/null +++ b/node_modules/accepts/README.md @@ -0,0 +1,140 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts diff --git a/node_modules/accepts/index.js b/node_modules/accepts/index.js new file mode 100644 index 00000000..e9b2f63f --- /dev/null +++ b/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/node_modules/accepts/package.json b/node_modules/accepts/package.json new file mode 100644 index 00000000..0f2d15da --- /dev/null +++ b/node_modules/accepts/package.json @@ -0,0 +1,47 @@ +{ + "name": "accepts", + "description": "Higher-level content negotiation", + "version": "1.3.8", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "jshttp/accepts", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ] +} diff --git a/node_modules/array-flatten/LICENSE b/node_modules/array-flatten/LICENSE new file mode 100644 index 00000000..983fbe8a --- /dev/null +++ b/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/array-flatten/README.md b/node_modules/array-flatten/README.md new file mode 100644 index 00000000..91fa5b63 --- /dev/null +++ b/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/node_modules/array-flatten/array-flatten.js b/node_modules/array-flatten/array-flatten.js new file mode 100644 index 00000000..089117b3 --- /dev/null +++ b/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/node_modules/array-flatten/package.json b/node_modules/array-flatten/package.json new file mode 100644 index 00000000..1a24e2a1 --- /dev/null +++ b/node_modules/array-flatten/package.json @@ -0,0 +1,39 @@ +{ + "name": "array-flatten", + "version": "1.1.1", + "description": "Flatten an array of nested arrays into a single flat array", + "main": "array-flatten.js", + "files": [ + "array-flatten.js", + "LICENSE" + ], + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "homepage": "https://github.com/blakeembrey/array-flatten", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + } +} diff --git a/node_modules/base64url/LICENSE b/node_modules/base64url/LICENSE new file mode 100644 index 00000000..bca88ce8 --- /dev/null +++ b/node_modules/base64url/LICENSE @@ -0,0 +1,20 @@ +Copyright (c) 2013–2016 Brian J. Brennan + +Permission is hereby granted, free of charge, to any person obtaining a +copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/base64url/dist/.gitkeep b/node_modules/base64url/dist/.gitkeep new file mode 100644 index 00000000..e69de29b diff --git a/node_modules/base64url/dist/base64url.d.ts b/node_modules/base64url/dist/base64url.d.ts new file mode 100644 index 00000000..f3b828b1 --- /dev/null +++ b/node_modules/base64url/dist/base64url.d.ts @@ -0,0 +1,11 @@ +/// +export interface Base64Url { + (input: string | Buffer, encoding?: string): string; + encode(input: string | Buffer, encoding?: string): string; + decode(base64url: string, encoding?: string): string; + toBase64(base64url: string | Buffer): string; + fromBase64(base64: string): string; + toBuffer(base64url: string): Buffer; +} +declare let base64url: Base64Url; +export default base64url; diff --git a/node_modules/base64url/dist/base64url.js b/node_modules/base64url/dist/base64url.js new file mode 100644 index 00000000..e0897b0d --- /dev/null +++ b/node_modules/base64url/dist/base64url.js @@ -0,0 +1,37 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +var pad_string_1 = require("./pad-string"); +function encode(input, encoding) { + if (encoding === void 0) { encoding = "utf8"; } + if (Buffer.isBuffer(input)) { + return fromBase64(input.toString("base64")); + } + return fromBase64(Buffer.from(input, encoding).toString("base64")); +} +; +function decode(base64url, encoding) { + if (encoding === void 0) { encoding = "utf8"; } + return Buffer.from(toBase64(base64url), "base64").toString(encoding); +} +function toBase64(base64url) { + base64url = base64url.toString(); + return pad_string_1.default(base64url) + .replace(/\-/g, "+") + .replace(/_/g, "/"); +} +function fromBase64(base64) { + return base64 + .replace(/=/g, "") + .replace(/\+/g, "-") + .replace(/\//g, "_"); +} +function toBuffer(base64url) { + return Buffer.from(toBase64(base64url), "base64"); +} +var base64url = encode; +base64url.encode = encode; +base64url.decode = decode; +base64url.toBase64 = toBase64; +base64url.fromBase64 = fromBase64; +base64url.toBuffer = toBuffer; +exports.default = base64url; diff --git a/node_modules/base64url/dist/pad-string.d.ts b/node_modules/base64url/dist/pad-string.d.ts new file mode 100644 index 00000000..1f692ecd --- /dev/null +++ b/node_modules/base64url/dist/pad-string.d.ts @@ -0,0 +1 @@ +export default function padString(input: string): string; diff --git a/node_modules/base64url/dist/pad-string.js b/node_modules/base64url/dist/pad-string.js new file mode 100644 index 00000000..638e25b6 --- /dev/null +++ b/node_modules/base64url/dist/pad-string.js @@ -0,0 +1,20 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +function padString(input) { + var segmentLength = 4; + var stringLength = input.length; + var diff = stringLength % segmentLength; + if (!diff) { + return input; + } + var position = stringLength; + var padLength = segmentLength - diff; + var paddedStringLength = stringLength + padLength; + var buffer = Buffer.alloc(paddedStringLength); + buffer.write(input); + while (padLength--) { + buffer.write("=", position++); + } + return buffer.toString(); +} +exports.default = padString; diff --git a/node_modules/base64url/index.js b/node_modules/base64url/index.js new file mode 100644 index 00000000..85e5831e --- /dev/null +++ b/node_modules/base64url/index.js @@ -0,0 +1,2 @@ +module.exports = require('./dist/base64url').default; +module.exports.default = module.exports; diff --git a/node_modules/base64url/package.json b/node_modules/base64url/package.json new file mode 100644 index 00000000..bb392c2b --- /dev/null +++ b/node_modules/base64url/package.json @@ -0,0 +1,35 @@ +{ + "name": "base64url", + "version": "3.0.1", + "description": "For encoding to/from base64urls", + "main": "index.js", + "types": "./dist/base64url.d.ts", + "files": [ + "dist/", + "index.js" + ], + "scripts": { + "build": "tsc", + "clean": "rm -f dist/*", + "test": "npm run clean && npm run build && tap test/*.test.js", + "prepublishOnly": "npm run test" + }, + "repository": { + "type": "git", + "url": "git://github.com/brianloveswords/base64url.git" + }, + "keywords": [ + "base64", + "base64url" + ], + "author": "Brian J Brennan", + "license": "MIT", + "readmeFilename": "README.md", + "engines": { + "node": ">=6.0.0" + }, + "devDependencies": { + "@types/node": "^10.0.0", + "tap": "^12.1.0" + } +} diff --git a/node_modules/base64url/readme.md b/node_modules/base64url/readme.md new file mode 100644 index 00000000..eb7a6e7b --- /dev/null +++ b/node_modules/base64url/readme.md @@ -0,0 +1,127 @@ +# base64url [![Build Status](https://secure.travis-ci.org/brianloveswords/base64url.png)](http://travis-ci.org/brianloveswords/base64url) + +Converting to, and from, [base64url](http://en.wikipedia.org/wiki/Base64#RFC_4648) + +# Install + +```bash +$ npm install base64url +``` + +After installing with `npm` you can require this library from JavaScript or TypeScript: + +JavaScript +```js +const base64url = require('base64url'); +``` + +TypeScript: +```typescript +import base64url from "base64url"; +``` + +# Usage + +## CLI + +The CLI has been removed. For the time being, please install `base64url@1.0.6` if you need the CLI. + +## Library + +### base64url(input: string | Buffer, encoding: string = "utf8"): string + +### base64url.encode(input: string | Buffer, encoding: string = "utf8"): string + +base64url encode `input`. Input should be a `string` or a `Buffer`. + + +Example + +```js +> base64url("ladies and gentlemen we are floating in space") +'bGFkaWVzIGFuZCBnZW50bGVtYW4sIHdlIGFyZSBmbG9hdGluZyBpbiBzcGFjZQ' +``` + +--- + +### base64url.decode(input: string, encoding: string = "utf8"): string + +Convert a base64url encoded string into a raw string. The `encoding` argument can be used if the input is a string that's not utf8. + +```js +> base64url.decode("cmlkZTogZHJlYW1zIGJ1cm4gZG93bg") +'ride: dreams burn down' +``` + +--- + +### base64url.fromBase64(input: string): string + +Convert a base64 encoded string to a base64url encoded string. + +Example + +```js +> base64url.fromBase64('qL8R4QIcQ/ZsRqOAbeRfcZhilN/MksRtDaErMA==') +'qL8R4QIcQ_ZsRqOAbeRfcZhilN_MksRtDaErMA' +``` + +--- + + +### base64url.toBase64(input: string): string + +Convert a base64url encoded string to a base64 encoded string. + +```js +> base64url.toBase64('qL8R4QIcQ_ZsRqOAbeRfcZhilN_MksRtDaErMA') +'qL8R4QIcQ/ZsRqOAbeRfcZhilN/MksRtDaErMA==' +``` + +--- + + +### base64url.toBuffer(input: string): Buffer + +Convert a base64url encoded string to a Buffer containing the decoded bytes. + +```js +> base64url.toBuffer('c3Bpcml0dWFsaXplZA') + +``` + +# Alternatives + +- [base64-url](https://github.com/joaquimserafim/base64-url) + +# Supported Node.js versions + +This library should be used with current versions of the Node.js runtime's long-term stable (LTS) +schedule. More information can be found [at the Node.js Release Working Group](https://github.com/nodejs/Release) repo. + +# License + +MIT + +``` +Copyright (c) 2013–2016 Brian J. Brennan + +Permission is hereby granted, free of charge, to any person obtaining a +copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +``` diff --git a/node_modules/bl/.jshintrc b/node_modules/bl/.jshintrc new file mode 100644 index 00000000..be119b29 --- /dev/null +++ b/node_modules/bl/.jshintrc @@ -0,0 +1,60 @@ +{ + "predef": [ ] + , "bitwise": false + , "camelcase": false + , "curly": false + , "eqeqeq": false + , "forin": false + , "immed": false + , "latedef": false + , "noarg": true + , "noempty": true + , "nonew": true + , "plusplus": false + , "quotmark": true + , "regexp": false + , "undef": true + , "unused": true + , "strict": false + , "trailing": true + , "maxlen": 120 + , "asi": true + , "boss": true + , "debug": true + , "eqnull": true + , "esnext": false + , "evil": true + , "expr": true + , "funcscope": false + , "globalstrict": false + , "iterator": false + , "lastsemic": true + , "laxbreak": true + , "laxcomma": true + , "loopfunc": true + , "multistr": false + , "onecase": false + , "proto": false + , "regexdash": false + , "scripturl": true + , "smarttabs": false + , "shadow": false + , "sub": true + , "supernew": false + , "validthis": true + , "browser": true + , "couch": false + , "devel": false + , "dojo": false + , "mootools": false + , "node": true + , "nonstandard": true + , "prototypejs": false + , "rhino": false + , "worker": true + , "wsh": false + , "nomen": false + , "onevar": false + , "passfail": false + , "esversion": 3 +} \ No newline at end of file diff --git a/node_modules/bl/.travis.yml b/node_modules/bl/.travis.yml new file mode 100644 index 00000000..1044a092 --- /dev/null +++ b/node_modules/bl/.travis.yml @@ -0,0 +1,15 @@ +sudo: false +language: node_js +node_js: + - '4' + - '6' + - '8' + - '9' + - '10' +branches: + only: + - master +notifications: + email: + - rod@vagg.org + - matteo.collina@gmail.com diff --git a/node_modules/bl/LICENSE.md b/node_modules/bl/LICENSE.md new file mode 100644 index 00000000..dea757d4 --- /dev/null +++ b/node_modules/bl/LICENSE.md @@ -0,0 +1,13 @@ +The MIT License (MIT) +===================== + +Copyright (c) 2013-2018 bl contributors +---------------------------------- + +*bl contributors listed at * + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/bl/README.md b/node_modules/bl/README.md new file mode 100644 index 00000000..79dca353 --- /dev/null +++ b/node_modules/bl/README.md @@ -0,0 +1,218 @@ +# bl *(BufferList)* + +[![Build Status](https://travis-ci.org/rvagg/bl.svg?branch=master)](https://travis-ci.org/rvagg/bl) + +**A Node.js Buffer list collector, reader and streamer thingy.** + +[![NPM](https://nodei.co/npm/bl.png?downloads=true&downloadRank=true)](https://nodei.co/npm/bl/) +[![NPM](https://nodei.co/npm-dl/bl.png?months=6&height=3)](https://nodei.co/npm/bl/) + +**bl** is a storage object for collections of Node Buffers, exposing them with the main Buffer readable API. Also works as a duplex stream so you can collect buffers from a stream that emits them and emit buffers to a stream that consumes them! + +The original buffers are kept intact and copies are only done as necessary. Any reads that require the use of a single original buffer will return a slice of that buffer only (which references the same memory as the original buffer). Reads that span buffers perform concatenation as required and return the results transparently. + +```js +const BufferList = require('bl') + +var bl = new BufferList() +bl.append(Buffer.from('abcd')) +bl.append(Buffer.from('efg')) +bl.append('hi') // bl will also accept & convert Strings +bl.append(Buffer.from('j')) +bl.append(Buffer.from([ 0x3, 0x4 ])) + +console.log(bl.length) // 12 + +console.log(bl.slice(0, 10).toString('ascii')) // 'abcdefghij' +console.log(bl.slice(3, 10).toString('ascii')) // 'defghij' +console.log(bl.slice(3, 6).toString('ascii')) // 'def' +console.log(bl.slice(3, 8).toString('ascii')) // 'defgh' +console.log(bl.slice(5, 10).toString('ascii')) // 'fghij' + +console.log(bl.indexOf('def')) // 3 +console.log(bl.indexOf('asdf')) // -1 + +// or just use toString! +console.log(bl.toString()) // 'abcdefghij\u0003\u0004' +console.log(bl.toString('ascii', 3, 8)) // 'defgh' +console.log(bl.toString('ascii', 5, 10)) // 'fghij' + +// other standard Buffer readables +console.log(bl.readUInt16BE(10)) // 0x0304 +console.log(bl.readUInt16LE(10)) // 0x0403 +``` + +Give it a callback in the constructor and use it just like **[concat-stream](https://github.com/maxogden/node-concat-stream)**: + +```js +const bl = require('bl') + , fs = require('fs') + +fs.createReadStream('README.md') + .pipe(bl(function (err, data) { // note 'new' isn't strictly required + // `data` is a complete Buffer object containing the full data + console.log(data.toString()) + })) +``` + +Note that when you use the *callback* method like this, the resulting `data` parameter is a concatenation of all `Buffer` objects in the list. If you want to avoid the overhead of this concatenation (in cases of extreme performance consciousness), then avoid the *callback* method and just listen to `'end'` instead, like a standard Stream. + +Or to fetch a URL using [hyperquest](https://github.com/substack/hyperquest) (should work with [request](http://github.com/mikeal/request) and even plain Node http too!): +```js +const hyperquest = require('hyperquest') + , bl = require('bl') + , url = 'https://raw.github.com/rvagg/bl/master/README.md' + +hyperquest(url).pipe(bl(function (err, data) { + console.log(data.toString()) +})) +``` + +Or, use it as a readable stream to recompose a list of Buffers to an output source: + +```js +const BufferList = require('bl') + , fs = require('fs') + +var bl = new BufferList() +bl.append(Buffer.from('abcd')) +bl.append(Buffer.from('efg')) +bl.append(Buffer.from('hi')) +bl.append(Buffer.from('j')) + +bl.pipe(fs.createWriteStream('gibberish.txt')) +``` + +## API + + * new BufferList([ callback ]) + * bl.length + * bl.append(buffer) + * bl.get(index) + * bl.indexOf(value[, byteOffset][, encoding]) + * bl.slice([ start[, end ] ]) + * bl.shallowSlice([ start[, end ] ]) + * bl.copy(dest, [ destStart, [ srcStart [, srcEnd ] ] ]) + * bl.duplicate() + * bl.consume(bytes) + * bl.toString([encoding, [ start, [ end ]]]) + * bl.readDoubleBE(), bl.readDoubleLE(), bl.readFloatBE(), bl.readFloatLE(), bl.readInt32BE(), bl.readInt32LE(), bl.readUInt32BE(), bl.readUInt32LE(), bl.readInt16BE(), bl.readInt16LE(), bl.readUInt16BE(), bl.readUInt16LE(), bl.readInt8(), bl.readUInt8() + * Streams + +-------------------------------------------------------- + +### new BufferList([ callback | Buffer | Buffer array | BufferList | BufferList array | String ]) +The constructor takes an optional callback, if supplied, the callback will be called with an error argument followed by a reference to the **bl** instance, when `bl.end()` is called (i.e. from a piped stream). This is a convenient method of collecting the entire contents of a stream, particularly when the stream is *chunky*, such as a network stream. + +Normally, no arguments are required for the constructor, but you can initialise the list by passing in a single `Buffer` object or an array of `Buffer` object. + +`new` is not strictly required, if you don't instantiate a new object, it will be done automatically for you so you can create a new instance simply with: + +```js +var bl = require('bl') +var myinstance = bl() + +// equivalent to: + +var BufferList = require('bl') +var myinstance = new BufferList() +``` + +-------------------------------------------------------- + +### bl.length +Get the length of the list in bytes. This is the sum of the lengths of all of the buffers contained in the list, minus any initial offset for a semi-consumed buffer at the beginning. Should accurately represent the total number of bytes that can be read from the list. + +-------------------------------------------------------- + +### bl.append(Buffer | Buffer array | BufferList | BufferList array | String) +`append(buffer)` adds an additional buffer or BufferList to the internal list. `this` is returned so it can be chained. + +-------------------------------------------------------- + +### bl.get(index) +`get()` will return the byte at the specified index. + +-------------------------------------------------------- + +### bl.indexOf(value[, byteOffset][, encoding]) +`get()` will return the byte at the specified index. +`indexOf()` method returns the first index at which a given element can be found in the BufferList, or -1 if it is not present. + +-------------------------------------------------------- + +### bl.slice([ start, [ end ] ]) +`slice()` returns a new `Buffer` object containing the bytes within the range specified. Both `start` and `end` are optional and will default to the beginning and end of the list respectively. + +If the requested range spans a single internal buffer then a slice of that buffer will be returned which shares the original memory range of that Buffer. If the range spans multiple buffers then copy operations will likely occur to give you a uniform Buffer. + +-------------------------------------------------------- + +### bl.shallowSlice([ start, [ end ] ]) +`shallowSlice()` returns a new `BufferList` object containing the bytes within the range specified. Both `start` and `end` are optional and will default to the beginning and end of the list respectively. + +No copies will be performed. All buffers in the result share memory with the original list. + +-------------------------------------------------------- + +### bl.copy(dest, [ destStart, [ srcStart [, srcEnd ] ] ]) +`copy()` copies the content of the list in the `dest` buffer, starting from `destStart` and containing the bytes within the range specified with `srcStart` to `srcEnd`. `destStart`, `start` and `end` are optional and will default to the beginning of the `dest` buffer, and the beginning and end of the list respectively. + +-------------------------------------------------------- + +### bl.duplicate() +`duplicate()` performs a **shallow-copy** of the list. The internal Buffers remains the same, so if you change the underlying Buffers, the change will be reflected in both the original and the duplicate. This method is needed if you want to call `consume()` or `pipe()` and still keep the original list.Example: + +```js +var bl = new BufferList() + +bl.append('hello') +bl.append(' world') +bl.append('\n') + +bl.duplicate().pipe(process.stdout, { end: false }) + +console.log(bl.toString()) +``` + +-------------------------------------------------------- + +### bl.consume(bytes) +`consume()` will shift bytes *off the start of the list*. The number of bytes consumed don't need to line up with the sizes of the internal Buffers—initial offsets will be calculated accordingly in order to give you a consistent view of the data. + +-------------------------------------------------------- + +### bl.toString([encoding, [ start, [ end ]]]) +`toString()` will return a string representation of the buffer. The optional `start` and `end` arguments are passed on to `slice()`, while the `encoding` is passed on to `toString()` of the resulting Buffer. See the [Buffer#toString()](http://nodejs.org/docs/latest/api/buffer.html#buffer_buf_tostring_encoding_start_end) documentation for more information. + +-------------------------------------------------------- + +### bl.readDoubleBE(), bl.readDoubleLE(), bl.readFloatBE(), bl.readFloatLE(), bl.readInt32BE(), bl.readInt32LE(), bl.readUInt32BE(), bl.readUInt32LE(), bl.readInt16BE(), bl.readInt16LE(), bl.readUInt16BE(), bl.readUInt16LE(), bl.readInt8(), bl.readUInt8() + +All of the standard byte-reading methods of the `Buffer` interface are implemented and will operate across internal Buffer boundaries transparently. + +See the [Buffer](http://nodejs.org/docs/latest/api/buffer.html) documentation for how these work. + +-------------------------------------------------------- + +### Streams +**bl** is a Node **[Duplex Stream](http://nodejs.org/docs/latest/api/stream.html#stream_class_stream_duplex)**, so it can be read from and written to like a standard Node stream. You can also `pipe()` to and from a **bl** instance. + +-------------------------------------------------------- + +## Contributors + +**bl** is brought to you by the following hackers: + + * [Rod Vagg](https://github.com/rvagg) + * [Matteo Collina](https://github.com/mcollina) + * [Jarett Cruger](https://github.com/jcrugzz) + +======= + + +## License & copyright + +Copyright (c) 2013-2018 bl contributors (listed above). + +bl is licensed under the MIT license. All rights not explicitly granted in the MIT license are reserved. See the included LICENSE.md file for more details. diff --git a/node_modules/bl/bl.js b/node_modules/bl/bl.js new file mode 100644 index 00000000..52c37405 --- /dev/null +++ b/node_modules/bl/bl.js @@ -0,0 +1,392 @@ +'use strict' +var DuplexStream = require('readable-stream').Duplex + , util = require('util') + , Buffer = require('safe-buffer').Buffer + +function BufferList (callback) { + if (!(this instanceof BufferList)) + return new BufferList(callback) + + this._bufs = [] + this.length = 0 + + if (typeof callback == 'function') { + this._callback = callback + + var piper = function piper (err) { + if (this._callback) { + this._callback(err) + this._callback = null + } + }.bind(this) + + this.on('pipe', function onPipe (src) { + src.on('error', piper) + }) + this.on('unpipe', function onUnpipe (src) { + src.removeListener('error', piper) + }) + } else { + this.append(callback) + } + + DuplexStream.call(this) +} + + +util.inherits(BufferList, DuplexStream) + + +BufferList.prototype._offset = function _offset (offset) { + var tot = 0, i = 0, _t + if (offset === 0) return [ 0, 0 ] + for (; i < this._bufs.length; i++) { + _t = tot + this._bufs[i].length + if (offset < _t || i == this._bufs.length - 1) { + return [ i, offset - tot ] + } + tot = _t + } +} + +BufferList.prototype._reverseOffset = function (blOffset) { + var bufferId = blOffset[0] + var offset = blOffset[1] + for (var i = 0; i < bufferId; i++) { + offset += this._bufs[i].length + } + return offset +} + +BufferList.prototype.append = function append (buf) { + var i = 0 + + if (Buffer.isBuffer(buf)) { + this._appendBuffer(buf) + } else if (Array.isArray(buf)) { + for (; i < buf.length; i++) + this.append(buf[i]) + } else if (buf instanceof BufferList) { + // unwrap argument into individual BufferLists + for (; i < buf._bufs.length; i++) + this.append(buf._bufs[i]) + } else if (buf != null) { + // coerce number arguments to strings, since Buffer(number) does + // uninitialized memory allocation + if (typeof buf == 'number') + buf = buf.toString() + + this._appendBuffer(Buffer.from(buf)) + } + + return this +} + + +BufferList.prototype._appendBuffer = function appendBuffer (buf) { + this._bufs.push(buf) + this.length += buf.length +} + + +BufferList.prototype._write = function _write (buf, encoding, callback) { + this._appendBuffer(buf) + + if (typeof callback == 'function') + callback() +} + + +BufferList.prototype._read = function _read (size) { + if (!this.length) + return this.push(null) + + size = Math.min(size, this.length) + this.push(this.slice(0, size)) + this.consume(size) +} + + +BufferList.prototype.end = function end (chunk) { + DuplexStream.prototype.end.call(this, chunk) + + if (this._callback) { + this._callback(null, this.slice()) + this._callback = null + } +} + + +BufferList.prototype.get = function get (index) { + if (index > this.length || index < 0) { + return undefined + } + var offset = this._offset(index) + return this._bufs[offset[0]][offset[1]] +} + + +BufferList.prototype.slice = function slice (start, end) { + if (typeof start == 'number' && start < 0) + start += this.length + if (typeof end == 'number' && end < 0) + end += this.length + return this.copy(null, 0, start, end) +} + + +BufferList.prototype.copy = function copy (dst, dstStart, srcStart, srcEnd) { + if (typeof srcStart != 'number' || srcStart < 0) + srcStart = 0 + if (typeof srcEnd != 'number' || srcEnd > this.length) + srcEnd = this.length + if (srcStart >= this.length) + return dst || Buffer.alloc(0) + if (srcEnd <= 0) + return dst || Buffer.alloc(0) + + var copy = !!dst + , off = this._offset(srcStart) + , len = srcEnd - srcStart + , bytes = len + , bufoff = (copy && dstStart) || 0 + , start = off[1] + , l + , i + + // copy/slice everything + if (srcStart === 0 && srcEnd == this.length) { + if (!copy) { // slice, but full concat if multiple buffers + return this._bufs.length === 1 + ? this._bufs[0] + : Buffer.concat(this._bufs, this.length) + } + + // copy, need to copy individual buffers + for (i = 0; i < this._bufs.length; i++) { + this._bufs[i].copy(dst, bufoff) + bufoff += this._bufs[i].length + } + + return dst + } + + // easy, cheap case where it's a subset of one of the buffers + if (bytes <= this._bufs[off[0]].length - start) { + return copy + ? this._bufs[off[0]].copy(dst, dstStart, start, start + bytes) + : this._bufs[off[0]].slice(start, start + bytes) + } + + if (!copy) // a slice, we need something to copy in to + dst = Buffer.allocUnsafe(len) + + for (i = off[0]; i < this._bufs.length; i++) { + l = this._bufs[i].length - start + + if (bytes > l) { + this._bufs[i].copy(dst, bufoff, start) + bufoff += l + } else { + this._bufs[i].copy(dst, bufoff, start, start + bytes) + bufoff += l + break + } + + bytes -= l + + if (start) + start = 0 + } + + // safeguard so that we don't return uninitialized memory + if (dst.length > bufoff) return dst.slice(0, bufoff) + + return dst +} + +BufferList.prototype.shallowSlice = function shallowSlice (start, end) { + start = start || 0 + end = typeof end !== 'number' ? this.length : end + + if (start < 0) + start += this.length + if (end < 0) + end += this.length + + if (start === end) { + return new BufferList() + } + var startOffset = this._offset(start) + , endOffset = this._offset(end) + , buffers = this._bufs.slice(startOffset[0], endOffset[0] + 1) + + if (endOffset[1] == 0) + buffers.pop() + else + buffers[buffers.length-1] = buffers[buffers.length-1].slice(0, endOffset[1]) + + if (startOffset[1] != 0) + buffers[0] = buffers[0].slice(startOffset[1]) + + return new BufferList(buffers) +} + +BufferList.prototype.toString = function toString (encoding, start, end) { + return this.slice(start, end).toString(encoding) +} + +BufferList.prototype.consume = function consume (bytes) { + // first, normalize the argument, in accordance with how Buffer does it + bytes = Math.trunc(bytes) + // do nothing if not a positive number + if (Number.isNaN(bytes) || bytes <= 0) return this + + while (this._bufs.length) { + if (bytes >= this._bufs[0].length) { + bytes -= this._bufs[0].length + this.length -= this._bufs[0].length + this._bufs.shift() + } else { + this._bufs[0] = this._bufs[0].slice(bytes) + this.length -= bytes + break + } + } + return this +} + + +BufferList.prototype.duplicate = function duplicate () { + var i = 0 + , copy = new BufferList() + + for (; i < this._bufs.length; i++) + copy.append(this._bufs[i]) + + return copy +} + + +BufferList.prototype.destroy = function destroy () { + this._bufs.length = 0 + this.length = 0 + this.push(null) +} + + +BufferList.prototype.indexOf = function (search, offset, encoding) { + if (encoding === undefined && typeof offset === 'string') { + encoding = offset + offset = undefined + } + if (typeof search === 'function' || Array.isArray(search)) { + throw new TypeError('The "value" argument must be one of type string, Buffer, BufferList, or Uint8Array.') + } else if (typeof search === 'number') { + search = Buffer.from([search]) + } else if (typeof search === 'string') { + search = Buffer.from(search, encoding) + } else if (search instanceof BufferList) { + search = search.slice() + } else if (!Buffer.isBuffer(search)) { + search = Buffer.from(search) + } + + offset = Number(offset || 0) + if (isNaN(offset)) { + offset = 0 + } + + if (offset < 0) { + offset = this.length + offset + } + + if (offset < 0) { + offset = 0 + } + + if (search.length === 0) { + return offset > this.length ? this.length : offset + } + + var blOffset = this._offset(offset) + var blIndex = blOffset[0] // index of which internal buffer we're working on + var buffOffset = blOffset[1] // offset of the internal buffer we're working on + + // scan over each buffer + for (blIndex; blIndex < this._bufs.length; blIndex++) { + var buff = this._bufs[blIndex] + while(buffOffset < buff.length) { + var availableWindow = buff.length - buffOffset + if (availableWindow >= search.length) { + var nativeSearchResult = buff.indexOf(search, buffOffset) + if (nativeSearchResult !== -1) { + return this._reverseOffset([blIndex, nativeSearchResult]) + } + buffOffset = buff.length - search.length + 1 // end of native search window + } else { + var revOffset = this._reverseOffset([blIndex, buffOffset]) + if (this._match(revOffset, search)) { + return revOffset + } + buffOffset++ + } + } + buffOffset = 0 + } + return -1 +} + +BufferList.prototype._match = function(offset, search) { + if (this.length - offset < search.length) { + return false + } + for (var searchOffset = 0; searchOffset < search.length ; searchOffset++) { + if(this.get(offset + searchOffset) !== search[searchOffset]){ + return false + } + } + return true +} + + +;(function () { + var methods = { + 'readDoubleBE' : 8 + , 'readDoubleLE' : 8 + , 'readFloatBE' : 4 + , 'readFloatLE' : 4 + , 'readInt32BE' : 4 + , 'readInt32LE' : 4 + , 'readUInt32BE' : 4 + , 'readUInt32LE' : 4 + , 'readInt16BE' : 2 + , 'readInt16LE' : 2 + , 'readUInt16BE' : 2 + , 'readUInt16LE' : 2 + , 'readInt8' : 1 + , 'readUInt8' : 1 + , 'readIntBE' : null + , 'readIntLE' : null + , 'readUIntBE' : null + , 'readUIntLE' : null + } + + for (var m in methods) { + (function (m) { + if (methods[m] === null) { + BufferList.prototype[m] = function (offset, byteLength) { + return this.slice(offset, offset + byteLength)[m](0, byteLength) + } + } + else { + BufferList.prototype[m] = function (offset) { + return this.slice(offset, offset + methods[m])[m](0) + } + } + }(m)) + } +}()) + + +module.exports = BufferList diff --git a/node_modules/bl/package.json b/node_modules/bl/package.json new file mode 100644 index 00000000..496a7299 --- /dev/null +++ b/node_modules/bl/package.json @@ -0,0 +1,35 @@ +{ + "name": "bl", + "version": "2.2.1", + "description": "Buffer List: collect buffers and access with a standard readable Buffer interface, streamable too!", + "main": "bl.js", + "scripts": { + "test": "node test/test.js | faucet" + }, + "repository": { + "type": "git", + "url": "https://github.com/rvagg/bl.git" + }, + "homepage": "https://github.com/rvagg/bl", + "authors": [ + "Rod Vagg (https://github.com/rvagg)", + "Matteo Collina (https://github.com/mcollina)", + "Jarett Cruger (https://github.com/jcrugzz)" + ], + "keywords": [ + "buffer", + "buffers", + "stream", + "awesomesauce" + ], + "license": "MIT", + "dependencies": { + "readable-stream": "^2.3.5", + "safe-buffer": "^5.1.1" + }, + "devDependencies": { + "faucet": "0.0.1", + "hash_file": "~0.1.1", + "tape": "~4.9.0" + } +} diff --git a/node_modules/bl/test/indexOf.js b/node_modules/bl/test/indexOf.js new file mode 100644 index 00000000..68435e1a --- /dev/null +++ b/node_modules/bl/test/indexOf.js @@ -0,0 +1,463 @@ +'use strict' + +var tape = require('tape') + , BufferList = require('../') + , Buffer = require('safe-buffer').Buffer + +tape('indexOf single byte needle', t => { + const bl = new BufferList(['abcdefg', 'abcdefg', '12345']) + t.equal(bl.indexOf('e'), 4) + t.equal(bl.indexOf('e', 5), 11) + t.equal(bl.indexOf('e', 12), -1) + t.equal(bl.indexOf('5'), 18) + t.end() +}) + +tape('indexOf multiple byte needle', t => { + const bl = new BufferList(['abcdefg', 'abcdefg']) + t.equal(bl.indexOf('ef'), 4) + t.equal(bl.indexOf('ef', 5), 11) + t.end() +}) + +tape('indexOf multiple byte needles across buffer boundaries', t => { + const bl = new BufferList(['abcdefg', 'abcdefg']) + t.equal(bl.indexOf('fgabc'), 5) + t.end() +}) + +tape('indexOf takes a buffer list search', t => { + const bl = new BufferList(['abcdefg', 'abcdefg']) + const search = new BufferList('fgabc') + t.equal(bl.indexOf(search), 5) + t.end() +}) + +tape('indexOf a zero byte needle', t => { + const b = new BufferList('abcdef') + const buf_empty = Buffer.from('') + t.equal(b.indexOf(''), 0) + t.equal(b.indexOf('', 1), 1) + t.equal(b.indexOf('', b.length + 1), b.length) + t.equal(b.indexOf('', Infinity), b.length) + t.equal(b.indexOf(buf_empty), 0) + t.equal(b.indexOf(buf_empty, 1), 1) + t.equal(b.indexOf(buf_empty, b.length + 1), b.length) + t.equal(b.indexOf(buf_empty, Infinity), b.length) + t.end() +}) + +tape('indexOf buffers smaller and larger than the needle', t => { + const bl = new BufferList(['abcdefg', 'a', 'bcdefg', 'a', 'bcfgab']) + t.equal(bl.indexOf('fgabc'), 5) + t.equal(bl.indexOf('fgabc', 6), 12) + t.equal(bl.indexOf('fgabc', 13), -1) + t.end() +}) + +// only present in node 6+ +;(process.version.substr(1).split('.')[0] >= 6) && tape('indexOf latin1 and binary encoding', t => { + const b = new BufferList('abcdef') + + // test latin1 encoding + t.equal( + new BufferList(Buffer.from(b.toString('latin1'), 'latin1')) + .indexOf('d', 0, 'latin1'), + 3 + ) + t.equal( + new BufferList(Buffer.from(b.toString('latin1'), 'latin1')) + .indexOf(Buffer.from('d', 'latin1'), 0, 'latin1'), + 3 + ) + t.equal( + new BufferList(Buffer.from('aa\u00e8aa', 'latin1')) + .indexOf('\u00e8', 'latin1'), + 2 + ) + t.equal( + new BufferList(Buffer.from('\u00e8', 'latin1')) + .indexOf('\u00e8', 'latin1'), + 0 + ) + t.equal( + new BufferList(Buffer.from('\u00e8', 'latin1')) + .indexOf(Buffer.from('\u00e8', 'latin1'), 'latin1'), + 0 + ) + + // test binary encoding + t.equal( + new BufferList(Buffer.from(b.toString('binary'), 'binary')) + .indexOf('d', 0, 'binary'), + 3 + ) + t.equal( + new BufferList(Buffer.from(b.toString('binary'), 'binary')) + .indexOf(Buffer.from('d', 'binary'), 0, 'binary'), + 3 + ) + t.equal( + new BufferList(Buffer.from('aa\u00e8aa', 'binary')) + .indexOf('\u00e8', 'binary'), + 2 + ) + t.equal( + new BufferList(Buffer.from('\u00e8', 'binary')) + .indexOf('\u00e8', 'binary'), + 0 + ) + t.equal( + new BufferList(Buffer.from('\u00e8', 'binary')) + .indexOf(Buffer.from('\u00e8', 'binary'), 'binary'), + 0 + ) + t.end() +}) + +tape('indexOf the entire nodejs10 buffer test suite', t => { + const b = new BufferList('abcdef') + const buf_a = Buffer.from('a') + const buf_bc = Buffer.from('bc') + const buf_f = Buffer.from('f') + const buf_z = Buffer.from('z') + + const stringComparison = 'abcdef' + + t.equal(b.indexOf('a'), 0) + t.equal(b.indexOf('a', 1), -1) + t.equal(b.indexOf('a', -1), -1) + t.equal(b.indexOf('a', -4), -1) + t.equal(b.indexOf('a', -b.length), 0) + t.equal(b.indexOf('a', NaN), 0) + t.equal(b.indexOf('a', -Infinity), 0) + t.equal(b.indexOf('a', Infinity), -1) + t.equal(b.indexOf('bc'), 1) + t.equal(b.indexOf('bc', 2), -1) + t.equal(b.indexOf('bc', -1), -1) + t.equal(b.indexOf('bc', -3), -1) + t.equal(b.indexOf('bc', -5), 1) + t.equal(b.indexOf('bc', NaN), 1) + t.equal(b.indexOf('bc', -Infinity), 1) + t.equal(b.indexOf('bc', Infinity), -1) + t.equal(b.indexOf('f'), b.length - 1) + t.equal(b.indexOf('z'), -1) + // empty search tests + t.equal(b.indexOf(buf_a), 0) + t.equal(b.indexOf(buf_a, 1), -1) + t.equal(b.indexOf(buf_a, -1), -1) + t.equal(b.indexOf(buf_a, -4), -1) + t.equal(b.indexOf(buf_a, -b.length), 0) + t.equal(b.indexOf(buf_a, NaN), 0) + t.equal(b.indexOf(buf_a, -Infinity), 0) + t.equal(b.indexOf(buf_a, Infinity), -1) + t.equal(b.indexOf(buf_bc), 1) + t.equal(b.indexOf(buf_bc, 2), -1) + t.equal(b.indexOf(buf_bc, -1), -1) + t.equal(b.indexOf(buf_bc, -3), -1) + t.equal(b.indexOf(buf_bc, -5), 1) + t.equal(b.indexOf(buf_bc, NaN), 1) + t.equal(b.indexOf(buf_bc, -Infinity), 1) + t.equal(b.indexOf(buf_bc, Infinity), -1) + t.equal(b.indexOf(buf_f), b.length - 1) + t.equal(b.indexOf(buf_z), -1) + t.equal(b.indexOf(0x61), 0) + t.equal(b.indexOf(0x61, 1), -1) + t.equal(b.indexOf(0x61, -1), -1) + t.equal(b.indexOf(0x61, -4), -1) + t.equal(b.indexOf(0x61, -b.length), 0) + t.equal(b.indexOf(0x61, NaN), 0) + t.equal(b.indexOf(0x61, -Infinity), 0) + t.equal(b.indexOf(0x61, Infinity), -1) + t.equal(b.indexOf(0x0), -1) + + // test offsets + t.equal(b.indexOf('d', 2), 3) + t.equal(b.indexOf('f', 5), 5) + t.equal(b.indexOf('f', -1), 5) + t.equal(b.indexOf('f', 6), -1) + + t.equal(b.indexOf(Buffer.from('d'), 2), 3) + t.equal(b.indexOf(Buffer.from('f'), 5), 5) + t.equal(b.indexOf(Buffer.from('f'), -1), 5) + t.equal(b.indexOf(Buffer.from('f'), 6), -1) + + t.equal(Buffer.from('ff').indexOf(Buffer.from('f'), 1, 'ucs2'), -1) + + // test invalid and uppercase encoding + t.equal(b.indexOf('b', 'utf8'), 1) + t.equal(b.indexOf('b', 'UTF8'), 1) + t.equal(b.indexOf('62', 'HEX'), 1) + t.throws(() => b.indexOf('bad', 'enc'), TypeError) + + // test hex encoding + t.equal( + Buffer.from(b.toString('hex'), 'hex') + .indexOf('64', 0, 'hex'), + 3 + ) + t.equal( + Buffer.from(b.toString('hex'), 'hex') + .indexOf(Buffer.from('64', 'hex'), 0, 'hex'), + 3 + ) + + // test base64 encoding + t.equal( + Buffer.from(b.toString('base64'), 'base64') + .indexOf('ZA==', 0, 'base64'), + 3 + ) + t.equal( + Buffer.from(b.toString('base64'), 'base64') + .indexOf(Buffer.from('ZA==', 'base64'), 0, 'base64'), + 3 + ) + + // test ascii encoding + t.equal( + Buffer.from(b.toString('ascii'), 'ascii') + .indexOf('d', 0, 'ascii'), + 3 + ) + t.equal( + Buffer.from(b.toString('ascii'), 'ascii') + .indexOf(Buffer.from('d', 'ascii'), 0, 'ascii'), + 3 + ) + + // test optional offset with passed encoding + t.equal(Buffer.from('aaaa0').indexOf('30', 'hex'), 4) + t.equal(Buffer.from('aaaa00a').indexOf('3030', 'hex'), 4) + + { + // test usc2 encoding + const twoByteString = Buffer.from('\u039a\u0391\u03a3\u03a3\u0395', 'ucs2') + + t.equal(8, twoByteString.indexOf('\u0395', 4, 'ucs2')) + t.equal(6, twoByteString.indexOf('\u03a3', -4, 'ucs2')) + t.equal(4, twoByteString.indexOf('\u03a3', -6, 'ucs2')) + t.equal(4, twoByteString.indexOf( + Buffer.from('\u03a3', 'ucs2'), -6, 'ucs2')) + t.equal(-1, twoByteString.indexOf('\u03a3', -2, 'ucs2')) + } + + const mixedByteStringUcs2 = + Buffer.from('\u039a\u0391abc\u03a3\u03a3\u0395', 'ucs2') + t.equal(6, mixedByteStringUcs2.indexOf('bc', 0, 'ucs2')) + t.equal(10, mixedByteStringUcs2.indexOf('\u03a3', 0, 'ucs2')) + t.equal(-1, mixedByteStringUcs2.indexOf('\u0396', 0, 'ucs2')) + + t.equal( + 6, mixedByteStringUcs2.indexOf(Buffer.from('bc', 'ucs2'), 0, 'ucs2')) + t.equal( + 10, mixedByteStringUcs2.indexOf(Buffer.from('\u03a3', 'ucs2'), 0, 'ucs2')) + t.equal( + -1, mixedByteStringUcs2.indexOf(Buffer.from('\u0396', 'ucs2'), 0, 'ucs2')) + + { + const twoByteString = Buffer.from('\u039a\u0391\u03a3\u03a3\u0395', 'ucs2') + + // Test single char pattern + t.equal(0, twoByteString.indexOf('\u039a', 0, 'ucs2')) + let index = twoByteString.indexOf('\u0391', 0, 'ucs2') + t.equal(2, index, `Alpha - at index ${index}`) + index = twoByteString.indexOf('\u03a3', 0, 'ucs2') + t.equal(4, index, `First Sigma - at index ${index}`) + index = twoByteString.indexOf('\u03a3', 6, 'ucs2') + t.equal(6, index, `Second Sigma - at index ${index}`) + index = twoByteString.indexOf('\u0395', 0, 'ucs2') + t.equal(8, index, `Epsilon - at index ${index}`) + index = twoByteString.indexOf('\u0392', 0, 'ucs2') + t.equal(-1, index, `Not beta - at index ${index}`) + + // Test multi-char pattern + index = twoByteString.indexOf('\u039a\u0391', 0, 'ucs2') + t.equal(0, index, `Lambda Alpha - at index ${index}`) + index = twoByteString.indexOf('\u0391\u03a3', 0, 'ucs2') + t.equal(2, index, `Alpha Sigma - at index ${index}`) + index = twoByteString.indexOf('\u03a3\u03a3', 0, 'ucs2') + t.equal(4, index, `Sigma Sigma - at index ${index}`) + index = twoByteString.indexOf('\u03a3\u0395', 0, 'ucs2') + t.equal(6, index, `Sigma Epsilon - at index ${index}`) + } + + const mixedByteStringUtf8 = Buffer.from('\u039a\u0391abc\u03a3\u03a3\u0395') + t.equal(5, mixedByteStringUtf8.indexOf('bc')) + t.equal(5, mixedByteStringUtf8.indexOf('bc', 5)) + t.equal(5, mixedByteStringUtf8.indexOf('bc', -8)) + t.equal(7, mixedByteStringUtf8.indexOf('\u03a3')) + t.equal(-1, mixedByteStringUtf8.indexOf('\u0396')) + + + // Test complex string indexOf algorithms. Only trigger for long strings. + // Long string that isn't a simple repeat of a shorter string. + let longString = 'A' + for (let i = 66; i < 76; i++) { // from 'B' to 'K' + longString = longString + String.fromCharCode(i) + longString + } + + const longBufferString = Buffer.from(longString) + + // pattern of 15 chars, repeated every 16 chars in long + let pattern = 'ABACABADABACABA' + for (let i = 0; i < longBufferString.length - pattern.length; i += 7) { + const index = longBufferString.indexOf(pattern, i) + t.equal((i + 15) & ~0xf, index, + `Long ABACABA...-string at index ${i}`) + } + + let index = longBufferString.indexOf('AJABACA') + t.equal(510, index, `Long AJABACA, First J - at index ${index}`) + index = longBufferString.indexOf('AJABACA', 511) + t.equal(1534, index, `Long AJABACA, Second J - at index ${index}`) + + pattern = 'JABACABADABACABA' + index = longBufferString.indexOf(pattern) + t.equal(511, index, `Long JABACABA..., First J - at index ${index}`) + index = longBufferString.indexOf(pattern, 512) + t.equal( + 1535, index, `Long JABACABA..., Second J - at index ${index}`) + + // Search for a non-ASCII string in a pure ASCII string. + const asciiString = Buffer.from( + 'arglebargleglopglyfarglebargleglopglyfarglebargleglopglyf') + t.equal(-1, asciiString.indexOf('\x2061')) + t.equal(3, asciiString.indexOf('leb', 0)) + + // Search in string containing many non-ASCII chars. + const allCodePoints = [] + for (let i = 0; i < 65536; i++) allCodePoints[i] = i + const allCharsString = String.fromCharCode.apply(String, allCodePoints) + const allCharsBufferUtf8 = Buffer.from(allCharsString) + const allCharsBufferUcs2 = Buffer.from(allCharsString, 'ucs2') + + // Search for string long enough to trigger complex search with ASCII pattern + // and UC16 subject. + t.equal(-1, allCharsBufferUtf8.indexOf('notfound')) + t.equal(-1, allCharsBufferUcs2.indexOf('notfound')) + + // Needle is longer than haystack, but only because it's encoded as UTF-16 + t.equal(Buffer.from('aaaa').indexOf('a'.repeat(4), 'ucs2'), -1) + + t.equal(Buffer.from('aaaa').indexOf('a'.repeat(4), 'utf8'), 0) + t.equal(Buffer.from('aaaa').indexOf('你好', 'ucs2'), -1) + + // Haystack has odd length, but the needle is UCS2. + t.equal(Buffer.from('aaaaa').indexOf('b', 'ucs2'), -1) + + { + // Find substrings in Utf8. + const lengths = [1, 3, 15]; // Single char, simple and complex. + const indices = [0x5, 0x60, 0x400, 0x680, 0x7ee, 0xFF02, 0x16610, 0x2f77b] + for (let lengthIndex = 0; lengthIndex < lengths.length; lengthIndex++) { + for (let i = 0; i < indices.length; i++) { + const index = indices[i] + let length = lengths[lengthIndex] + + if (index + length > 0x7F) { + length = 2 * length + } + + if (index + length > 0x7FF) { + length = 3 * length + } + + if (index + length > 0xFFFF) { + length = 4 * length + } + + const patternBufferUtf8 = allCharsBufferUtf8.slice(index, index + length) + t.equal(index, allCharsBufferUtf8.indexOf(patternBufferUtf8)) + + const patternStringUtf8 = patternBufferUtf8.toString() + t.equal(index, allCharsBufferUtf8.indexOf(patternStringUtf8)) + } + } + } + + { + // Find substrings in Usc2. + const lengths = [2, 4, 16]; // Single char, simple and complex. + const indices = [0x5, 0x65, 0x105, 0x205, 0x285, 0x2005, 0x2085, 0xfff0] + for (let lengthIndex = 0; lengthIndex < lengths.length; lengthIndex++) { + for (let i = 0; i < indices.length; i++) { + const index = indices[i] * 2 + const length = lengths[lengthIndex] + + const patternBufferUcs2 = + allCharsBufferUcs2.slice(index, index + length) + t.equal( + index, allCharsBufferUcs2.indexOf(patternBufferUcs2, 0, 'ucs2')) + + const patternStringUcs2 = patternBufferUcs2.toString('ucs2') + t.equal( + index, allCharsBufferUcs2.indexOf(patternStringUcs2, 0, 'ucs2')) + } + } + } + + [ + () => {}, + {}, + [] + ].forEach(val => { + debugger + t.throws(() => b.indexOf(val), TypeError, `"${JSON.stringify(val)}" should throw`) + }) + + // Test weird offset arguments. + // The following offsets coerce to NaN or 0, searching the whole Buffer + t.equal(b.indexOf('b', undefined), 1) + t.equal(b.indexOf('b', {}), 1) + t.equal(b.indexOf('b', 0), 1) + t.equal(b.indexOf('b', null), 1) + t.equal(b.indexOf('b', []), 1) + + // The following offset coerces to 2, in other words +[2] === 2 + t.equal(b.indexOf('b', [2]), -1) + + // Behavior should match String.indexOf() + t.equal( + b.indexOf('b', undefined), + stringComparison.indexOf('b', undefined)) + t.equal( + b.indexOf('b', {}), + stringComparison.indexOf('b', {})) + t.equal( + b.indexOf('b', 0), + stringComparison.indexOf('b', 0)) + t.equal( + b.indexOf('b', null), + stringComparison.indexOf('b', null)) + t.equal( + b.indexOf('b', []), + stringComparison.indexOf('b', [])) + t.equal( + b.indexOf('b', [2]), + stringComparison.indexOf('b', [2])) + + // test truncation of Number arguments to uint8 + { + const buf = Buffer.from('this is a test') + t.equal(buf.indexOf(0x6973), 3) + t.equal(buf.indexOf(0x697320), 4) + t.equal(buf.indexOf(0x69732069), 2) + t.equal(buf.indexOf(0x697374657374), 0) + t.equal(buf.indexOf(0x69737374), 0) + t.equal(buf.indexOf(0x69737465), 11) + t.equal(buf.indexOf(0x69737465), 11) + t.equal(buf.indexOf(-140), 0) + t.equal(buf.indexOf(-152), 1) + t.equal(buf.indexOf(0xff), -1) + t.equal(buf.indexOf(0xffff), -1) + } + + // Test that Uint8Array arguments are okay. + { + const needle = new Uint8Array([ 0x66, 0x6f, 0x6f ]) + const haystack = new BufferList(Buffer.from('a foo b foo')) + t.equal(haystack.indexOf(needle), 2) + } + t.end() +}) diff --git a/node_modules/bl/test/test.js b/node_modules/bl/test/test.js new file mode 100644 index 00000000..42fcad41 --- /dev/null +++ b/node_modules/bl/test/test.js @@ -0,0 +1,782 @@ +'use strict' + +var tape = require('tape') + , crypto = require('crypto') + , fs = require('fs') + , hash = require('hash_file') + , BufferList = require('../') + , Buffer = require('safe-buffer').Buffer + + , encodings = + ('hex utf8 utf-8 ascii binary base64' + + (process.browser ? '' : ' ucs2 ucs-2 utf16le utf-16le')).split(' ') + +// run the indexOf tests +require('./indexOf') + +tape('single bytes from single buffer', function (t) { + var bl = new BufferList() + bl.append(Buffer.from('abcd')) + + t.equal(bl.length, 4) + t.equal(bl.get(-1), undefined) + t.equal(bl.get(0), 97) + t.equal(bl.get(1), 98) + t.equal(bl.get(2), 99) + t.equal(bl.get(3), 100) + t.equal(bl.get(4), undefined) + + t.end() +}) + +tape('single bytes from multiple buffers', function (t) { + var bl = new BufferList() + bl.append(Buffer.from('abcd')) + bl.append(Buffer.from('efg')) + bl.append(Buffer.from('hi')) + bl.append(Buffer.from('j')) + + t.equal(bl.length, 10) + + t.equal(bl.get(0), 97) + t.equal(bl.get(1), 98) + t.equal(bl.get(2), 99) + t.equal(bl.get(3), 100) + t.equal(bl.get(4), 101) + t.equal(bl.get(5), 102) + t.equal(bl.get(6), 103) + t.equal(bl.get(7), 104) + t.equal(bl.get(8), 105) + t.equal(bl.get(9), 106) + t.end() +}) + +tape('multi bytes from single buffer', function (t) { + var bl = new BufferList() + bl.append(Buffer.from('abcd')) + + t.equal(bl.length, 4) + + t.equal(bl.slice(0, 4).toString('ascii'), 'abcd') + t.equal(bl.slice(0, 3).toString('ascii'), 'abc') + t.equal(bl.slice(1, 4).toString('ascii'), 'bcd') + t.equal(bl.slice(-4, -1).toString('ascii'), 'abc') + + t.end() +}) + +tape('multi bytes from single buffer (negative indexes)', function (t) { + var bl = new BufferList() + bl.append(Buffer.from('buffer')) + + t.equal(bl.length, 6) + + t.equal(bl.slice(-6, -1).toString('ascii'), 'buffe') + t.equal(bl.slice(-6, -2).toString('ascii'), 'buff') + t.equal(bl.slice(-5, -2).toString('ascii'), 'uff') + + t.end() +}) + +tape('multiple bytes from multiple buffers', function (t) { + var bl = new BufferList() + + bl.append(Buffer.from('abcd')) + bl.append(Buffer.from('efg')) + bl.append(Buffer.from('hi')) + bl.append(Buffer.from('j')) + + t.equal(bl.length, 10) + + t.equal(bl.slice(0, 10).toString('ascii'), 'abcdefghij') + t.equal(bl.slice(3, 10).toString('ascii'), 'defghij') + t.equal(bl.slice(3, 6).toString('ascii'), 'def') + t.equal(bl.slice(3, 8).toString('ascii'), 'defgh') + t.equal(bl.slice(5, 10).toString('ascii'), 'fghij') + t.equal(bl.slice(-7, -4).toString('ascii'), 'def') + + t.end() +}) + +tape('multiple bytes from multiple buffer lists', function (t) { + var bl = new BufferList() + + bl.append(new BufferList([ Buffer.from('abcd'), Buffer.from('efg') ])) + bl.append(new BufferList([ Buffer.from('hi'), Buffer.from('j') ])) + + t.equal(bl.length, 10) + + t.equal(bl.slice(0, 10).toString('ascii'), 'abcdefghij') + + t.equal(bl.slice(3, 10).toString('ascii'), 'defghij') + t.equal(bl.slice(3, 6).toString('ascii'), 'def') + t.equal(bl.slice(3, 8).toString('ascii'), 'defgh') + t.equal(bl.slice(5, 10).toString('ascii'), 'fghij') + + t.end() +}) + +// same data as previous test, just using nested constructors +tape('multiple bytes from crazy nested buffer lists', function (t) { + var bl = new BufferList() + + bl.append(new BufferList([ + new BufferList([ + new BufferList(Buffer.from('abc')) + , Buffer.from('d') + , new BufferList(Buffer.from('efg')) + ]) + , new BufferList([ Buffer.from('hi') ]) + , new BufferList(Buffer.from('j')) + ])) + + t.equal(bl.length, 10) + + t.equal(bl.slice(0, 10).toString('ascii'), 'abcdefghij') + + t.equal(bl.slice(3, 10).toString('ascii'), 'defghij') + t.equal(bl.slice(3, 6).toString('ascii'), 'def') + t.equal(bl.slice(3, 8).toString('ascii'), 'defgh') + t.equal(bl.slice(5, 10).toString('ascii'), 'fghij') + + t.end() +}) + +tape('append accepts arrays of Buffers', function (t) { + var bl = new BufferList() + bl.append(Buffer.from('abc')) + bl.append([ Buffer.from('def') ]) + bl.append([ Buffer.from('ghi'), Buffer.from('jkl') ]) + bl.append([ Buffer.from('mnop'), Buffer.from('qrstu'), Buffer.from('vwxyz') ]) + t.equal(bl.length, 26) + t.equal(bl.slice().toString('ascii'), 'abcdefghijklmnopqrstuvwxyz') + t.end() +}) + +tape('append accepts arrays of BufferLists', function (t) { + var bl = new BufferList() + bl.append(Buffer.from('abc')) + bl.append([ new BufferList('def') ]) + bl.append(new BufferList([ Buffer.from('ghi'), new BufferList('jkl') ])) + bl.append([ Buffer.from('mnop'), new BufferList([ Buffer.from('qrstu'), Buffer.from('vwxyz') ]) ]) + t.equal(bl.length, 26) + t.equal(bl.slice().toString('ascii'), 'abcdefghijklmnopqrstuvwxyz') + t.end() +}) + +tape('append chainable', function (t) { + var bl = new BufferList() + t.ok(bl.append(Buffer.from('abcd')) === bl) + t.ok(bl.append([ Buffer.from('abcd') ]) === bl) + t.ok(bl.append(new BufferList(Buffer.from('abcd'))) === bl) + t.ok(bl.append([ new BufferList(Buffer.from('abcd')) ]) === bl) + t.end() +}) + +tape('append chainable (test results)', function (t) { + var bl = new BufferList('abc') + .append([ new BufferList('def') ]) + .append(new BufferList([ Buffer.from('ghi'), new BufferList('jkl') ])) + .append([ Buffer.from('mnop'), new BufferList([ Buffer.from('qrstu'), Buffer.from('vwxyz') ]) ]) + + t.equal(bl.length, 26) + t.equal(bl.slice().toString('ascii'), 'abcdefghijklmnopqrstuvwxyz') + t.end() +}) + +tape('consuming from multiple buffers', function (t) { + var bl = new BufferList() + + bl.append(Buffer.from('abcd')) + bl.append(Buffer.from('efg')) + bl.append(Buffer.from('hi')) + bl.append(Buffer.from('j')) + + t.equal(bl.length, 10) + + t.equal(bl.slice(0, 10).toString('ascii'), 'abcdefghij') + + bl.consume(3) + t.equal(bl.length, 7) + t.equal(bl.slice(0, 7).toString('ascii'), 'defghij') + + bl.consume(2) + t.equal(bl.length, 5) + t.equal(bl.slice(0, 5).toString('ascii'), 'fghij') + + bl.consume(1) + t.equal(bl.length, 4) + t.equal(bl.slice(0, 4).toString('ascii'), 'ghij') + + bl.consume(1) + t.equal(bl.length, 3) + t.equal(bl.slice(0, 3).toString('ascii'), 'hij') + + bl.consume(2) + t.equal(bl.length, 1) + t.equal(bl.slice(0, 1).toString('ascii'), 'j') + + t.end() +}) + +tape('complete consumption', function (t) { + var bl = new BufferList() + + bl.append(Buffer.from('a')) + bl.append(Buffer.from('b')) + + bl.consume(2) + + t.equal(bl.length, 0) + t.equal(bl._bufs.length, 0) + + t.end() +}) + +tape('test readUInt8 / readInt8', function (t) { + var buf1 = Buffer.alloc(1) + , buf2 = Buffer.alloc(3) + , buf3 = Buffer.alloc(3) + , bl = new BufferList() + + buf2[1] = 0x3 + buf2[2] = 0x4 + buf3[0] = 0x23 + buf3[1] = 0x42 + + bl.append(buf1) + bl.append(buf2) + bl.append(buf3) + + t.equal(bl.readUInt8(2), 0x3) + t.equal(bl.readInt8(2), 0x3) + t.equal(bl.readUInt8(3), 0x4) + t.equal(bl.readInt8(3), 0x4) + t.equal(bl.readUInt8(4), 0x23) + t.equal(bl.readInt8(4), 0x23) + t.equal(bl.readUInt8(5), 0x42) + t.equal(bl.readInt8(5), 0x42) + t.end() +}) + +tape('test readUInt16LE / readUInt16BE / readInt16LE / readInt16BE', function (t) { + var buf1 = Buffer.alloc(1) + , buf2 = Buffer.alloc(3) + , buf3 = Buffer.alloc(3) + , bl = new BufferList() + + buf2[1] = 0x3 + buf2[2] = 0x4 + buf3[0] = 0x23 + buf3[1] = 0x42 + + bl.append(buf1) + bl.append(buf2) + bl.append(buf3) + + t.equal(bl.readUInt16BE(2), 0x0304) + t.equal(bl.readUInt16LE(2), 0x0403) + t.equal(bl.readInt16BE(2), 0x0304) + t.equal(bl.readInt16LE(2), 0x0403) + t.equal(bl.readUInt16BE(3), 0x0423) + t.equal(bl.readUInt16LE(3), 0x2304) + t.equal(bl.readInt16BE(3), 0x0423) + t.equal(bl.readInt16LE(3), 0x2304) + t.equal(bl.readUInt16BE(4), 0x2342) + t.equal(bl.readUInt16LE(4), 0x4223) + t.equal(bl.readInt16BE(4), 0x2342) + t.equal(bl.readInt16LE(4), 0x4223) + t.end() +}) + +tape('test readUInt32LE / readUInt32BE / readInt32LE / readInt32BE', function (t) { + var buf1 = Buffer.alloc(1) + , buf2 = Buffer.alloc(3) + , buf3 = Buffer.alloc(3) + , bl = new BufferList() + + buf2[1] = 0x3 + buf2[2] = 0x4 + buf3[0] = 0x23 + buf3[1] = 0x42 + + bl.append(buf1) + bl.append(buf2) + bl.append(buf3) + + t.equal(bl.readUInt32BE(2), 0x03042342) + t.equal(bl.readUInt32LE(2), 0x42230403) + t.equal(bl.readInt32BE(2), 0x03042342) + t.equal(bl.readInt32LE(2), 0x42230403) + t.end() +}) + +tape('test readUIntLE / readUIntBE / readIntLE / readIntBE', function (t) { + var buf1 = Buffer.alloc(1) + , buf2 = Buffer.alloc(3) + , buf3 = Buffer.alloc(3) + , bl = new BufferList() + + buf2[0] = 0x2 + buf2[1] = 0x3 + buf2[2] = 0x4 + buf3[0] = 0x23 + buf3[1] = 0x42 + buf3[2] = 0x61 + + bl.append(buf1) + bl.append(buf2) + bl.append(buf3) + + t.equal(bl.readUIntBE(1, 1), 0x02) + t.equal(bl.readUIntBE(1, 2), 0x0203) + t.equal(bl.readUIntBE(1, 3), 0x020304) + t.equal(bl.readUIntBE(1, 4), 0x02030423) + t.equal(bl.readUIntBE(1, 5), 0x0203042342) + t.equal(bl.readUIntBE(1, 6), 0x020304234261) + t.equal(bl.readUIntLE(1, 1), 0x02) + t.equal(bl.readUIntLE(1, 2), 0x0302) + t.equal(bl.readUIntLE(1, 3), 0x040302) + t.equal(bl.readUIntLE(1, 4), 0x23040302) + t.equal(bl.readUIntLE(1, 5), 0x4223040302) + t.equal(bl.readUIntLE(1, 6), 0x614223040302) + t.equal(bl.readIntBE(1, 1), 0x02) + t.equal(bl.readIntBE(1, 2), 0x0203) + t.equal(bl.readIntBE(1, 3), 0x020304) + t.equal(bl.readIntBE(1, 4), 0x02030423) + t.equal(bl.readIntBE(1, 5), 0x0203042342) + t.equal(bl.readIntBE(1, 6), 0x020304234261) + t.equal(bl.readIntLE(1, 1), 0x02) + t.equal(bl.readIntLE(1, 2), 0x0302) + t.equal(bl.readIntLE(1, 3), 0x040302) + t.equal(bl.readIntLE(1, 4), 0x23040302) + t.equal(bl.readIntLE(1, 5), 0x4223040302) + t.equal(bl.readIntLE(1, 6), 0x614223040302) + t.end() +}) + +tape('test readFloatLE / readFloatBE', function (t) { + var buf1 = Buffer.alloc(1) + , buf2 = Buffer.alloc(3) + , buf3 = Buffer.alloc(3) + , bl = new BufferList() + + buf2[1] = 0x00 + buf2[2] = 0x00 + buf3[0] = 0x80 + buf3[1] = 0x3f + + bl.append(buf1) + bl.append(buf2) + bl.append(buf3) + + t.equal(bl.readFloatLE(2), 0x01) + t.end() +}) + +tape('test readDoubleLE / readDoubleBE', function (t) { + var buf1 = Buffer.alloc(1) + , buf2 = Buffer.alloc(3) + , buf3 = Buffer.alloc(10) + , bl = new BufferList() + + buf2[1] = 0x55 + buf2[2] = 0x55 + buf3[0] = 0x55 + buf3[1] = 0x55 + buf3[2] = 0x55 + buf3[3] = 0x55 + buf3[4] = 0xd5 + buf3[5] = 0x3f + + bl.append(buf1) + bl.append(buf2) + bl.append(buf3) + + t.equal(bl.readDoubleLE(2), 0.3333333333333333) + t.end() +}) + +tape('test toString', function (t) { + var bl = new BufferList() + + bl.append(Buffer.from('abcd')) + bl.append(Buffer.from('efg')) + bl.append(Buffer.from('hi')) + bl.append(Buffer.from('j')) + + t.equal(bl.toString('ascii', 0, 10), 'abcdefghij') + t.equal(bl.toString('ascii', 3, 10), 'defghij') + t.equal(bl.toString('ascii', 3, 6), 'def') + t.equal(bl.toString('ascii', 3, 8), 'defgh') + t.equal(bl.toString('ascii', 5, 10), 'fghij') + + t.end() +}) + +tape('test toString encoding', function (t) { + var bl = new BufferList() + , b = Buffer.from('abcdefghij\xff\x00') + + bl.append(Buffer.from('abcd')) + bl.append(Buffer.from('efg')) + bl.append(Buffer.from('hi')) + bl.append(Buffer.from('j')) + bl.append(Buffer.from('\xff\x00')) + + encodings.forEach(function (enc) { + t.equal(bl.toString(enc), b.toString(enc), enc) + }) + + t.end() +}) + +tape('uninitialized memory', function (t) { + const secret = crypto.randomBytes(256) + for (let i = 0; i < 1e6; i++) { + const clone = Buffer.from(secret) + const bl = new BufferList() + bl.append(Buffer.from('a')) + bl.consume(-1024) + const buf = bl.slice(1) + if (buf.indexOf(clone) !== -1) { + t.fail(`Match (at ${i})`) + break + } + } + t.end() +}) + +!process.browser && tape('test stream', function (t) { + var random = crypto.randomBytes(65534) + , rndhash = hash(random, 'md5') + , md5sum = crypto.createHash('md5') + , bl = new BufferList(function (err, buf) { + t.ok(Buffer.isBuffer(buf)) + t.ok(err === null) + t.equal(rndhash, hash(bl.slice(), 'md5')) + t.equal(rndhash, hash(buf, 'md5')) + + bl.pipe(fs.createWriteStream('/tmp/bl_test_rnd_out.dat')) + .on('close', function () { + var s = fs.createReadStream('/tmp/bl_test_rnd_out.dat') + s.on('data', md5sum.update.bind(md5sum)) + s.on('end', function() { + t.equal(rndhash, md5sum.digest('hex'), 'woohoo! correct hash!') + t.end() + }) + }) + + }) + + fs.writeFileSync('/tmp/bl_test_rnd.dat', random) + fs.createReadStream('/tmp/bl_test_rnd.dat').pipe(bl) +}) + +tape('instantiation with Buffer', function (t) { + var buf = crypto.randomBytes(1024) + , buf2 = crypto.randomBytes(1024) + , b = BufferList(buf) + + t.equal(buf.toString('hex'), b.slice().toString('hex'), 'same buffer') + b = BufferList([ buf, buf2 ]) + t.equal(b.slice().toString('hex'), Buffer.concat([ buf, buf2 ]).toString('hex'), 'same buffer') + t.end() +}) + +tape('test String appendage', function (t) { + var bl = new BufferList() + , b = Buffer.from('abcdefghij\xff\x00') + + bl.append('abcd') + bl.append('efg') + bl.append('hi') + bl.append('j') + bl.append('\xff\x00') + + encodings.forEach(function (enc) { + t.equal(bl.toString(enc), b.toString(enc)) + }) + + t.end() +}) + +tape('test Number appendage', function (t) { + var bl = new BufferList() + , b = Buffer.from('1234567890') + + bl.append(1234) + bl.append(567) + bl.append(89) + bl.append(0) + + encodings.forEach(function (enc) { + t.equal(bl.toString(enc), b.toString(enc)) + }) + + t.end() +}) + +tape('write nothing, should get empty buffer', function (t) { + t.plan(3) + BufferList(function (err, data) { + t.notOk(err, 'no error') + t.ok(Buffer.isBuffer(data), 'got a buffer') + t.equal(0, data.length, 'got a zero-length buffer') + t.end() + }).end() +}) + +tape('unicode string', function (t) { + t.plan(2) + var inp1 = '\u2600' + , inp2 = '\u2603' + , exp = inp1 + ' and ' + inp2 + , bl = BufferList() + bl.write(inp1) + bl.write(' and ') + bl.write(inp2) + t.equal(exp, bl.toString()) + t.equal(Buffer.from(exp).toString('hex'), bl.toString('hex')) +}) + +tape('should emit finish', function (t) { + var source = BufferList() + , dest = BufferList() + + source.write('hello') + source.pipe(dest) + + dest.on('finish', function () { + t.equal(dest.toString('utf8'), 'hello') + t.end() + }) +}) + +tape('basic copy', function (t) { + var buf = crypto.randomBytes(1024) + , buf2 = Buffer.alloc(1024) + , b = BufferList(buf) + + b.copy(buf2) + t.equal(b.slice().toString('hex'), buf2.toString('hex'), 'same buffer') + t.end() +}) + +tape('copy after many appends', function (t) { + var buf = crypto.randomBytes(512) + , buf2 = Buffer.alloc(1024) + , b = BufferList(buf) + + b.append(buf) + b.copy(buf2) + t.equal(b.slice().toString('hex'), buf2.toString('hex'), 'same buffer') + t.end() +}) + +tape('copy at a precise position', function (t) { + var buf = crypto.randomBytes(1004) + , buf2 = Buffer.alloc(1024) + , b = BufferList(buf) + + b.copy(buf2, 20) + t.equal(b.slice().toString('hex'), buf2.slice(20).toString('hex'), 'same buffer') + t.end() +}) + +tape('copy starting from a precise location', function (t) { + var buf = crypto.randomBytes(10) + , buf2 = Buffer.alloc(5) + , b = BufferList(buf) + + b.copy(buf2, 0, 5) + t.equal(b.slice(5).toString('hex'), buf2.toString('hex'), 'same buffer') + t.end() +}) + +tape('copy in an interval', function (t) { + var rnd = crypto.randomBytes(10) + , b = BufferList(rnd) // put the random bytes there + , actual = Buffer.alloc(3) + , expected = Buffer.alloc(3) + + rnd.copy(expected, 0, 5, 8) + b.copy(actual, 0, 5, 8) + + t.equal(actual.toString('hex'), expected.toString('hex'), 'same buffer') + t.end() +}) + +tape('copy an interval between two buffers', function (t) { + var buf = crypto.randomBytes(10) + , buf2 = Buffer.alloc(10) + , b = BufferList(buf) + + b.append(buf) + b.copy(buf2, 0, 5, 15) + + t.equal(b.slice(5, 15).toString('hex'), buf2.toString('hex'), 'same buffer') + t.end() +}) + +tape('shallow slice across buffer boundaries', function (t) { + var bl = new BufferList(['First', 'Second', 'Third']) + + t.equal(bl.shallowSlice(3, 13).toString(), 'stSecondTh') + t.end() +}) + +tape('shallow slice within single buffer', function (t) { + t.plan(2) + var bl = new BufferList(['First', 'Second', 'Third']) + + t.equal(bl.shallowSlice(5, 10).toString(), 'Secon') + t.equal(bl.shallowSlice(7, 10).toString(), 'con') + t.end() +}) + +tape('shallow slice single buffer', function (t) { + t.plan(3) + var bl = new BufferList(['First', 'Second', 'Third']) + + t.equal(bl.shallowSlice(0, 5).toString(), 'First') + t.equal(bl.shallowSlice(5, 11).toString(), 'Second') + t.equal(bl.shallowSlice(11, 16).toString(), 'Third') +}) + +tape('shallow slice with negative or omitted indices', function (t) { + t.plan(4) + var bl = new BufferList(['First', 'Second', 'Third']) + + t.equal(bl.shallowSlice().toString(), 'FirstSecondThird') + t.equal(bl.shallowSlice(5).toString(), 'SecondThird') + t.equal(bl.shallowSlice(5, -3).toString(), 'SecondTh') + t.equal(bl.shallowSlice(-8).toString(), 'ondThird') +}) + +tape('shallow slice does not make a copy', function (t) { + t.plan(1) + var buffers = [Buffer.from('First'), Buffer.from('Second'), Buffer.from('Third')] + var bl = (new BufferList(buffers)).shallowSlice(5, -3) + + buffers[1].fill('h') + buffers[2].fill('h') + + t.equal(bl.toString(), 'hhhhhhhh') +}) + +tape('shallow slice with 0 length', function (t) { + t.plan(1) + var buffers = [Buffer.from('First'), Buffer.from('Second'), Buffer.from('Third')] + var bl = (new BufferList(buffers)).shallowSlice(0, 0) + t.equal(bl.length, 0) +}) + +tape('shallow slice with 0 length from middle', function (t) { + t.plan(1) + var buffers = [Buffer.from('First'), Buffer.from('Second'), Buffer.from('Third')] + var bl = (new BufferList(buffers)).shallowSlice(10, 10) + t.equal(bl.length, 0) +}) + +tape('duplicate', function (t) { + t.plan(2) + + var bl = new BufferList('abcdefghij\xff\x00') + , dup = bl.duplicate() + + t.equal(bl.prototype, dup.prototype) + t.equal(bl.toString('hex'), dup.toString('hex')) +}) + +tape('destroy no pipe', function (t) { + t.plan(2) + + var bl = new BufferList('alsdkfja;lsdkfja;lsdk') + bl.destroy() + + t.equal(bl._bufs.length, 0) + t.equal(bl.length, 0) +}) + +!process.browser && tape('destroy with pipe before read end', function (t) { + t.plan(2) + + var bl = new BufferList() + fs.createReadStream(__dirname + '/test.js') + .pipe(bl) + + bl.destroy() + + t.equal(bl._bufs.length, 0) + t.equal(bl.length, 0) + +}) + +!process.browser && tape('destroy with pipe before read end with race', function (t) { + t.plan(2) + + var bl = new BufferList() + fs.createReadStream(__dirname + '/test.js') + .pipe(bl) + + setTimeout(function () { + bl.destroy() + setTimeout(function () { + t.equal(bl._bufs.length, 0) + t.equal(bl.length, 0) + }, 500) + }, 500) +}) + +!process.browser && tape('destroy with pipe after read end', function (t) { + t.plan(2) + + var bl = new BufferList() + fs.createReadStream(__dirname + '/test.js') + .on('end', onEnd) + .pipe(bl) + + function onEnd () { + bl.destroy() + + t.equal(bl._bufs.length, 0) + t.equal(bl.length, 0) + } +}) + +!process.browser && tape('destroy with pipe while writing to a destination', function (t) { + t.plan(4) + + var bl = new BufferList() + , ds = new BufferList() + + fs.createReadStream(__dirname + '/test.js') + .on('end', onEnd) + .pipe(bl) + + function onEnd () { + bl.pipe(ds) + + setTimeout(function () { + bl.destroy() + + t.equals(bl._bufs.length, 0) + t.equals(bl.length, 0) + + ds.destroy() + + t.equals(bl._bufs.length, 0) + t.equals(bl.length, 0) + + }, 100) + } +}) + +!process.browser && tape('handle error', function (t) { + t.plan(2) + fs.createReadStream('/does/not/exist').pipe(BufferList(function (err, data) { + t.ok(err instanceof Error, 'has error') + t.notOk(data, 'no data') + })) +}) diff --git a/node_modules/body-parser/HISTORY.md b/node_modules/body-parser/HISTORY.md new file mode 100644 index 00000000..81d23e06 --- /dev/null +++ b/node_modules/body-parser/HISTORY.md @@ -0,0 +1,672 @@ +1.20.3 / 2024-09-10 +=================== + + * deps: qs@6.13.0 + * add `depth` option to customize the depth level in the parser + * IMPORTANT: The default `depth` level for parsing URL-encoded data is now `32` (previously was `Infinity`) + +1.20.2 / 2023-02-21 +=================== + + * Fix strict json error message on Node.js 19+ + * deps: content-type@~1.0.5 + - perf: skip value escaping when unnecessary + * deps: raw-body@2.5.2 + +1.20.1 / 2022-10-06 +=================== + + * deps: qs@6.11.0 + * perf: remove unnecessary object clone + +1.20.0 / 2022-04-02 +=================== + + * Fix error message for json parse whitespace in `strict` + * Fix internal error when inflated body exceeds limit + * Prevent loss of async hooks context + * Prevent hanging when request already read + * deps: depd@2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + * deps: http-errors@2.0.0 + - deps: depd@2.0.0 + - deps: statuses@2.0.1 + * deps: on-finished@2.4.1 + * deps: qs@6.10.3 + * deps: raw-body@2.5.1 + - deps: http-errors@2.0.0 + +1.19.2 / 2022-02-15 +=================== + + * deps: bytes@3.1.2 + * deps: qs@6.9.7 + * Fix handling of `__proto__` keys + * deps: raw-body@2.4.3 + - deps: bytes@3.1.2 + +1.19.1 / 2021-12-10 +=================== + + * deps: bytes@3.1.1 + * deps: http-errors@1.8.1 + - deps: inherits@2.0.4 + - deps: toidentifier@1.0.1 + - deps: setprototypeof@1.2.0 + * deps: qs@6.9.6 + * deps: raw-body@2.4.2 + - deps: bytes@3.1.1 + - deps: http-errors@1.8.1 + * deps: safe-buffer@5.2.1 + * deps: type-is@~1.6.18 + +1.19.0 / 2019-04-25 +=================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: raw-body@2.4.0 + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + * deps: type-is@~1.6.17 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +1.18.3 / 2018-05-14 +=================== + + * Fix stack trace for strict json parse error + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: http-errors@~1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + * deps: qs@6.5.2 + * deps: raw-body@2.3.3 + - deps: http-errors@1.6.3 + - deps: iconv-lite@0.4.23 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +1.18.2 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: remove argument reassignment + +1.18.1 / 2017-09-12 +=================== + + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: raw-body@2.3.2 + - deps: iconv-lite@0.4.19 + +1.18.0 / 2017-09-08 +=================== + + * Fix JSON strict violation error to match native parse error + * Include the `body` property on verify errors + * Include the `type` property on all generated errors + * Use `http-errors` to set status code on errors + * deps: bytes@3.0.0 + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + * deps: qs@6.5.0 + * deps: raw-body@2.3.1 + - Use `http-errors` for standard emitted errors + - deps: bytes@3.0.0 + - deps: iconv-lite@0.4.18 + - perf: skip buffer decoding on overage chunk + * perf: prevent internal `throw` when missing charset + +1.17.2 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + +1.17.1 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +1.17.0 / 2017-03-01 +=================== + + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + * deps: qs@6.3.1 + - Fix compacting nested arrays + +1.16.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.16.0 / 2017-01-17 +=================== + + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + * deps: qs@6.2.1 + - Fix array parsing from skipping empty values + * deps: raw-body@~2.2.0 + - deps: iconv-lite@0.4.15 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +1.15.2 / 2016-06-19 +=================== + + * deps: bytes@2.4.0 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: http-errors@~1.5.0 + - Use `setprototypeof` module to replace `__proto__` setting + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: qs@6.2.0 + * deps: raw-body@~2.1.7 + - deps: bytes@2.4.0 + - perf: remove double-cleanup on happy path + * deps: type-is@~1.6.13 + - deps: mime-types@~2.1.11 + +1.15.1 / 2016-05-05 +=================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + * deps: raw-body@~2.1.6 + - deps: bytes@2.3.0 + * deps: type-is@~1.6.12 + - deps: mime-types@~2.1.10 + +1.15.0 / 2016-02-10 +=================== + + * deps: http-errors@~1.4.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.2.1 < 2' + * deps: qs@6.1.0 + * deps: type-is@~1.6.11 + - deps: mime-types@~2.1.9 + +1.14.2 / 2015-12-16 +=================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + * deps: qs@5.2.0 + * deps: raw-body@~2.1.5 + - deps: bytes@2.2.0 + - deps: iconv-lite@0.4.13 + * deps: type-is@~1.6.10 + - deps: mime-types@~2.1.8 + +1.14.1 / 2015-09-27 +=================== + + * Fix issue where invalid charset results in 400 when `verify` used + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + * deps: raw-body@~2.1.4 + - Fix masking critical errors from `iconv-lite` + - deps: iconv-lite@0.4.12 + * deps: type-is@~1.6.9 + - deps: mime-types@~2.1.7 + +1.14.0 / 2015-09-16 +=================== + + * Fix JSON strict parse error to match syntax errors + * Provide static `require` analysis in `urlencoded` parser + * deps: depd@~1.1.0 + - Support web browser loading + * deps: qs@5.1.0 + * deps: raw-body@~2.1.3 + - Fix sync callback when attaching data listener causes sync read + * deps: type-is@~1.6.8 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.6 + +1.13.3 / 2015-07-31 +=================== + + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +1.13.2 / 2015-07-05 +=================== + + * deps: iconv-lite@0.4.11 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix user-visible incompatibilities from 3.1.0 + - Fix various parsing edge cases + * deps: raw-body@~2.1.2 + - Fix error stack traces to skip `makeError` + - deps: iconv-lite@0.4.11 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +1.13.1 / 2015-06-16 +=================== + + * deps: qs@2.4.2 + - Downgraded from 3.1.0 because of user-visible incompatibilities + +1.13.0 / 2015-06-14 +=================== + + * Add `statusCode` property on `Error`s, in addition to `status` + * Change `type` default to `application/json` for JSON parser + * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + * Provide static `require` analysis + * Use the `http-errors` module to generate errors + * deps: bytes@2.1.0 + - Slight optimizations + * deps: iconv-lite@0.4.10 + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + - Leading BOM is now removed when decoding + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: qs@3.1.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + - Parsed object now has `null` prototype + * deps: raw-body@~2.1.1 + - Use `unpipe` module for unpiping requests + - deps: iconv-lite@0.4.10 + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: remove argument reassignment + * perf: remove delete call + +1.12.4 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: on-finished@~2.2.1 + * deps: raw-body@~2.0.1 + - Fix a false-positive when unpiping in Node.js 0.8 + - deps: bytes@2.0.1 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +1.12.3 / 2015-04-15 +=================== + + * Slight efficiency improvement when not debugging + * deps: depd@~1.0.1 + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + * deps: raw-body@1.3.4 + - Fix hanging callback if request aborts during read + - deps: iconv-lite@0.4.8 + +1.12.2 / 2015-03-16 +=================== + + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + +1.12.1 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +1.12.0 / 2015-02-13 +=================== + + * add `debug` messages + * accept a function for the `type` option + * use `content-type` to parse `Content-Type` headers + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + * deps: raw-body@1.3.3 + - deps: iconv-lite@0.4.7 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +1.11.0 / 2015-01-30 +=================== + + * make internal `extended: true` depth limit infinity + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +1.10.2 / 2015-01-20 +=================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + * deps: raw-body@1.3.2 + - deps: iconv-lite@0.4.6 + +1.10.1 / 2015-01-01 +=================== + + * deps: on-finished@~2.2.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +1.10.0 / 2014-12-02 +=================== + + * make internal `extended: true` array limit dynamic + +1.9.3 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: raw-body@1.3.1 + - deps: iconv-lite@0.4.5 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +1.9.2 / 2014-10-27 +================== + + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +1.9.1 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +1.9.0 / 2014-09-24 +================== + + * include the charset in "unsupported charset" error message + * include the encoding in "unsupported content encoding" error message + * deps: depd@~1.0.0 + +1.8.4 / 2014-09-23 +================== + + * fix content encoding to be case-insensitive + +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +1.8.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + +1.8.1 / 2014-09-07 +================== + + * deps: media-typer@0.3.0 + * deps: type-is@~1.5.1 + +1.8.0 / 2014-09-05 +================== + + * make empty-body-handling consistent between chunked requests + - empty `json` produces `{}` + - empty `raw` produces `new Buffer(0)` + - empty `text` produces `''` + - empty `urlencoded` produces `{}` + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: type-is@~1.5.0 + - fix `hasbody` to be true for `content-length: 0` + +1.7.0 / 2014-09-01 +================== + + * add `parameterLimit` option to `urlencoded` parser + * change `urlencoded` extended array limit to 100 + * respond with 413 when over `parameterLimit` in `urlencoded` + +1.6.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +1.6.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +1.6.5 / 2014-08-16 +================== + + * deps: on-finished@2.1.0 + +1.6.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + +1.6.3 / 2014-08-10 +================== + + * deps: qs@1.2.1 + +1.6.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +1.6.1 / 2014-08-06 +================== + + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +1.6.0 / 2014-08-05 +================== + + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + +1.5.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.5.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.5.0 / 2014-07-20 +================== + + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + * deps: raw-body@1.3.0 + - deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + - Fix `Cannot switch to old mode now` error on Node.js 0.10+ + * deps: type-is@~1.3.2 + +1.4.3 / 2014-06-19 +================== + + * deps: type-is@1.3.1 + - fix global variable leak + +1.4.2 / 2014-06-19 +================== + + * deps: type-is@1.3.0 + - improve type parsing + +1.4.1 / 2014-06-19 +================== + + * fix urlencoded extended deprecation message + +1.4.0 / 2014-06-19 +================== + + * add `text` parser + * add `raw` parser + * check accepted charset in content-type (accepts utf-8) + * check accepted encoding in content-encoding (accepts identity) + * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed + * deprecate `urlencoded()` without provided `extended` option + * lazy-load urlencoded parsers + * parsers split into files for reduced mem usage + * support gzip and deflate bodies + - set `inflate: false` to turn off + * deps: raw-body@1.2.2 + - Support all encodings from `iconv-lite` + +1.3.1 / 2014-06-11 +================== + + * deps: type-is@1.2.1 + - Switch dependency from mime to mime-types@1.0.0 + +1.3.0 / 2014-05-31 +================== + + * add `extended` option to urlencoded parser + +1.2.2 / 2014-05-27 +================== + + * deps: raw-body@1.1.6 + - assert stream encoding on node.js 0.8 + - assert stream encoding on node.js < 0.10.6 + - deps: bytes@1 + +1.2.1 / 2014-05-26 +================== + + * invoke `next(err)` after request fully read + - prevents hung responses and socket hang ups + +1.2.0 / 2014-05-11 +================== + + * add `verify` option + * deps: type-is@1.2.0 + - support suffix matching + +1.1.2 / 2014-05-11 +================== + + * improve json parser speed + +1.1.1 / 2014-05-11 +================== + + * fix repeated limit parsing with every request + +1.1.0 / 2014-05-10 +================== + + * add `type` option + * deps: pin for safety and consistency + +1.0.2 / 2014-04-14 +================== + + * use `type-is` module + +1.0.1 / 2014-03-20 +================== + + * lower default limits to 100kb diff --git a/node_modules/body-parser/LICENSE b/node_modules/body-parser/LICENSE new file mode 100644 index 00000000..386b7b69 --- /dev/null +++ b/node_modules/body-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/body-parser/README.md b/node_modules/body-parser/README.md new file mode 100644 index 00000000..f6661b7d --- /dev/null +++ b/node_modules/body-parser/README.md @@ -0,0 +1,476 @@ +# body-parser + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] +[![OpenSSF Scorecard Badge][ossf-scorecard-badge]][ossf-scorecard-visualizer] + +Node.js body parsing middleware. + +Parse incoming request bodies in a middleware before your handlers, available +under the `req.body` property. + +**Note** As `req.body`'s shape is based on user-controlled input, all +properties and values in this object are untrusted and should be validated +before trusting. For example, `req.body.foo.toString()` may fail in multiple +ways, for example the `foo` property may not be there or may not be a string, +and `toString` may not be a function and instead a string or other user input. + +[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/). + +_This does not handle multipart bodies_, due to their complex and typically +large nature. For multipart bodies, you may be interested in the following +modules: + + * [busboy](https://www.npmjs.org/package/busboy#readme) and + [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme) + * [multiparty](https://www.npmjs.org/package/multiparty#readme) and + [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme) + * [formidable](https://www.npmjs.org/package/formidable#readme) + * [multer](https://www.npmjs.org/package/multer#readme) + +This module provides the following parsers: + + * [JSON body parser](#bodyparserjsonoptions) + * [Raw body parser](#bodyparserrawoptions) + * [Text body parser](#bodyparsertextoptions) + * [URL-encoded form body parser](#bodyparserurlencodedoptions) + +Other body parsers you might be interested in: + +- [body](https://www.npmjs.org/package/body#readme) +- [co-body](https://www.npmjs.org/package/co-body#readme) + +## Installation + +```sh +$ npm install body-parser +``` + +## API + +```js +var bodyParser = require('body-parser') +``` + +The `bodyParser` object exposes various factories to create middlewares. All +middlewares will populate the `req.body` property with the parsed body when +the `Content-Type` request header matches the `type` option, or an empty +object (`{}`) if there was no body to parse, the `Content-Type` was not matched, +or an error occurred. + +The various errors returned by this module are described in the +[errors section](#errors). + +### bodyParser.json([options]) + +Returns middleware that only parses `json` and only looks at requests where +the `Content-Type` header matches the `type` option. This parser accepts any +Unicode encoding of the body and supports automatic inflation of `gzip` and +`deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). + +#### Options + +The `json` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### reviver + +The `reviver` option is passed directly to `JSON.parse` as the second +argument. You can find more information on this argument +[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter). + +##### strict + +When set to `true`, will only accept arrays and objects; when `false` will +accept anything `JSON.parse` accepts. Defaults to `true`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not a +function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `json`), a mime type (like `application/json`), or +a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a truthy +value. Defaults to `application/json`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.raw([options]) + +Returns middleware that parses all bodies as a `Buffer` and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a `Buffer` object +of the body. + +#### Options + +The `raw` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. +If not a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this +can be an extension name (like `bin`), a mime type (like +`application/octet-stream`), or a mime type with a wildcard (like `*/*` or +`application/*`). If a function, the `type` option is called as `fn(req)` +and the request is parsed if it returns a truthy value. Defaults to +`application/octet-stream`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.text([options]) + +Returns middleware that parses all bodies as a string and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` string containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a string of the +body. + +#### Options + +The `text` function takes an optional `options` object that may contain any of +the following keys: + +##### defaultCharset + +Specify the default character set for the text content if the charset is not +specified in the `Content-Type` header of the request. Defaults to `utf-8`. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `txt`), a mime type (like `text/plain`), or a mime +type with a wildcard (like `*/*` or `text/*`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a +truthy value. Defaults to `text/plain`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.urlencoded([options]) + +Returns middleware that only parses `urlencoded` bodies and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser accepts only UTF-8 encoding of the body and supports automatic +inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This object will contain +key-value pairs, where the value can be a string or array (when `extended` is +`false`), or any type (when `extended` is `true`). + +#### Options + +The `urlencoded` function takes an optional `options` object that may contain +any of the following keys: + +##### extended + +The `extended` option allows to choose between parsing the URL-encoded data +with the `querystring` library (when `false`) or the `qs` library (when +`true`). The "extended" syntax allows for rich objects and arrays to be +encoded into the URL-encoded format, allowing for a JSON-like experience +with URL-encoded. For more information, please +[see the qs library](https://www.npmjs.org/package/qs#readme). + +Defaults to `true`, but using the default has been deprecated. Please +research into the difference between `qs` and `querystring` and choose the +appropriate setting. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### parameterLimit + +The `parameterLimit` option controls the maximum number of parameters that +are allowed in the URL-encoded data. If a request contains more parameters +than this value, a 413 will be returned to the client. Defaults to `1000`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `urlencoded`), a mime type (like +`application/x-www-form-urlencoded`), or a mime type with a wildcard (like +`*/x-www-form-urlencoded`). If a function, the `type` option is called as +`fn(req)` and the request is parsed if it returns a truthy value. Defaults +to `application/x-www-form-urlencoded`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +#### depth + +The `depth` option is used to configure the maximum depth of the `qs` library when `extended` is `true`. This allows you to limit the amount of keys that are parsed and can be useful to prevent certain types of abuse. Defaults to `32`. It is recommended to keep this value as low as possible. + +## Errors + +The middlewares provided by this module create errors using the +[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors +will typically have a `status`/`statusCode` property that contains the suggested +HTTP response code, an `expose` property to determine if the `message` property +should be displayed to the client, a `type` property to determine the type of +error without matching against the `message`, and a `body` property containing +the read body, if available. + +The following are the common errors created, though any error can come through +for various reasons. + +### content encoding unsupported + +This error will occur when the request had a `Content-Encoding` header that +contained an encoding but the "inflation" option was set to `false`. The +`status` property is set to `415`, the `type` property is set to +`'encoding.unsupported'`, and the `charset` property will be set to the +encoding that is unsupported. + +### entity parse failed + +This error will occur when the request contained an entity that could not be +parsed by the middleware. The `status` property is set to `400`, the `type` +property is set to `'entity.parse.failed'`, and the `body` property is set to +the entity value that failed parsing. + +### entity verify failed + +This error will occur when the request contained an entity that could not be +failed verification by the defined `verify` option. The `status` property is +set to `403`, the `type` property is set to `'entity.verify.failed'`, and the +`body` property is set to the entity value that failed verification. + +### request aborted + +This error will occur when the request is aborted by the client before reading +the body has finished. The `received` property will be set to the number of +bytes received before the request was aborted and the `expected` property is +set to the number of expected bytes. The `status` property is set to `400` +and `type` property is set to `'request.aborted'`. + +### request entity too large + +This error will occur when the request body's size is larger than the "limit" +option. The `limit` property will be set to the byte limit and the `length` +property will be set to the request body's length. The `status` property is +set to `413` and the `type` property is set to `'entity.too.large'`. + +### request size did not match content length + +This error will occur when the request's length did not match the length from +the `Content-Length` header. This typically occurs when the request is malformed, +typically when the `Content-Length` header was calculated based on characters +instead of bytes. The `status` property is set to `400` and the `type` property +is set to `'request.size.invalid'`. + +### stream encoding should not be set + +This error will occur when something called the `req.setEncoding` method prior +to this middleware. This module operates directly on bytes only and you cannot +call `req.setEncoding` when using this module. The `status` property is set to +`500` and the `type` property is set to `'stream.encoding.set'`. + +### stream is not readable + +This error will occur when the request is no longer readable when this middleware +attempts to read it. This typically means something other than a middleware from +this module read the request body already and the middleware was also configured to +read the same request. The `status` property is set to `500` and the `type` +property is set to `'stream.not.readable'`. + +### too many parameters + +This error will occur when the content of the request exceeds the configured +`parameterLimit` for the `urlencoded` parser. The `status` property is set to +`413` and the `type` property is set to `'parameters.too.many'`. + +### unsupported charset "BOGUS" + +This error will occur when the request had a charset parameter in the +`Content-Type` header, but the `iconv-lite` module does not support it OR the +parser does not support it. The charset is contained in the message as well +as in the `charset` property. The `status` property is set to `415`, the +`type` property is set to `'charset.unsupported'`, and the `charset` property +is set to the charset that is unsupported. + +### unsupported content encoding "bogus" + +This error will occur when the request had a `Content-Encoding` header that +contained an unsupported encoding. The encoding is contained in the message +as well as in the `encoding` property. The `status` property is set to `415`, +the `type` property is set to `'encoding.unsupported'`, and the `encoding` +property is set to the encoding that is unsupported. + +### The input exceeded the depth + +This error occurs when using `bodyParser.urlencoded` with the `extended` property set to `true` and the input exceeds the configured `depth` option. The `status` property is set to `400`. It is recommended to review the `depth` option and evaluate if it requires a higher value. When the `depth` option is set to `32` (default value), the error will not be thrown. + +## Examples + +### Express/Connect top-level generic + +This example demonstrates adding a generic JSON and URL-encoded parser as a +top-level middleware, which will parse the bodies of all incoming requests. +This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### Express route-specific + +This example demonstrates adding body parsers specifically to the routes that +need them. In general, this is the most recommended way to use body-parser with +Express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + res.send('welcome, ' + req.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + // create user in req.body +}) +``` + +### Change accepted type for parsers + +All the parsers accept a `type` option which allows you to change the +`Content-Type` that the middleware will parse. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/expressjs/body-parser/master?label=ci +[ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/body-parser/master +[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master +[node-version-image]: https://badgen.net/npm/node/body-parser +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/body-parser +[npm-url]: https://npmjs.org/package/body-parser +[npm-version-image]: https://badgen.net/npm/v/body-parser +[ossf-scorecard-badge]: https://api.scorecard.dev/projects/github.com/expressjs/body-parser/badge +[ossf-scorecard-visualizer]: https://ossf.github.io/scorecard-visualizer/#/projects/github.com/expressjs/body-parser \ No newline at end of file diff --git a/node_modules/body-parser/SECURITY.md b/node_modules/body-parser/SECURITY.md new file mode 100644 index 00000000..9694d429 --- /dev/null +++ b/node_modules/body-parser/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The Express team and community take all security bugs seriously. Thank you +for improving the security of Express. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `body-parser`. This +information can be found in the npm registry using the command +`npm owner ls body-parser`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/expressjs/body-parser/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/node_modules/body-parser/index.js b/node_modules/body-parser/index.js new file mode 100644 index 00000000..bb24d739 --- /dev/null +++ b/node_modules/body-parser/index.js @@ -0,0 +1,156 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('body-parser') + +/** + * Cache of loaded parsers. + * @private + */ + +var parsers = Object.create(null) + +/** + * @typedef Parsers + * @type {function} + * @property {function} json + * @property {function} raw + * @property {function} text + * @property {function} urlencoded + */ + +/** + * Module exports. + * @type {Parsers} + */ + +exports = module.exports = deprecate.function(bodyParser, + 'bodyParser: use individual json/urlencoded middlewares') + +/** + * JSON parser. + * @public + */ + +Object.defineProperty(exports, 'json', { + configurable: true, + enumerable: true, + get: createParserGetter('json') +}) + +/** + * Raw parser. + * @public + */ + +Object.defineProperty(exports, 'raw', { + configurable: true, + enumerable: true, + get: createParserGetter('raw') +}) + +/** + * Text parser. + * @public + */ + +Object.defineProperty(exports, 'text', { + configurable: true, + enumerable: true, + get: createParserGetter('text') +}) + +/** + * URL-encoded parser. + * @public + */ + +Object.defineProperty(exports, 'urlencoded', { + configurable: true, + enumerable: true, + get: createParserGetter('urlencoded') +}) + +/** + * Create a middleware to parse json and urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @deprecated + * @public + */ + +function bodyParser (options) { + // use default type for parsers + var opts = Object.create(options || null, { + type: { + configurable: true, + enumerable: true, + value: undefined, + writable: true + } + }) + + var _urlencoded = exports.urlencoded(opts) + var _json = exports.json(opts) + + return function bodyParser (req, res, next) { + _json(req, res, function (err) { + if (err) return next(err) + _urlencoded(req, res, next) + }) + } +} + +/** + * Create a getter for loading a parser. + * @private + */ + +function createParserGetter (name) { + return function get () { + return loadParser(name) + } +} + +/** + * Load a parser module. + * @private + */ + +function loadParser (parserName) { + var parser = parsers[parserName] + + if (parser !== undefined) { + return parser + } + + // this uses a switch for static require analysis + switch (parserName) { + case 'json': + parser = require('./lib/types/json') + break + case 'raw': + parser = require('./lib/types/raw') + break + case 'text': + parser = require('./lib/types/text') + break + case 'urlencoded': + parser = require('./lib/types/urlencoded') + break + } + + // store to prevent invoking require() + return (parsers[parserName] = parser) +} diff --git a/node_modules/body-parser/lib/read.js b/node_modules/body-parser/lib/read.js new file mode 100644 index 00000000..fce6283f --- /dev/null +++ b/node_modules/body-parser/lib/read.js @@ -0,0 +1,205 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var destroy = require('destroy') +var getBody = require('raw-body') +var iconv = require('iconv-lite') +var onFinished = require('on-finished') +var unpipe = require('unpipe') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = read + +/** + * Read a request into a buffer and parse. + * + * @param {object} req + * @param {object} res + * @param {function} next + * @param {function} parse + * @param {function} debug + * @param {object} options + * @private + */ + +function read (req, res, next, parse, debug, options) { + var length + var opts = options + var stream + + // flag as parsed + req._body = true + + // read options + var encoding = opts.encoding !== null + ? opts.encoding + : null + var verify = opts.verify + + try { + // get the content stream + stream = contentstream(req, debug, opts.inflate) + length = stream.length + stream.length = undefined + } catch (err) { + return next(err) + } + + // set raw-body options + opts.length = length + opts.encoding = verify + ? null + : encoding + + // assert charset is supported + if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) { + return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + })) + } + + // read body + debug('read body') + getBody(stream, opts, function (error, body) { + if (error) { + var _error + + if (error.type === 'encoding.unsupported') { + // echo back charset + _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + }) + } else { + // set status code on error + _error = createError(400, error) + } + + // unpipe from stream and destroy + if (stream !== req) { + unpipe(req) + destroy(stream, true) + } + + // read off entire request + dump(req, function onfinished () { + next(createError(400, _error)) + }) + return + } + + // verify + if (verify) { + try { + debug('verify body') + verify(req, res, body, encoding) + } catch (err) { + next(createError(403, err, { + body: body, + type: err.type || 'entity.verify.failed' + })) + return + } + } + + // parse + var str = body + try { + debug('parse body') + str = typeof body !== 'string' && encoding !== null + ? iconv.decode(body, encoding) + : body + req.body = parse(str) + } catch (err) { + next(createError(400, err, { + body: str, + type: err.type || 'entity.parse.failed' + })) + return + } + + next() + }) +} + +/** + * Get the content stream of the request. + * + * @param {object} req + * @param {function} debug + * @param {boolean} [inflate=true] + * @return {object} + * @api private + */ + +function contentstream (req, debug, inflate) { + var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase() + var length = req.headers['content-length'] + var stream + + debug('content-encoding "%s"', encoding) + + if (inflate === false && encoding !== 'identity') { + throw createError(415, 'content encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + switch (encoding) { + case 'deflate': + stream = zlib.createInflate() + debug('inflate body') + req.pipe(stream) + break + case 'gzip': + stream = zlib.createGunzip() + debug('gunzip body') + req.pipe(stream) + break + case 'identity': + stream = req + stream.length = length + break + default: + throw createError(415, 'unsupported content encoding "' + encoding + '"', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + return stream +} + +/** + * Dump the contents of a request. + * + * @param {object} req + * @param {function} callback + * @api private + */ + +function dump (req, callback) { + if (onFinished.isFinished(req)) { + callback(null) + } else { + onFinished(req, callback) + req.resume() + } +} diff --git a/node_modules/body-parser/lib/types/json.js b/node_modules/body-parser/lib/types/json.js new file mode 100644 index 00000000..59f3f7e2 --- /dev/null +++ b/node_modules/body-parser/lib/types/json.js @@ -0,0 +1,247 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:json') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = json + +/** + * RegExp to match the first non-space in a string. + * + * Allowed whitespace is defined in RFC 7159: + * + * ws = *( + * %x20 / ; Space + * %x09 / ; Horizontal tab + * %x0A / ; Line feed or New line + * %x0D ) ; Carriage return + */ + +var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex + +var JSON_SYNTAX_CHAR = '#' +var JSON_SYNTAX_REGEXP = /#+/g + +/** + * Create a middleware to parse JSON bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function json (options) { + var opts = options || {} + + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var inflate = opts.inflate !== false + var reviver = opts.reviver + var strict = opts.strict !== false + var type = opts.type || 'application/json' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + if (body.length === 0) { + // special-case empty json body, as it's a common client-side mistake + // TODO: maybe make this configurable or part of "strict" option + return {} + } + + if (strict) { + var first = firstchar(body) + + if (first !== '{' && first !== '[') { + debug('strict violation') + throw createStrictSyntaxError(body, first) + } + } + + try { + debug('parse json') + return JSON.parse(body, reviver) + } catch (e) { + throw normalizeJsonSyntaxError(e, { + message: e.message, + stack: e.stack + }) + } + } + + return function jsonParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset per RFC 7159 sec 8.1 + var charset = getCharset(req) || 'utf-8' + if (charset.slice(0, 4) !== 'utf-') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Create strict violation syntax error matching native error. + * + * @param {string} str + * @param {string} char + * @return {Error} + * @private + */ + +function createStrictSyntaxError (str, char) { + var index = str.indexOf(char) + var partial = '' + + if (index !== -1) { + partial = str.substring(0, index) + JSON_SYNTAX_CHAR + + for (var i = index + 1; i < str.length; i++) { + partial += JSON_SYNTAX_CHAR + } + } + + try { + JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation') + } catch (e) { + return normalizeJsonSyntaxError(e, { + message: e.message.replace(JSON_SYNTAX_REGEXP, function (placeholder) { + return str.substring(index, index + placeholder.length) + }), + stack: e.stack + }) + } +} + +/** + * Get the first non-whitespace character in a string. + * + * @param {string} str + * @return {function} + * @private + */ + +function firstchar (str) { + var match = FIRST_CHAR_REGEXP.exec(str) + + return match + ? match[1] + : undefined +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Normalize a SyntaxError for JSON.parse. + * + * @param {SyntaxError} error + * @param {object} obj + * @return {SyntaxError} + */ + +function normalizeJsonSyntaxError (error, obj) { + var keys = Object.getOwnPropertyNames(error) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key !== 'stack' && key !== 'message') { + delete error[key] + } + } + + // replace stack before message for Node.js 0.10 and below + error.stack = obj.stack.replace(error.message, obj.message) + error.message = obj.message + + return error +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/raw.js b/node_modules/body-parser/lib/types/raw.js new file mode 100644 index 00000000..f5d1b674 --- /dev/null +++ b/node_modules/body-parser/lib/types/raw.js @@ -0,0 +1,101 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var debug = require('debug')('body-parser:raw') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = raw + +/** + * Create a middleware to parse raw bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function raw (options) { + var opts = options || {} + + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/octet-stream' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function rawParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // read + read(req, res, next, parse, debug, { + encoding: null, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/text.js b/node_modules/body-parser/lib/types/text.js new file mode 100644 index 00000000..083a0090 --- /dev/null +++ b/node_modules/body-parser/lib/types/text.js @@ -0,0 +1,121 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var debug = require('debug')('body-parser:text') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = text + +/** + * Create a middleware to parse text bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function text (options) { + var opts = options || {} + + var defaultCharset = opts.defaultCharset || 'utf-8' + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'text/plain' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function textParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // get charset + var charset = getCharset(req) || defaultCharset + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/urlencoded.js b/node_modules/body-parser/lib/types/urlencoded.js new file mode 100644 index 00000000..2bd4485f --- /dev/null +++ b/node_modules/body-parser/lib/types/urlencoded.js @@ -0,0 +1,307 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:urlencoded') +var deprecate = require('depd')('body-parser') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = urlencoded + +/** + * Cache of parser modules. + */ + +var parsers = Object.create(null) + +/** + * Create a middleware to parse urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function urlencoded (options) { + var opts = options || {} + + // notice because option default will flip in next major + if (opts.extended === undefined) { + deprecate('undefined extended: provide extended option') + } + + var extended = opts.extended !== false + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/x-www-form-urlencoded' + var verify = opts.verify || false + var depth = typeof opts.depth !== 'number' + ? Number(opts.depth || 32) + : opts.depth + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate query parser + var queryparse = extended + ? extendedparser(opts) + : simpleparser(opts) + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + return body.length + ? queryparse(body) + : {} + } + + return function urlencodedParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset + var charset = getCharset(req) || 'utf-8' + if (charset !== 'utf-8') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + debug: debug, + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify, + depth: depth + }) + } +} + +/** + * Get the extended query parser. + * + * @param {object} options + */ + +function extendedparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + + var depth = typeof options.depth !== 'number' + ? Number(options.depth || 32) + : options.depth + var parse = parser('qs') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isNaN(depth) || depth < 0) { + throw new TypeError('option depth must be a zero or a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + var arrayLimit = Math.max(100, paramCount) + + debug('parse extended urlencoding') + try { + return parse(body, { + allowPrototypes: true, + arrayLimit: arrayLimit, + depth: depth, + strictDepth: true, + parameterLimit: parameterLimit + }) + } catch (err) { + if (err instanceof RangeError) { + throw createError(400, 'The input exceeded the depth', { + type: 'querystring.parse.rangeError' + }) + } else { + throw err + } + } + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Count the number of parameters, stopping once limit reached + * + * @param {string} body + * @param {number} limit + * @api private + */ + +function parameterCount (body, limit) { + var count = 0 + var index = 0 + + while ((index = body.indexOf('&', index)) !== -1) { + count++ + index++ + + if (count === limit) { + return undefined + } + } + + return count +} + +/** + * Get parser for module name dynamically. + * + * @param {string} name + * @return {function} + * @api private + */ + +function parser (name) { + var mod = parsers[name] + + if (mod !== undefined) { + return mod.parse + } + + // this uses a switch for static require analysis + switch (name) { + case 'qs': + mod = require('qs') + break + case 'querystring': + mod = require('querystring') + break + } + + // store to prevent invoking require() + parsers[name] = mod + + return mod.parse +} + +/** + * Get the simple query parser. + * + * @param {object} options + */ + +function simpleparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('querystring') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + debug('parse urlencoding') + return parse(body, undefined, undefined, { maxKeys: parameterLimit }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/package.json b/node_modules/body-parser/package.json new file mode 100644 index 00000000..3c9926fc --- /dev/null +++ b/node_modules/body-parser/package.json @@ -0,0 +1,56 @@ +{ + "name": "body-parser", + "description": "Node.js body parsing middleware", + "version": "1.20.3", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "expressjs/body-parser", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.5", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.13.0", + "raw-body": "2.5.2", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "devDependencies": { + "eslint": "8.34.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-markdown": "3.0.0", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "methods": "1.1.2", + "mocha": "10.2.0", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "supertest": "6.3.3" + }, + "files": [ + "lib/", + "LICENSE", + "HISTORY.md", + "SECURITY.md", + "index.js" + ], + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/node_modules/bson/HISTORY.md b/node_modules/bson/HISTORY.md new file mode 100644 index 00000000..d8d5d207 --- /dev/null +++ b/node_modules/bson/HISTORY.md @@ -0,0 +1,301 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +### [1.1.6](https://github.com/mongodb/js-bson/compare/v1.1.5...v1.1.6) (2021-03-16) + + +### Bug Fixes + +* Throw error on bigint usage and add helpers to Long ([#426](https://github.com/mongodb/js-bson/issues/426)) ([375f368](https://github.com/mongodb/js-bson/commit/375f368738807f2d41c7751e618fd09c8a1b94c9)) + +### [1.1.5](https://github.com/mongodb/js-bson/compare/v1.1.4...v1.1.5) (2020-08-10) + + +### Bug Fixes + +* **object-id:** harden the duck-typing ([b526145](https://github.com/mongodb/js-bson/commit/b5261450c3bc4abb2e2fb19b5b1a7aba27982d44)) + + +## [1.1.3](https://github.com/mongodb/js-bson/compare/v1.1.2...v1.1.3) (2019-11-09) + +Reverts 1.1.2 + + +## [1.1.2](https://github.com/mongodb/js-bson/compare/v1.1.1...v1.1.2) (2019-11-08) + + +### Bug Fixes + +* **_bsontype:** only check bsontype if it is a prototype member. ([dd8a349](https://github.com/mongodb/js-bson/commit/dd8a349)) + + + + +## [1.1.1](https://github.com/mongodb/js-bson/compare/v1.1.0...v1.1.1) (2019-03-08) + + +### Bug Fixes + +* **object-id:** support 4.x->1.x interop for MinKey and ObjectId ([53419a5](https://github.com/mongodb/js-bson/commit/53419a5)) + + +### Features + +* replace new Buffer with modern versions ([24aefba](https://github.com/mongodb/js-bson/commit/24aefba)) + + + + +# [1.1.0](https://github.com/mongodb/js-bson/compare/v1.0.9...v1.1.0) (2018-08-13) + + +### Bug Fixes + +* **serializer:** do not use checkKeys for $clusterTime ([573e141](https://github.com/mongodb/js-bson/commit/573e141)) + + + + +## [1.0.9](https://github.com/mongodb/js-bson/compare/v1.0.8...v1.0.9) (2018-06-07) + + +### Bug Fixes + +* **serializer:** remove use of `const` ([5feb12f](https://github.com/mongodb/js-bson/commit/5feb12f)) + + + + +## [1.0.7](https://github.com/mongodb/js-bson/compare/v1.0.6...v1.0.7) (2018-06-06) + + +### Bug Fixes + +* **binary:** add type checking for buffer ([26b05b5](https://github.com/mongodb/js-bson/commit/26b05b5)) +* **bson:** fix custom inspect property ([080323b](https://github.com/mongodb/js-bson/commit/080323b)) +* **readme:** clarify documentation about deserialize methods ([20f764c](https://github.com/mongodb/js-bson/commit/20f764c)) +* **serialization:** normalize function stringification ([1320c10](https://github.com/mongodb/js-bson/commit/1320c10)) + + + + +## [1.0.6](https://github.com/mongodb/js-bson/compare/v1.0.5...v1.0.6) (2018-03-12) + + +### Features + +* **serialization:** support arbitrary sizes for the internal serialization buffer ([abe97bc](https://github.com/mongodb/js-bson/commit/abe97bc)) + + + + +## 1.0.5 (2018-02-26) + + +### Bug Fixes + +* **decimal128:** add basic guard against REDOS attacks ([bd61c45](https://github.com/mongodb/js-bson/commit/bd61c45)) +* **objectid:** if pid is 1, use random value ([e188ae6](https://github.com/mongodb/js-bson/commit/e188ae6)) + + + +1.0.4 2016-01-11 +---------------- +- #204 remove Buffer.from as it's partially broken in early 4.x.x. series of node releases. + +1.0.3 2016-01-03 +---------------- +- Fixed toString for ObjectId so it will work with inspect. + +1.0.2 2016-01-02 +---------------- +- Minor optimizations for ObjectID to use Buffer.from where available. + +1.0.1 2016-12-06 +---------------- +- Reverse behavior for undefined to be serialized as NULL. MongoDB 3.4 does not allow for undefined comparisons. + +1.0.0 2016-12-06 +---------------- +- Introduced new BSON API and documentation. + +0.5.7 2016-11-18 +----------------- +- NODE-848 BSON Regex flags must be alphabetically ordered. + +0.5.6 2016-10-19 +----------------- +- NODE-833, Detects cyclic dependencies in documents and throws error if one is found. +- Fix(deserializer): corrected the check for (size + index) comparison… (Issue #195, https://github.com/JoelParke). + +0.5.5 2016-09-15 +----------------- +- Added DBPointer up conversion to DBRef + +0.5.4 2016-08-23 +----------------- +- Added promoteValues flag (default to true) allowing user to specify if deserialization should be into wrapper classes only. + +0.5.3 2016-07-11 +----------------- +- Throw error if ObjectId is not a string or a buffer. + +0.5.2 2016-07-11 +----------------- +- All values encoded big-endian style for ObjectId. + +0.5.1 2016-07-11 +----------------- +- Fixed encoding/decoding issue in ObjectId timestamp generation. +- Removed BinaryParser dependency from the serializer/deserializer. + +0.5.0 2016-07-05 +----------------- +- Added Decimal128 type and extended test suite to include entire bson corpus. + +0.4.23 2016-04-08 +----------------- +- Allow for proper detection of ObjectId or objects that look like ObjectId, improving compatibility across third party libraries. +- Remove one package from dependency due to having been pulled from NPM. + +0.4.22 2016-03-04 +----------------- +- Fix "TypeError: data.copy is not a function" in Electron (Issue #170, https://github.com/kangas). +- Fixed issue with undefined type on deserializing. + +0.4.21 2016-01-12 +----------------- +- Minor optimizations to avoid non needed object creation. + +0.4.20 2015-10-15 +----------------- +- Added bower file to repository. +- Fixed browser pid sometimes set greater than 0xFFFF on browsers (Issue #155, https://github.com/rahatarmanahmed) + +0.4.19 2015-10-15 +----------------- +- Remove all support for bson-ext. + +0.4.18 2015-10-15 +----------------- +- ObjectID equality check should return boolean instead of throwing exception for invalid oid string #139 +- add option for deserializing binary into Buffer object #116 + +0.4.17 2015-10-15 +----------------- +- Validate regexp string for null bytes and throw if there is one. + +0.4.16 2015-10-07 +----------------- +- Fixed issue with return statement in Map.js. + +0.4.15 2015-10-06 +----------------- +- Exposed Map correctly via index.js file. + +0.4.14 2015-10-06 +----------------- +- Exposed Map correctly via bson.js file. + +0.4.13 2015-10-06 +----------------- +- Added ES6 Map type serialization as well as a polyfill for ES5. + +0.4.12 2015-09-18 +----------------- +- Made ignore undefined an optional parameter. + +0.4.11 2015-08-06 +----------------- +- Minor fix for invalid key checking. + +0.4.10 2015-08-06 +----------------- +- NODE-38 Added new BSONRegExp type to allow direct serialization to MongoDB type. +- Some performance improvements by in lining code. + +0.4.9 2015-08-06 +---------------- +- Undefined fields are omitted from serialization in objects. + +0.4.8 2015-07-14 +---------------- +- Fixed size validation to ensure we can deserialize from dumped files. + +0.4.7 2015-06-26 +---------------- +- Added ability to instruct deserializer to return raw BSON buffers for named array fields. +- Minor deserialization optimization by moving inlined function out. + +0.4.6 2015-06-17 +---------------- +- Fixed serializeWithBufferAndIndex bug. + +0.4.5 2015-06-17 +---------------- +- Removed any references to the shared buffer to avoid non GC collectible bson instances. + +0.4.4 2015-06-17 +---------------- +- Fixed rethrowing of error when not RangeError. + +0.4.3 2015-06-17 +---------------- +- Start buffer at 64K and double as needed, meaning we keep a low memory profile until needed. + +0.4.2 2015-06-16 +---------------- +- More fixes for corrupt Bson + +0.4.1 2015-06-16 +---------------- +- More fixes for corrupt Bson + +0.4.0 2015-06-16 +---------------- +- New JS serializer serializing into a single buffer then copying out the new buffer. Performance is similar to current C++ parser. +- Removed bson-ext extension dependency for now. + +0.3.2 2015-03-27 +---------------- +- Removed node-gyp from install script in package.json. + +0.3.1 2015-03-27 +---------------- +- Return pure js version on native() call if failed to initialize. + +0.3.0 2015-03-26 +---------------- +- Pulled out all C++ code into bson-ext and made it an optional dependency. + +0.2.21 2015-03-21 +----------------- +- Updated Nan to 1.7.0 to support io.js and node 0.12.0 + +0.2.19 2015-02-16 +----------------- +- Updated Nan to 1.6.2 to support io.js and node 0.12.0 + +0.2.18 2015-01-20 +----------------- +- Updated Nan to 1.5.1 to support io.js + +0.2.16 2014-12-17 +----------------- +- Made pid cycle on 0xffff to avoid weird overflows on creation of ObjectID's + +0.2.12 2014-08-24 +----------------- +- Fixes for fortify review of c++ extension +- toBSON correctly allows returns of non objects + +0.2.3 2013-10-01 +---------------- +- Drying of ObjectId code for generation of id (Issue #54, https://github.com/moredip) +- Fixed issue where corrupt CString's could cause endless loop +- Support for Node 0.11.X > (Issue #49, https://github.com/kkoopa) + +0.1.4 2012-09-25 +---------------- +- Added precompiled c++ native extensions for win32 ia32 and x64 diff --git a/node_modules/bson/LICENSE.md b/node_modules/bson/LICENSE.md new file mode 100644 index 00000000..261eeb9e --- /dev/null +++ b/node_modules/bson/LICENSE.md @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/node_modules/bson/README.md b/node_modules/bson/README.md new file mode 100644 index 00000000..06883410 --- /dev/null +++ b/node_modules/bson/README.md @@ -0,0 +1,170 @@ +# BSON parser + +BSON is short for Bin­ary JSON and is the bin­ary-en­coded seri­al­iz­a­tion of JSON-like doc­u­ments. You can learn more about it in [the specification](http://bsonspec.org). + +This browser version of the BSON parser is compiled using [webpack](https://webpack.js.org/) and the current version is pre-compiled in the `browser_build` directory. + +This is the default BSON parser, however, there is a C++ Node.js addon version as well that does not support the browser. It can be found at [mongod-js/bson-ext](https://github.com/mongodb-js/bson-ext). + +## Usage + +To build a new version perform the following operations: + +``` +npm install +npm run build +``` + +A simple example of how to use BSON in the browser: + +```html + + + +``` + +A simple example of how to use BSON in `Node.js`: + +```js +// Get BSON parser class +var BSON = require('bson') +// Get the Long type +var Long = BSON.Long; +// Create a bson parser instance +var bson = new BSON(); + +// Serialize document +var doc = { long: Long.fromNumber(100) } + +// Serialize a document +var data = bson.serialize(doc) +console.log('data:', data) + +// Deserialize the resulting Buffer +var doc_2 = bson.deserialize(data) +console.log('doc_2:', doc_2) +``` + +## Installation + +`npm install bson` + +## API + +### BSON types + +For all BSON types documentation, please refer to the following sources: + * [MongoDB BSON Type Reference](https://docs.mongodb.com/manual/reference/bson-types/) + * [BSON Spec](https://bsonspec.org/) + +### BSON serialization and deserialiation + +**`new BSON()`** - Creates a new BSON serializer/deserializer you can use to serialize and deserialize BSON. + +#### BSON.serialize + +The BSON `serialize` method takes a JavaScript object and an optional options object and returns a Node.js Buffer. + + * `BSON.serialize(object, options)` + * @param {Object} object the JavaScript object to serialize. + * @param {Boolean} [options.checkKeys=false] the serializer will check if keys are valid. + * @param {Boolean} [options.serializeFunctions=false] serialize the JavaScript functions. + * @param {Boolean} [options.ignoreUndefined=true] + * @return {Buffer} returns a Buffer instance. + +#### BSON.serializeWithBufferAndIndex + +The BSON `serializeWithBufferAndIndex` method takes an object, a target buffer instance and an optional options object and returns the end serialization index in the final buffer. + + * `BSON.serializeWithBufferAndIndex(object, buffer, options)` + * @param {Object} object the JavaScript object to serialize. + * @param {Buffer} buffer the Buffer you pre-allocated to store the serialized BSON object. + * @param {Boolean} [options.checkKeys=false] the serializer will check if keys are valid. + * @param {Boolean} [options.serializeFunctions=false] serialize the JavaScript functions. + * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields. + * @param {Number} [options.index=0] the index in the buffer where we wish to start serializing into. + * @return {Number} returns the index pointing to the last written byte in the buffer. + +#### BSON.calculateObjectSize + +The BSON `calculateObjectSize` method takes a JavaScript object and an optional options object and returns the size of the BSON object. + + * `BSON.calculateObjectSize(object, options)` + * @param {Object} object the JavaScript object to serialize. + * @param {Boolean} [options.serializeFunctions=false] serialize the JavaScript functions. + * @param {Boolean} [options.ignoreUndefined=true] + * @return {Buffer} returns a Buffer instance. + +#### BSON.deserialize + +The BSON `deserialize` method takes a Node.js Buffer and an optional options object and returns a deserialized JavaScript object. + + * `BSON.deserialize(buffer, options)` + * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized. + * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse. + * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function. + * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits + * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a Node.js Buffer instance. + * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types. + * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer. + * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances. + * @return {Object} returns the deserialized Javascript Object. + +#### BSON.deserializeStream + +The BSON `deserializeStream` method takes a Node.js Buffer, `startIndex` and allow more control over deserialization of a Buffer containing concatenated BSON documents. + + * `BSON.deserializeStream(buffer, startIndex, numberOfDocuments, documents, docStartIndex, options)` + * @param {Buffer} buffer the buffer containing the serialized set of BSON documents. + * @param {Number} startIndex the start index in the data Buffer where the deserialization is to start. + * @param {Number} numberOfDocuments number of documents to deserialize. + * @param {Array} documents an array where to store the deserialized documents. + * @param {Number} docStartIndex the index in the documents array from where to start inserting documents. + * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized. + * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse. + * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function. + * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits + * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a Node.js Buffer instance. + * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types. + * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer. + * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances. + * @return {Number} returns the next index in the buffer after deserialization **x** numbers of documents. + +## FAQ + +#### Why does `undefined` get converted to `null`? + +The `undefined` BSON type has been [deprecated for many years](http://bsonspec.org/spec.html), so this library has dropped support for it. Use the `ignoreUndefined` option (for example, from the [driver](http://mongodb.github.io/node-mongodb-native/2.2/api/MongoClient.html#connect) ) to instead remove `undefined` keys. + +#### How do I add custom serialization logic? + +This library looks for `toBSON()` functions on every path, and calls the `toBSON()` function to get the value to serialize. + +```javascript +var bson = new BSON(); + +class CustomSerialize { + toBSON() { + return 42; + } +} + +const obj = { answer: new CustomSerialize() }; +// "{ answer: 42 }" +console.log(bson.deserialize(bson.serialize(obj))); +``` diff --git a/node_modules/bson/bower.json b/node_modules/bson/bower.json new file mode 100644 index 00000000..eded1f82 --- /dev/null +++ b/node_modules/bson/bower.json @@ -0,0 +1,26 @@ +{ + "name": "bson", + "description": "A bson parser for node.js and the browser", + "keywords": [ + "mongodb", + "bson", + "parser" + ], + "author": "Christian Amor Kvalheim ", + "main": "./browser_build/bson.js", + "license": "Apache-2.0", + "moduleType": [ + "globals", + "node" + ], + "ignore": [ + "**/.*", + "alternate_parsers", + "benchmarks", + "bower_components", + "node_modules", + "test", + "tools" + ], + "version": "1.1.6" +} diff --git a/node_modules/bson/browser_build/bson.js b/node_modules/bson/browser_build/bson.js new file mode 100644 index 00000000..9540a86f --- /dev/null +++ b/node_modules/bson/browser_build/bson.js @@ -0,0 +1,18218 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else { + var a = factory(); + for(var i in a) (typeof exports === 'object' ? exports : root)[i] = a[i]; + } +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; + +/******/ // The require function +/******/ function __webpack_require__(moduleId) { + +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; + +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; + +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); + +/******/ // Flag the module as loaded +/******/ module.loaded = true; + +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } + + +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; + +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; + +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = "/"; + +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(1); + module.exports = __webpack_require__(332); + + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(global) {"use strict"; + + __webpack_require__(2); + + __webpack_require__(328); + + __webpack_require__(329); + + if (global._babelPolyfill) { + throw new Error("only one instance of babel-polyfill is allowed"); + } + global._babelPolyfill = true; + + var DEFINE_PROPERTY = "defineProperty"; + function define(O, key, value) { + O[key] || Object[DEFINE_PROPERTY](O, key, { + writable: true, + configurable: true, + value: value + }); + } + + define(String.prototype, "padLeft", "".padStart); + define(String.prototype, "padRight", "".padEnd); + + "pop,reverse,shift,keys,values,entries,indexOf,every,some,forEach,map,filter,find,findIndex,includes,join,slice,concat,push,splice,unshift,sort,lastIndexOf,reduce,reduceRight,copyWithin,fill".split(",").forEach(function (key) { + [][key] && define(Array, key, Function.call.bind([][key])); + }); + /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()))) + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(3); + __webpack_require__(53); + __webpack_require__(54); + __webpack_require__(55); + __webpack_require__(56); + __webpack_require__(58); + __webpack_require__(60); + __webpack_require__(61); + __webpack_require__(62); + __webpack_require__(63); + __webpack_require__(64); + __webpack_require__(65); + __webpack_require__(66); + __webpack_require__(67); + __webpack_require__(68); + __webpack_require__(70); + __webpack_require__(72); + __webpack_require__(74); + __webpack_require__(76); + __webpack_require__(79); + __webpack_require__(80); + __webpack_require__(81); + __webpack_require__(85); + __webpack_require__(87); + __webpack_require__(89); + __webpack_require__(92); + __webpack_require__(93); + __webpack_require__(94); + __webpack_require__(95); + __webpack_require__(97); + __webpack_require__(98); + __webpack_require__(99); + __webpack_require__(100); + __webpack_require__(101); + __webpack_require__(102); + __webpack_require__(103); + __webpack_require__(105); + __webpack_require__(106); + __webpack_require__(107); + __webpack_require__(109); + __webpack_require__(110); + __webpack_require__(111); + __webpack_require__(113); + __webpack_require__(115); + __webpack_require__(116); + __webpack_require__(117); + __webpack_require__(118); + __webpack_require__(119); + __webpack_require__(120); + __webpack_require__(121); + __webpack_require__(122); + __webpack_require__(123); + __webpack_require__(124); + __webpack_require__(125); + __webpack_require__(126); + __webpack_require__(127); + __webpack_require__(132); + __webpack_require__(133); + __webpack_require__(137); + __webpack_require__(138); + __webpack_require__(139); + __webpack_require__(140); + __webpack_require__(142); + __webpack_require__(143); + __webpack_require__(144); + __webpack_require__(145); + __webpack_require__(146); + __webpack_require__(147); + __webpack_require__(148); + __webpack_require__(149); + __webpack_require__(150); + __webpack_require__(151); + __webpack_require__(152); + __webpack_require__(153); + __webpack_require__(154); + __webpack_require__(155); + __webpack_require__(156); + __webpack_require__(158); + __webpack_require__(159); + __webpack_require__(161); + __webpack_require__(162); + __webpack_require__(168); + __webpack_require__(169); + __webpack_require__(171); + __webpack_require__(172); + __webpack_require__(173); + __webpack_require__(177); + __webpack_require__(178); + __webpack_require__(179); + __webpack_require__(180); + __webpack_require__(181); + __webpack_require__(183); + __webpack_require__(184); + __webpack_require__(185); + __webpack_require__(186); + __webpack_require__(189); + __webpack_require__(191); + __webpack_require__(192); + __webpack_require__(193); + __webpack_require__(195); + __webpack_require__(197); + __webpack_require__(199); + __webpack_require__(201); + __webpack_require__(202); + __webpack_require__(203); + __webpack_require__(207); + __webpack_require__(208); + __webpack_require__(209); + __webpack_require__(211); + __webpack_require__(221); + __webpack_require__(225); + __webpack_require__(226); + __webpack_require__(228); + __webpack_require__(229); + __webpack_require__(233); + __webpack_require__(234); + __webpack_require__(236); + __webpack_require__(237); + __webpack_require__(238); + __webpack_require__(239); + __webpack_require__(240); + __webpack_require__(241); + __webpack_require__(242); + __webpack_require__(243); + __webpack_require__(244); + __webpack_require__(245); + __webpack_require__(246); + __webpack_require__(247); + __webpack_require__(248); + __webpack_require__(249); + __webpack_require__(250); + __webpack_require__(251); + __webpack_require__(252); + __webpack_require__(253); + __webpack_require__(254); + __webpack_require__(256); + __webpack_require__(257); + __webpack_require__(258); + __webpack_require__(259); + __webpack_require__(260); + __webpack_require__(262); + __webpack_require__(263); + __webpack_require__(264); + __webpack_require__(266); + __webpack_require__(267); + __webpack_require__(268); + __webpack_require__(269); + __webpack_require__(270); + __webpack_require__(271); + __webpack_require__(272); + __webpack_require__(273); + __webpack_require__(275); + __webpack_require__(276); + __webpack_require__(278); + __webpack_require__(279); + __webpack_require__(280); + __webpack_require__(281); + __webpack_require__(284); + __webpack_require__(285); + __webpack_require__(287); + __webpack_require__(288); + __webpack_require__(289); + __webpack_require__(290); + __webpack_require__(292); + __webpack_require__(293); + __webpack_require__(294); + __webpack_require__(295); + __webpack_require__(296); + __webpack_require__(297); + __webpack_require__(298); + __webpack_require__(299); + __webpack_require__(300); + __webpack_require__(301); + __webpack_require__(303); + __webpack_require__(304); + __webpack_require__(305); + __webpack_require__(306); + __webpack_require__(307); + __webpack_require__(308); + __webpack_require__(309); + __webpack_require__(310); + __webpack_require__(311); + __webpack_require__(312); + __webpack_require__(313); + __webpack_require__(315); + __webpack_require__(316); + __webpack_require__(317); + __webpack_require__(318); + __webpack_require__(319); + __webpack_require__(320); + __webpack_require__(321); + __webpack_require__(322); + __webpack_require__(323); + __webpack_require__(324); + __webpack_require__(325); + __webpack_require__(326); + __webpack_require__(327); + module.exports = __webpack_require__(9); + + +/***/ }), +/* 3 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // ECMAScript 6 symbols shim + var global = __webpack_require__(4); + var has = __webpack_require__(5); + var DESCRIPTORS = __webpack_require__(6); + var $export = __webpack_require__(8); + var redefine = __webpack_require__(18); + var META = __webpack_require__(25).KEY; + var $fails = __webpack_require__(7); + var shared = __webpack_require__(21); + var setToStringTag = __webpack_require__(26); + var uid = __webpack_require__(19); + var wks = __webpack_require__(27); + var wksExt = __webpack_require__(28); + var wksDefine = __webpack_require__(29); + var enumKeys = __webpack_require__(30); + var isArray = __webpack_require__(45); + var anObject = __webpack_require__(12); + var isObject = __webpack_require__(13); + var toObject = __webpack_require__(46); + var toIObject = __webpack_require__(33); + var toPrimitive = __webpack_require__(16); + var createDesc = __webpack_require__(17); + var _create = __webpack_require__(47); + var gOPNExt = __webpack_require__(50); + var $GOPD = __webpack_require__(52); + var $GOPS = __webpack_require__(43); + var $DP = __webpack_require__(11); + var $keys = __webpack_require__(31); + var gOPD = $GOPD.f; + var dP = $DP.f; + var gOPN = gOPNExt.f; + var $Symbol = global.Symbol; + var $JSON = global.JSON; + var _stringify = $JSON && $JSON.stringify; + var PROTOTYPE = 'prototype'; + var HIDDEN = wks('_hidden'); + var TO_PRIMITIVE = wks('toPrimitive'); + var isEnum = {}.propertyIsEnumerable; + var SymbolRegistry = shared('symbol-registry'); + var AllSymbols = shared('symbols'); + var OPSymbols = shared('op-symbols'); + var ObjectProto = Object[PROTOTYPE]; + var USE_NATIVE = typeof $Symbol == 'function' && !!$GOPS.f; + var QObject = global.QObject; + // Don't use setters in Qt Script, https://github.com/zloirock/core-js/issues/173 + var setter = !QObject || !QObject[PROTOTYPE] || !QObject[PROTOTYPE].findChild; + + // fallback for old Android, https://code.google.com/p/v8/issues/detail?id=687 + var setSymbolDesc = DESCRIPTORS && $fails(function () { + return _create(dP({}, 'a', { + get: function () { return dP(this, 'a', { value: 7 }).a; } + })).a != 7; + }) ? function (it, key, D) { + var protoDesc = gOPD(ObjectProto, key); + if (protoDesc) delete ObjectProto[key]; + dP(it, key, D); + if (protoDesc && it !== ObjectProto) dP(ObjectProto, key, protoDesc); + } : dP; + + var wrap = function (tag) { + var sym = AllSymbols[tag] = _create($Symbol[PROTOTYPE]); + sym._k = tag; + return sym; + }; + + var isSymbol = USE_NATIVE && typeof $Symbol.iterator == 'symbol' ? function (it) { + return typeof it == 'symbol'; + } : function (it) { + return it instanceof $Symbol; + }; + + var $defineProperty = function defineProperty(it, key, D) { + if (it === ObjectProto) $defineProperty(OPSymbols, key, D); + anObject(it); + key = toPrimitive(key, true); + anObject(D); + if (has(AllSymbols, key)) { + if (!D.enumerable) { + if (!has(it, HIDDEN)) dP(it, HIDDEN, createDesc(1, {})); + it[HIDDEN][key] = true; + } else { + if (has(it, HIDDEN) && it[HIDDEN][key]) it[HIDDEN][key] = false; + D = _create(D, { enumerable: createDesc(0, false) }); + } return setSymbolDesc(it, key, D); + } return dP(it, key, D); + }; + var $defineProperties = function defineProperties(it, P) { + anObject(it); + var keys = enumKeys(P = toIObject(P)); + var i = 0; + var l = keys.length; + var key; + while (l > i) $defineProperty(it, key = keys[i++], P[key]); + return it; + }; + var $create = function create(it, P) { + return P === undefined ? _create(it) : $defineProperties(_create(it), P); + }; + var $propertyIsEnumerable = function propertyIsEnumerable(key) { + var E = isEnum.call(this, key = toPrimitive(key, true)); + if (this === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return false; + return E || !has(this, key) || !has(AllSymbols, key) || has(this, HIDDEN) && this[HIDDEN][key] ? E : true; + }; + var $getOwnPropertyDescriptor = function getOwnPropertyDescriptor(it, key) { + it = toIObject(it); + key = toPrimitive(key, true); + if (it === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return; + var D = gOPD(it, key); + if (D && has(AllSymbols, key) && !(has(it, HIDDEN) && it[HIDDEN][key])) D.enumerable = true; + return D; + }; + var $getOwnPropertyNames = function getOwnPropertyNames(it) { + var names = gOPN(toIObject(it)); + var result = []; + var i = 0; + var key; + while (names.length > i) { + if (!has(AllSymbols, key = names[i++]) && key != HIDDEN && key != META) result.push(key); + } return result; + }; + var $getOwnPropertySymbols = function getOwnPropertySymbols(it) { + var IS_OP = it === ObjectProto; + var names = gOPN(IS_OP ? OPSymbols : toIObject(it)); + var result = []; + var i = 0; + var key; + while (names.length > i) { + if (has(AllSymbols, key = names[i++]) && (IS_OP ? has(ObjectProto, key) : true)) result.push(AllSymbols[key]); + } return result; + }; + + // 19.4.1.1 Symbol([description]) + if (!USE_NATIVE) { + $Symbol = function Symbol() { + if (this instanceof $Symbol) throw TypeError('Symbol is not a constructor!'); + var tag = uid(arguments.length > 0 ? arguments[0] : undefined); + var $set = function (value) { + if (this === ObjectProto) $set.call(OPSymbols, value); + if (has(this, HIDDEN) && has(this[HIDDEN], tag)) this[HIDDEN][tag] = false; + setSymbolDesc(this, tag, createDesc(1, value)); + }; + if (DESCRIPTORS && setter) setSymbolDesc(ObjectProto, tag, { configurable: true, set: $set }); + return wrap(tag); + }; + redefine($Symbol[PROTOTYPE], 'toString', function toString() { + return this._k; + }); + + $GOPD.f = $getOwnPropertyDescriptor; + $DP.f = $defineProperty; + __webpack_require__(51).f = gOPNExt.f = $getOwnPropertyNames; + __webpack_require__(44).f = $propertyIsEnumerable; + $GOPS.f = $getOwnPropertySymbols; + + if (DESCRIPTORS && !__webpack_require__(22)) { + redefine(ObjectProto, 'propertyIsEnumerable', $propertyIsEnumerable, true); + } + + wksExt.f = function (name) { + return wrap(wks(name)); + }; + } + + $export($export.G + $export.W + $export.F * !USE_NATIVE, { Symbol: $Symbol }); + + for (var es6Symbols = ( + // 19.4.2.2, 19.4.2.3, 19.4.2.4, 19.4.2.6, 19.4.2.8, 19.4.2.9, 19.4.2.10, 19.4.2.11, 19.4.2.12, 19.4.2.13, 19.4.2.14 + 'hasInstance,isConcatSpreadable,iterator,match,replace,search,species,split,toPrimitive,toStringTag,unscopables' + ).split(','), j = 0; es6Symbols.length > j;)wks(es6Symbols[j++]); + + for (var wellKnownSymbols = $keys(wks.store), k = 0; wellKnownSymbols.length > k;) wksDefine(wellKnownSymbols[k++]); + + $export($export.S + $export.F * !USE_NATIVE, 'Symbol', { + // 19.4.2.1 Symbol.for(key) + 'for': function (key) { + return has(SymbolRegistry, key += '') + ? SymbolRegistry[key] + : SymbolRegistry[key] = $Symbol(key); + }, + // 19.4.2.5 Symbol.keyFor(sym) + keyFor: function keyFor(sym) { + if (!isSymbol(sym)) throw TypeError(sym + ' is not a symbol!'); + for (var key in SymbolRegistry) if (SymbolRegistry[key] === sym) return key; + }, + useSetter: function () { setter = true; }, + useSimple: function () { setter = false; } + }); + + $export($export.S + $export.F * !USE_NATIVE, 'Object', { + // 19.1.2.2 Object.create(O [, Properties]) + create: $create, + // 19.1.2.4 Object.defineProperty(O, P, Attributes) + defineProperty: $defineProperty, + // 19.1.2.3 Object.defineProperties(O, Properties) + defineProperties: $defineProperties, + // 19.1.2.6 Object.getOwnPropertyDescriptor(O, P) + getOwnPropertyDescriptor: $getOwnPropertyDescriptor, + // 19.1.2.7 Object.getOwnPropertyNames(O) + getOwnPropertyNames: $getOwnPropertyNames, + // 19.1.2.8 Object.getOwnPropertySymbols(O) + getOwnPropertySymbols: $getOwnPropertySymbols + }); + + // Chrome 38 and 39 `Object.getOwnPropertySymbols` fails on primitives + // https://bugs.chromium.org/p/v8/issues/detail?id=3443 + var FAILS_ON_PRIMITIVES = $fails(function () { $GOPS.f(1); }); + + $export($export.S + $export.F * FAILS_ON_PRIMITIVES, 'Object', { + getOwnPropertySymbols: function getOwnPropertySymbols(it) { + return $GOPS.f(toObject(it)); + } + }); + + // 24.3.2 JSON.stringify(value [, replacer [, space]]) + $JSON && $export($export.S + $export.F * (!USE_NATIVE || $fails(function () { + var S = $Symbol(); + // MS Edge converts symbol values to JSON as {} + // WebKit converts symbol values to JSON as null + // V8 throws on boxed symbols + return _stringify([S]) != '[null]' || _stringify({ a: S }) != '{}' || _stringify(Object(S)) != '{}'; + })), 'JSON', { + stringify: function stringify(it) { + var args = [it]; + var i = 1; + var replacer, $replacer; + while (arguments.length > i) args.push(arguments[i++]); + $replacer = replacer = args[1]; + if (!isObject(replacer) && it === undefined || isSymbol(it)) return; // IE8 returns string on undefined + if (!isArray(replacer)) replacer = function (key, value) { + if (typeof $replacer == 'function') value = $replacer.call(this, key, value); + if (!isSymbol(value)) return value; + }; + args[1] = replacer; + return _stringify.apply($JSON, args); + } + }); + + // 19.4.3.4 Symbol.prototype[@@toPrimitive](hint) + $Symbol[PROTOTYPE][TO_PRIMITIVE] || __webpack_require__(10)($Symbol[PROTOTYPE], TO_PRIMITIVE, $Symbol[PROTOTYPE].valueOf); + // 19.4.3.5 Symbol.prototype[@@toStringTag] + setToStringTag($Symbol, 'Symbol'); + // 20.2.1.9 Math[@@toStringTag] + setToStringTag(Math, 'Math', true); + // 24.3.3 JSON[@@toStringTag] + setToStringTag(global.JSON, 'JSON', true); + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + // https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 + var global = module.exports = typeof window != 'undefined' && window.Math == Math + ? window : typeof self != 'undefined' && self.Math == Math ? self + // eslint-disable-next-line no-new-func + : Function('return this')(); + if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef + + +/***/ }), +/* 5 */ +/***/ (function(module, exports) { + + var hasOwnProperty = {}.hasOwnProperty; + module.exports = function (it, key) { + return hasOwnProperty.call(it, key); + }; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + // Thank's IE8 for his funny defineProperty + module.exports = !__webpack_require__(7)(function () { + return Object.defineProperty({}, 'a', { get: function () { return 7; } }).a != 7; + }); + + +/***/ }), +/* 7 */ +/***/ (function(module, exports) { + + module.exports = function (exec) { + try { + return !!exec(); + } catch (e) { + return true; + } + }; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + + var global = __webpack_require__(4); + var core = __webpack_require__(9); + var hide = __webpack_require__(10); + var redefine = __webpack_require__(18); + var ctx = __webpack_require__(23); + var PROTOTYPE = 'prototype'; + + var $export = function (type, name, source) { + var IS_FORCED = type & $export.F; + var IS_GLOBAL = type & $export.G; + var IS_STATIC = type & $export.S; + var IS_PROTO = type & $export.P; + var IS_BIND = type & $export.B; + var target = IS_GLOBAL ? global : IS_STATIC ? global[name] || (global[name] = {}) : (global[name] || {})[PROTOTYPE]; + var exports = IS_GLOBAL ? core : core[name] || (core[name] = {}); + var expProto = exports[PROTOTYPE] || (exports[PROTOTYPE] = {}); + var key, own, out, exp; + if (IS_GLOBAL) source = name; + for (key in source) { + // contains in native + own = !IS_FORCED && target && target[key] !== undefined; + // export native or passed + out = (own ? target : source)[key]; + // bind timers to global for call from export context + exp = IS_BIND && own ? ctx(out, global) : IS_PROTO && typeof out == 'function' ? ctx(Function.call, out) : out; + // extend global + if (target) redefine(target, key, out, type & $export.U); + // export + if (exports[key] != out) hide(exports, key, exp); + if (IS_PROTO && expProto[key] != out) expProto[key] = out; + } + }; + global.core = core; + // type bitmap + $export.F = 1; // forced + $export.G = 2; // global + $export.S = 4; // static + $export.P = 8; // proto + $export.B = 16; // bind + $export.W = 32; // wrap + $export.U = 64; // safe + $export.R = 128; // real proto method for `library` + module.exports = $export; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports) { + + var core = module.exports = { version: '2.6.10' }; + if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + + var dP = __webpack_require__(11); + var createDesc = __webpack_require__(17); + module.exports = __webpack_require__(6) ? function (object, key, value) { + return dP.f(object, key, createDesc(1, value)); + } : function (object, key, value) { + object[key] = value; + return object; + }; + + +/***/ }), +/* 11 */ +/***/ (function(module, exports, __webpack_require__) { + + var anObject = __webpack_require__(12); + var IE8_DOM_DEFINE = __webpack_require__(14); + var toPrimitive = __webpack_require__(16); + var dP = Object.defineProperty; + + exports.f = __webpack_require__(6) ? Object.defineProperty : function defineProperty(O, P, Attributes) { + anObject(O); + P = toPrimitive(P, true); + anObject(Attributes); + if (IE8_DOM_DEFINE) try { + return dP(O, P, Attributes); + } catch (e) { /* empty */ } + if ('get' in Attributes || 'set' in Attributes) throw TypeError('Accessors not supported!'); + if ('value' in Attributes) O[P] = Attributes.value; + return O; + }; + + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + + var isObject = __webpack_require__(13); + module.exports = function (it) { + if (!isObject(it)) throw TypeError(it + ' is not an object!'); + return it; + }; + + +/***/ }), +/* 13 */ +/***/ (function(module, exports) { + + module.exports = function (it) { + return typeof it === 'object' ? it !== null : typeof it === 'function'; + }; + + +/***/ }), +/* 14 */ +/***/ (function(module, exports, __webpack_require__) { + + module.exports = !__webpack_require__(6) && !__webpack_require__(7)(function () { + return Object.defineProperty(__webpack_require__(15)('div'), 'a', { get: function () { return 7; } }).a != 7; + }); + + +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { + + var isObject = __webpack_require__(13); + var document = __webpack_require__(4).document; + // typeof document.createElement is 'object' in old IE + var is = isObject(document) && isObject(document.createElement); + module.exports = function (it) { + return is ? document.createElement(it) : {}; + }; + + +/***/ }), +/* 16 */ +/***/ (function(module, exports, __webpack_require__) { + + // 7.1.1 ToPrimitive(input [, PreferredType]) + var isObject = __webpack_require__(13); + // instead of the ES6 spec version, we didn't implement @@toPrimitive case + // and the second argument - flag - preferred type is a string + module.exports = function (it, S) { + if (!isObject(it)) return it; + var fn, val; + if (S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val; + if (typeof (fn = it.valueOf) == 'function' && !isObject(val = fn.call(it))) return val; + if (!S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val; + throw TypeError("Can't convert object to primitive value"); + }; + + +/***/ }), +/* 17 */ +/***/ (function(module, exports) { + + module.exports = function (bitmap, value) { + return { + enumerable: !(bitmap & 1), + configurable: !(bitmap & 2), + writable: !(bitmap & 4), + value: value + }; + }; + + +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + + var global = __webpack_require__(4); + var hide = __webpack_require__(10); + var has = __webpack_require__(5); + var SRC = __webpack_require__(19)('src'); + var $toString = __webpack_require__(20); + var TO_STRING = 'toString'; + var TPL = ('' + $toString).split(TO_STRING); + + __webpack_require__(9).inspectSource = function (it) { + return $toString.call(it); + }; + + (module.exports = function (O, key, val, safe) { + var isFunction = typeof val == 'function'; + if (isFunction) has(val, 'name') || hide(val, 'name', key); + if (O[key] === val) return; + if (isFunction) has(val, SRC) || hide(val, SRC, O[key] ? '' + O[key] : TPL.join(String(key))); + if (O === global) { + O[key] = val; + } else if (!safe) { + delete O[key]; + hide(O, key, val); + } else if (O[key]) { + O[key] = val; + } else { + hide(O, key, val); + } + // add fake Function#toString for correct work wrapped methods / constructors with methods like LoDash isNative + })(Function.prototype, TO_STRING, function toString() { + return typeof this == 'function' && this[SRC] || $toString.call(this); + }); + + +/***/ }), +/* 19 */ +/***/ (function(module, exports) { + + var id = 0; + var px = Math.random(); + module.exports = function (key) { + return 'Symbol('.concat(key === undefined ? '' : key, ')_', (++id + px).toString(36)); + }; + + +/***/ }), +/* 20 */ +/***/ (function(module, exports, __webpack_require__) { + + module.exports = __webpack_require__(21)('native-function-to-string', Function.toString); + + +/***/ }), +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { + + var core = __webpack_require__(9); + var global = __webpack_require__(4); + var SHARED = '__core-js_shared__'; + var store = global[SHARED] || (global[SHARED] = {}); + + (module.exports = function (key, value) { + return store[key] || (store[key] = value !== undefined ? value : {}); + })('versions', []).push({ + version: core.version, + mode: __webpack_require__(22) ? 'pure' : 'global', + copyright: '© 2019 Denis Pushkarev (zloirock.ru)' + }); + + +/***/ }), +/* 22 */ +/***/ (function(module, exports) { + + module.exports = false; + + +/***/ }), +/* 23 */ +/***/ (function(module, exports, __webpack_require__) { + + // optional / simple context binding + var aFunction = __webpack_require__(24); + module.exports = function (fn, that, length) { + aFunction(fn); + if (that === undefined) return fn; + switch (length) { + case 1: return function (a) { + return fn.call(that, a); + }; + case 2: return function (a, b) { + return fn.call(that, a, b); + }; + case 3: return function (a, b, c) { + return fn.call(that, a, b, c); + }; + } + return function (/* ...args */) { + return fn.apply(that, arguments); + }; + }; + + +/***/ }), +/* 24 */ +/***/ (function(module, exports) { + + module.exports = function (it) { + if (typeof it != 'function') throw TypeError(it + ' is not a function!'); + return it; + }; + + +/***/ }), +/* 25 */ +/***/ (function(module, exports, __webpack_require__) { + + var META = __webpack_require__(19)('meta'); + var isObject = __webpack_require__(13); + var has = __webpack_require__(5); + var setDesc = __webpack_require__(11).f; + var id = 0; + var isExtensible = Object.isExtensible || function () { + return true; + }; + var FREEZE = !__webpack_require__(7)(function () { + return isExtensible(Object.preventExtensions({})); + }); + var setMeta = function (it) { + setDesc(it, META, { value: { + i: 'O' + ++id, // object ID + w: {} // weak collections IDs + } }); + }; + var fastKey = function (it, create) { + // return primitive with prefix + if (!isObject(it)) return typeof it == 'symbol' ? it : (typeof it == 'string' ? 'S' : 'P') + it; + if (!has(it, META)) { + // can't set metadata to uncaught frozen object + if (!isExtensible(it)) return 'F'; + // not necessary to add metadata + if (!create) return 'E'; + // add missing metadata + setMeta(it); + // return object ID + } return it[META].i; + }; + var getWeak = function (it, create) { + if (!has(it, META)) { + // can't set metadata to uncaught frozen object + if (!isExtensible(it)) return true; + // not necessary to add metadata + if (!create) return false; + // add missing metadata + setMeta(it); + // return hash weak collections IDs + } return it[META].w; + }; + // add metadata on freeze-family methods calling + var onFreeze = function (it) { + if (FREEZE && meta.NEED && isExtensible(it) && !has(it, META)) setMeta(it); + return it; + }; + var meta = module.exports = { + KEY: META, + NEED: false, + fastKey: fastKey, + getWeak: getWeak, + onFreeze: onFreeze + }; + + +/***/ }), +/* 26 */ +/***/ (function(module, exports, __webpack_require__) { + + var def = __webpack_require__(11).f; + var has = __webpack_require__(5); + var TAG = __webpack_require__(27)('toStringTag'); + + module.exports = function (it, tag, stat) { + if (it && !has(it = stat ? it : it.prototype, TAG)) def(it, TAG, { configurable: true, value: tag }); + }; + + +/***/ }), +/* 27 */ +/***/ (function(module, exports, __webpack_require__) { + + var store = __webpack_require__(21)('wks'); + var uid = __webpack_require__(19); + var Symbol = __webpack_require__(4).Symbol; + var USE_SYMBOL = typeof Symbol == 'function'; + + var $exports = module.exports = function (name) { + return store[name] || (store[name] = + USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name)); + }; + + $exports.store = store; + + +/***/ }), +/* 28 */ +/***/ (function(module, exports, __webpack_require__) { + + exports.f = __webpack_require__(27); + + +/***/ }), +/* 29 */ +/***/ (function(module, exports, __webpack_require__) { + + var global = __webpack_require__(4); + var core = __webpack_require__(9); + var LIBRARY = __webpack_require__(22); + var wksExt = __webpack_require__(28); + var defineProperty = __webpack_require__(11).f; + module.exports = function (name) { + var $Symbol = core.Symbol || (core.Symbol = LIBRARY ? {} : global.Symbol || {}); + if (name.charAt(0) != '_' && !(name in $Symbol)) defineProperty($Symbol, name, { value: wksExt.f(name) }); + }; + + +/***/ }), +/* 30 */ +/***/ (function(module, exports, __webpack_require__) { + + // all enumerable object keys, includes symbols + var getKeys = __webpack_require__(31); + var gOPS = __webpack_require__(43); + var pIE = __webpack_require__(44); + module.exports = function (it) { + var result = getKeys(it); + var getSymbols = gOPS.f; + if (getSymbols) { + var symbols = getSymbols(it); + var isEnum = pIE.f; + var i = 0; + var key; + while (symbols.length > i) if (isEnum.call(it, key = symbols[i++])) result.push(key); + } return result; + }; + + +/***/ }), +/* 31 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.14 / 15.2.3.14 Object.keys(O) + var $keys = __webpack_require__(32); + var enumBugKeys = __webpack_require__(42); + + module.exports = Object.keys || function keys(O) { + return $keys(O, enumBugKeys); + }; + + +/***/ }), +/* 32 */ +/***/ (function(module, exports, __webpack_require__) { + + var has = __webpack_require__(5); + var toIObject = __webpack_require__(33); + var arrayIndexOf = __webpack_require__(37)(false); + var IE_PROTO = __webpack_require__(41)('IE_PROTO'); + + module.exports = function (object, names) { + var O = toIObject(object); + var i = 0; + var result = []; + var key; + for (key in O) if (key != IE_PROTO) has(O, key) && result.push(key); + // Don't enum bug & hidden keys + while (names.length > i) if (has(O, key = names[i++])) { + ~arrayIndexOf(result, key) || result.push(key); + } + return result; + }; + + +/***/ }), +/* 33 */ +/***/ (function(module, exports, __webpack_require__) { + + // to indexed object, toObject with fallback for non-array-like ES3 strings + var IObject = __webpack_require__(34); + var defined = __webpack_require__(36); + module.exports = function (it) { + return IObject(defined(it)); + }; + + +/***/ }), +/* 34 */ +/***/ (function(module, exports, __webpack_require__) { + + // fallback for non-array-like ES3 and non-enumerable old V8 strings + var cof = __webpack_require__(35); + // eslint-disable-next-line no-prototype-builtins + module.exports = Object('z').propertyIsEnumerable(0) ? Object : function (it) { + return cof(it) == 'String' ? it.split('') : Object(it); + }; + + +/***/ }), +/* 35 */ +/***/ (function(module, exports) { + + var toString = {}.toString; + + module.exports = function (it) { + return toString.call(it).slice(8, -1); + }; + + +/***/ }), +/* 36 */ +/***/ (function(module, exports) { + + // 7.2.1 RequireObjectCoercible(argument) + module.exports = function (it) { + if (it == undefined) throw TypeError("Can't call method on " + it); + return it; + }; + + +/***/ }), +/* 37 */ +/***/ (function(module, exports, __webpack_require__) { + + // false -> Array#indexOf + // true -> Array#includes + var toIObject = __webpack_require__(33); + var toLength = __webpack_require__(38); + var toAbsoluteIndex = __webpack_require__(40); + module.exports = function (IS_INCLUDES) { + return function ($this, el, fromIndex) { + var O = toIObject($this); + var length = toLength(O.length); + var index = toAbsoluteIndex(fromIndex, length); + var value; + // Array#includes uses SameValueZero equality algorithm + // eslint-disable-next-line no-self-compare + if (IS_INCLUDES && el != el) while (length > index) { + value = O[index++]; + // eslint-disable-next-line no-self-compare + if (value != value) return true; + // Array#indexOf ignores holes, Array#includes - not + } else for (;length > index; index++) if (IS_INCLUDES || index in O) { + if (O[index] === el) return IS_INCLUDES || index || 0; + } return !IS_INCLUDES && -1; + }; + }; + + +/***/ }), +/* 38 */ +/***/ (function(module, exports, __webpack_require__) { + + // 7.1.15 ToLength + var toInteger = __webpack_require__(39); + var min = Math.min; + module.exports = function (it) { + return it > 0 ? min(toInteger(it), 0x1fffffffffffff) : 0; // pow(2, 53) - 1 == 9007199254740991 + }; + + +/***/ }), +/* 39 */ +/***/ (function(module, exports) { + + // 7.1.4 ToInteger + var ceil = Math.ceil; + var floor = Math.floor; + module.exports = function (it) { + return isNaN(it = +it) ? 0 : (it > 0 ? floor : ceil)(it); + }; + + +/***/ }), +/* 40 */ +/***/ (function(module, exports, __webpack_require__) { + + var toInteger = __webpack_require__(39); + var max = Math.max; + var min = Math.min; + module.exports = function (index, length) { + index = toInteger(index); + return index < 0 ? max(index + length, 0) : min(index, length); + }; + + +/***/ }), +/* 41 */ +/***/ (function(module, exports, __webpack_require__) { + + var shared = __webpack_require__(21)('keys'); + var uid = __webpack_require__(19); + module.exports = function (key) { + return shared[key] || (shared[key] = uid(key)); + }; + + +/***/ }), +/* 42 */ +/***/ (function(module, exports) { + + // IE 8- don't enum bug keys + module.exports = ( + 'constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf' + ).split(','); + + +/***/ }), +/* 43 */ +/***/ (function(module, exports) { + + exports.f = Object.getOwnPropertySymbols; + + +/***/ }), +/* 44 */ +/***/ (function(module, exports) { + + exports.f = {}.propertyIsEnumerable; + + +/***/ }), +/* 45 */ +/***/ (function(module, exports, __webpack_require__) { + + // 7.2.2 IsArray(argument) + var cof = __webpack_require__(35); + module.exports = Array.isArray || function isArray(arg) { + return cof(arg) == 'Array'; + }; + + +/***/ }), +/* 46 */ +/***/ (function(module, exports, __webpack_require__) { + + // 7.1.13 ToObject(argument) + var defined = __webpack_require__(36); + module.exports = function (it) { + return Object(defined(it)); + }; + + +/***/ }), +/* 47 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties]) + var anObject = __webpack_require__(12); + var dPs = __webpack_require__(48); + var enumBugKeys = __webpack_require__(42); + var IE_PROTO = __webpack_require__(41)('IE_PROTO'); + var Empty = function () { /* empty */ }; + var PROTOTYPE = 'prototype'; + + // Create object with fake `null` prototype: use iframe Object with cleared prototype + var createDict = function () { + // Thrash, waste and sodomy: IE GC bug + var iframe = __webpack_require__(15)('iframe'); + var i = enumBugKeys.length; + var lt = '<'; + var gt = '>'; + var iframeDocument; + iframe.style.display = 'none'; + __webpack_require__(49).appendChild(iframe); + iframe.src = 'javascript:'; // eslint-disable-line no-script-url + // createDict = iframe.contentWindow.Object; + // html.removeChild(iframe); + iframeDocument = iframe.contentWindow.document; + iframeDocument.open(); + iframeDocument.write(lt + 'script' + gt + 'document.F=Object' + lt + '/script' + gt); + iframeDocument.close(); + createDict = iframeDocument.F; + while (i--) delete createDict[PROTOTYPE][enumBugKeys[i]]; + return createDict(); + }; + + module.exports = Object.create || function create(O, Properties) { + var result; + if (O !== null) { + Empty[PROTOTYPE] = anObject(O); + result = new Empty(); + Empty[PROTOTYPE] = null; + // add "__proto__" for Object.getPrototypeOf polyfill + result[IE_PROTO] = O; + } else result = createDict(); + return Properties === undefined ? result : dPs(result, Properties); + }; + + +/***/ }), +/* 48 */ +/***/ (function(module, exports, __webpack_require__) { + + var dP = __webpack_require__(11); + var anObject = __webpack_require__(12); + var getKeys = __webpack_require__(31); + + module.exports = __webpack_require__(6) ? Object.defineProperties : function defineProperties(O, Properties) { + anObject(O); + var keys = getKeys(Properties); + var length = keys.length; + var i = 0; + var P; + while (length > i) dP.f(O, P = keys[i++], Properties[P]); + return O; + }; + + +/***/ }), +/* 49 */ +/***/ (function(module, exports, __webpack_require__) { + + var document = __webpack_require__(4).document; + module.exports = document && document.documentElement; + + +/***/ }), +/* 50 */ +/***/ (function(module, exports, __webpack_require__) { + + // fallback for IE11 buggy Object.getOwnPropertyNames with iframe and window + var toIObject = __webpack_require__(33); + var gOPN = __webpack_require__(51).f; + var toString = {}.toString; + + var windowNames = typeof window == 'object' && window && Object.getOwnPropertyNames + ? Object.getOwnPropertyNames(window) : []; + + var getWindowNames = function (it) { + try { + return gOPN(it); + } catch (e) { + return windowNames.slice(); + } + }; + + module.exports.f = function getOwnPropertyNames(it) { + return windowNames && toString.call(it) == '[object Window]' ? getWindowNames(it) : gOPN(toIObject(it)); + }; + + +/***/ }), +/* 51 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.7 / 15.2.3.4 Object.getOwnPropertyNames(O) + var $keys = __webpack_require__(32); + var hiddenKeys = __webpack_require__(42).concat('length', 'prototype'); + + exports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) { + return $keys(O, hiddenKeys); + }; + + +/***/ }), +/* 52 */ +/***/ (function(module, exports, __webpack_require__) { + + var pIE = __webpack_require__(44); + var createDesc = __webpack_require__(17); + var toIObject = __webpack_require__(33); + var toPrimitive = __webpack_require__(16); + var has = __webpack_require__(5); + var IE8_DOM_DEFINE = __webpack_require__(14); + var gOPD = Object.getOwnPropertyDescriptor; + + exports.f = __webpack_require__(6) ? gOPD : function getOwnPropertyDescriptor(O, P) { + O = toIObject(O); + P = toPrimitive(P, true); + if (IE8_DOM_DEFINE) try { + return gOPD(O, P); + } catch (e) { /* empty */ } + if (has(O, P)) return createDesc(!pIE.f.call(O, P), O[P]); + }; + + +/***/ }), +/* 53 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + // 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties]) + $export($export.S, 'Object', { create: __webpack_require__(47) }); + + +/***/ }), +/* 54 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + // 19.1.2.4 / 15.2.3.6 Object.defineProperty(O, P, Attributes) + $export($export.S + $export.F * !__webpack_require__(6), 'Object', { defineProperty: __webpack_require__(11).f }); + + +/***/ }), +/* 55 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + // 19.1.2.3 / 15.2.3.7 Object.defineProperties(O, Properties) + $export($export.S + $export.F * !__webpack_require__(6), 'Object', { defineProperties: __webpack_require__(48) }); + + +/***/ }), +/* 56 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.6 Object.getOwnPropertyDescriptor(O, P) + var toIObject = __webpack_require__(33); + var $getOwnPropertyDescriptor = __webpack_require__(52).f; + + __webpack_require__(57)('getOwnPropertyDescriptor', function () { + return function getOwnPropertyDescriptor(it, key) { + return $getOwnPropertyDescriptor(toIObject(it), key); + }; + }); + + +/***/ }), +/* 57 */ +/***/ (function(module, exports, __webpack_require__) { + + // most Object methods by ES6 should accept primitives + var $export = __webpack_require__(8); + var core = __webpack_require__(9); + var fails = __webpack_require__(7); + module.exports = function (KEY, exec) { + var fn = (core.Object || {})[KEY] || Object[KEY]; + var exp = {}; + exp[KEY] = exec(fn); + $export($export.S + $export.F * fails(function () { fn(1); }), 'Object', exp); + }; + + +/***/ }), +/* 58 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.9 Object.getPrototypeOf(O) + var toObject = __webpack_require__(46); + var $getPrototypeOf = __webpack_require__(59); + + __webpack_require__(57)('getPrototypeOf', function () { + return function getPrototypeOf(it) { + return $getPrototypeOf(toObject(it)); + }; + }); + + +/***/ }), +/* 59 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.9 / 15.2.3.2 Object.getPrototypeOf(O) + var has = __webpack_require__(5); + var toObject = __webpack_require__(46); + var IE_PROTO = __webpack_require__(41)('IE_PROTO'); + var ObjectProto = Object.prototype; + + module.exports = Object.getPrototypeOf || function (O) { + O = toObject(O); + if (has(O, IE_PROTO)) return O[IE_PROTO]; + if (typeof O.constructor == 'function' && O instanceof O.constructor) { + return O.constructor.prototype; + } return O instanceof Object ? ObjectProto : null; + }; + + +/***/ }), +/* 60 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.14 Object.keys(O) + var toObject = __webpack_require__(46); + var $keys = __webpack_require__(31); + + __webpack_require__(57)('keys', function () { + return function keys(it) { + return $keys(toObject(it)); + }; + }); + + +/***/ }), +/* 61 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.7 Object.getOwnPropertyNames(O) + __webpack_require__(57)('getOwnPropertyNames', function () { + return __webpack_require__(50).f; + }); + + +/***/ }), +/* 62 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.5 Object.freeze(O) + var isObject = __webpack_require__(13); + var meta = __webpack_require__(25).onFreeze; + + __webpack_require__(57)('freeze', function ($freeze) { + return function freeze(it) { + return $freeze && isObject(it) ? $freeze(meta(it)) : it; + }; + }); + + +/***/ }), +/* 63 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.17 Object.seal(O) + var isObject = __webpack_require__(13); + var meta = __webpack_require__(25).onFreeze; + + __webpack_require__(57)('seal', function ($seal) { + return function seal(it) { + return $seal && isObject(it) ? $seal(meta(it)) : it; + }; + }); + + +/***/ }), +/* 64 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.15 Object.preventExtensions(O) + var isObject = __webpack_require__(13); + var meta = __webpack_require__(25).onFreeze; + + __webpack_require__(57)('preventExtensions', function ($preventExtensions) { + return function preventExtensions(it) { + return $preventExtensions && isObject(it) ? $preventExtensions(meta(it)) : it; + }; + }); + + +/***/ }), +/* 65 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.12 Object.isFrozen(O) + var isObject = __webpack_require__(13); + + __webpack_require__(57)('isFrozen', function ($isFrozen) { + return function isFrozen(it) { + return isObject(it) ? $isFrozen ? $isFrozen(it) : false : true; + }; + }); + + +/***/ }), +/* 66 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.13 Object.isSealed(O) + var isObject = __webpack_require__(13); + + __webpack_require__(57)('isSealed', function ($isSealed) { + return function isSealed(it) { + return isObject(it) ? $isSealed ? $isSealed(it) : false : true; + }; + }); + + +/***/ }), +/* 67 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.2.11 Object.isExtensible(O) + var isObject = __webpack_require__(13); + + __webpack_require__(57)('isExtensible', function ($isExtensible) { + return function isExtensible(it) { + return isObject(it) ? $isExtensible ? $isExtensible(it) : true : false; + }; + }); + + +/***/ }), +/* 68 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.3.1 Object.assign(target, source) + var $export = __webpack_require__(8); + + $export($export.S + $export.F, 'Object', { assign: __webpack_require__(69) }); + + +/***/ }), +/* 69 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 19.1.2.1 Object.assign(target, source, ...) + var DESCRIPTORS = __webpack_require__(6); + var getKeys = __webpack_require__(31); + var gOPS = __webpack_require__(43); + var pIE = __webpack_require__(44); + var toObject = __webpack_require__(46); + var IObject = __webpack_require__(34); + var $assign = Object.assign; + + // should work with symbols and should have deterministic property order (V8 bug) + module.exports = !$assign || __webpack_require__(7)(function () { + var A = {}; + var B = {}; + // eslint-disable-next-line no-undef + var S = Symbol(); + var K = 'abcdefghijklmnopqrst'; + A[S] = 7; + K.split('').forEach(function (k) { B[k] = k; }); + return $assign({}, A)[S] != 7 || Object.keys($assign({}, B)).join('') != K; + }) ? function assign(target, source) { // eslint-disable-line no-unused-vars + var T = toObject(target); + var aLen = arguments.length; + var index = 1; + var getSymbols = gOPS.f; + var isEnum = pIE.f; + while (aLen > index) { + var S = IObject(arguments[index++]); + var keys = getSymbols ? getKeys(S).concat(getSymbols(S)) : getKeys(S); + var length = keys.length; + var j = 0; + var key; + while (length > j) { + key = keys[j++]; + if (!DESCRIPTORS || isEnum.call(S, key)) T[key] = S[key]; + } + } return T; + } : $assign; + + +/***/ }), +/* 70 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.3.10 Object.is(value1, value2) + var $export = __webpack_require__(8); + $export($export.S, 'Object', { is: __webpack_require__(71) }); + + +/***/ }), +/* 71 */ +/***/ (function(module, exports) { + + // 7.2.9 SameValue(x, y) + module.exports = Object.is || function is(x, y) { + // eslint-disable-next-line no-self-compare + return x === y ? x !== 0 || 1 / x === 1 / y : x != x && y != y; + }; + + +/***/ }), +/* 72 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.1.3.19 Object.setPrototypeOf(O, proto) + var $export = __webpack_require__(8); + $export($export.S, 'Object', { setPrototypeOf: __webpack_require__(73).set }); + + +/***/ }), +/* 73 */ +/***/ (function(module, exports, __webpack_require__) { + + // Works with __proto__ only. Old v8 can't work with null proto objects. + /* eslint-disable no-proto */ + var isObject = __webpack_require__(13); + var anObject = __webpack_require__(12); + var check = function (O, proto) { + anObject(O); + if (!isObject(proto) && proto !== null) throw TypeError(proto + ": can't set as prototype!"); + }; + module.exports = { + set: Object.setPrototypeOf || ('__proto__' in {} ? // eslint-disable-line + function (test, buggy, set) { + try { + set = __webpack_require__(23)(Function.call, __webpack_require__(52).f(Object.prototype, '__proto__').set, 2); + set(test, []); + buggy = !(test instanceof Array); + } catch (e) { buggy = true; } + return function setPrototypeOf(O, proto) { + check(O, proto); + if (buggy) O.__proto__ = proto; + else set(O, proto); + return O; + }; + }({}, false) : undefined), + check: check + }; + + +/***/ }), +/* 74 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 19.1.3.6 Object.prototype.toString() + var classof = __webpack_require__(75); + var test = {}; + test[__webpack_require__(27)('toStringTag')] = 'z'; + if (test + '' != '[object z]') { + __webpack_require__(18)(Object.prototype, 'toString', function toString() { + return '[object ' + classof(this) + ']'; + }, true); + } + + +/***/ }), +/* 75 */ +/***/ (function(module, exports, __webpack_require__) { + + // getting tag from 19.1.3.6 Object.prototype.toString() + var cof = __webpack_require__(35); + var TAG = __webpack_require__(27)('toStringTag'); + // ES3 wrong here + var ARG = cof(function () { return arguments; }()) == 'Arguments'; + + // fallback for IE11 Script Access Denied error + var tryGet = function (it, key) { + try { + return it[key]; + } catch (e) { /* empty */ } + }; + + module.exports = function (it) { + var O, T, B; + return it === undefined ? 'Undefined' : it === null ? 'Null' + // @@toStringTag case + : typeof (T = tryGet(O = Object(it), TAG)) == 'string' ? T + // builtinTag case + : ARG ? cof(O) + // ES3 arguments fallback + : (B = cof(O)) == 'Object' && typeof O.callee == 'function' ? 'Arguments' : B; + }; + + +/***/ }), +/* 76 */ +/***/ (function(module, exports, __webpack_require__) { + + // 19.2.3.2 / 15.3.4.5 Function.prototype.bind(thisArg, args...) + var $export = __webpack_require__(8); + + $export($export.P, 'Function', { bind: __webpack_require__(77) }); + + +/***/ }), +/* 77 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var aFunction = __webpack_require__(24); + var isObject = __webpack_require__(13); + var invoke = __webpack_require__(78); + var arraySlice = [].slice; + var factories = {}; + + var construct = function (F, len, args) { + if (!(len in factories)) { + for (var n = [], i = 0; i < len; i++) n[i] = 'a[' + i + ']'; + // eslint-disable-next-line no-new-func + factories[len] = Function('F,a', 'return new F(' + n.join(',') + ')'); + } return factories[len](F, args); + }; + + module.exports = Function.bind || function bind(that /* , ...args */) { + var fn = aFunction(this); + var partArgs = arraySlice.call(arguments, 1); + var bound = function (/* args... */) { + var args = partArgs.concat(arraySlice.call(arguments)); + return this instanceof bound ? construct(fn, args.length, args) : invoke(fn, args, that); + }; + if (isObject(fn.prototype)) bound.prototype = fn.prototype; + return bound; + }; + + +/***/ }), +/* 78 */ +/***/ (function(module, exports) { + + // fast apply, http://jsperf.lnkit.com/fast-apply/5 + module.exports = function (fn, args, that) { + var un = that === undefined; + switch (args.length) { + case 0: return un ? fn() + : fn.call(that); + case 1: return un ? fn(args[0]) + : fn.call(that, args[0]); + case 2: return un ? fn(args[0], args[1]) + : fn.call(that, args[0], args[1]); + case 3: return un ? fn(args[0], args[1], args[2]) + : fn.call(that, args[0], args[1], args[2]); + case 4: return un ? fn(args[0], args[1], args[2], args[3]) + : fn.call(that, args[0], args[1], args[2], args[3]); + } return fn.apply(that, args); + }; + + +/***/ }), +/* 79 */ +/***/ (function(module, exports, __webpack_require__) { + + var dP = __webpack_require__(11).f; + var FProto = Function.prototype; + var nameRE = /^\s*function ([^ (]*)/; + var NAME = 'name'; + + // 19.2.4.2 name + NAME in FProto || __webpack_require__(6) && dP(FProto, NAME, { + configurable: true, + get: function () { + try { + return ('' + this).match(nameRE)[1]; + } catch (e) { + return ''; + } + } + }); + + +/***/ }), +/* 80 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var isObject = __webpack_require__(13); + var getPrototypeOf = __webpack_require__(59); + var HAS_INSTANCE = __webpack_require__(27)('hasInstance'); + var FunctionProto = Function.prototype; + // 19.2.3.6 Function.prototype[@@hasInstance](V) + if (!(HAS_INSTANCE in FunctionProto)) __webpack_require__(11).f(FunctionProto, HAS_INSTANCE, { value: function (O) { + if (typeof this != 'function' || !isObject(O)) return false; + if (!isObject(this.prototype)) return O instanceof this; + // for environment w/o native `@@hasInstance` logic enough `instanceof`, but add this: + while (O = getPrototypeOf(O)) if (this.prototype === O) return true; + return false; + } }); + + +/***/ }), +/* 81 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var $parseInt = __webpack_require__(82); + // 18.2.5 parseInt(string, radix) + $export($export.G + $export.F * (parseInt != $parseInt), { parseInt: $parseInt }); + + +/***/ }), +/* 82 */ +/***/ (function(module, exports, __webpack_require__) { + + var $parseInt = __webpack_require__(4).parseInt; + var $trim = __webpack_require__(83).trim; + var ws = __webpack_require__(84); + var hex = /^[-+]?0[xX]/; + + module.exports = $parseInt(ws + '08') !== 8 || $parseInt(ws + '0x16') !== 22 ? function parseInt(str, radix) { + var string = $trim(String(str), 3); + return $parseInt(string, (radix >>> 0) || (hex.test(string) ? 16 : 10)); + } : $parseInt; + + +/***/ }), +/* 83 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var defined = __webpack_require__(36); + var fails = __webpack_require__(7); + var spaces = __webpack_require__(84); + var space = '[' + spaces + ']'; + var non = '\u200b\u0085'; + var ltrim = RegExp('^' + space + space + '*'); + var rtrim = RegExp(space + space + '*$'); + + var exporter = function (KEY, exec, ALIAS) { + var exp = {}; + var FORCE = fails(function () { + return !!spaces[KEY]() || non[KEY]() != non; + }); + var fn = exp[KEY] = FORCE ? exec(trim) : spaces[KEY]; + if (ALIAS) exp[ALIAS] = fn; + $export($export.P + $export.F * FORCE, 'String', exp); + }; + + // 1 -> String#trimLeft + // 2 -> String#trimRight + // 3 -> String#trim + var trim = exporter.trim = function (string, TYPE) { + string = String(defined(string)); + if (TYPE & 1) string = string.replace(ltrim, ''); + if (TYPE & 2) string = string.replace(rtrim, ''); + return string; + }; + + module.exports = exporter; + + +/***/ }), +/* 84 */ +/***/ (function(module, exports) { + + module.exports = '\x09\x0A\x0B\x0C\x0D\x20\xA0\u1680\u180E\u2000\u2001\u2002\u2003' + + '\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFF'; + + +/***/ }), +/* 85 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var $parseFloat = __webpack_require__(86); + // 18.2.4 parseFloat(string) + $export($export.G + $export.F * (parseFloat != $parseFloat), { parseFloat: $parseFloat }); + + +/***/ }), +/* 86 */ +/***/ (function(module, exports, __webpack_require__) { + + var $parseFloat = __webpack_require__(4).parseFloat; + var $trim = __webpack_require__(83).trim; + + module.exports = 1 / $parseFloat(__webpack_require__(84) + '-0') !== -Infinity ? function parseFloat(str) { + var string = $trim(String(str), 3); + var result = $parseFloat(string); + return result === 0 && string.charAt(0) == '-' ? -0 : result; + } : $parseFloat; + + +/***/ }), +/* 87 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var global = __webpack_require__(4); + var has = __webpack_require__(5); + var cof = __webpack_require__(35); + var inheritIfRequired = __webpack_require__(88); + var toPrimitive = __webpack_require__(16); + var fails = __webpack_require__(7); + var gOPN = __webpack_require__(51).f; + var gOPD = __webpack_require__(52).f; + var dP = __webpack_require__(11).f; + var $trim = __webpack_require__(83).trim; + var NUMBER = 'Number'; + var $Number = global[NUMBER]; + var Base = $Number; + var proto = $Number.prototype; + // Opera ~12 has broken Object#toString + var BROKEN_COF = cof(__webpack_require__(47)(proto)) == NUMBER; + var TRIM = 'trim' in String.prototype; + + // 7.1.3 ToNumber(argument) + var toNumber = function (argument) { + var it = toPrimitive(argument, false); + if (typeof it == 'string' && it.length > 2) { + it = TRIM ? it.trim() : $trim(it, 3); + var first = it.charCodeAt(0); + var third, radix, maxCode; + if (first === 43 || first === 45) { + third = it.charCodeAt(2); + if (third === 88 || third === 120) return NaN; // Number('+0x1') should be NaN, old V8 fix + } else if (first === 48) { + switch (it.charCodeAt(1)) { + case 66: case 98: radix = 2; maxCode = 49; break; // fast equal /^0b[01]+$/i + case 79: case 111: radix = 8; maxCode = 55; break; // fast equal /^0o[0-7]+$/i + default: return +it; + } + for (var digits = it.slice(2), i = 0, l = digits.length, code; i < l; i++) { + code = digits.charCodeAt(i); + // parseInt parses a string to a first unavailable symbol + // but ToNumber should return NaN if a string contains unavailable symbols + if (code < 48 || code > maxCode) return NaN; + } return parseInt(digits, radix); + } + } return +it; + }; + + if (!$Number(' 0o1') || !$Number('0b1') || $Number('+0x1')) { + $Number = function Number(value) { + var it = arguments.length < 1 ? 0 : value; + var that = this; + return that instanceof $Number + // check on 1..constructor(foo) case + && (BROKEN_COF ? fails(function () { proto.valueOf.call(that); }) : cof(that) != NUMBER) + ? inheritIfRequired(new Base(toNumber(it)), that, $Number) : toNumber(it); + }; + for (var keys = __webpack_require__(6) ? gOPN(Base) : ( + // ES3: + 'MAX_VALUE,MIN_VALUE,NaN,NEGATIVE_INFINITY,POSITIVE_INFINITY,' + + // ES6 (in case, if modules with ES6 Number statics required before): + 'EPSILON,isFinite,isInteger,isNaN,isSafeInteger,MAX_SAFE_INTEGER,' + + 'MIN_SAFE_INTEGER,parseFloat,parseInt,isInteger' + ).split(','), j = 0, key; keys.length > j; j++) { + if (has(Base, key = keys[j]) && !has($Number, key)) { + dP($Number, key, gOPD(Base, key)); + } + } + $Number.prototype = proto; + proto.constructor = $Number; + __webpack_require__(18)(global, NUMBER, $Number); + } + + +/***/ }), +/* 88 */ +/***/ (function(module, exports, __webpack_require__) { + + var isObject = __webpack_require__(13); + var setPrototypeOf = __webpack_require__(73).set; + module.exports = function (that, target, C) { + var S = target.constructor; + var P; + if (S !== C && typeof S == 'function' && (P = S.prototype) !== C.prototype && isObject(P) && setPrototypeOf) { + setPrototypeOf(that, P); + } return that; + }; + + +/***/ }), +/* 89 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var toInteger = __webpack_require__(39); + var aNumberValue = __webpack_require__(90); + var repeat = __webpack_require__(91); + var $toFixed = 1.0.toFixed; + var floor = Math.floor; + var data = [0, 0, 0, 0, 0, 0]; + var ERROR = 'Number.toFixed: incorrect invocation!'; + var ZERO = '0'; + + var multiply = function (n, c) { + var i = -1; + var c2 = c; + while (++i < 6) { + c2 += n * data[i]; + data[i] = c2 % 1e7; + c2 = floor(c2 / 1e7); + } + }; + var divide = function (n) { + var i = 6; + var c = 0; + while (--i >= 0) { + c += data[i]; + data[i] = floor(c / n); + c = (c % n) * 1e7; + } + }; + var numToString = function () { + var i = 6; + var s = ''; + while (--i >= 0) { + if (s !== '' || i === 0 || data[i] !== 0) { + var t = String(data[i]); + s = s === '' ? t : s + repeat.call(ZERO, 7 - t.length) + t; + } + } return s; + }; + var pow = function (x, n, acc) { + return n === 0 ? acc : n % 2 === 1 ? pow(x, n - 1, acc * x) : pow(x * x, n / 2, acc); + }; + var log = function (x) { + var n = 0; + var x2 = x; + while (x2 >= 4096) { + n += 12; + x2 /= 4096; + } + while (x2 >= 2) { + n += 1; + x2 /= 2; + } return n; + }; + + $export($export.P + $export.F * (!!$toFixed && ( + 0.00008.toFixed(3) !== '0.000' || + 0.9.toFixed(0) !== '1' || + 1.255.toFixed(2) !== '1.25' || + 1000000000000000128.0.toFixed(0) !== '1000000000000000128' + ) || !__webpack_require__(7)(function () { + // V8 ~ Android 4.3- + $toFixed.call({}); + })), 'Number', { + toFixed: function toFixed(fractionDigits) { + var x = aNumberValue(this, ERROR); + var f = toInteger(fractionDigits); + var s = ''; + var m = ZERO; + var e, z, j, k; + if (f < 0 || f > 20) throw RangeError(ERROR); + // eslint-disable-next-line no-self-compare + if (x != x) return 'NaN'; + if (x <= -1e21 || x >= 1e21) return String(x); + if (x < 0) { + s = '-'; + x = -x; + } + if (x > 1e-21) { + e = log(x * pow(2, 69, 1)) - 69; + z = e < 0 ? x * pow(2, -e, 1) : x / pow(2, e, 1); + z *= 0x10000000000000; + e = 52 - e; + if (e > 0) { + multiply(0, z); + j = f; + while (j >= 7) { + multiply(1e7, 0); + j -= 7; + } + multiply(pow(10, j, 1), 0); + j = e - 1; + while (j >= 23) { + divide(1 << 23); + j -= 23; + } + divide(1 << j); + multiply(1, 1); + divide(2); + m = numToString(); + } else { + multiply(0, z); + multiply(1 << -e, 0); + m = numToString() + repeat.call(ZERO, f); + } + } + if (f > 0) { + k = m.length; + m = s + (k <= f ? '0.' + repeat.call(ZERO, f - k) + m : m.slice(0, k - f) + '.' + m.slice(k - f)); + } else { + m = s + m; + } return m; + } + }); + + +/***/ }), +/* 90 */ +/***/ (function(module, exports, __webpack_require__) { + + var cof = __webpack_require__(35); + module.exports = function (it, msg) { + if (typeof it != 'number' && cof(it) != 'Number') throw TypeError(msg); + return +it; + }; + + +/***/ }), +/* 91 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var toInteger = __webpack_require__(39); + var defined = __webpack_require__(36); + + module.exports = function repeat(count) { + var str = String(defined(this)); + var res = ''; + var n = toInteger(count); + if (n < 0 || n == Infinity) throw RangeError("Count can't be negative"); + for (;n > 0; (n >>>= 1) && (str += str)) if (n & 1) res += str; + return res; + }; + + +/***/ }), +/* 92 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $fails = __webpack_require__(7); + var aNumberValue = __webpack_require__(90); + var $toPrecision = 1.0.toPrecision; + + $export($export.P + $export.F * ($fails(function () { + // IE7- + return $toPrecision.call(1, undefined) !== '1'; + }) || !$fails(function () { + // V8 ~ Android 4.3- + $toPrecision.call({}); + })), 'Number', { + toPrecision: function toPrecision(precision) { + var that = aNumberValue(this, 'Number#toPrecision: incorrect invocation!'); + return precision === undefined ? $toPrecision.call(that) : $toPrecision.call(that, precision); + } + }); + + +/***/ }), +/* 93 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.1 Number.EPSILON + var $export = __webpack_require__(8); + + $export($export.S, 'Number', { EPSILON: Math.pow(2, -52) }); + + +/***/ }), +/* 94 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.2 Number.isFinite(number) + var $export = __webpack_require__(8); + var _isFinite = __webpack_require__(4).isFinite; + + $export($export.S, 'Number', { + isFinite: function isFinite(it) { + return typeof it == 'number' && _isFinite(it); + } + }); + + +/***/ }), +/* 95 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.3 Number.isInteger(number) + var $export = __webpack_require__(8); + + $export($export.S, 'Number', { isInteger: __webpack_require__(96) }); + + +/***/ }), +/* 96 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.3 Number.isInteger(number) + var isObject = __webpack_require__(13); + var floor = Math.floor; + module.exports = function isInteger(it) { + return !isObject(it) && isFinite(it) && floor(it) === it; + }; + + +/***/ }), +/* 97 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.4 Number.isNaN(number) + var $export = __webpack_require__(8); + + $export($export.S, 'Number', { + isNaN: function isNaN(number) { + // eslint-disable-next-line no-self-compare + return number != number; + } + }); + + +/***/ }), +/* 98 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.5 Number.isSafeInteger(number) + var $export = __webpack_require__(8); + var isInteger = __webpack_require__(96); + var abs = Math.abs; + + $export($export.S, 'Number', { + isSafeInteger: function isSafeInteger(number) { + return isInteger(number) && abs(number) <= 0x1fffffffffffff; + } + }); + + +/***/ }), +/* 99 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.6 Number.MAX_SAFE_INTEGER + var $export = __webpack_require__(8); + + $export($export.S, 'Number', { MAX_SAFE_INTEGER: 0x1fffffffffffff }); + + +/***/ }), +/* 100 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.1.2.10 Number.MIN_SAFE_INTEGER + var $export = __webpack_require__(8); + + $export($export.S, 'Number', { MIN_SAFE_INTEGER: -0x1fffffffffffff }); + + +/***/ }), +/* 101 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var $parseFloat = __webpack_require__(86); + // 20.1.2.12 Number.parseFloat(string) + $export($export.S + $export.F * (Number.parseFloat != $parseFloat), 'Number', { parseFloat: $parseFloat }); + + +/***/ }), +/* 102 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var $parseInt = __webpack_require__(82); + // 20.1.2.13 Number.parseInt(string, radix) + $export($export.S + $export.F * (Number.parseInt != $parseInt), 'Number', { parseInt: $parseInt }); + + +/***/ }), +/* 103 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.3 Math.acosh(x) + var $export = __webpack_require__(8); + var log1p = __webpack_require__(104); + var sqrt = Math.sqrt; + var $acosh = Math.acosh; + + $export($export.S + $export.F * !($acosh + // V8 bug: https://code.google.com/p/v8/issues/detail?id=3509 + && Math.floor($acosh(Number.MAX_VALUE)) == 710 + // Tor Browser bug: Math.acosh(Infinity) -> NaN + && $acosh(Infinity) == Infinity + ), 'Math', { + acosh: function acosh(x) { + return (x = +x) < 1 ? NaN : x > 94906265.62425156 + ? Math.log(x) + Math.LN2 + : log1p(x - 1 + sqrt(x - 1) * sqrt(x + 1)); + } + }); + + +/***/ }), +/* 104 */ +/***/ (function(module, exports) { + + // 20.2.2.20 Math.log1p(x) + module.exports = Math.log1p || function log1p(x) { + return (x = +x) > -1e-8 && x < 1e-8 ? x - x * x / 2 : Math.log(1 + x); + }; + + +/***/ }), +/* 105 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.5 Math.asinh(x) + var $export = __webpack_require__(8); + var $asinh = Math.asinh; + + function asinh(x) { + return !isFinite(x = +x) || x == 0 ? x : x < 0 ? -asinh(-x) : Math.log(x + Math.sqrt(x * x + 1)); + } + + // Tor Browser bug: Math.asinh(0) -> -0 + $export($export.S + $export.F * !($asinh && 1 / $asinh(0) > 0), 'Math', { asinh: asinh }); + + +/***/ }), +/* 106 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.7 Math.atanh(x) + var $export = __webpack_require__(8); + var $atanh = Math.atanh; + + // Tor Browser bug: Math.atanh(-0) -> 0 + $export($export.S + $export.F * !($atanh && 1 / $atanh(-0) < 0), 'Math', { + atanh: function atanh(x) { + return (x = +x) == 0 ? x : Math.log((1 + x) / (1 - x)) / 2; + } + }); + + +/***/ }), +/* 107 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.9 Math.cbrt(x) + var $export = __webpack_require__(8); + var sign = __webpack_require__(108); + + $export($export.S, 'Math', { + cbrt: function cbrt(x) { + return sign(x = +x) * Math.pow(Math.abs(x), 1 / 3); + } + }); + + +/***/ }), +/* 108 */ +/***/ (function(module, exports) { + + // 20.2.2.28 Math.sign(x) + module.exports = Math.sign || function sign(x) { + // eslint-disable-next-line no-self-compare + return (x = +x) == 0 || x != x ? x : x < 0 ? -1 : 1; + }; + + +/***/ }), +/* 109 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.11 Math.clz32(x) + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + clz32: function clz32(x) { + return (x >>>= 0) ? 31 - Math.floor(Math.log(x + 0.5) * Math.LOG2E) : 32; + } + }); + + +/***/ }), +/* 110 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.12 Math.cosh(x) + var $export = __webpack_require__(8); + var exp = Math.exp; + + $export($export.S, 'Math', { + cosh: function cosh(x) { + return (exp(x = +x) + exp(-x)) / 2; + } + }); + + +/***/ }), +/* 111 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.14 Math.expm1(x) + var $export = __webpack_require__(8); + var $expm1 = __webpack_require__(112); + + $export($export.S + $export.F * ($expm1 != Math.expm1), 'Math', { expm1: $expm1 }); + + +/***/ }), +/* 112 */ +/***/ (function(module, exports) { + + // 20.2.2.14 Math.expm1(x) + var $expm1 = Math.expm1; + module.exports = (!$expm1 + // Old FF bug + || $expm1(10) > 22025.465794806719 || $expm1(10) < 22025.4657948067165168 + // Tor Browser bug + || $expm1(-2e-17) != -2e-17 + ) ? function expm1(x) { + return (x = +x) == 0 ? x : x > -1e-6 && x < 1e-6 ? x + x * x / 2 : Math.exp(x) - 1; + } : $expm1; + + +/***/ }), +/* 113 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.16 Math.fround(x) + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { fround: __webpack_require__(114) }); + + +/***/ }), +/* 114 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.16 Math.fround(x) + var sign = __webpack_require__(108); + var pow = Math.pow; + var EPSILON = pow(2, -52); + var EPSILON32 = pow(2, -23); + var MAX32 = pow(2, 127) * (2 - EPSILON32); + var MIN32 = pow(2, -126); + + var roundTiesToEven = function (n) { + return n + 1 / EPSILON - 1 / EPSILON; + }; + + module.exports = Math.fround || function fround(x) { + var $abs = Math.abs(x); + var $sign = sign(x); + var a, result; + if ($abs < MIN32) return $sign * roundTiesToEven($abs / MIN32 / EPSILON32) * MIN32 * EPSILON32; + a = (1 + EPSILON32 / EPSILON) * $abs; + result = a - (a - $abs); + // eslint-disable-next-line no-self-compare + if (result > MAX32 || result != result) return $sign * Infinity; + return $sign * result; + }; + + +/***/ }), +/* 115 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.17 Math.hypot([value1[, value2[, … ]]]) + var $export = __webpack_require__(8); + var abs = Math.abs; + + $export($export.S, 'Math', { + hypot: function hypot(value1, value2) { // eslint-disable-line no-unused-vars + var sum = 0; + var i = 0; + var aLen = arguments.length; + var larg = 0; + var arg, div; + while (i < aLen) { + arg = abs(arguments[i++]); + if (larg < arg) { + div = larg / arg; + sum = sum * div * div + 1; + larg = arg; + } else if (arg > 0) { + div = arg / larg; + sum += div * div; + } else sum += arg; + } + return larg === Infinity ? Infinity : larg * Math.sqrt(sum); + } + }); + + +/***/ }), +/* 116 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.18 Math.imul(x, y) + var $export = __webpack_require__(8); + var $imul = Math.imul; + + // some WebKit versions fails with big numbers, some has wrong arity + $export($export.S + $export.F * __webpack_require__(7)(function () { + return $imul(0xffffffff, 5) != -5 || $imul.length != 2; + }), 'Math', { + imul: function imul(x, y) { + var UINT16 = 0xffff; + var xn = +x; + var yn = +y; + var xl = UINT16 & xn; + var yl = UINT16 & yn; + return 0 | xl * yl + ((UINT16 & xn >>> 16) * yl + xl * (UINT16 & yn >>> 16) << 16 >>> 0); + } + }); + + +/***/ }), +/* 117 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.21 Math.log10(x) + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + log10: function log10(x) { + return Math.log(x) * Math.LOG10E; + } + }); + + +/***/ }), +/* 118 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.20 Math.log1p(x) + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { log1p: __webpack_require__(104) }); + + +/***/ }), +/* 119 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.22 Math.log2(x) + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + log2: function log2(x) { + return Math.log(x) / Math.LN2; + } + }); + + +/***/ }), +/* 120 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.28 Math.sign(x) + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { sign: __webpack_require__(108) }); + + +/***/ }), +/* 121 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.30 Math.sinh(x) + var $export = __webpack_require__(8); + var expm1 = __webpack_require__(112); + var exp = Math.exp; + + // V8 near Chromium 38 has a problem with very small numbers + $export($export.S + $export.F * __webpack_require__(7)(function () { + return !Math.sinh(-2e-17) != -2e-17; + }), 'Math', { + sinh: function sinh(x) { + return Math.abs(x = +x) < 1 + ? (expm1(x) - expm1(-x)) / 2 + : (exp(x - 1) - exp(-x - 1)) * (Math.E / 2); + } + }); + + +/***/ }), +/* 122 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.33 Math.tanh(x) + var $export = __webpack_require__(8); + var expm1 = __webpack_require__(112); + var exp = Math.exp; + + $export($export.S, 'Math', { + tanh: function tanh(x) { + var a = expm1(x = +x); + var b = expm1(-x); + return a == Infinity ? 1 : b == Infinity ? -1 : (a - b) / (exp(x) + exp(-x)); + } + }); + + +/***/ }), +/* 123 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.2.2.34 Math.trunc(x) + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + trunc: function trunc(it) { + return (it > 0 ? Math.floor : Math.ceil)(it); + } + }); + + +/***/ }), +/* 124 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var toAbsoluteIndex = __webpack_require__(40); + var fromCharCode = String.fromCharCode; + var $fromCodePoint = String.fromCodePoint; + + // length should be 1, old FF problem + $export($export.S + $export.F * (!!$fromCodePoint && $fromCodePoint.length != 1), 'String', { + // 21.1.2.2 String.fromCodePoint(...codePoints) + fromCodePoint: function fromCodePoint(x) { // eslint-disable-line no-unused-vars + var res = []; + var aLen = arguments.length; + var i = 0; + var code; + while (aLen > i) { + code = +arguments[i++]; + if (toAbsoluteIndex(code, 0x10ffff) !== code) throw RangeError(code + ' is not a valid code point'); + res.push(code < 0x10000 + ? fromCharCode(code) + : fromCharCode(((code -= 0x10000) >> 10) + 0xd800, code % 0x400 + 0xdc00) + ); + } return res.join(''); + } + }); + + +/***/ }), +/* 125 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var toIObject = __webpack_require__(33); + var toLength = __webpack_require__(38); + + $export($export.S, 'String', { + // 21.1.2.4 String.raw(callSite, ...substitutions) + raw: function raw(callSite) { + var tpl = toIObject(callSite.raw); + var len = toLength(tpl.length); + var aLen = arguments.length; + var res = []; + var i = 0; + while (len > i) { + res.push(String(tpl[i++])); + if (i < aLen) res.push(String(arguments[i])); + } return res.join(''); + } + }); + + +/***/ }), +/* 126 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 21.1.3.25 String.prototype.trim() + __webpack_require__(83)('trim', function ($trim) { + return function trim() { + return $trim(this, 3); + }; + }); + + +/***/ }), +/* 127 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $at = __webpack_require__(128)(true); + + // 21.1.3.27 String.prototype[@@iterator]() + __webpack_require__(129)(String, 'String', function (iterated) { + this._t = String(iterated); // target + this._i = 0; // next index + // 21.1.5.2.1 %StringIteratorPrototype%.next() + }, function () { + var O = this._t; + var index = this._i; + var point; + if (index >= O.length) return { value: undefined, done: true }; + point = $at(O, index); + this._i += point.length; + return { value: point, done: false }; + }); + + +/***/ }), +/* 128 */ +/***/ (function(module, exports, __webpack_require__) { + + var toInteger = __webpack_require__(39); + var defined = __webpack_require__(36); + // true -> String#at + // false -> String#codePointAt + module.exports = function (TO_STRING) { + return function (that, pos) { + var s = String(defined(that)); + var i = toInteger(pos); + var l = s.length; + var a, b; + if (i < 0 || i >= l) return TO_STRING ? '' : undefined; + a = s.charCodeAt(i); + return a < 0xd800 || a > 0xdbff || i + 1 === l || (b = s.charCodeAt(i + 1)) < 0xdc00 || b > 0xdfff + ? TO_STRING ? s.charAt(i) : a + : TO_STRING ? s.slice(i, i + 2) : (a - 0xd800 << 10) + (b - 0xdc00) + 0x10000; + }; + }; + + +/***/ }), +/* 129 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var LIBRARY = __webpack_require__(22); + var $export = __webpack_require__(8); + var redefine = __webpack_require__(18); + var hide = __webpack_require__(10); + var Iterators = __webpack_require__(130); + var $iterCreate = __webpack_require__(131); + var setToStringTag = __webpack_require__(26); + var getPrototypeOf = __webpack_require__(59); + var ITERATOR = __webpack_require__(27)('iterator'); + var BUGGY = !([].keys && 'next' in [].keys()); // Safari has buggy iterators w/o `next` + var FF_ITERATOR = '@@iterator'; + var KEYS = 'keys'; + var VALUES = 'values'; + + var returnThis = function () { return this; }; + + module.exports = function (Base, NAME, Constructor, next, DEFAULT, IS_SET, FORCED) { + $iterCreate(Constructor, NAME, next); + var getMethod = function (kind) { + if (!BUGGY && kind in proto) return proto[kind]; + switch (kind) { + case KEYS: return function keys() { return new Constructor(this, kind); }; + case VALUES: return function values() { return new Constructor(this, kind); }; + } return function entries() { return new Constructor(this, kind); }; + }; + var TAG = NAME + ' Iterator'; + var DEF_VALUES = DEFAULT == VALUES; + var VALUES_BUG = false; + var proto = Base.prototype; + var $native = proto[ITERATOR] || proto[FF_ITERATOR] || DEFAULT && proto[DEFAULT]; + var $default = $native || getMethod(DEFAULT); + var $entries = DEFAULT ? !DEF_VALUES ? $default : getMethod('entries') : undefined; + var $anyNative = NAME == 'Array' ? proto.entries || $native : $native; + var methods, key, IteratorPrototype; + // Fix native + if ($anyNative) { + IteratorPrototype = getPrototypeOf($anyNative.call(new Base())); + if (IteratorPrototype !== Object.prototype && IteratorPrototype.next) { + // Set @@toStringTag to native iterators + setToStringTag(IteratorPrototype, TAG, true); + // fix for some old engines + if (!LIBRARY && typeof IteratorPrototype[ITERATOR] != 'function') hide(IteratorPrototype, ITERATOR, returnThis); + } + } + // fix Array#{values, @@iterator}.name in V8 / FF + if (DEF_VALUES && $native && $native.name !== VALUES) { + VALUES_BUG = true; + $default = function values() { return $native.call(this); }; + } + // Define iterator + if ((!LIBRARY || FORCED) && (BUGGY || VALUES_BUG || !proto[ITERATOR])) { + hide(proto, ITERATOR, $default); + } + // Plug for library + Iterators[NAME] = $default; + Iterators[TAG] = returnThis; + if (DEFAULT) { + methods = { + values: DEF_VALUES ? $default : getMethod(VALUES), + keys: IS_SET ? $default : getMethod(KEYS), + entries: $entries + }; + if (FORCED) for (key in methods) { + if (!(key in proto)) redefine(proto, key, methods[key]); + } else $export($export.P + $export.F * (BUGGY || VALUES_BUG), NAME, methods); + } + return methods; + }; + + +/***/ }), +/* 130 */ +/***/ (function(module, exports) { + + module.exports = {}; + + +/***/ }), +/* 131 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var create = __webpack_require__(47); + var descriptor = __webpack_require__(17); + var setToStringTag = __webpack_require__(26); + var IteratorPrototype = {}; + + // 25.1.2.1.1 %IteratorPrototype%[@@iterator]() + __webpack_require__(10)(IteratorPrototype, __webpack_require__(27)('iterator'), function () { return this; }); + + module.exports = function (Constructor, NAME, next) { + Constructor.prototype = create(IteratorPrototype, { next: descriptor(1, next) }); + setToStringTag(Constructor, NAME + ' Iterator'); + }; + + +/***/ }), +/* 132 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $at = __webpack_require__(128)(false); + $export($export.P, 'String', { + // 21.1.3.3 String.prototype.codePointAt(pos) + codePointAt: function codePointAt(pos) { + return $at(this, pos); + } + }); + + +/***/ }), +/* 133 */ +/***/ (function(module, exports, __webpack_require__) { + + // 21.1.3.6 String.prototype.endsWith(searchString [, endPosition]) + 'use strict'; + var $export = __webpack_require__(8); + var toLength = __webpack_require__(38); + var context = __webpack_require__(134); + var ENDS_WITH = 'endsWith'; + var $endsWith = ''[ENDS_WITH]; + + $export($export.P + $export.F * __webpack_require__(136)(ENDS_WITH), 'String', { + endsWith: function endsWith(searchString /* , endPosition = @length */) { + var that = context(this, searchString, ENDS_WITH); + var endPosition = arguments.length > 1 ? arguments[1] : undefined; + var len = toLength(that.length); + var end = endPosition === undefined ? len : Math.min(toLength(endPosition), len); + var search = String(searchString); + return $endsWith + ? $endsWith.call(that, search, end) + : that.slice(end - search.length, end) === search; + } + }); + + +/***/ }), +/* 134 */ +/***/ (function(module, exports, __webpack_require__) { + + // helper for String#{startsWith, endsWith, includes} + var isRegExp = __webpack_require__(135); + var defined = __webpack_require__(36); + + module.exports = function (that, searchString, NAME) { + if (isRegExp(searchString)) throw TypeError('String#' + NAME + " doesn't accept regex!"); + return String(defined(that)); + }; + + +/***/ }), +/* 135 */ +/***/ (function(module, exports, __webpack_require__) { + + // 7.2.8 IsRegExp(argument) + var isObject = __webpack_require__(13); + var cof = __webpack_require__(35); + var MATCH = __webpack_require__(27)('match'); + module.exports = function (it) { + var isRegExp; + return isObject(it) && ((isRegExp = it[MATCH]) !== undefined ? !!isRegExp : cof(it) == 'RegExp'); + }; + + +/***/ }), +/* 136 */ +/***/ (function(module, exports, __webpack_require__) { + + var MATCH = __webpack_require__(27)('match'); + module.exports = function (KEY) { + var re = /./; + try { + '/./'[KEY](re); + } catch (e) { + try { + re[MATCH] = false; + return !'/./'[KEY](re); + } catch (f) { /* empty */ } + } return true; + }; + + +/***/ }), +/* 137 */ +/***/ (function(module, exports, __webpack_require__) { + + // 21.1.3.7 String.prototype.includes(searchString, position = 0) + 'use strict'; + var $export = __webpack_require__(8); + var context = __webpack_require__(134); + var INCLUDES = 'includes'; + + $export($export.P + $export.F * __webpack_require__(136)(INCLUDES), 'String', { + includes: function includes(searchString /* , position = 0 */) { + return !!~context(this, searchString, INCLUDES) + .indexOf(searchString, arguments.length > 1 ? arguments[1] : undefined); + } + }); + + +/***/ }), +/* 138 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + + $export($export.P, 'String', { + // 21.1.3.13 String.prototype.repeat(count) + repeat: __webpack_require__(91) + }); + + +/***/ }), +/* 139 */ +/***/ (function(module, exports, __webpack_require__) { + + // 21.1.3.18 String.prototype.startsWith(searchString [, position ]) + 'use strict'; + var $export = __webpack_require__(8); + var toLength = __webpack_require__(38); + var context = __webpack_require__(134); + var STARTS_WITH = 'startsWith'; + var $startsWith = ''[STARTS_WITH]; + + $export($export.P + $export.F * __webpack_require__(136)(STARTS_WITH), 'String', { + startsWith: function startsWith(searchString /* , position = 0 */) { + var that = context(this, searchString, STARTS_WITH); + var index = toLength(Math.min(arguments.length > 1 ? arguments[1] : undefined, that.length)); + var search = String(searchString); + return $startsWith + ? $startsWith.call(that, search, index) + : that.slice(index, index + search.length) === search; + } + }); + + +/***/ }), +/* 140 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.2 String.prototype.anchor(name) + __webpack_require__(141)('anchor', function (createHTML) { + return function anchor(name) { + return createHTML(this, 'a', 'name', name); + }; + }); + + +/***/ }), +/* 141 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var fails = __webpack_require__(7); + var defined = __webpack_require__(36); + var quot = /"/g; + // B.2.3.2.1 CreateHTML(string, tag, attribute, value) + var createHTML = function (string, tag, attribute, value) { + var S = String(defined(string)); + var p1 = '<' + tag; + if (attribute !== '') p1 += ' ' + attribute + '="' + String(value).replace(quot, '"') + '"'; + return p1 + '>' + S + ''; + }; + module.exports = function (NAME, exec) { + var O = {}; + O[NAME] = exec(createHTML); + $export($export.P + $export.F * fails(function () { + var test = ''[NAME]('"'); + return test !== test.toLowerCase() || test.split('"').length > 3; + }), 'String', O); + }; + + +/***/ }), +/* 142 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.3 String.prototype.big() + __webpack_require__(141)('big', function (createHTML) { + return function big() { + return createHTML(this, 'big', '', ''); + }; + }); + + +/***/ }), +/* 143 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.4 String.prototype.blink() + __webpack_require__(141)('blink', function (createHTML) { + return function blink() { + return createHTML(this, 'blink', '', ''); + }; + }); + + +/***/ }), +/* 144 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.5 String.prototype.bold() + __webpack_require__(141)('bold', function (createHTML) { + return function bold() { + return createHTML(this, 'b', '', ''); + }; + }); + + +/***/ }), +/* 145 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.6 String.prototype.fixed() + __webpack_require__(141)('fixed', function (createHTML) { + return function fixed() { + return createHTML(this, 'tt', '', ''); + }; + }); + + +/***/ }), +/* 146 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.7 String.prototype.fontcolor(color) + __webpack_require__(141)('fontcolor', function (createHTML) { + return function fontcolor(color) { + return createHTML(this, 'font', 'color', color); + }; + }); + + +/***/ }), +/* 147 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.8 String.prototype.fontsize(size) + __webpack_require__(141)('fontsize', function (createHTML) { + return function fontsize(size) { + return createHTML(this, 'font', 'size', size); + }; + }); + + +/***/ }), +/* 148 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.9 String.prototype.italics() + __webpack_require__(141)('italics', function (createHTML) { + return function italics() { + return createHTML(this, 'i', '', ''); + }; + }); + + +/***/ }), +/* 149 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.10 String.prototype.link(url) + __webpack_require__(141)('link', function (createHTML) { + return function link(url) { + return createHTML(this, 'a', 'href', url); + }; + }); + + +/***/ }), +/* 150 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.11 String.prototype.small() + __webpack_require__(141)('small', function (createHTML) { + return function small() { + return createHTML(this, 'small', '', ''); + }; + }); + + +/***/ }), +/* 151 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.12 String.prototype.strike() + __webpack_require__(141)('strike', function (createHTML) { + return function strike() { + return createHTML(this, 'strike', '', ''); + }; + }); + + +/***/ }), +/* 152 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.13 String.prototype.sub() + __webpack_require__(141)('sub', function (createHTML) { + return function sub() { + return createHTML(this, 'sub', '', ''); + }; + }); + + +/***/ }), +/* 153 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // B.2.3.14 String.prototype.sup() + __webpack_require__(141)('sup', function (createHTML) { + return function sup() { + return createHTML(this, 'sup', '', ''); + }; + }); + + +/***/ }), +/* 154 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.3.3.1 / 15.9.4.4 Date.now() + var $export = __webpack_require__(8); + + $export($export.S, 'Date', { now: function () { return new Date().getTime(); } }); + + +/***/ }), +/* 155 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var toObject = __webpack_require__(46); + var toPrimitive = __webpack_require__(16); + + $export($export.P + $export.F * __webpack_require__(7)(function () { + return new Date(NaN).toJSON() !== null + || Date.prototype.toJSON.call({ toISOString: function () { return 1; } }) !== 1; + }), 'Date', { + // eslint-disable-next-line no-unused-vars + toJSON: function toJSON(key) { + var O = toObject(this); + var pv = toPrimitive(O); + return typeof pv == 'number' && !isFinite(pv) ? null : O.toISOString(); + } + }); + + +/***/ }), +/* 156 */ +/***/ (function(module, exports, __webpack_require__) { + + // 20.3.4.36 / 15.9.5.43 Date.prototype.toISOString() + var $export = __webpack_require__(8); + var toISOString = __webpack_require__(157); + + // PhantomJS / old WebKit has a broken implementations + $export($export.P + $export.F * (Date.prototype.toISOString !== toISOString), 'Date', { + toISOString: toISOString + }); + + +/***/ }), +/* 157 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 20.3.4.36 / 15.9.5.43 Date.prototype.toISOString() + var fails = __webpack_require__(7); + var getTime = Date.prototype.getTime; + var $toISOString = Date.prototype.toISOString; + + var lz = function (num) { + return num > 9 ? num : '0' + num; + }; + + // PhantomJS / old WebKit has a broken implementations + module.exports = (fails(function () { + return $toISOString.call(new Date(-5e13 - 1)) != '0385-07-25T07:06:39.999Z'; + }) || !fails(function () { + $toISOString.call(new Date(NaN)); + })) ? function toISOString() { + if (!isFinite(getTime.call(this))) throw RangeError('Invalid time value'); + var d = this; + var y = d.getUTCFullYear(); + var m = d.getUTCMilliseconds(); + var s = y < 0 ? '-' : y > 9999 ? '+' : ''; + return s + ('00000' + Math.abs(y)).slice(s ? -6 : -4) + + '-' + lz(d.getUTCMonth() + 1) + '-' + lz(d.getUTCDate()) + + 'T' + lz(d.getUTCHours()) + ':' + lz(d.getUTCMinutes()) + + ':' + lz(d.getUTCSeconds()) + '.' + (m > 99 ? m : '0' + lz(m)) + 'Z'; + } : $toISOString; + + +/***/ }), +/* 158 */ +/***/ (function(module, exports, __webpack_require__) { + + var DateProto = Date.prototype; + var INVALID_DATE = 'Invalid Date'; + var TO_STRING = 'toString'; + var $toString = DateProto[TO_STRING]; + var getTime = DateProto.getTime; + if (new Date(NaN) + '' != INVALID_DATE) { + __webpack_require__(18)(DateProto, TO_STRING, function toString() { + var value = getTime.call(this); + // eslint-disable-next-line no-self-compare + return value === value ? $toString.call(this) : INVALID_DATE; + }); + } + + +/***/ }), +/* 159 */ +/***/ (function(module, exports, __webpack_require__) { + + var TO_PRIMITIVE = __webpack_require__(27)('toPrimitive'); + var proto = Date.prototype; + + if (!(TO_PRIMITIVE in proto)) __webpack_require__(10)(proto, TO_PRIMITIVE, __webpack_require__(160)); + + +/***/ }), +/* 160 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var anObject = __webpack_require__(12); + var toPrimitive = __webpack_require__(16); + var NUMBER = 'number'; + + module.exports = function (hint) { + if (hint !== 'string' && hint !== NUMBER && hint !== 'default') throw TypeError('Incorrect hint'); + return toPrimitive(anObject(this), hint != NUMBER); + }; + + +/***/ }), +/* 161 */ +/***/ (function(module, exports, __webpack_require__) { + + // 22.1.2.2 / 15.4.3.2 Array.isArray(arg) + var $export = __webpack_require__(8); + + $export($export.S, 'Array', { isArray: __webpack_require__(45) }); + + +/***/ }), +/* 162 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var ctx = __webpack_require__(23); + var $export = __webpack_require__(8); + var toObject = __webpack_require__(46); + var call = __webpack_require__(163); + var isArrayIter = __webpack_require__(164); + var toLength = __webpack_require__(38); + var createProperty = __webpack_require__(165); + var getIterFn = __webpack_require__(166); + + $export($export.S + $export.F * !__webpack_require__(167)(function (iter) { Array.from(iter); }), 'Array', { + // 22.1.2.1 Array.from(arrayLike, mapfn = undefined, thisArg = undefined) + from: function from(arrayLike /* , mapfn = undefined, thisArg = undefined */) { + var O = toObject(arrayLike); + var C = typeof this == 'function' ? this : Array; + var aLen = arguments.length; + var mapfn = aLen > 1 ? arguments[1] : undefined; + var mapping = mapfn !== undefined; + var index = 0; + var iterFn = getIterFn(O); + var length, result, step, iterator; + if (mapping) mapfn = ctx(mapfn, aLen > 2 ? arguments[2] : undefined, 2); + // if object isn't iterable or it's array with default iterator - use simple case + if (iterFn != undefined && !(C == Array && isArrayIter(iterFn))) { + for (iterator = iterFn.call(O), result = new C(); !(step = iterator.next()).done; index++) { + createProperty(result, index, mapping ? call(iterator, mapfn, [step.value, index], true) : step.value); + } + } else { + length = toLength(O.length); + for (result = new C(length); length > index; index++) { + createProperty(result, index, mapping ? mapfn(O[index], index) : O[index]); + } + } + result.length = index; + return result; + } + }); + + +/***/ }), +/* 163 */ +/***/ (function(module, exports, __webpack_require__) { + + // call something on iterator step with safe closing on error + var anObject = __webpack_require__(12); + module.exports = function (iterator, fn, value, entries) { + try { + return entries ? fn(anObject(value)[0], value[1]) : fn(value); + // 7.4.6 IteratorClose(iterator, completion) + } catch (e) { + var ret = iterator['return']; + if (ret !== undefined) anObject(ret.call(iterator)); + throw e; + } + }; + + +/***/ }), +/* 164 */ +/***/ (function(module, exports, __webpack_require__) { + + // check on default Array iterator + var Iterators = __webpack_require__(130); + var ITERATOR = __webpack_require__(27)('iterator'); + var ArrayProto = Array.prototype; + + module.exports = function (it) { + return it !== undefined && (Iterators.Array === it || ArrayProto[ITERATOR] === it); + }; + + +/***/ }), +/* 165 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $defineProperty = __webpack_require__(11); + var createDesc = __webpack_require__(17); + + module.exports = function (object, index, value) { + if (index in object) $defineProperty.f(object, index, createDesc(0, value)); + else object[index] = value; + }; + + +/***/ }), +/* 166 */ +/***/ (function(module, exports, __webpack_require__) { + + var classof = __webpack_require__(75); + var ITERATOR = __webpack_require__(27)('iterator'); + var Iterators = __webpack_require__(130); + module.exports = __webpack_require__(9).getIteratorMethod = function (it) { + if (it != undefined) return it[ITERATOR] + || it['@@iterator'] + || Iterators[classof(it)]; + }; + + +/***/ }), +/* 167 */ +/***/ (function(module, exports, __webpack_require__) { + + var ITERATOR = __webpack_require__(27)('iterator'); + var SAFE_CLOSING = false; + + try { + var riter = [7][ITERATOR](); + riter['return'] = function () { SAFE_CLOSING = true; }; + // eslint-disable-next-line no-throw-literal + Array.from(riter, function () { throw 2; }); + } catch (e) { /* empty */ } + + module.exports = function (exec, skipClosing) { + if (!skipClosing && !SAFE_CLOSING) return false; + var safe = false; + try { + var arr = [7]; + var iter = arr[ITERATOR](); + iter.next = function () { return { done: safe = true }; }; + arr[ITERATOR] = function () { return iter; }; + exec(arr); + } catch (e) { /* empty */ } + return safe; + }; + + +/***/ }), +/* 168 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var createProperty = __webpack_require__(165); + + // WebKit Array.of isn't generic + $export($export.S + $export.F * __webpack_require__(7)(function () { + function F() { /* empty */ } + return !(Array.of.call(F) instanceof F); + }), 'Array', { + // 22.1.2.3 Array.of( ...items) + of: function of(/* ...args */) { + var index = 0; + var aLen = arguments.length; + var result = new (typeof this == 'function' ? this : Array)(aLen); + while (aLen > index) createProperty(result, index, arguments[index++]); + result.length = aLen; + return result; + } + }); + + +/***/ }), +/* 169 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 22.1.3.13 Array.prototype.join(separator) + var $export = __webpack_require__(8); + var toIObject = __webpack_require__(33); + var arrayJoin = [].join; + + // fallback for not array-like strings + $export($export.P + $export.F * (__webpack_require__(34) != Object || !__webpack_require__(170)(arrayJoin)), 'Array', { + join: function join(separator) { + return arrayJoin.call(toIObject(this), separator === undefined ? ',' : separator); + } + }); + + +/***/ }), +/* 170 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var fails = __webpack_require__(7); + + module.exports = function (method, arg) { + return !!method && fails(function () { + // eslint-disable-next-line no-useless-call + arg ? method.call(null, function () { /* empty */ }, 1) : method.call(null); + }); + }; + + +/***/ }), +/* 171 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var html = __webpack_require__(49); + var cof = __webpack_require__(35); + var toAbsoluteIndex = __webpack_require__(40); + var toLength = __webpack_require__(38); + var arraySlice = [].slice; + + // fallback for not array-like ES3 strings and DOM objects + $export($export.P + $export.F * __webpack_require__(7)(function () { + if (html) arraySlice.call(html); + }), 'Array', { + slice: function slice(begin, end) { + var len = toLength(this.length); + var klass = cof(this); + end = end === undefined ? len : end; + if (klass == 'Array') return arraySlice.call(this, begin, end); + var start = toAbsoluteIndex(begin, len); + var upTo = toAbsoluteIndex(end, len); + var size = toLength(upTo - start); + var cloned = new Array(size); + var i = 0; + for (; i < size; i++) cloned[i] = klass == 'String' + ? this.charAt(start + i) + : this[start + i]; + return cloned; + } + }); + + +/***/ }), +/* 172 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var aFunction = __webpack_require__(24); + var toObject = __webpack_require__(46); + var fails = __webpack_require__(7); + var $sort = [].sort; + var test = [1, 2, 3]; + + $export($export.P + $export.F * (fails(function () { + // IE8- + test.sort(undefined); + }) || !fails(function () { + // V8 bug + test.sort(null); + // Old WebKit + }) || !__webpack_require__(170)($sort)), 'Array', { + // 22.1.3.25 Array.prototype.sort(comparefn) + sort: function sort(comparefn) { + return comparefn === undefined + ? $sort.call(toObject(this)) + : $sort.call(toObject(this), aFunction(comparefn)); + } + }); + + +/***/ }), +/* 173 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $forEach = __webpack_require__(174)(0); + var STRICT = __webpack_require__(170)([].forEach, true); + + $export($export.P + $export.F * !STRICT, 'Array', { + // 22.1.3.10 / 15.4.4.18 Array.prototype.forEach(callbackfn [, thisArg]) + forEach: function forEach(callbackfn /* , thisArg */) { + return $forEach(this, callbackfn, arguments[1]); + } + }); + + +/***/ }), +/* 174 */ +/***/ (function(module, exports, __webpack_require__) { + + // 0 -> Array#forEach + // 1 -> Array#map + // 2 -> Array#filter + // 3 -> Array#some + // 4 -> Array#every + // 5 -> Array#find + // 6 -> Array#findIndex + var ctx = __webpack_require__(23); + var IObject = __webpack_require__(34); + var toObject = __webpack_require__(46); + var toLength = __webpack_require__(38); + var asc = __webpack_require__(175); + module.exports = function (TYPE, $create) { + var IS_MAP = TYPE == 1; + var IS_FILTER = TYPE == 2; + var IS_SOME = TYPE == 3; + var IS_EVERY = TYPE == 4; + var IS_FIND_INDEX = TYPE == 6; + var NO_HOLES = TYPE == 5 || IS_FIND_INDEX; + var create = $create || asc; + return function ($this, callbackfn, that) { + var O = toObject($this); + var self = IObject(O); + var f = ctx(callbackfn, that, 3); + var length = toLength(self.length); + var index = 0; + var result = IS_MAP ? create($this, length) : IS_FILTER ? create($this, 0) : undefined; + var val, res; + for (;length > index; index++) if (NO_HOLES || index in self) { + val = self[index]; + res = f(val, index, O); + if (TYPE) { + if (IS_MAP) result[index] = res; // map + else if (res) switch (TYPE) { + case 3: return true; // some + case 5: return val; // find + case 6: return index; // findIndex + case 2: result.push(val); // filter + } else if (IS_EVERY) return false; // every + } + } + return IS_FIND_INDEX ? -1 : IS_SOME || IS_EVERY ? IS_EVERY : result; + }; + }; + + +/***/ }), +/* 175 */ +/***/ (function(module, exports, __webpack_require__) { + + // 9.4.2.3 ArraySpeciesCreate(originalArray, length) + var speciesConstructor = __webpack_require__(176); + + module.exports = function (original, length) { + return new (speciesConstructor(original))(length); + }; + + +/***/ }), +/* 176 */ +/***/ (function(module, exports, __webpack_require__) { + + var isObject = __webpack_require__(13); + var isArray = __webpack_require__(45); + var SPECIES = __webpack_require__(27)('species'); + + module.exports = function (original) { + var C; + if (isArray(original)) { + C = original.constructor; + // cross-realm fallback + if (typeof C == 'function' && (C === Array || isArray(C.prototype))) C = undefined; + if (isObject(C)) { + C = C[SPECIES]; + if (C === null) C = undefined; + } + } return C === undefined ? Array : C; + }; + + +/***/ }), +/* 177 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $map = __webpack_require__(174)(1); + + $export($export.P + $export.F * !__webpack_require__(170)([].map, true), 'Array', { + // 22.1.3.15 / 15.4.4.19 Array.prototype.map(callbackfn [, thisArg]) + map: function map(callbackfn /* , thisArg */) { + return $map(this, callbackfn, arguments[1]); + } + }); + + +/***/ }), +/* 178 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $filter = __webpack_require__(174)(2); + + $export($export.P + $export.F * !__webpack_require__(170)([].filter, true), 'Array', { + // 22.1.3.7 / 15.4.4.20 Array.prototype.filter(callbackfn [, thisArg]) + filter: function filter(callbackfn /* , thisArg */) { + return $filter(this, callbackfn, arguments[1]); + } + }); + + +/***/ }), +/* 179 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $some = __webpack_require__(174)(3); + + $export($export.P + $export.F * !__webpack_require__(170)([].some, true), 'Array', { + // 22.1.3.23 / 15.4.4.17 Array.prototype.some(callbackfn [, thisArg]) + some: function some(callbackfn /* , thisArg */) { + return $some(this, callbackfn, arguments[1]); + } + }); + + +/***/ }), +/* 180 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $every = __webpack_require__(174)(4); + + $export($export.P + $export.F * !__webpack_require__(170)([].every, true), 'Array', { + // 22.1.3.5 / 15.4.4.16 Array.prototype.every(callbackfn [, thisArg]) + every: function every(callbackfn /* , thisArg */) { + return $every(this, callbackfn, arguments[1]); + } + }); + + +/***/ }), +/* 181 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $reduce = __webpack_require__(182); + + $export($export.P + $export.F * !__webpack_require__(170)([].reduce, true), 'Array', { + // 22.1.3.18 / 15.4.4.21 Array.prototype.reduce(callbackfn [, initialValue]) + reduce: function reduce(callbackfn /* , initialValue */) { + return $reduce(this, callbackfn, arguments.length, arguments[1], false); + } + }); + + +/***/ }), +/* 182 */ +/***/ (function(module, exports, __webpack_require__) { + + var aFunction = __webpack_require__(24); + var toObject = __webpack_require__(46); + var IObject = __webpack_require__(34); + var toLength = __webpack_require__(38); + + module.exports = function (that, callbackfn, aLen, memo, isRight) { + aFunction(callbackfn); + var O = toObject(that); + var self = IObject(O); + var length = toLength(O.length); + var index = isRight ? length - 1 : 0; + var i = isRight ? -1 : 1; + if (aLen < 2) for (;;) { + if (index in self) { + memo = self[index]; + index += i; + break; + } + index += i; + if (isRight ? index < 0 : length <= index) { + throw TypeError('Reduce of empty array with no initial value'); + } + } + for (;isRight ? index >= 0 : length > index; index += i) if (index in self) { + memo = callbackfn(memo, self[index], index, O); + } + return memo; + }; + + +/***/ }), +/* 183 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $reduce = __webpack_require__(182); + + $export($export.P + $export.F * !__webpack_require__(170)([].reduceRight, true), 'Array', { + // 22.1.3.19 / 15.4.4.22 Array.prototype.reduceRight(callbackfn [, initialValue]) + reduceRight: function reduceRight(callbackfn /* , initialValue */) { + return $reduce(this, callbackfn, arguments.length, arguments[1], true); + } + }); + + +/***/ }), +/* 184 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $indexOf = __webpack_require__(37)(false); + var $native = [].indexOf; + var NEGATIVE_ZERO = !!$native && 1 / [1].indexOf(1, -0) < 0; + + $export($export.P + $export.F * (NEGATIVE_ZERO || !__webpack_require__(170)($native)), 'Array', { + // 22.1.3.11 / 15.4.4.14 Array.prototype.indexOf(searchElement [, fromIndex]) + indexOf: function indexOf(searchElement /* , fromIndex = 0 */) { + return NEGATIVE_ZERO + // convert -0 to +0 + ? $native.apply(this, arguments) || 0 + : $indexOf(this, searchElement, arguments[1]); + } + }); + + +/***/ }), +/* 185 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var toIObject = __webpack_require__(33); + var toInteger = __webpack_require__(39); + var toLength = __webpack_require__(38); + var $native = [].lastIndexOf; + var NEGATIVE_ZERO = !!$native && 1 / [1].lastIndexOf(1, -0) < 0; + + $export($export.P + $export.F * (NEGATIVE_ZERO || !__webpack_require__(170)($native)), 'Array', { + // 22.1.3.14 / 15.4.4.15 Array.prototype.lastIndexOf(searchElement [, fromIndex]) + lastIndexOf: function lastIndexOf(searchElement /* , fromIndex = @[*-1] */) { + // convert -0 to +0 + if (NEGATIVE_ZERO) return $native.apply(this, arguments) || 0; + var O = toIObject(this); + var length = toLength(O.length); + var index = length - 1; + if (arguments.length > 1) index = Math.min(index, toInteger(arguments[1])); + if (index < 0) index = length + index; + for (;index >= 0; index--) if (index in O) if (O[index] === searchElement) return index || 0; + return -1; + } + }); + + +/***/ }), +/* 186 */ +/***/ (function(module, exports, __webpack_require__) { + + // 22.1.3.3 Array.prototype.copyWithin(target, start, end = this.length) + var $export = __webpack_require__(8); + + $export($export.P, 'Array', { copyWithin: __webpack_require__(187) }); + + __webpack_require__(188)('copyWithin'); + + +/***/ }), +/* 187 */ +/***/ (function(module, exports, __webpack_require__) { + + // 22.1.3.3 Array.prototype.copyWithin(target, start, end = this.length) + 'use strict'; + var toObject = __webpack_require__(46); + var toAbsoluteIndex = __webpack_require__(40); + var toLength = __webpack_require__(38); + + module.exports = [].copyWithin || function copyWithin(target /* = 0 */, start /* = 0, end = @length */) { + var O = toObject(this); + var len = toLength(O.length); + var to = toAbsoluteIndex(target, len); + var from = toAbsoluteIndex(start, len); + var end = arguments.length > 2 ? arguments[2] : undefined; + var count = Math.min((end === undefined ? len : toAbsoluteIndex(end, len)) - from, len - to); + var inc = 1; + if (from < to && to < from + count) { + inc = -1; + from += count - 1; + to += count - 1; + } + while (count-- > 0) { + if (from in O) O[to] = O[from]; + else delete O[to]; + to += inc; + from += inc; + } return O; + }; + + +/***/ }), +/* 188 */ +/***/ (function(module, exports, __webpack_require__) { + + // 22.1.3.31 Array.prototype[@@unscopables] + var UNSCOPABLES = __webpack_require__(27)('unscopables'); + var ArrayProto = Array.prototype; + if (ArrayProto[UNSCOPABLES] == undefined) __webpack_require__(10)(ArrayProto, UNSCOPABLES, {}); + module.exports = function (key) { + ArrayProto[UNSCOPABLES][key] = true; + }; + + +/***/ }), +/* 189 */ +/***/ (function(module, exports, __webpack_require__) { + + // 22.1.3.6 Array.prototype.fill(value, start = 0, end = this.length) + var $export = __webpack_require__(8); + + $export($export.P, 'Array', { fill: __webpack_require__(190) }); + + __webpack_require__(188)('fill'); + + +/***/ }), +/* 190 */ +/***/ (function(module, exports, __webpack_require__) { + + // 22.1.3.6 Array.prototype.fill(value, start = 0, end = this.length) + 'use strict'; + var toObject = __webpack_require__(46); + var toAbsoluteIndex = __webpack_require__(40); + var toLength = __webpack_require__(38); + module.exports = function fill(value /* , start = 0, end = @length */) { + var O = toObject(this); + var length = toLength(O.length); + var aLen = arguments.length; + var index = toAbsoluteIndex(aLen > 1 ? arguments[1] : undefined, length); + var end = aLen > 2 ? arguments[2] : undefined; + var endPos = end === undefined ? length : toAbsoluteIndex(end, length); + while (endPos > index) O[index++] = value; + return O; + }; + + +/***/ }), +/* 191 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 22.1.3.8 Array.prototype.find(predicate, thisArg = undefined) + var $export = __webpack_require__(8); + var $find = __webpack_require__(174)(5); + var KEY = 'find'; + var forced = true; + // Shouldn't skip holes + if (KEY in []) Array(1)[KEY](function () { forced = false; }); + $export($export.P + $export.F * forced, 'Array', { + find: function find(callbackfn /* , that = undefined */) { + return $find(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined); + } + }); + __webpack_require__(188)(KEY); + + +/***/ }), +/* 192 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 22.1.3.9 Array.prototype.findIndex(predicate, thisArg = undefined) + var $export = __webpack_require__(8); + var $find = __webpack_require__(174)(6); + var KEY = 'findIndex'; + var forced = true; + // Shouldn't skip holes + if (KEY in []) Array(1)[KEY](function () { forced = false; }); + $export($export.P + $export.F * forced, 'Array', { + findIndex: function findIndex(callbackfn /* , that = undefined */) { + return $find(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined); + } + }); + __webpack_require__(188)(KEY); + + +/***/ }), +/* 193 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(194)('Array'); + + +/***/ }), +/* 194 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var global = __webpack_require__(4); + var dP = __webpack_require__(11); + var DESCRIPTORS = __webpack_require__(6); + var SPECIES = __webpack_require__(27)('species'); + + module.exports = function (KEY) { + var C = global[KEY]; + if (DESCRIPTORS && C && !C[SPECIES]) dP.f(C, SPECIES, { + configurable: true, + get: function () { return this; } + }); + }; + + +/***/ }), +/* 195 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var addToUnscopables = __webpack_require__(188); + var step = __webpack_require__(196); + var Iterators = __webpack_require__(130); + var toIObject = __webpack_require__(33); + + // 22.1.3.4 Array.prototype.entries() + // 22.1.3.13 Array.prototype.keys() + // 22.1.3.29 Array.prototype.values() + // 22.1.3.30 Array.prototype[@@iterator]() + module.exports = __webpack_require__(129)(Array, 'Array', function (iterated, kind) { + this._t = toIObject(iterated); // target + this._i = 0; // next index + this._k = kind; // kind + // 22.1.5.2.1 %ArrayIteratorPrototype%.next() + }, function () { + var O = this._t; + var kind = this._k; + var index = this._i++; + if (!O || index >= O.length) { + this._t = undefined; + return step(1); + } + if (kind == 'keys') return step(0, index); + if (kind == 'values') return step(0, O[index]); + return step(0, [index, O[index]]); + }, 'values'); + + // argumentsList[@@iterator] is %ArrayProto_values% (9.4.4.6, 9.4.4.7) + Iterators.Arguments = Iterators.Array; + + addToUnscopables('keys'); + addToUnscopables('values'); + addToUnscopables('entries'); + + +/***/ }), +/* 196 */ +/***/ (function(module, exports) { + + module.exports = function (done, value) { + return { value: value, done: !!done }; + }; + + +/***/ }), +/* 197 */ +/***/ (function(module, exports, __webpack_require__) { + + var global = __webpack_require__(4); + var inheritIfRequired = __webpack_require__(88); + var dP = __webpack_require__(11).f; + var gOPN = __webpack_require__(51).f; + var isRegExp = __webpack_require__(135); + var $flags = __webpack_require__(198); + var $RegExp = global.RegExp; + var Base = $RegExp; + var proto = $RegExp.prototype; + var re1 = /a/g; + var re2 = /a/g; + // "new" creates a new object, old webkit buggy here + var CORRECT_NEW = new $RegExp(re1) !== re1; + + if (__webpack_require__(6) && (!CORRECT_NEW || __webpack_require__(7)(function () { + re2[__webpack_require__(27)('match')] = false; + // RegExp constructor can alter flags and IsRegExp works correct with @@match + return $RegExp(re1) != re1 || $RegExp(re2) == re2 || $RegExp(re1, 'i') != '/a/i'; + }))) { + $RegExp = function RegExp(p, f) { + var tiRE = this instanceof $RegExp; + var piRE = isRegExp(p); + var fiU = f === undefined; + return !tiRE && piRE && p.constructor === $RegExp && fiU ? p + : inheritIfRequired(CORRECT_NEW + ? new Base(piRE && !fiU ? p.source : p, f) + : Base((piRE = p instanceof $RegExp) ? p.source : p, piRE && fiU ? $flags.call(p) : f) + , tiRE ? this : proto, $RegExp); + }; + var proxy = function (key) { + key in $RegExp || dP($RegExp, key, { + configurable: true, + get: function () { return Base[key]; }, + set: function (it) { Base[key] = it; } + }); + }; + for (var keys = gOPN(Base), i = 0; keys.length > i;) proxy(keys[i++]); + proto.constructor = $RegExp; + $RegExp.prototype = proto; + __webpack_require__(18)(global, 'RegExp', $RegExp); + } + + __webpack_require__(194)('RegExp'); + + +/***/ }), +/* 198 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 21.2.5.3 get RegExp.prototype.flags + var anObject = __webpack_require__(12); + module.exports = function () { + var that = anObject(this); + var result = ''; + if (that.global) result += 'g'; + if (that.ignoreCase) result += 'i'; + if (that.multiline) result += 'm'; + if (that.unicode) result += 'u'; + if (that.sticky) result += 'y'; + return result; + }; + + +/***/ }), +/* 199 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var regexpExec = __webpack_require__(200); + __webpack_require__(8)({ + target: 'RegExp', + proto: true, + forced: regexpExec !== /./.exec + }, { + exec: regexpExec + }); + + +/***/ }), +/* 200 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var regexpFlags = __webpack_require__(198); + + var nativeExec = RegExp.prototype.exec; + // This always refers to the native implementation, because the + // String#replace polyfill uses ./fix-regexp-well-known-symbol-logic.js, + // which loads this file before patching the method. + var nativeReplace = String.prototype.replace; + + var patchedExec = nativeExec; + + var LAST_INDEX = 'lastIndex'; + + var UPDATES_LAST_INDEX_WRONG = (function () { + var re1 = /a/, + re2 = /b*/g; + nativeExec.call(re1, 'a'); + nativeExec.call(re2, 'a'); + return re1[LAST_INDEX] !== 0 || re2[LAST_INDEX] !== 0; + })(); + + // nonparticipating capturing group, copied from es5-shim's String#split patch. + var NPCG_INCLUDED = /()??/.exec('')[1] !== undefined; + + var PATCH = UPDATES_LAST_INDEX_WRONG || NPCG_INCLUDED; + + if (PATCH) { + patchedExec = function exec(str) { + var re = this; + var lastIndex, reCopy, match, i; + + if (NPCG_INCLUDED) { + reCopy = new RegExp('^' + re.source + '$(?!\\s)', regexpFlags.call(re)); + } + if (UPDATES_LAST_INDEX_WRONG) lastIndex = re[LAST_INDEX]; + + match = nativeExec.call(re, str); + + if (UPDATES_LAST_INDEX_WRONG && match) { + re[LAST_INDEX] = re.global ? match.index + match[0].length : lastIndex; + } + if (NPCG_INCLUDED && match && match.length > 1) { + // Fix browsers whose `exec` methods don't consistently return `undefined` + // for NPCG, like IE8. NOTE: This doesn' work for /(.?)?/ + // eslint-disable-next-line no-loop-func + nativeReplace.call(match[0], reCopy, function () { + for (i = 1; i < arguments.length - 2; i++) { + if (arguments[i] === undefined) match[i] = undefined; + } + }); + } + + return match; + }; + } + + module.exports = patchedExec; + + +/***/ }), +/* 201 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + __webpack_require__(202); + var anObject = __webpack_require__(12); + var $flags = __webpack_require__(198); + var DESCRIPTORS = __webpack_require__(6); + var TO_STRING = 'toString'; + var $toString = /./[TO_STRING]; + + var define = function (fn) { + __webpack_require__(18)(RegExp.prototype, TO_STRING, fn, true); + }; + + // 21.2.5.14 RegExp.prototype.toString() + if (__webpack_require__(7)(function () { return $toString.call({ source: 'a', flags: 'b' }) != '/a/b'; })) { + define(function toString() { + var R = anObject(this); + return '/'.concat(R.source, '/', + 'flags' in R ? R.flags : !DESCRIPTORS && R instanceof RegExp ? $flags.call(R) : undefined); + }); + // FF44- RegExp#toString has a wrong name + } else if ($toString.name != TO_STRING) { + define(function toString() { + return $toString.call(this); + }); + } + + +/***/ }), +/* 202 */ +/***/ (function(module, exports, __webpack_require__) { + + // 21.2.5.3 get RegExp.prototype.flags() + if (__webpack_require__(6) && /./g.flags != 'g') __webpack_require__(11).f(RegExp.prototype, 'flags', { + configurable: true, + get: __webpack_require__(198) + }); + + +/***/ }), +/* 203 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var anObject = __webpack_require__(12); + var toLength = __webpack_require__(38); + var advanceStringIndex = __webpack_require__(204); + var regExpExec = __webpack_require__(205); + + // @@match logic + __webpack_require__(206)('match', 1, function (defined, MATCH, $match, maybeCallNative) { + return [ + // `String.prototype.match` method + // https://tc39.github.io/ecma262/#sec-string.prototype.match + function match(regexp) { + var O = defined(this); + var fn = regexp == undefined ? undefined : regexp[MATCH]; + return fn !== undefined ? fn.call(regexp, O) : new RegExp(regexp)[MATCH](String(O)); + }, + // `RegExp.prototype[@@match]` method + // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@match + function (regexp) { + var res = maybeCallNative($match, regexp, this); + if (res.done) return res.value; + var rx = anObject(regexp); + var S = String(this); + if (!rx.global) return regExpExec(rx, S); + var fullUnicode = rx.unicode; + rx.lastIndex = 0; + var A = []; + var n = 0; + var result; + while ((result = regExpExec(rx, S)) !== null) { + var matchStr = String(result[0]); + A[n] = matchStr; + if (matchStr === '') rx.lastIndex = advanceStringIndex(S, toLength(rx.lastIndex), fullUnicode); + n++; + } + return n === 0 ? null : A; + } + ]; + }); + + +/***/ }), +/* 204 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var at = __webpack_require__(128)(true); + + // `AdvanceStringIndex` abstract operation + // https://tc39.github.io/ecma262/#sec-advancestringindex + module.exports = function (S, index, unicode) { + return index + (unicode ? at(S, index).length : 1); + }; + + +/***/ }), +/* 205 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var classof = __webpack_require__(75); + var builtinExec = RegExp.prototype.exec; + + // `RegExpExec` abstract operation + // https://tc39.github.io/ecma262/#sec-regexpexec + module.exports = function (R, S) { + var exec = R.exec; + if (typeof exec === 'function') { + var result = exec.call(R, S); + if (typeof result !== 'object') { + throw new TypeError('RegExp exec method returned something other than an Object or null'); + } + return result; + } + if (classof(R) !== 'RegExp') { + throw new TypeError('RegExp#exec called on incompatible receiver'); + } + return builtinExec.call(R, S); + }; + + +/***/ }), +/* 206 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + __webpack_require__(199); + var redefine = __webpack_require__(18); + var hide = __webpack_require__(10); + var fails = __webpack_require__(7); + var defined = __webpack_require__(36); + var wks = __webpack_require__(27); + var regexpExec = __webpack_require__(200); + + var SPECIES = wks('species'); + + var REPLACE_SUPPORTS_NAMED_GROUPS = !fails(function () { + // #replace needs built-in support for named groups. + // #match works fine because it just return the exec results, even if it has + // a "grops" property. + var re = /./; + re.exec = function () { + var result = []; + result.groups = { a: '7' }; + return result; + }; + return ''.replace(re, '$') !== '7'; + }); + + var SPLIT_WORKS_WITH_OVERWRITTEN_EXEC = (function () { + // Chrome 51 has a buggy "split" implementation when RegExp#exec !== nativeExec + var re = /(?:)/; + var originalExec = re.exec; + re.exec = function () { return originalExec.apply(this, arguments); }; + var result = 'ab'.split(re); + return result.length === 2 && result[0] === 'a' && result[1] === 'b'; + })(); + + module.exports = function (KEY, length, exec) { + var SYMBOL = wks(KEY); + + var DELEGATES_TO_SYMBOL = !fails(function () { + // String methods call symbol-named RegEp methods + var O = {}; + O[SYMBOL] = function () { return 7; }; + return ''[KEY](O) != 7; + }); + + var DELEGATES_TO_EXEC = DELEGATES_TO_SYMBOL ? !fails(function () { + // Symbol-named RegExp methods call .exec + var execCalled = false; + var re = /a/; + re.exec = function () { execCalled = true; return null; }; + if (KEY === 'split') { + // RegExp[@@split] doesn't call the regex's exec method, but first creates + // a new one. We need to return the patched regex when creating the new one. + re.constructor = {}; + re.constructor[SPECIES] = function () { return re; }; + } + re[SYMBOL](''); + return !execCalled; + }) : undefined; + + if ( + !DELEGATES_TO_SYMBOL || + !DELEGATES_TO_EXEC || + (KEY === 'replace' && !REPLACE_SUPPORTS_NAMED_GROUPS) || + (KEY === 'split' && !SPLIT_WORKS_WITH_OVERWRITTEN_EXEC) + ) { + var nativeRegExpMethod = /./[SYMBOL]; + var fns = exec( + defined, + SYMBOL, + ''[KEY], + function maybeCallNative(nativeMethod, regexp, str, arg2, forceStringMethod) { + if (regexp.exec === regexpExec) { + if (DELEGATES_TO_SYMBOL && !forceStringMethod) { + // The native String method already delegates to @@method (this + // polyfilled function), leasing to infinite recursion. + // We avoid it by directly calling the native @@method method. + return { done: true, value: nativeRegExpMethod.call(regexp, str, arg2) }; + } + return { done: true, value: nativeMethod.call(str, regexp, arg2) }; + } + return { done: false }; + } + ); + var strfn = fns[0]; + var rxfn = fns[1]; + + redefine(String.prototype, KEY, strfn); + hide(RegExp.prototype, SYMBOL, length == 2 + // 21.2.5.8 RegExp.prototype[@@replace](string, replaceValue) + // 21.2.5.11 RegExp.prototype[@@split](string, limit) + ? function (string, arg) { return rxfn.call(string, this, arg); } + // 21.2.5.6 RegExp.prototype[@@match](string) + // 21.2.5.9 RegExp.prototype[@@search](string) + : function (string) { return rxfn.call(string, this); } + ); + } + }; + + +/***/ }), +/* 207 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var anObject = __webpack_require__(12); + var toObject = __webpack_require__(46); + var toLength = __webpack_require__(38); + var toInteger = __webpack_require__(39); + var advanceStringIndex = __webpack_require__(204); + var regExpExec = __webpack_require__(205); + var max = Math.max; + var min = Math.min; + var floor = Math.floor; + var SUBSTITUTION_SYMBOLS = /\$([$&`']|\d\d?|<[^>]*>)/g; + var SUBSTITUTION_SYMBOLS_NO_NAMED = /\$([$&`']|\d\d?)/g; + + var maybeToString = function (it) { + return it === undefined ? it : String(it); + }; + + // @@replace logic + __webpack_require__(206)('replace', 2, function (defined, REPLACE, $replace, maybeCallNative) { + return [ + // `String.prototype.replace` method + // https://tc39.github.io/ecma262/#sec-string.prototype.replace + function replace(searchValue, replaceValue) { + var O = defined(this); + var fn = searchValue == undefined ? undefined : searchValue[REPLACE]; + return fn !== undefined + ? fn.call(searchValue, O, replaceValue) + : $replace.call(String(O), searchValue, replaceValue); + }, + // `RegExp.prototype[@@replace]` method + // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@replace + function (regexp, replaceValue) { + var res = maybeCallNative($replace, regexp, this, replaceValue); + if (res.done) return res.value; + + var rx = anObject(regexp); + var S = String(this); + var functionalReplace = typeof replaceValue === 'function'; + if (!functionalReplace) replaceValue = String(replaceValue); + var global = rx.global; + if (global) { + var fullUnicode = rx.unicode; + rx.lastIndex = 0; + } + var results = []; + while (true) { + var result = regExpExec(rx, S); + if (result === null) break; + results.push(result); + if (!global) break; + var matchStr = String(result[0]); + if (matchStr === '') rx.lastIndex = advanceStringIndex(S, toLength(rx.lastIndex), fullUnicode); + } + var accumulatedResult = ''; + var nextSourcePosition = 0; + for (var i = 0; i < results.length; i++) { + result = results[i]; + var matched = String(result[0]); + var position = max(min(toInteger(result.index), S.length), 0); + var captures = []; + // NOTE: This is equivalent to + // captures = result.slice(1).map(maybeToString) + // but for some reason `nativeSlice.call(result, 1, result.length)` (called in + // the slice polyfill when slicing native arrays) "doesn't work" in safari 9 and + // causes a crash (https://pastebin.com/N21QzeQA) when trying to debug it. + for (var j = 1; j < result.length; j++) captures.push(maybeToString(result[j])); + var namedCaptures = result.groups; + if (functionalReplace) { + var replacerArgs = [matched].concat(captures, position, S); + if (namedCaptures !== undefined) replacerArgs.push(namedCaptures); + var replacement = String(replaceValue.apply(undefined, replacerArgs)); + } else { + replacement = getSubstitution(matched, S, position, captures, namedCaptures, replaceValue); + } + if (position >= nextSourcePosition) { + accumulatedResult += S.slice(nextSourcePosition, position) + replacement; + nextSourcePosition = position + matched.length; + } + } + return accumulatedResult + S.slice(nextSourcePosition); + } + ]; + + // https://tc39.github.io/ecma262/#sec-getsubstitution + function getSubstitution(matched, str, position, captures, namedCaptures, replacement) { + var tailPos = position + matched.length; + var m = captures.length; + var symbols = SUBSTITUTION_SYMBOLS_NO_NAMED; + if (namedCaptures !== undefined) { + namedCaptures = toObject(namedCaptures); + symbols = SUBSTITUTION_SYMBOLS; + } + return $replace.call(replacement, symbols, function (match, ch) { + var capture; + switch (ch.charAt(0)) { + case '$': return '$'; + case '&': return matched; + case '`': return str.slice(0, position); + case "'": return str.slice(tailPos); + case '<': + capture = namedCaptures[ch.slice(1, -1)]; + break; + default: // \d\d? + var n = +ch; + if (n === 0) return match; + if (n > m) { + var f = floor(n / 10); + if (f === 0) return match; + if (f <= m) return captures[f - 1] === undefined ? ch.charAt(1) : captures[f - 1] + ch.charAt(1); + return match; + } + capture = captures[n - 1]; + } + return capture === undefined ? '' : capture; + }); + } + }); + + +/***/ }), +/* 208 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var anObject = __webpack_require__(12); + var sameValue = __webpack_require__(71); + var regExpExec = __webpack_require__(205); + + // @@search logic + __webpack_require__(206)('search', 1, function (defined, SEARCH, $search, maybeCallNative) { + return [ + // `String.prototype.search` method + // https://tc39.github.io/ecma262/#sec-string.prototype.search + function search(regexp) { + var O = defined(this); + var fn = regexp == undefined ? undefined : regexp[SEARCH]; + return fn !== undefined ? fn.call(regexp, O) : new RegExp(regexp)[SEARCH](String(O)); + }, + // `RegExp.prototype[@@search]` method + // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@search + function (regexp) { + var res = maybeCallNative($search, regexp, this); + if (res.done) return res.value; + var rx = anObject(regexp); + var S = String(this); + var previousLastIndex = rx.lastIndex; + if (!sameValue(previousLastIndex, 0)) rx.lastIndex = 0; + var result = regExpExec(rx, S); + if (!sameValue(rx.lastIndex, previousLastIndex)) rx.lastIndex = previousLastIndex; + return result === null ? -1 : result.index; + } + ]; + }); + + +/***/ }), +/* 209 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var isRegExp = __webpack_require__(135); + var anObject = __webpack_require__(12); + var speciesConstructor = __webpack_require__(210); + var advanceStringIndex = __webpack_require__(204); + var toLength = __webpack_require__(38); + var callRegExpExec = __webpack_require__(205); + var regexpExec = __webpack_require__(200); + var fails = __webpack_require__(7); + var $min = Math.min; + var $push = [].push; + var $SPLIT = 'split'; + var LENGTH = 'length'; + var LAST_INDEX = 'lastIndex'; + var MAX_UINT32 = 0xffffffff; + + // babel-minify transpiles RegExp('x', 'y') -> /x/y and it causes SyntaxError + var SUPPORTS_Y = !fails(function () { RegExp(MAX_UINT32, 'y'); }); + + // @@split logic + __webpack_require__(206)('split', 2, function (defined, SPLIT, $split, maybeCallNative) { + var internalSplit; + if ( + 'abbc'[$SPLIT](/(b)*/)[1] == 'c' || + 'test'[$SPLIT](/(?:)/, -1)[LENGTH] != 4 || + 'ab'[$SPLIT](/(?:ab)*/)[LENGTH] != 2 || + '.'[$SPLIT](/(.?)(.?)/)[LENGTH] != 4 || + '.'[$SPLIT](/()()/)[LENGTH] > 1 || + ''[$SPLIT](/.?/)[LENGTH] + ) { + // based on es5-shim implementation, need to rework it + internalSplit = function (separator, limit) { + var string = String(this); + if (separator === undefined && limit === 0) return []; + // If `separator` is not a regex, use native split + if (!isRegExp(separator)) return $split.call(string, separator, limit); + var output = []; + var flags = (separator.ignoreCase ? 'i' : '') + + (separator.multiline ? 'm' : '') + + (separator.unicode ? 'u' : '') + + (separator.sticky ? 'y' : ''); + var lastLastIndex = 0; + var splitLimit = limit === undefined ? MAX_UINT32 : limit >>> 0; + // Make `global` and avoid `lastIndex` issues by working with a copy + var separatorCopy = new RegExp(separator.source, flags + 'g'); + var match, lastIndex, lastLength; + while (match = regexpExec.call(separatorCopy, string)) { + lastIndex = separatorCopy[LAST_INDEX]; + if (lastIndex > lastLastIndex) { + output.push(string.slice(lastLastIndex, match.index)); + if (match[LENGTH] > 1 && match.index < string[LENGTH]) $push.apply(output, match.slice(1)); + lastLength = match[0][LENGTH]; + lastLastIndex = lastIndex; + if (output[LENGTH] >= splitLimit) break; + } + if (separatorCopy[LAST_INDEX] === match.index) separatorCopy[LAST_INDEX]++; // Avoid an infinite loop + } + if (lastLastIndex === string[LENGTH]) { + if (lastLength || !separatorCopy.test('')) output.push(''); + } else output.push(string.slice(lastLastIndex)); + return output[LENGTH] > splitLimit ? output.slice(0, splitLimit) : output; + }; + // Chakra, V8 + } else if ('0'[$SPLIT](undefined, 0)[LENGTH]) { + internalSplit = function (separator, limit) { + return separator === undefined && limit === 0 ? [] : $split.call(this, separator, limit); + }; + } else { + internalSplit = $split; + } + + return [ + // `String.prototype.split` method + // https://tc39.github.io/ecma262/#sec-string.prototype.split + function split(separator, limit) { + var O = defined(this); + var splitter = separator == undefined ? undefined : separator[SPLIT]; + return splitter !== undefined + ? splitter.call(separator, O, limit) + : internalSplit.call(String(O), separator, limit); + }, + // `RegExp.prototype[@@split]` method + // https://tc39.github.io/ecma262/#sec-regexp.prototype-@@split + // + // NOTE: This cannot be properly polyfilled in engines that don't support + // the 'y' flag. + function (regexp, limit) { + var res = maybeCallNative(internalSplit, regexp, this, limit, internalSplit !== $split); + if (res.done) return res.value; + + var rx = anObject(regexp); + var S = String(this); + var C = speciesConstructor(rx, RegExp); + + var unicodeMatching = rx.unicode; + var flags = (rx.ignoreCase ? 'i' : '') + + (rx.multiline ? 'm' : '') + + (rx.unicode ? 'u' : '') + + (SUPPORTS_Y ? 'y' : 'g'); + + // ^(? + rx + ) is needed, in combination with some S slicing, to + // simulate the 'y' flag. + var splitter = new C(SUPPORTS_Y ? rx : '^(?:' + rx.source + ')', flags); + var lim = limit === undefined ? MAX_UINT32 : limit >>> 0; + if (lim === 0) return []; + if (S.length === 0) return callRegExpExec(splitter, S) === null ? [S] : []; + var p = 0; + var q = 0; + var A = []; + while (q < S.length) { + splitter.lastIndex = SUPPORTS_Y ? q : 0; + var z = callRegExpExec(splitter, SUPPORTS_Y ? S : S.slice(q)); + var e; + if ( + z === null || + (e = $min(toLength(splitter.lastIndex + (SUPPORTS_Y ? 0 : q)), S.length)) === p + ) { + q = advanceStringIndex(S, q, unicodeMatching); + } else { + A.push(S.slice(p, q)); + if (A.length === lim) return A; + for (var i = 1; i <= z.length - 1; i++) { + A.push(z[i]); + if (A.length === lim) return A; + } + q = p = e; + } + } + A.push(S.slice(p)); + return A; + } + ]; + }); + + +/***/ }), +/* 210 */ +/***/ (function(module, exports, __webpack_require__) { + + // 7.3.20 SpeciesConstructor(O, defaultConstructor) + var anObject = __webpack_require__(12); + var aFunction = __webpack_require__(24); + var SPECIES = __webpack_require__(27)('species'); + module.exports = function (O, D) { + var C = anObject(O).constructor; + var S; + return C === undefined || (S = anObject(C)[SPECIES]) == undefined ? D : aFunction(S); + }; + + +/***/ }), +/* 211 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var LIBRARY = __webpack_require__(22); + var global = __webpack_require__(4); + var ctx = __webpack_require__(23); + var classof = __webpack_require__(75); + var $export = __webpack_require__(8); + var isObject = __webpack_require__(13); + var aFunction = __webpack_require__(24); + var anInstance = __webpack_require__(212); + var forOf = __webpack_require__(213); + var speciesConstructor = __webpack_require__(210); + var task = __webpack_require__(214).set; + var microtask = __webpack_require__(215)(); + var newPromiseCapabilityModule = __webpack_require__(216); + var perform = __webpack_require__(217); + var userAgent = __webpack_require__(218); + var promiseResolve = __webpack_require__(219); + var PROMISE = 'Promise'; + var TypeError = global.TypeError; + var process = global.process; + var versions = process && process.versions; + var v8 = versions && versions.v8 || ''; + var $Promise = global[PROMISE]; + var isNode = classof(process) == 'process'; + var empty = function () { /* empty */ }; + var Internal, newGenericPromiseCapability, OwnPromiseCapability, Wrapper; + var newPromiseCapability = newGenericPromiseCapability = newPromiseCapabilityModule.f; + + var USE_NATIVE = !!function () { + try { + // correct subclassing with @@species support + var promise = $Promise.resolve(1); + var FakePromise = (promise.constructor = {})[__webpack_require__(27)('species')] = function (exec) { + exec(empty, empty); + }; + // unhandled rejections tracking support, NodeJS Promise without it fails @@species test + return (isNode || typeof PromiseRejectionEvent == 'function') + && promise.then(empty) instanceof FakePromise + // v8 6.6 (Node 10 and Chrome 66) have a bug with resolving custom thenables + // https://bugs.chromium.org/p/chromium/issues/detail?id=830565 + // we can't detect it synchronously, so just check versions + && v8.indexOf('6.6') !== 0 + && userAgent.indexOf('Chrome/66') === -1; + } catch (e) { /* empty */ } + }(); + + // helpers + var isThenable = function (it) { + var then; + return isObject(it) && typeof (then = it.then) == 'function' ? then : false; + }; + var notify = function (promise, isReject) { + if (promise._n) return; + promise._n = true; + var chain = promise._c; + microtask(function () { + var value = promise._v; + var ok = promise._s == 1; + var i = 0; + var run = function (reaction) { + var handler = ok ? reaction.ok : reaction.fail; + var resolve = reaction.resolve; + var reject = reaction.reject; + var domain = reaction.domain; + var result, then, exited; + try { + if (handler) { + if (!ok) { + if (promise._h == 2) onHandleUnhandled(promise); + promise._h = 1; + } + if (handler === true) result = value; + else { + if (domain) domain.enter(); + result = handler(value); // may throw + if (domain) { + domain.exit(); + exited = true; + } + } + if (result === reaction.promise) { + reject(TypeError('Promise-chain cycle')); + } else if (then = isThenable(result)) { + then.call(result, resolve, reject); + } else resolve(result); + } else reject(value); + } catch (e) { + if (domain && !exited) domain.exit(); + reject(e); + } + }; + while (chain.length > i) run(chain[i++]); // variable length - can't use forEach + promise._c = []; + promise._n = false; + if (isReject && !promise._h) onUnhandled(promise); + }); + }; + var onUnhandled = function (promise) { + task.call(global, function () { + var value = promise._v; + var unhandled = isUnhandled(promise); + var result, handler, console; + if (unhandled) { + result = perform(function () { + if (isNode) { + process.emit('unhandledRejection', value, promise); + } else if (handler = global.onunhandledrejection) { + handler({ promise: promise, reason: value }); + } else if ((console = global.console) && console.error) { + console.error('Unhandled promise rejection', value); + } + }); + // Browsers should not trigger `rejectionHandled` event if it was handled here, NodeJS - should + promise._h = isNode || isUnhandled(promise) ? 2 : 1; + } promise._a = undefined; + if (unhandled && result.e) throw result.v; + }); + }; + var isUnhandled = function (promise) { + return promise._h !== 1 && (promise._a || promise._c).length === 0; + }; + var onHandleUnhandled = function (promise) { + task.call(global, function () { + var handler; + if (isNode) { + process.emit('rejectionHandled', promise); + } else if (handler = global.onrejectionhandled) { + handler({ promise: promise, reason: promise._v }); + } + }); + }; + var $reject = function (value) { + var promise = this; + if (promise._d) return; + promise._d = true; + promise = promise._w || promise; // unwrap + promise._v = value; + promise._s = 2; + if (!promise._a) promise._a = promise._c.slice(); + notify(promise, true); + }; + var $resolve = function (value) { + var promise = this; + var then; + if (promise._d) return; + promise._d = true; + promise = promise._w || promise; // unwrap + try { + if (promise === value) throw TypeError("Promise can't be resolved itself"); + if (then = isThenable(value)) { + microtask(function () { + var wrapper = { _w: promise, _d: false }; // wrap + try { + then.call(value, ctx($resolve, wrapper, 1), ctx($reject, wrapper, 1)); + } catch (e) { + $reject.call(wrapper, e); + } + }); + } else { + promise._v = value; + promise._s = 1; + notify(promise, false); + } + } catch (e) { + $reject.call({ _w: promise, _d: false }, e); // wrap + } + }; + + // constructor polyfill + if (!USE_NATIVE) { + // 25.4.3.1 Promise(executor) + $Promise = function Promise(executor) { + anInstance(this, $Promise, PROMISE, '_h'); + aFunction(executor); + Internal.call(this); + try { + executor(ctx($resolve, this, 1), ctx($reject, this, 1)); + } catch (err) { + $reject.call(this, err); + } + }; + // eslint-disable-next-line no-unused-vars + Internal = function Promise(executor) { + this._c = []; // <- awaiting reactions + this._a = undefined; // <- checked in isUnhandled reactions + this._s = 0; // <- state + this._d = false; // <- done + this._v = undefined; // <- value + this._h = 0; // <- rejection state, 0 - default, 1 - handled, 2 - unhandled + this._n = false; // <- notify + }; + Internal.prototype = __webpack_require__(220)($Promise.prototype, { + // 25.4.5.3 Promise.prototype.then(onFulfilled, onRejected) + then: function then(onFulfilled, onRejected) { + var reaction = newPromiseCapability(speciesConstructor(this, $Promise)); + reaction.ok = typeof onFulfilled == 'function' ? onFulfilled : true; + reaction.fail = typeof onRejected == 'function' && onRejected; + reaction.domain = isNode ? process.domain : undefined; + this._c.push(reaction); + if (this._a) this._a.push(reaction); + if (this._s) notify(this, false); + return reaction.promise; + }, + // 25.4.5.1 Promise.prototype.catch(onRejected) + 'catch': function (onRejected) { + return this.then(undefined, onRejected); + } + }); + OwnPromiseCapability = function () { + var promise = new Internal(); + this.promise = promise; + this.resolve = ctx($resolve, promise, 1); + this.reject = ctx($reject, promise, 1); + }; + newPromiseCapabilityModule.f = newPromiseCapability = function (C) { + return C === $Promise || C === Wrapper + ? new OwnPromiseCapability(C) + : newGenericPromiseCapability(C); + }; + } + + $export($export.G + $export.W + $export.F * !USE_NATIVE, { Promise: $Promise }); + __webpack_require__(26)($Promise, PROMISE); + __webpack_require__(194)(PROMISE); + Wrapper = __webpack_require__(9)[PROMISE]; + + // statics + $export($export.S + $export.F * !USE_NATIVE, PROMISE, { + // 25.4.4.5 Promise.reject(r) + reject: function reject(r) { + var capability = newPromiseCapability(this); + var $$reject = capability.reject; + $$reject(r); + return capability.promise; + } + }); + $export($export.S + $export.F * (LIBRARY || !USE_NATIVE), PROMISE, { + // 25.4.4.6 Promise.resolve(x) + resolve: function resolve(x) { + return promiseResolve(LIBRARY && this === Wrapper ? $Promise : this, x); + } + }); + $export($export.S + $export.F * !(USE_NATIVE && __webpack_require__(167)(function (iter) { + $Promise.all(iter)['catch'](empty); + })), PROMISE, { + // 25.4.4.1 Promise.all(iterable) + all: function all(iterable) { + var C = this; + var capability = newPromiseCapability(C); + var resolve = capability.resolve; + var reject = capability.reject; + var result = perform(function () { + var values = []; + var index = 0; + var remaining = 1; + forOf(iterable, false, function (promise) { + var $index = index++; + var alreadyCalled = false; + values.push(undefined); + remaining++; + C.resolve(promise).then(function (value) { + if (alreadyCalled) return; + alreadyCalled = true; + values[$index] = value; + --remaining || resolve(values); + }, reject); + }); + --remaining || resolve(values); + }); + if (result.e) reject(result.v); + return capability.promise; + }, + // 25.4.4.4 Promise.race(iterable) + race: function race(iterable) { + var C = this; + var capability = newPromiseCapability(C); + var reject = capability.reject; + var result = perform(function () { + forOf(iterable, false, function (promise) { + C.resolve(promise).then(capability.resolve, reject); + }); + }); + if (result.e) reject(result.v); + return capability.promise; + } + }); + + +/***/ }), +/* 212 */ +/***/ (function(module, exports) { + + module.exports = function (it, Constructor, name, forbiddenField) { + if (!(it instanceof Constructor) || (forbiddenField !== undefined && forbiddenField in it)) { + throw TypeError(name + ': incorrect invocation!'); + } return it; + }; + + +/***/ }), +/* 213 */ +/***/ (function(module, exports, __webpack_require__) { + + var ctx = __webpack_require__(23); + var call = __webpack_require__(163); + var isArrayIter = __webpack_require__(164); + var anObject = __webpack_require__(12); + var toLength = __webpack_require__(38); + var getIterFn = __webpack_require__(166); + var BREAK = {}; + var RETURN = {}; + var exports = module.exports = function (iterable, entries, fn, that, ITERATOR) { + var iterFn = ITERATOR ? function () { return iterable; } : getIterFn(iterable); + var f = ctx(fn, that, entries ? 2 : 1); + var index = 0; + var length, step, iterator, result; + if (typeof iterFn != 'function') throw TypeError(iterable + ' is not iterable!'); + // fast case for arrays with default iterator + if (isArrayIter(iterFn)) for (length = toLength(iterable.length); length > index; index++) { + result = entries ? f(anObject(step = iterable[index])[0], step[1]) : f(iterable[index]); + if (result === BREAK || result === RETURN) return result; + } else for (iterator = iterFn.call(iterable); !(step = iterator.next()).done;) { + result = call(iterator, f, step.value, entries); + if (result === BREAK || result === RETURN) return result; + } + }; + exports.BREAK = BREAK; + exports.RETURN = RETURN; + + +/***/ }), +/* 214 */ +/***/ (function(module, exports, __webpack_require__) { + + var ctx = __webpack_require__(23); + var invoke = __webpack_require__(78); + var html = __webpack_require__(49); + var cel = __webpack_require__(15); + var global = __webpack_require__(4); + var process = global.process; + var setTask = global.setImmediate; + var clearTask = global.clearImmediate; + var MessageChannel = global.MessageChannel; + var Dispatch = global.Dispatch; + var counter = 0; + var queue = {}; + var ONREADYSTATECHANGE = 'onreadystatechange'; + var defer, channel, port; + var run = function () { + var id = +this; + // eslint-disable-next-line no-prototype-builtins + if (queue.hasOwnProperty(id)) { + var fn = queue[id]; + delete queue[id]; + fn(); + } + }; + var listener = function (event) { + run.call(event.data); + }; + // Node.js 0.9+ & IE10+ has setImmediate, otherwise: + if (!setTask || !clearTask) { + setTask = function setImmediate(fn) { + var args = []; + var i = 1; + while (arguments.length > i) args.push(arguments[i++]); + queue[++counter] = function () { + // eslint-disable-next-line no-new-func + invoke(typeof fn == 'function' ? fn : Function(fn), args); + }; + defer(counter); + return counter; + }; + clearTask = function clearImmediate(id) { + delete queue[id]; + }; + // Node.js 0.8- + if (__webpack_require__(35)(process) == 'process') { + defer = function (id) { + process.nextTick(ctx(run, id, 1)); + }; + // Sphere (JS game engine) Dispatch API + } else if (Dispatch && Dispatch.now) { + defer = function (id) { + Dispatch.now(ctx(run, id, 1)); + }; + // Browsers with MessageChannel, includes WebWorkers + } else if (MessageChannel) { + channel = new MessageChannel(); + port = channel.port2; + channel.port1.onmessage = listener; + defer = ctx(port.postMessage, port, 1); + // Browsers with postMessage, skip WebWorkers + // IE8 has postMessage, but it's sync & typeof its postMessage is 'object' + } else if (global.addEventListener && typeof postMessage == 'function' && !global.importScripts) { + defer = function (id) { + global.postMessage(id + '', '*'); + }; + global.addEventListener('message', listener, false); + // IE8- + } else if (ONREADYSTATECHANGE in cel('script')) { + defer = function (id) { + html.appendChild(cel('script'))[ONREADYSTATECHANGE] = function () { + html.removeChild(this); + run.call(id); + }; + }; + // Rest old browsers + } else { + defer = function (id) { + setTimeout(ctx(run, id, 1), 0); + }; + } + } + module.exports = { + set: setTask, + clear: clearTask + }; + + +/***/ }), +/* 215 */ +/***/ (function(module, exports, __webpack_require__) { + + var global = __webpack_require__(4); + var macrotask = __webpack_require__(214).set; + var Observer = global.MutationObserver || global.WebKitMutationObserver; + var process = global.process; + var Promise = global.Promise; + var isNode = __webpack_require__(35)(process) == 'process'; + + module.exports = function () { + var head, last, notify; + + var flush = function () { + var parent, fn; + if (isNode && (parent = process.domain)) parent.exit(); + while (head) { + fn = head.fn; + head = head.next; + try { + fn(); + } catch (e) { + if (head) notify(); + else last = undefined; + throw e; + } + } last = undefined; + if (parent) parent.enter(); + }; + + // Node.js + if (isNode) { + notify = function () { + process.nextTick(flush); + }; + // browsers with MutationObserver, except iOS Safari - https://github.com/zloirock/core-js/issues/339 + } else if (Observer && !(global.navigator && global.navigator.standalone)) { + var toggle = true; + var node = document.createTextNode(''); + new Observer(flush).observe(node, { characterData: true }); // eslint-disable-line no-new + notify = function () { + node.data = toggle = !toggle; + }; + // environments with maybe non-completely correct, but existent Promise + } else if (Promise && Promise.resolve) { + // Promise.resolve without an argument throws an error in LG WebOS 2 + var promise = Promise.resolve(undefined); + notify = function () { + promise.then(flush); + }; + // for other environments - macrotask based on: + // - setImmediate + // - MessageChannel + // - window.postMessag + // - onreadystatechange + // - setTimeout + } else { + notify = function () { + // strange IE + webpack dev server bug - use .call(global) + macrotask.call(global, flush); + }; + } + + return function (fn) { + var task = { fn: fn, next: undefined }; + if (last) last.next = task; + if (!head) { + head = task; + notify(); + } last = task; + }; + }; + + +/***/ }), +/* 216 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 25.4.1.5 NewPromiseCapability(C) + var aFunction = __webpack_require__(24); + + function PromiseCapability(C) { + var resolve, reject; + this.promise = new C(function ($$resolve, $$reject) { + if (resolve !== undefined || reject !== undefined) throw TypeError('Bad Promise constructor'); + resolve = $$resolve; + reject = $$reject; + }); + this.resolve = aFunction(resolve); + this.reject = aFunction(reject); + } + + module.exports.f = function (C) { + return new PromiseCapability(C); + }; + + +/***/ }), +/* 217 */ +/***/ (function(module, exports) { + + module.exports = function (exec) { + try { + return { e: false, v: exec() }; + } catch (e) { + return { e: true, v: e }; + } + }; + + +/***/ }), +/* 218 */ +/***/ (function(module, exports, __webpack_require__) { + + var global = __webpack_require__(4); + var navigator = global.navigator; + + module.exports = navigator && navigator.userAgent || ''; + + +/***/ }), +/* 219 */ +/***/ (function(module, exports, __webpack_require__) { + + var anObject = __webpack_require__(12); + var isObject = __webpack_require__(13); + var newPromiseCapability = __webpack_require__(216); + + module.exports = function (C, x) { + anObject(C); + if (isObject(x) && x.constructor === C) return x; + var promiseCapability = newPromiseCapability.f(C); + var resolve = promiseCapability.resolve; + resolve(x); + return promiseCapability.promise; + }; + + +/***/ }), +/* 220 */ +/***/ (function(module, exports, __webpack_require__) { + + var redefine = __webpack_require__(18); + module.exports = function (target, src, safe) { + for (var key in src) redefine(target, key, src[key], safe); + return target; + }; + + +/***/ }), +/* 221 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var strong = __webpack_require__(222); + var validate = __webpack_require__(223); + var MAP = 'Map'; + + // 23.1 Map Objects + module.exports = __webpack_require__(224)(MAP, function (get) { + return function Map() { return get(this, arguments.length > 0 ? arguments[0] : undefined); }; + }, { + // 23.1.3.6 Map.prototype.get(key) + get: function get(key) { + var entry = strong.getEntry(validate(this, MAP), key); + return entry && entry.v; + }, + // 23.1.3.9 Map.prototype.set(key, value) + set: function set(key, value) { + return strong.def(validate(this, MAP), key === 0 ? 0 : key, value); + } + }, strong, true); + + +/***/ }), +/* 222 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var dP = __webpack_require__(11).f; + var create = __webpack_require__(47); + var redefineAll = __webpack_require__(220); + var ctx = __webpack_require__(23); + var anInstance = __webpack_require__(212); + var forOf = __webpack_require__(213); + var $iterDefine = __webpack_require__(129); + var step = __webpack_require__(196); + var setSpecies = __webpack_require__(194); + var DESCRIPTORS = __webpack_require__(6); + var fastKey = __webpack_require__(25).fastKey; + var validate = __webpack_require__(223); + var SIZE = DESCRIPTORS ? '_s' : 'size'; + + var getEntry = function (that, key) { + // fast case + var index = fastKey(key); + var entry; + if (index !== 'F') return that._i[index]; + // frozen object case + for (entry = that._f; entry; entry = entry.n) { + if (entry.k == key) return entry; + } + }; + + module.exports = { + getConstructor: function (wrapper, NAME, IS_MAP, ADDER) { + var C = wrapper(function (that, iterable) { + anInstance(that, C, NAME, '_i'); + that._t = NAME; // collection type + that._i = create(null); // index + that._f = undefined; // first entry + that._l = undefined; // last entry + that[SIZE] = 0; // size + if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that); + }); + redefineAll(C.prototype, { + // 23.1.3.1 Map.prototype.clear() + // 23.2.3.2 Set.prototype.clear() + clear: function clear() { + for (var that = validate(this, NAME), data = that._i, entry = that._f; entry; entry = entry.n) { + entry.r = true; + if (entry.p) entry.p = entry.p.n = undefined; + delete data[entry.i]; + } + that._f = that._l = undefined; + that[SIZE] = 0; + }, + // 23.1.3.3 Map.prototype.delete(key) + // 23.2.3.4 Set.prototype.delete(value) + 'delete': function (key) { + var that = validate(this, NAME); + var entry = getEntry(that, key); + if (entry) { + var next = entry.n; + var prev = entry.p; + delete that._i[entry.i]; + entry.r = true; + if (prev) prev.n = next; + if (next) next.p = prev; + if (that._f == entry) that._f = next; + if (that._l == entry) that._l = prev; + that[SIZE]--; + } return !!entry; + }, + // 23.2.3.6 Set.prototype.forEach(callbackfn, thisArg = undefined) + // 23.1.3.5 Map.prototype.forEach(callbackfn, thisArg = undefined) + forEach: function forEach(callbackfn /* , that = undefined */) { + validate(this, NAME); + var f = ctx(callbackfn, arguments.length > 1 ? arguments[1] : undefined, 3); + var entry; + while (entry = entry ? entry.n : this._f) { + f(entry.v, entry.k, this); + // revert to the last existing entry + while (entry && entry.r) entry = entry.p; + } + }, + // 23.1.3.7 Map.prototype.has(key) + // 23.2.3.7 Set.prototype.has(value) + has: function has(key) { + return !!getEntry(validate(this, NAME), key); + } + }); + if (DESCRIPTORS) dP(C.prototype, 'size', { + get: function () { + return validate(this, NAME)[SIZE]; + } + }); + return C; + }, + def: function (that, key, value) { + var entry = getEntry(that, key); + var prev, index; + // change existing entry + if (entry) { + entry.v = value; + // create new entry + } else { + that._l = entry = { + i: index = fastKey(key, true), // <- index + k: key, // <- key + v: value, // <- value + p: prev = that._l, // <- previous entry + n: undefined, // <- next entry + r: false // <- removed + }; + if (!that._f) that._f = entry; + if (prev) prev.n = entry; + that[SIZE]++; + // add to index + if (index !== 'F') that._i[index] = entry; + } return that; + }, + getEntry: getEntry, + setStrong: function (C, NAME, IS_MAP) { + // add .keys, .values, .entries, [@@iterator] + // 23.1.3.4, 23.1.3.8, 23.1.3.11, 23.1.3.12, 23.2.3.5, 23.2.3.8, 23.2.3.10, 23.2.3.11 + $iterDefine(C, NAME, function (iterated, kind) { + this._t = validate(iterated, NAME); // target + this._k = kind; // kind + this._l = undefined; // previous + }, function () { + var that = this; + var kind = that._k; + var entry = that._l; + // revert to the last existing entry + while (entry && entry.r) entry = entry.p; + // get next entry + if (!that._t || !(that._l = entry = entry ? entry.n : that._t._f)) { + // or finish the iteration + that._t = undefined; + return step(1); + } + // return step by kind + if (kind == 'keys') return step(0, entry.k); + if (kind == 'values') return step(0, entry.v); + return step(0, [entry.k, entry.v]); + }, IS_MAP ? 'entries' : 'values', !IS_MAP, true); + + // add [@@species], 23.1.2.2, 23.2.2.2 + setSpecies(NAME); + } + }; + + +/***/ }), +/* 223 */ +/***/ (function(module, exports, __webpack_require__) { + + var isObject = __webpack_require__(13); + module.exports = function (it, TYPE) { + if (!isObject(it) || it._t !== TYPE) throw TypeError('Incompatible receiver, ' + TYPE + ' required!'); + return it; + }; + + +/***/ }), +/* 224 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var global = __webpack_require__(4); + var $export = __webpack_require__(8); + var redefine = __webpack_require__(18); + var redefineAll = __webpack_require__(220); + var meta = __webpack_require__(25); + var forOf = __webpack_require__(213); + var anInstance = __webpack_require__(212); + var isObject = __webpack_require__(13); + var fails = __webpack_require__(7); + var $iterDetect = __webpack_require__(167); + var setToStringTag = __webpack_require__(26); + var inheritIfRequired = __webpack_require__(88); + + module.exports = function (NAME, wrapper, methods, common, IS_MAP, IS_WEAK) { + var Base = global[NAME]; + var C = Base; + var ADDER = IS_MAP ? 'set' : 'add'; + var proto = C && C.prototype; + var O = {}; + var fixMethod = function (KEY) { + var fn = proto[KEY]; + redefine(proto, KEY, + KEY == 'delete' ? function (a) { + return IS_WEAK && !isObject(a) ? false : fn.call(this, a === 0 ? 0 : a); + } : KEY == 'has' ? function has(a) { + return IS_WEAK && !isObject(a) ? false : fn.call(this, a === 0 ? 0 : a); + } : KEY == 'get' ? function get(a) { + return IS_WEAK && !isObject(a) ? undefined : fn.call(this, a === 0 ? 0 : a); + } : KEY == 'add' ? function add(a) { fn.call(this, a === 0 ? 0 : a); return this; } + : function set(a, b) { fn.call(this, a === 0 ? 0 : a, b); return this; } + ); + }; + if (typeof C != 'function' || !(IS_WEAK || proto.forEach && !fails(function () { + new C().entries().next(); + }))) { + // create collection constructor + C = common.getConstructor(wrapper, NAME, IS_MAP, ADDER); + redefineAll(C.prototype, methods); + meta.NEED = true; + } else { + var instance = new C(); + // early implementations not supports chaining + var HASNT_CHAINING = instance[ADDER](IS_WEAK ? {} : -0, 1) != instance; + // V8 ~ Chromium 40- weak-collections throws on primitives, but should return false + var THROWS_ON_PRIMITIVES = fails(function () { instance.has(1); }); + // most early implementations doesn't supports iterables, most modern - not close it correctly + var ACCEPT_ITERABLES = $iterDetect(function (iter) { new C(iter); }); // eslint-disable-line no-new + // for early implementations -0 and +0 not the same + var BUGGY_ZERO = !IS_WEAK && fails(function () { + // V8 ~ Chromium 42- fails only with 5+ elements + var $instance = new C(); + var index = 5; + while (index--) $instance[ADDER](index, index); + return !$instance.has(-0); + }); + if (!ACCEPT_ITERABLES) { + C = wrapper(function (target, iterable) { + anInstance(target, C, NAME); + var that = inheritIfRequired(new Base(), target, C); + if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that); + return that; + }); + C.prototype = proto; + proto.constructor = C; + } + if (THROWS_ON_PRIMITIVES || BUGGY_ZERO) { + fixMethod('delete'); + fixMethod('has'); + IS_MAP && fixMethod('get'); + } + if (BUGGY_ZERO || HASNT_CHAINING) fixMethod(ADDER); + // weak collections should not contains .clear method + if (IS_WEAK && proto.clear) delete proto.clear; + } + + setToStringTag(C, NAME); + + O[NAME] = C; + $export($export.G + $export.W + $export.F * (C != Base), O); + + if (!IS_WEAK) common.setStrong(C, NAME, IS_MAP); + + return C; + }; + + +/***/ }), +/* 225 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var strong = __webpack_require__(222); + var validate = __webpack_require__(223); + var SET = 'Set'; + + // 23.2 Set Objects + module.exports = __webpack_require__(224)(SET, function (get) { + return function Set() { return get(this, arguments.length > 0 ? arguments[0] : undefined); }; + }, { + // 23.2.3.1 Set.prototype.add(value) + add: function add(value) { + return strong.def(validate(this, SET), value = value === 0 ? 0 : value, value); + } + }, strong); + + +/***/ }), +/* 226 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var global = __webpack_require__(4); + var each = __webpack_require__(174)(0); + var redefine = __webpack_require__(18); + var meta = __webpack_require__(25); + var assign = __webpack_require__(69); + var weak = __webpack_require__(227); + var isObject = __webpack_require__(13); + var validate = __webpack_require__(223); + var NATIVE_WEAK_MAP = __webpack_require__(223); + var IS_IE11 = !global.ActiveXObject && 'ActiveXObject' in global; + var WEAK_MAP = 'WeakMap'; + var getWeak = meta.getWeak; + var isExtensible = Object.isExtensible; + var uncaughtFrozenStore = weak.ufstore; + var InternalMap; + + var wrapper = function (get) { + return function WeakMap() { + return get(this, arguments.length > 0 ? arguments[0] : undefined); + }; + }; + + var methods = { + // 23.3.3.3 WeakMap.prototype.get(key) + get: function get(key) { + if (isObject(key)) { + var data = getWeak(key); + if (data === true) return uncaughtFrozenStore(validate(this, WEAK_MAP)).get(key); + return data ? data[this._i] : undefined; + } + }, + // 23.3.3.5 WeakMap.prototype.set(key, value) + set: function set(key, value) { + return weak.def(validate(this, WEAK_MAP), key, value); + } + }; + + // 23.3 WeakMap Objects + var $WeakMap = module.exports = __webpack_require__(224)(WEAK_MAP, wrapper, methods, weak, true, true); + + // IE11 WeakMap frozen keys fix + if (NATIVE_WEAK_MAP && IS_IE11) { + InternalMap = weak.getConstructor(wrapper, WEAK_MAP); + assign(InternalMap.prototype, methods); + meta.NEED = true; + each(['delete', 'has', 'get', 'set'], function (key) { + var proto = $WeakMap.prototype; + var method = proto[key]; + redefine(proto, key, function (a, b) { + // store frozen objects on internal weakmap shim + if (isObject(a) && !isExtensible(a)) { + if (!this._f) this._f = new InternalMap(); + var result = this._f[key](a, b); + return key == 'set' ? this : result; + // store all the rest on native weakmap + } return method.call(this, a, b); + }); + }); + } + + +/***/ }), +/* 227 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var redefineAll = __webpack_require__(220); + var getWeak = __webpack_require__(25).getWeak; + var anObject = __webpack_require__(12); + var isObject = __webpack_require__(13); + var anInstance = __webpack_require__(212); + var forOf = __webpack_require__(213); + var createArrayMethod = __webpack_require__(174); + var $has = __webpack_require__(5); + var validate = __webpack_require__(223); + var arrayFind = createArrayMethod(5); + var arrayFindIndex = createArrayMethod(6); + var id = 0; + + // fallback for uncaught frozen keys + var uncaughtFrozenStore = function (that) { + return that._l || (that._l = new UncaughtFrozenStore()); + }; + var UncaughtFrozenStore = function () { + this.a = []; + }; + var findUncaughtFrozen = function (store, key) { + return arrayFind(store.a, function (it) { + return it[0] === key; + }); + }; + UncaughtFrozenStore.prototype = { + get: function (key) { + var entry = findUncaughtFrozen(this, key); + if (entry) return entry[1]; + }, + has: function (key) { + return !!findUncaughtFrozen(this, key); + }, + set: function (key, value) { + var entry = findUncaughtFrozen(this, key); + if (entry) entry[1] = value; + else this.a.push([key, value]); + }, + 'delete': function (key) { + var index = arrayFindIndex(this.a, function (it) { + return it[0] === key; + }); + if (~index) this.a.splice(index, 1); + return !!~index; + } + }; + + module.exports = { + getConstructor: function (wrapper, NAME, IS_MAP, ADDER) { + var C = wrapper(function (that, iterable) { + anInstance(that, C, NAME, '_i'); + that._t = NAME; // collection type + that._i = id++; // collection id + that._l = undefined; // leak store for uncaught frozen objects + if (iterable != undefined) forOf(iterable, IS_MAP, that[ADDER], that); + }); + redefineAll(C.prototype, { + // 23.3.3.2 WeakMap.prototype.delete(key) + // 23.4.3.3 WeakSet.prototype.delete(value) + 'delete': function (key) { + if (!isObject(key)) return false; + var data = getWeak(key); + if (data === true) return uncaughtFrozenStore(validate(this, NAME))['delete'](key); + return data && $has(data, this._i) && delete data[this._i]; + }, + // 23.3.3.4 WeakMap.prototype.has(key) + // 23.4.3.4 WeakSet.prototype.has(value) + has: function has(key) { + if (!isObject(key)) return false; + var data = getWeak(key); + if (data === true) return uncaughtFrozenStore(validate(this, NAME)).has(key); + return data && $has(data, this._i); + } + }); + return C; + }, + def: function (that, key, value) { + var data = getWeak(anObject(key), true); + if (data === true) uncaughtFrozenStore(that).set(key, value); + else data[that._i] = value; + return that; + }, + ufstore: uncaughtFrozenStore + }; + + +/***/ }), +/* 228 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var weak = __webpack_require__(227); + var validate = __webpack_require__(223); + var WEAK_SET = 'WeakSet'; + + // 23.4 WeakSet Objects + __webpack_require__(224)(WEAK_SET, function (get) { + return function WeakSet() { return get(this, arguments.length > 0 ? arguments[0] : undefined); }; + }, { + // 23.4.3.1 WeakSet.prototype.add(value) + add: function add(value) { + return weak.def(validate(this, WEAK_SET), value, true); + } + }, weak, false, true); + + +/***/ }), +/* 229 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var $typed = __webpack_require__(230); + var buffer = __webpack_require__(231); + var anObject = __webpack_require__(12); + var toAbsoluteIndex = __webpack_require__(40); + var toLength = __webpack_require__(38); + var isObject = __webpack_require__(13); + var ArrayBuffer = __webpack_require__(4).ArrayBuffer; + var speciesConstructor = __webpack_require__(210); + var $ArrayBuffer = buffer.ArrayBuffer; + var $DataView = buffer.DataView; + var $isView = $typed.ABV && ArrayBuffer.isView; + var $slice = $ArrayBuffer.prototype.slice; + var VIEW = $typed.VIEW; + var ARRAY_BUFFER = 'ArrayBuffer'; + + $export($export.G + $export.W + $export.F * (ArrayBuffer !== $ArrayBuffer), { ArrayBuffer: $ArrayBuffer }); + + $export($export.S + $export.F * !$typed.CONSTR, ARRAY_BUFFER, { + // 24.1.3.1 ArrayBuffer.isView(arg) + isView: function isView(it) { + return $isView && $isView(it) || isObject(it) && VIEW in it; + } + }); + + $export($export.P + $export.U + $export.F * __webpack_require__(7)(function () { + return !new $ArrayBuffer(2).slice(1, undefined).byteLength; + }), ARRAY_BUFFER, { + // 24.1.4.3 ArrayBuffer.prototype.slice(start, end) + slice: function slice(start, end) { + if ($slice !== undefined && end === undefined) return $slice.call(anObject(this), start); // FF fix + var len = anObject(this).byteLength; + var first = toAbsoluteIndex(start, len); + var fin = toAbsoluteIndex(end === undefined ? len : end, len); + var result = new (speciesConstructor(this, $ArrayBuffer))(toLength(fin - first)); + var viewS = new $DataView(this); + var viewT = new $DataView(result); + var index = 0; + while (first < fin) { + viewT.setUint8(index++, viewS.getUint8(first++)); + } return result; + } + }); + + __webpack_require__(194)(ARRAY_BUFFER); + + +/***/ }), +/* 230 */ +/***/ (function(module, exports, __webpack_require__) { + + var global = __webpack_require__(4); + var hide = __webpack_require__(10); + var uid = __webpack_require__(19); + var TYPED = uid('typed_array'); + var VIEW = uid('view'); + var ABV = !!(global.ArrayBuffer && global.DataView); + var CONSTR = ABV; + var i = 0; + var l = 9; + var Typed; + + var TypedArrayConstructors = ( + 'Int8Array,Uint8Array,Uint8ClampedArray,Int16Array,Uint16Array,Int32Array,Uint32Array,Float32Array,Float64Array' + ).split(','); + + while (i < l) { + if (Typed = global[TypedArrayConstructors[i++]]) { + hide(Typed.prototype, TYPED, true); + hide(Typed.prototype, VIEW, true); + } else CONSTR = false; + } + + module.exports = { + ABV: ABV, + CONSTR: CONSTR, + TYPED: TYPED, + VIEW: VIEW + }; + + +/***/ }), +/* 231 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var global = __webpack_require__(4); + var DESCRIPTORS = __webpack_require__(6); + var LIBRARY = __webpack_require__(22); + var $typed = __webpack_require__(230); + var hide = __webpack_require__(10); + var redefineAll = __webpack_require__(220); + var fails = __webpack_require__(7); + var anInstance = __webpack_require__(212); + var toInteger = __webpack_require__(39); + var toLength = __webpack_require__(38); + var toIndex = __webpack_require__(232); + var gOPN = __webpack_require__(51).f; + var dP = __webpack_require__(11).f; + var arrayFill = __webpack_require__(190); + var setToStringTag = __webpack_require__(26); + var ARRAY_BUFFER = 'ArrayBuffer'; + var DATA_VIEW = 'DataView'; + var PROTOTYPE = 'prototype'; + var WRONG_LENGTH = 'Wrong length!'; + var WRONG_INDEX = 'Wrong index!'; + var $ArrayBuffer = global[ARRAY_BUFFER]; + var $DataView = global[DATA_VIEW]; + var Math = global.Math; + var RangeError = global.RangeError; + // eslint-disable-next-line no-shadow-restricted-names + var Infinity = global.Infinity; + var BaseBuffer = $ArrayBuffer; + var abs = Math.abs; + var pow = Math.pow; + var floor = Math.floor; + var log = Math.log; + var LN2 = Math.LN2; + var BUFFER = 'buffer'; + var BYTE_LENGTH = 'byteLength'; + var BYTE_OFFSET = 'byteOffset'; + var $BUFFER = DESCRIPTORS ? '_b' : BUFFER; + var $LENGTH = DESCRIPTORS ? '_l' : BYTE_LENGTH; + var $OFFSET = DESCRIPTORS ? '_o' : BYTE_OFFSET; + + // IEEE754 conversions based on https://github.com/feross/ieee754 + function packIEEE754(value, mLen, nBytes) { + var buffer = new Array(nBytes); + var eLen = nBytes * 8 - mLen - 1; + var eMax = (1 << eLen) - 1; + var eBias = eMax >> 1; + var rt = mLen === 23 ? pow(2, -24) - pow(2, -77) : 0; + var i = 0; + var s = value < 0 || value === 0 && 1 / value < 0 ? 1 : 0; + var e, m, c; + value = abs(value); + // eslint-disable-next-line no-self-compare + if (value != value || value === Infinity) { + // eslint-disable-next-line no-self-compare + m = value != value ? 1 : 0; + e = eMax; + } else { + e = floor(log(value) / LN2); + if (value * (c = pow(2, -e)) < 1) { + e--; + c *= 2; + } + if (e + eBias >= 1) { + value += rt / c; + } else { + value += rt * pow(2, 1 - eBias); + } + if (value * c >= 2) { + e++; + c /= 2; + } + if (e + eBias >= eMax) { + m = 0; + e = eMax; + } else if (e + eBias >= 1) { + m = (value * c - 1) * pow(2, mLen); + e = e + eBias; + } else { + m = value * pow(2, eBias - 1) * pow(2, mLen); + e = 0; + } + } + for (; mLen >= 8; buffer[i++] = m & 255, m /= 256, mLen -= 8); + e = e << mLen | m; + eLen += mLen; + for (; eLen > 0; buffer[i++] = e & 255, e /= 256, eLen -= 8); + buffer[--i] |= s * 128; + return buffer; + } + function unpackIEEE754(buffer, mLen, nBytes) { + var eLen = nBytes * 8 - mLen - 1; + var eMax = (1 << eLen) - 1; + var eBias = eMax >> 1; + var nBits = eLen - 7; + var i = nBytes - 1; + var s = buffer[i--]; + var e = s & 127; + var m; + s >>= 7; + for (; nBits > 0; e = e * 256 + buffer[i], i--, nBits -= 8); + m = e & (1 << -nBits) - 1; + e >>= -nBits; + nBits += mLen; + for (; nBits > 0; m = m * 256 + buffer[i], i--, nBits -= 8); + if (e === 0) { + e = 1 - eBias; + } else if (e === eMax) { + return m ? NaN : s ? -Infinity : Infinity; + } else { + m = m + pow(2, mLen); + e = e - eBias; + } return (s ? -1 : 1) * m * pow(2, e - mLen); + } + + function unpackI32(bytes) { + return bytes[3] << 24 | bytes[2] << 16 | bytes[1] << 8 | bytes[0]; + } + function packI8(it) { + return [it & 0xff]; + } + function packI16(it) { + return [it & 0xff, it >> 8 & 0xff]; + } + function packI32(it) { + return [it & 0xff, it >> 8 & 0xff, it >> 16 & 0xff, it >> 24 & 0xff]; + } + function packF64(it) { + return packIEEE754(it, 52, 8); + } + function packF32(it) { + return packIEEE754(it, 23, 4); + } + + function addGetter(C, key, internal) { + dP(C[PROTOTYPE], key, { get: function () { return this[internal]; } }); + } + + function get(view, bytes, index, isLittleEndian) { + var numIndex = +index; + var intIndex = toIndex(numIndex); + if (intIndex + bytes > view[$LENGTH]) throw RangeError(WRONG_INDEX); + var store = view[$BUFFER]._b; + var start = intIndex + view[$OFFSET]; + var pack = store.slice(start, start + bytes); + return isLittleEndian ? pack : pack.reverse(); + } + function set(view, bytes, index, conversion, value, isLittleEndian) { + var numIndex = +index; + var intIndex = toIndex(numIndex); + if (intIndex + bytes > view[$LENGTH]) throw RangeError(WRONG_INDEX); + var store = view[$BUFFER]._b; + var start = intIndex + view[$OFFSET]; + var pack = conversion(+value); + for (var i = 0; i < bytes; i++) store[start + i] = pack[isLittleEndian ? i : bytes - i - 1]; + } + + if (!$typed.ABV) { + $ArrayBuffer = function ArrayBuffer(length) { + anInstance(this, $ArrayBuffer, ARRAY_BUFFER); + var byteLength = toIndex(length); + this._b = arrayFill.call(new Array(byteLength), 0); + this[$LENGTH] = byteLength; + }; + + $DataView = function DataView(buffer, byteOffset, byteLength) { + anInstance(this, $DataView, DATA_VIEW); + anInstance(buffer, $ArrayBuffer, DATA_VIEW); + var bufferLength = buffer[$LENGTH]; + var offset = toInteger(byteOffset); + if (offset < 0 || offset > bufferLength) throw RangeError('Wrong offset!'); + byteLength = byteLength === undefined ? bufferLength - offset : toLength(byteLength); + if (offset + byteLength > bufferLength) throw RangeError(WRONG_LENGTH); + this[$BUFFER] = buffer; + this[$OFFSET] = offset; + this[$LENGTH] = byteLength; + }; + + if (DESCRIPTORS) { + addGetter($ArrayBuffer, BYTE_LENGTH, '_l'); + addGetter($DataView, BUFFER, '_b'); + addGetter($DataView, BYTE_LENGTH, '_l'); + addGetter($DataView, BYTE_OFFSET, '_o'); + } + + redefineAll($DataView[PROTOTYPE], { + getInt8: function getInt8(byteOffset) { + return get(this, 1, byteOffset)[0] << 24 >> 24; + }, + getUint8: function getUint8(byteOffset) { + return get(this, 1, byteOffset)[0]; + }, + getInt16: function getInt16(byteOffset /* , littleEndian */) { + var bytes = get(this, 2, byteOffset, arguments[1]); + return (bytes[1] << 8 | bytes[0]) << 16 >> 16; + }, + getUint16: function getUint16(byteOffset /* , littleEndian */) { + var bytes = get(this, 2, byteOffset, arguments[1]); + return bytes[1] << 8 | bytes[0]; + }, + getInt32: function getInt32(byteOffset /* , littleEndian */) { + return unpackI32(get(this, 4, byteOffset, arguments[1])); + }, + getUint32: function getUint32(byteOffset /* , littleEndian */) { + return unpackI32(get(this, 4, byteOffset, arguments[1])) >>> 0; + }, + getFloat32: function getFloat32(byteOffset /* , littleEndian */) { + return unpackIEEE754(get(this, 4, byteOffset, arguments[1]), 23, 4); + }, + getFloat64: function getFloat64(byteOffset /* , littleEndian */) { + return unpackIEEE754(get(this, 8, byteOffset, arguments[1]), 52, 8); + }, + setInt8: function setInt8(byteOffset, value) { + set(this, 1, byteOffset, packI8, value); + }, + setUint8: function setUint8(byteOffset, value) { + set(this, 1, byteOffset, packI8, value); + }, + setInt16: function setInt16(byteOffset, value /* , littleEndian */) { + set(this, 2, byteOffset, packI16, value, arguments[2]); + }, + setUint16: function setUint16(byteOffset, value /* , littleEndian */) { + set(this, 2, byteOffset, packI16, value, arguments[2]); + }, + setInt32: function setInt32(byteOffset, value /* , littleEndian */) { + set(this, 4, byteOffset, packI32, value, arguments[2]); + }, + setUint32: function setUint32(byteOffset, value /* , littleEndian */) { + set(this, 4, byteOffset, packI32, value, arguments[2]); + }, + setFloat32: function setFloat32(byteOffset, value /* , littleEndian */) { + set(this, 4, byteOffset, packF32, value, arguments[2]); + }, + setFloat64: function setFloat64(byteOffset, value /* , littleEndian */) { + set(this, 8, byteOffset, packF64, value, arguments[2]); + } + }); + } else { + if (!fails(function () { + $ArrayBuffer(1); + }) || !fails(function () { + new $ArrayBuffer(-1); // eslint-disable-line no-new + }) || fails(function () { + new $ArrayBuffer(); // eslint-disable-line no-new + new $ArrayBuffer(1.5); // eslint-disable-line no-new + new $ArrayBuffer(NaN); // eslint-disable-line no-new + return $ArrayBuffer.name != ARRAY_BUFFER; + })) { + $ArrayBuffer = function ArrayBuffer(length) { + anInstance(this, $ArrayBuffer); + return new BaseBuffer(toIndex(length)); + }; + var ArrayBufferProto = $ArrayBuffer[PROTOTYPE] = BaseBuffer[PROTOTYPE]; + for (var keys = gOPN(BaseBuffer), j = 0, key; keys.length > j;) { + if (!((key = keys[j++]) in $ArrayBuffer)) hide($ArrayBuffer, key, BaseBuffer[key]); + } + if (!LIBRARY) ArrayBufferProto.constructor = $ArrayBuffer; + } + // iOS Safari 7.x bug + var view = new $DataView(new $ArrayBuffer(2)); + var $setInt8 = $DataView[PROTOTYPE].setInt8; + view.setInt8(0, 2147483648); + view.setInt8(1, 2147483649); + if (view.getInt8(0) || !view.getInt8(1)) redefineAll($DataView[PROTOTYPE], { + setInt8: function setInt8(byteOffset, value) { + $setInt8.call(this, byteOffset, value << 24 >> 24); + }, + setUint8: function setUint8(byteOffset, value) { + $setInt8.call(this, byteOffset, value << 24 >> 24); + } + }, true); + } + setToStringTag($ArrayBuffer, ARRAY_BUFFER); + setToStringTag($DataView, DATA_VIEW); + hide($DataView[PROTOTYPE], $typed.VIEW, true); + exports[ARRAY_BUFFER] = $ArrayBuffer; + exports[DATA_VIEW] = $DataView; + + +/***/ }), +/* 232 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/ecma262/#sec-toindex + var toInteger = __webpack_require__(39); + var toLength = __webpack_require__(38); + module.exports = function (it) { + if (it === undefined) return 0; + var number = toInteger(it); + var length = toLength(number); + if (number !== length) throw RangeError('Wrong length!'); + return length; + }; + + +/***/ }), +/* 233 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + $export($export.G + $export.W + $export.F * !__webpack_require__(230).ABV, { + DataView: __webpack_require__(231).DataView + }); + + +/***/ }), +/* 234 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Int8', 1, function (init) { + return function Int8Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 235 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + if (__webpack_require__(6)) { + var LIBRARY = __webpack_require__(22); + var global = __webpack_require__(4); + var fails = __webpack_require__(7); + var $export = __webpack_require__(8); + var $typed = __webpack_require__(230); + var $buffer = __webpack_require__(231); + var ctx = __webpack_require__(23); + var anInstance = __webpack_require__(212); + var propertyDesc = __webpack_require__(17); + var hide = __webpack_require__(10); + var redefineAll = __webpack_require__(220); + var toInteger = __webpack_require__(39); + var toLength = __webpack_require__(38); + var toIndex = __webpack_require__(232); + var toAbsoluteIndex = __webpack_require__(40); + var toPrimitive = __webpack_require__(16); + var has = __webpack_require__(5); + var classof = __webpack_require__(75); + var isObject = __webpack_require__(13); + var toObject = __webpack_require__(46); + var isArrayIter = __webpack_require__(164); + var create = __webpack_require__(47); + var getPrototypeOf = __webpack_require__(59); + var gOPN = __webpack_require__(51).f; + var getIterFn = __webpack_require__(166); + var uid = __webpack_require__(19); + var wks = __webpack_require__(27); + var createArrayMethod = __webpack_require__(174); + var createArrayIncludes = __webpack_require__(37); + var speciesConstructor = __webpack_require__(210); + var ArrayIterators = __webpack_require__(195); + var Iterators = __webpack_require__(130); + var $iterDetect = __webpack_require__(167); + var setSpecies = __webpack_require__(194); + var arrayFill = __webpack_require__(190); + var arrayCopyWithin = __webpack_require__(187); + var $DP = __webpack_require__(11); + var $GOPD = __webpack_require__(52); + var dP = $DP.f; + var gOPD = $GOPD.f; + var RangeError = global.RangeError; + var TypeError = global.TypeError; + var Uint8Array = global.Uint8Array; + var ARRAY_BUFFER = 'ArrayBuffer'; + var SHARED_BUFFER = 'Shared' + ARRAY_BUFFER; + var BYTES_PER_ELEMENT = 'BYTES_PER_ELEMENT'; + var PROTOTYPE = 'prototype'; + var ArrayProto = Array[PROTOTYPE]; + var $ArrayBuffer = $buffer.ArrayBuffer; + var $DataView = $buffer.DataView; + var arrayForEach = createArrayMethod(0); + var arrayFilter = createArrayMethod(2); + var arraySome = createArrayMethod(3); + var arrayEvery = createArrayMethod(4); + var arrayFind = createArrayMethod(5); + var arrayFindIndex = createArrayMethod(6); + var arrayIncludes = createArrayIncludes(true); + var arrayIndexOf = createArrayIncludes(false); + var arrayValues = ArrayIterators.values; + var arrayKeys = ArrayIterators.keys; + var arrayEntries = ArrayIterators.entries; + var arrayLastIndexOf = ArrayProto.lastIndexOf; + var arrayReduce = ArrayProto.reduce; + var arrayReduceRight = ArrayProto.reduceRight; + var arrayJoin = ArrayProto.join; + var arraySort = ArrayProto.sort; + var arraySlice = ArrayProto.slice; + var arrayToString = ArrayProto.toString; + var arrayToLocaleString = ArrayProto.toLocaleString; + var ITERATOR = wks('iterator'); + var TAG = wks('toStringTag'); + var TYPED_CONSTRUCTOR = uid('typed_constructor'); + var DEF_CONSTRUCTOR = uid('def_constructor'); + var ALL_CONSTRUCTORS = $typed.CONSTR; + var TYPED_ARRAY = $typed.TYPED; + var VIEW = $typed.VIEW; + var WRONG_LENGTH = 'Wrong length!'; + + var $map = createArrayMethod(1, function (O, length) { + return allocate(speciesConstructor(O, O[DEF_CONSTRUCTOR]), length); + }); + + var LITTLE_ENDIAN = fails(function () { + // eslint-disable-next-line no-undef + return new Uint8Array(new Uint16Array([1]).buffer)[0] === 1; + }); + + var FORCED_SET = !!Uint8Array && !!Uint8Array[PROTOTYPE].set && fails(function () { + new Uint8Array(1).set({}); + }); + + var toOffset = function (it, BYTES) { + var offset = toInteger(it); + if (offset < 0 || offset % BYTES) throw RangeError('Wrong offset!'); + return offset; + }; + + var validate = function (it) { + if (isObject(it) && TYPED_ARRAY in it) return it; + throw TypeError(it + ' is not a typed array!'); + }; + + var allocate = function (C, length) { + if (!(isObject(C) && TYPED_CONSTRUCTOR in C)) { + throw TypeError('It is not a typed array constructor!'); + } return new C(length); + }; + + var speciesFromList = function (O, list) { + return fromList(speciesConstructor(O, O[DEF_CONSTRUCTOR]), list); + }; + + var fromList = function (C, list) { + var index = 0; + var length = list.length; + var result = allocate(C, length); + while (length > index) result[index] = list[index++]; + return result; + }; + + var addGetter = function (it, key, internal) { + dP(it, key, { get: function () { return this._d[internal]; } }); + }; + + var $from = function from(source /* , mapfn, thisArg */) { + var O = toObject(source); + var aLen = arguments.length; + var mapfn = aLen > 1 ? arguments[1] : undefined; + var mapping = mapfn !== undefined; + var iterFn = getIterFn(O); + var i, length, values, result, step, iterator; + if (iterFn != undefined && !isArrayIter(iterFn)) { + for (iterator = iterFn.call(O), values = [], i = 0; !(step = iterator.next()).done; i++) { + values.push(step.value); + } O = values; + } + if (mapping && aLen > 2) mapfn = ctx(mapfn, arguments[2], 2); + for (i = 0, length = toLength(O.length), result = allocate(this, length); length > i; i++) { + result[i] = mapping ? mapfn(O[i], i) : O[i]; + } + return result; + }; + + var $of = function of(/* ...items */) { + var index = 0; + var length = arguments.length; + var result = allocate(this, length); + while (length > index) result[index] = arguments[index++]; + return result; + }; + + // iOS Safari 6.x fails here + var TO_LOCALE_BUG = !!Uint8Array && fails(function () { arrayToLocaleString.call(new Uint8Array(1)); }); + + var $toLocaleString = function toLocaleString() { + return arrayToLocaleString.apply(TO_LOCALE_BUG ? arraySlice.call(validate(this)) : validate(this), arguments); + }; + + var proto = { + copyWithin: function copyWithin(target, start /* , end */) { + return arrayCopyWithin.call(validate(this), target, start, arguments.length > 2 ? arguments[2] : undefined); + }, + every: function every(callbackfn /* , thisArg */) { + return arrayEvery(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined); + }, + fill: function fill(value /* , start, end */) { // eslint-disable-line no-unused-vars + return arrayFill.apply(validate(this), arguments); + }, + filter: function filter(callbackfn /* , thisArg */) { + return speciesFromList(this, arrayFilter(validate(this), callbackfn, + arguments.length > 1 ? arguments[1] : undefined)); + }, + find: function find(predicate /* , thisArg */) { + return arrayFind(validate(this), predicate, arguments.length > 1 ? arguments[1] : undefined); + }, + findIndex: function findIndex(predicate /* , thisArg */) { + return arrayFindIndex(validate(this), predicate, arguments.length > 1 ? arguments[1] : undefined); + }, + forEach: function forEach(callbackfn /* , thisArg */) { + arrayForEach(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined); + }, + indexOf: function indexOf(searchElement /* , fromIndex */) { + return arrayIndexOf(validate(this), searchElement, arguments.length > 1 ? arguments[1] : undefined); + }, + includes: function includes(searchElement /* , fromIndex */) { + return arrayIncludes(validate(this), searchElement, arguments.length > 1 ? arguments[1] : undefined); + }, + join: function join(separator) { // eslint-disable-line no-unused-vars + return arrayJoin.apply(validate(this), arguments); + }, + lastIndexOf: function lastIndexOf(searchElement /* , fromIndex */) { // eslint-disable-line no-unused-vars + return arrayLastIndexOf.apply(validate(this), arguments); + }, + map: function map(mapfn /* , thisArg */) { + return $map(validate(this), mapfn, arguments.length > 1 ? arguments[1] : undefined); + }, + reduce: function reduce(callbackfn /* , initialValue */) { // eslint-disable-line no-unused-vars + return arrayReduce.apply(validate(this), arguments); + }, + reduceRight: function reduceRight(callbackfn /* , initialValue */) { // eslint-disable-line no-unused-vars + return arrayReduceRight.apply(validate(this), arguments); + }, + reverse: function reverse() { + var that = this; + var length = validate(that).length; + var middle = Math.floor(length / 2); + var index = 0; + var value; + while (index < middle) { + value = that[index]; + that[index++] = that[--length]; + that[length] = value; + } return that; + }, + some: function some(callbackfn /* , thisArg */) { + return arraySome(validate(this), callbackfn, arguments.length > 1 ? arguments[1] : undefined); + }, + sort: function sort(comparefn) { + return arraySort.call(validate(this), comparefn); + }, + subarray: function subarray(begin, end) { + var O = validate(this); + var length = O.length; + var $begin = toAbsoluteIndex(begin, length); + return new (speciesConstructor(O, O[DEF_CONSTRUCTOR]))( + O.buffer, + O.byteOffset + $begin * O.BYTES_PER_ELEMENT, + toLength((end === undefined ? length : toAbsoluteIndex(end, length)) - $begin) + ); + } + }; + + var $slice = function slice(start, end) { + return speciesFromList(this, arraySlice.call(validate(this), start, end)); + }; + + var $set = function set(arrayLike /* , offset */) { + validate(this); + var offset = toOffset(arguments[1], 1); + var length = this.length; + var src = toObject(arrayLike); + var len = toLength(src.length); + var index = 0; + if (len + offset > length) throw RangeError(WRONG_LENGTH); + while (index < len) this[offset + index] = src[index++]; + }; + + var $iterators = { + entries: function entries() { + return arrayEntries.call(validate(this)); + }, + keys: function keys() { + return arrayKeys.call(validate(this)); + }, + values: function values() { + return arrayValues.call(validate(this)); + } + }; + + var isTAIndex = function (target, key) { + return isObject(target) + && target[TYPED_ARRAY] + && typeof key != 'symbol' + && key in target + && String(+key) == String(key); + }; + var $getDesc = function getOwnPropertyDescriptor(target, key) { + return isTAIndex(target, key = toPrimitive(key, true)) + ? propertyDesc(2, target[key]) + : gOPD(target, key); + }; + var $setDesc = function defineProperty(target, key, desc) { + if (isTAIndex(target, key = toPrimitive(key, true)) + && isObject(desc) + && has(desc, 'value') + && !has(desc, 'get') + && !has(desc, 'set') + // TODO: add validation descriptor w/o calling accessors + && !desc.configurable + && (!has(desc, 'writable') || desc.writable) + && (!has(desc, 'enumerable') || desc.enumerable) + ) { + target[key] = desc.value; + return target; + } return dP(target, key, desc); + }; + + if (!ALL_CONSTRUCTORS) { + $GOPD.f = $getDesc; + $DP.f = $setDesc; + } + + $export($export.S + $export.F * !ALL_CONSTRUCTORS, 'Object', { + getOwnPropertyDescriptor: $getDesc, + defineProperty: $setDesc + }); + + if (fails(function () { arrayToString.call({}); })) { + arrayToString = arrayToLocaleString = function toString() { + return arrayJoin.call(this); + }; + } + + var $TypedArrayPrototype$ = redefineAll({}, proto); + redefineAll($TypedArrayPrototype$, $iterators); + hide($TypedArrayPrototype$, ITERATOR, $iterators.values); + redefineAll($TypedArrayPrototype$, { + slice: $slice, + set: $set, + constructor: function () { /* noop */ }, + toString: arrayToString, + toLocaleString: $toLocaleString + }); + addGetter($TypedArrayPrototype$, 'buffer', 'b'); + addGetter($TypedArrayPrototype$, 'byteOffset', 'o'); + addGetter($TypedArrayPrototype$, 'byteLength', 'l'); + addGetter($TypedArrayPrototype$, 'length', 'e'); + dP($TypedArrayPrototype$, TAG, { + get: function () { return this[TYPED_ARRAY]; } + }); + + // eslint-disable-next-line max-statements + module.exports = function (KEY, BYTES, wrapper, CLAMPED) { + CLAMPED = !!CLAMPED; + var NAME = KEY + (CLAMPED ? 'Clamped' : '') + 'Array'; + var GETTER = 'get' + KEY; + var SETTER = 'set' + KEY; + var TypedArray = global[NAME]; + var Base = TypedArray || {}; + var TAC = TypedArray && getPrototypeOf(TypedArray); + var FORCED = !TypedArray || !$typed.ABV; + var O = {}; + var TypedArrayPrototype = TypedArray && TypedArray[PROTOTYPE]; + var getter = function (that, index) { + var data = that._d; + return data.v[GETTER](index * BYTES + data.o, LITTLE_ENDIAN); + }; + var setter = function (that, index, value) { + var data = that._d; + if (CLAMPED) value = (value = Math.round(value)) < 0 ? 0 : value > 0xff ? 0xff : value & 0xff; + data.v[SETTER](index * BYTES + data.o, value, LITTLE_ENDIAN); + }; + var addElement = function (that, index) { + dP(that, index, { + get: function () { + return getter(this, index); + }, + set: function (value) { + return setter(this, index, value); + }, + enumerable: true + }); + }; + if (FORCED) { + TypedArray = wrapper(function (that, data, $offset, $length) { + anInstance(that, TypedArray, NAME, '_d'); + var index = 0; + var offset = 0; + var buffer, byteLength, length, klass; + if (!isObject(data)) { + length = toIndex(data); + byteLength = length * BYTES; + buffer = new $ArrayBuffer(byteLength); + } else if (data instanceof $ArrayBuffer || (klass = classof(data)) == ARRAY_BUFFER || klass == SHARED_BUFFER) { + buffer = data; + offset = toOffset($offset, BYTES); + var $len = data.byteLength; + if ($length === undefined) { + if ($len % BYTES) throw RangeError(WRONG_LENGTH); + byteLength = $len - offset; + if (byteLength < 0) throw RangeError(WRONG_LENGTH); + } else { + byteLength = toLength($length) * BYTES; + if (byteLength + offset > $len) throw RangeError(WRONG_LENGTH); + } + length = byteLength / BYTES; + } else if (TYPED_ARRAY in data) { + return fromList(TypedArray, data); + } else { + return $from.call(TypedArray, data); + } + hide(that, '_d', { + b: buffer, + o: offset, + l: byteLength, + e: length, + v: new $DataView(buffer) + }); + while (index < length) addElement(that, index++); + }); + TypedArrayPrototype = TypedArray[PROTOTYPE] = create($TypedArrayPrototype$); + hide(TypedArrayPrototype, 'constructor', TypedArray); + } else if (!fails(function () { + TypedArray(1); + }) || !fails(function () { + new TypedArray(-1); // eslint-disable-line no-new + }) || !$iterDetect(function (iter) { + new TypedArray(); // eslint-disable-line no-new + new TypedArray(null); // eslint-disable-line no-new + new TypedArray(1.5); // eslint-disable-line no-new + new TypedArray(iter); // eslint-disable-line no-new + }, true)) { + TypedArray = wrapper(function (that, data, $offset, $length) { + anInstance(that, TypedArray, NAME); + var klass; + // `ws` module bug, temporarily remove validation length for Uint8Array + // https://github.com/websockets/ws/pull/645 + if (!isObject(data)) return new Base(toIndex(data)); + if (data instanceof $ArrayBuffer || (klass = classof(data)) == ARRAY_BUFFER || klass == SHARED_BUFFER) { + return $length !== undefined + ? new Base(data, toOffset($offset, BYTES), $length) + : $offset !== undefined + ? new Base(data, toOffset($offset, BYTES)) + : new Base(data); + } + if (TYPED_ARRAY in data) return fromList(TypedArray, data); + return $from.call(TypedArray, data); + }); + arrayForEach(TAC !== Function.prototype ? gOPN(Base).concat(gOPN(TAC)) : gOPN(Base), function (key) { + if (!(key in TypedArray)) hide(TypedArray, key, Base[key]); + }); + TypedArray[PROTOTYPE] = TypedArrayPrototype; + if (!LIBRARY) TypedArrayPrototype.constructor = TypedArray; + } + var $nativeIterator = TypedArrayPrototype[ITERATOR]; + var CORRECT_ITER_NAME = !!$nativeIterator + && ($nativeIterator.name == 'values' || $nativeIterator.name == undefined); + var $iterator = $iterators.values; + hide(TypedArray, TYPED_CONSTRUCTOR, true); + hide(TypedArrayPrototype, TYPED_ARRAY, NAME); + hide(TypedArrayPrototype, VIEW, true); + hide(TypedArrayPrototype, DEF_CONSTRUCTOR, TypedArray); + + if (CLAMPED ? new TypedArray(1)[TAG] != NAME : !(TAG in TypedArrayPrototype)) { + dP(TypedArrayPrototype, TAG, { + get: function () { return NAME; } + }); + } + + O[NAME] = TypedArray; + + $export($export.G + $export.W + $export.F * (TypedArray != Base), O); + + $export($export.S, NAME, { + BYTES_PER_ELEMENT: BYTES + }); + + $export($export.S + $export.F * fails(function () { Base.of.call(TypedArray, 1); }), NAME, { + from: $from, + of: $of + }); + + if (!(BYTES_PER_ELEMENT in TypedArrayPrototype)) hide(TypedArrayPrototype, BYTES_PER_ELEMENT, BYTES); + + $export($export.P, NAME, proto); + + setSpecies(NAME); + + $export($export.P + $export.F * FORCED_SET, NAME, { set: $set }); + + $export($export.P + $export.F * !CORRECT_ITER_NAME, NAME, $iterators); + + if (!LIBRARY && TypedArrayPrototype.toString != arrayToString) TypedArrayPrototype.toString = arrayToString; + + $export($export.P + $export.F * fails(function () { + new TypedArray(1).slice(); + }), NAME, { slice: $slice }); + + $export($export.P + $export.F * (fails(function () { + return [1, 2].toLocaleString() != new TypedArray([1, 2]).toLocaleString(); + }) || !fails(function () { + TypedArrayPrototype.toLocaleString.call([1, 2]); + })), NAME, { toLocaleString: $toLocaleString }); + + Iterators[NAME] = CORRECT_ITER_NAME ? $nativeIterator : $iterator; + if (!LIBRARY && !CORRECT_ITER_NAME) hide(TypedArrayPrototype, ITERATOR, $iterator); + }; + } else module.exports = function () { /* empty */ }; + + +/***/ }), +/* 236 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Uint8', 1, function (init) { + return function Uint8Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 237 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Uint8', 1, function (init) { + return function Uint8ClampedArray(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }, true); + + +/***/ }), +/* 238 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Int16', 2, function (init) { + return function Int16Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 239 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Uint16', 2, function (init) { + return function Uint16Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 240 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Int32', 4, function (init) { + return function Int32Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 241 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Uint32', 4, function (init) { + return function Uint32Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 242 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Float32', 4, function (init) { + return function Float32Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 243 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(235)('Float64', 8, function (init) { + return function Float64Array(data, byteOffset, length) { + return init(this, data, byteOffset, length); + }; + }); + + +/***/ }), +/* 244 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.1 Reflect.apply(target, thisArgument, argumentsList) + var $export = __webpack_require__(8); + var aFunction = __webpack_require__(24); + var anObject = __webpack_require__(12); + var rApply = (__webpack_require__(4).Reflect || {}).apply; + var fApply = Function.apply; + // MS Edge argumentsList argument is optional + $export($export.S + $export.F * !__webpack_require__(7)(function () { + rApply(function () { /* empty */ }); + }), 'Reflect', { + apply: function apply(target, thisArgument, argumentsList) { + var T = aFunction(target); + var L = anObject(argumentsList); + return rApply ? rApply(T, thisArgument, L) : fApply.call(T, thisArgument, L); + } + }); + + +/***/ }), +/* 245 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.2 Reflect.construct(target, argumentsList [, newTarget]) + var $export = __webpack_require__(8); + var create = __webpack_require__(47); + var aFunction = __webpack_require__(24); + var anObject = __webpack_require__(12); + var isObject = __webpack_require__(13); + var fails = __webpack_require__(7); + var bind = __webpack_require__(77); + var rConstruct = (__webpack_require__(4).Reflect || {}).construct; + + // MS Edge supports only 2 arguments and argumentsList argument is optional + // FF Nightly sets third argument as `new.target`, but does not create `this` from it + var NEW_TARGET_BUG = fails(function () { + function F() { /* empty */ } + return !(rConstruct(function () { /* empty */ }, [], F) instanceof F); + }); + var ARGS_BUG = !fails(function () { + rConstruct(function () { /* empty */ }); + }); + + $export($export.S + $export.F * (NEW_TARGET_BUG || ARGS_BUG), 'Reflect', { + construct: function construct(Target, args /* , newTarget */) { + aFunction(Target); + anObject(args); + var newTarget = arguments.length < 3 ? Target : aFunction(arguments[2]); + if (ARGS_BUG && !NEW_TARGET_BUG) return rConstruct(Target, args, newTarget); + if (Target == newTarget) { + // w/o altered newTarget, optimization for 0-4 arguments + switch (args.length) { + case 0: return new Target(); + case 1: return new Target(args[0]); + case 2: return new Target(args[0], args[1]); + case 3: return new Target(args[0], args[1], args[2]); + case 4: return new Target(args[0], args[1], args[2], args[3]); + } + // w/o altered newTarget, lot of arguments case + var $args = [null]; + $args.push.apply($args, args); + return new (bind.apply(Target, $args))(); + } + // with altered newTarget, not support built-in constructors + var proto = newTarget.prototype; + var instance = create(isObject(proto) ? proto : Object.prototype); + var result = Function.apply.call(Target, instance, args); + return isObject(result) ? result : instance; + } + }); + + +/***/ }), +/* 246 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.3 Reflect.defineProperty(target, propertyKey, attributes) + var dP = __webpack_require__(11); + var $export = __webpack_require__(8); + var anObject = __webpack_require__(12); + var toPrimitive = __webpack_require__(16); + + // MS Edge has broken Reflect.defineProperty - throwing instead of returning false + $export($export.S + $export.F * __webpack_require__(7)(function () { + // eslint-disable-next-line no-undef + Reflect.defineProperty(dP.f({}, 1, { value: 1 }), 1, { value: 2 }); + }), 'Reflect', { + defineProperty: function defineProperty(target, propertyKey, attributes) { + anObject(target); + propertyKey = toPrimitive(propertyKey, true); + anObject(attributes); + try { + dP.f(target, propertyKey, attributes); + return true; + } catch (e) { + return false; + } + } + }); + + +/***/ }), +/* 247 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.4 Reflect.deleteProperty(target, propertyKey) + var $export = __webpack_require__(8); + var gOPD = __webpack_require__(52).f; + var anObject = __webpack_require__(12); + + $export($export.S, 'Reflect', { + deleteProperty: function deleteProperty(target, propertyKey) { + var desc = gOPD(anObject(target), propertyKey); + return desc && !desc.configurable ? false : delete target[propertyKey]; + } + }); + + +/***/ }), +/* 248 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // 26.1.5 Reflect.enumerate(target) + var $export = __webpack_require__(8); + var anObject = __webpack_require__(12); + var Enumerate = function (iterated) { + this._t = anObject(iterated); // target + this._i = 0; // next index + var keys = this._k = []; // keys + var key; + for (key in iterated) keys.push(key); + }; + __webpack_require__(131)(Enumerate, 'Object', function () { + var that = this; + var keys = that._k; + var key; + do { + if (that._i >= keys.length) return { value: undefined, done: true }; + } while (!((key = keys[that._i++]) in that._t)); + return { value: key, done: false }; + }); + + $export($export.S, 'Reflect', { + enumerate: function enumerate(target) { + return new Enumerate(target); + } + }); + + +/***/ }), +/* 249 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.6 Reflect.get(target, propertyKey [, receiver]) + var gOPD = __webpack_require__(52); + var getPrototypeOf = __webpack_require__(59); + var has = __webpack_require__(5); + var $export = __webpack_require__(8); + var isObject = __webpack_require__(13); + var anObject = __webpack_require__(12); + + function get(target, propertyKey /* , receiver */) { + var receiver = arguments.length < 3 ? target : arguments[2]; + var desc, proto; + if (anObject(target) === receiver) return target[propertyKey]; + if (desc = gOPD.f(target, propertyKey)) return has(desc, 'value') + ? desc.value + : desc.get !== undefined + ? desc.get.call(receiver) + : undefined; + if (isObject(proto = getPrototypeOf(target))) return get(proto, propertyKey, receiver); + } + + $export($export.S, 'Reflect', { get: get }); + + +/***/ }), +/* 250 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.7 Reflect.getOwnPropertyDescriptor(target, propertyKey) + var gOPD = __webpack_require__(52); + var $export = __webpack_require__(8); + var anObject = __webpack_require__(12); + + $export($export.S, 'Reflect', { + getOwnPropertyDescriptor: function getOwnPropertyDescriptor(target, propertyKey) { + return gOPD.f(anObject(target), propertyKey); + } + }); + + +/***/ }), +/* 251 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.8 Reflect.getPrototypeOf(target) + var $export = __webpack_require__(8); + var getProto = __webpack_require__(59); + var anObject = __webpack_require__(12); + + $export($export.S, 'Reflect', { + getPrototypeOf: function getPrototypeOf(target) { + return getProto(anObject(target)); + } + }); + + +/***/ }), +/* 252 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.9 Reflect.has(target, propertyKey) + var $export = __webpack_require__(8); + + $export($export.S, 'Reflect', { + has: function has(target, propertyKey) { + return propertyKey in target; + } + }); + + +/***/ }), +/* 253 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.10 Reflect.isExtensible(target) + var $export = __webpack_require__(8); + var anObject = __webpack_require__(12); + var $isExtensible = Object.isExtensible; + + $export($export.S, 'Reflect', { + isExtensible: function isExtensible(target) { + anObject(target); + return $isExtensible ? $isExtensible(target) : true; + } + }); + + +/***/ }), +/* 254 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.11 Reflect.ownKeys(target) + var $export = __webpack_require__(8); + + $export($export.S, 'Reflect', { ownKeys: __webpack_require__(255) }); + + +/***/ }), +/* 255 */ +/***/ (function(module, exports, __webpack_require__) { + + // all object keys, includes non-enumerable and symbols + var gOPN = __webpack_require__(51); + var gOPS = __webpack_require__(43); + var anObject = __webpack_require__(12); + var Reflect = __webpack_require__(4).Reflect; + module.exports = Reflect && Reflect.ownKeys || function ownKeys(it) { + var keys = gOPN.f(anObject(it)); + var getSymbols = gOPS.f; + return getSymbols ? keys.concat(getSymbols(it)) : keys; + }; + + +/***/ }), +/* 256 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.12 Reflect.preventExtensions(target) + var $export = __webpack_require__(8); + var anObject = __webpack_require__(12); + var $preventExtensions = Object.preventExtensions; + + $export($export.S, 'Reflect', { + preventExtensions: function preventExtensions(target) { + anObject(target); + try { + if ($preventExtensions) $preventExtensions(target); + return true; + } catch (e) { + return false; + } + } + }); + + +/***/ }), +/* 257 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.13 Reflect.set(target, propertyKey, V [, receiver]) + var dP = __webpack_require__(11); + var gOPD = __webpack_require__(52); + var getPrototypeOf = __webpack_require__(59); + var has = __webpack_require__(5); + var $export = __webpack_require__(8); + var createDesc = __webpack_require__(17); + var anObject = __webpack_require__(12); + var isObject = __webpack_require__(13); + + function set(target, propertyKey, V /* , receiver */) { + var receiver = arguments.length < 4 ? target : arguments[3]; + var ownDesc = gOPD.f(anObject(target), propertyKey); + var existingDescriptor, proto; + if (!ownDesc) { + if (isObject(proto = getPrototypeOf(target))) { + return set(proto, propertyKey, V, receiver); + } + ownDesc = createDesc(0); + } + if (has(ownDesc, 'value')) { + if (ownDesc.writable === false || !isObject(receiver)) return false; + if (existingDescriptor = gOPD.f(receiver, propertyKey)) { + if (existingDescriptor.get || existingDescriptor.set || existingDescriptor.writable === false) return false; + existingDescriptor.value = V; + dP.f(receiver, propertyKey, existingDescriptor); + } else dP.f(receiver, propertyKey, createDesc(0, V)); + return true; + } + return ownDesc.set === undefined ? false : (ownDesc.set.call(receiver, V), true); + } + + $export($export.S, 'Reflect', { set: set }); + + +/***/ }), +/* 258 */ +/***/ (function(module, exports, __webpack_require__) { + + // 26.1.14 Reflect.setPrototypeOf(target, proto) + var $export = __webpack_require__(8); + var setProto = __webpack_require__(73); + + if (setProto) $export($export.S, 'Reflect', { + setPrototypeOf: function setPrototypeOf(target, proto) { + setProto.check(target, proto); + try { + setProto.set(target, proto); + return true; + } catch (e) { + return false; + } + } + }); + + +/***/ }), +/* 259 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/tc39/Array.prototype.includes + var $export = __webpack_require__(8); + var $includes = __webpack_require__(37)(true); + + $export($export.P, 'Array', { + includes: function includes(el /* , fromIndex = 0 */) { + return $includes(this, el, arguments.length > 1 ? arguments[1] : undefined); + } + }); + + __webpack_require__(188)('includes'); + + +/***/ }), +/* 260 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://tc39.github.io/proposal-flatMap/#sec-Array.prototype.flatMap + var $export = __webpack_require__(8); + var flattenIntoArray = __webpack_require__(261); + var toObject = __webpack_require__(46); + var toLength = __webpack_require__(38); + var aFunction = __webpack_require__(24); + var arraySpeciesCreate = __webpack_require__(175); + + $export($export.P, 'Array', { + flatMap: function flatMap(callbackfn /* , thisArg */) { + var O = toObject(this); + var sourceLen, A; + aFunction(callbackfn); + sourceLen = toLength(O.length); + A = arraySpeciesCreate(O, 0); + flattenIntoArray(A, O, O, sourceLen, 0, 1, callbackfn, arguments[1]); + return A; + } + }); + + __webpack_require__(188)('flatMap'); + + +/***/ }), +/* 261 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://tc39.github.io/proposal-flatMap/#sec-FlattenIntoArray + var isArray = __webpack_require__(45); + var isObject = __webpack_require__(13); + var toLength = __webpack_require__(38); + var ctx = __webpack_require__(23); + var IS_CONCAT_SPREADABLE = __webpack_require__(27)('isConcatSpreadable'); + + function flattenIntoArray(target, original, source, sourceLen, start, depth, mapper, thisArg) { + var targetIndex = start; + var sourceIndex = 0; + var mapFn = mapper ? ctx(mapper, thisArg, 3) : false; + var element, spreadable; + + while (sourceIndex < sourceLen) { + if (sourceIndex in source) { + element = mapFn ? mapFn(source[sourceIndex], sourceIndex, original) : source[sourceIndex]; + + spreadable = false; + if (isObject(element)) { + spreadable = element[IS_CONCAT_SPREADABLE]; + spreadable = spreadable !== undefined ? !!spreadable : isArray(element); + } + + if (spreadable && depth > 0) { + targetIndex = flattenIntoArray(target, original, element, toLength(element.length), targetIndex, depth - 1) - 1; + } else { + if (targetIndex >= 0x1fffffffffffff) throw TypeError(); + target[targetIndex] = element; + } + + targetIndex++; + } + sourceIndex++; + } + return targetIndex; + } + + module.exports = flattenIntoArray; + + +/***/ }), +/* 262 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://tc39.github.io/proposal-flatMap/#sec-Array.prototype.flatten + var $export = __webpack_require__(8); + var flattenIntoArray = __webpack_require__(261); + var toObject = __webpack_require__(46); + var toLength = __webpack_require__(38); + var toInteger = __webpack_require__(39); + var arraySpeciesCreate = __webpack_require__(175); + + $export($export.P, 'Array', { + flatten: function flatten(/* depthArg = 1 */) { + var depthArg = arguments[0]; + var O = toObject(this); + var sourceLen = toLength(O.length); + var A = arraySpeciesCreate(O, 0); + flattenIntoArray(A, O, O, sourceLen, 0, depthArg === undefined ? 1 : toInteger(depthArg)); + return A; + } + }); + + __webpack_require__(188)('flatten'); + + +/***/ }), +/* 263 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/mathiasbynens/String.prototype.at + var $export = __webpack_require__(8); + var $at = __webpack_require__(128)(true); + + $export($export.P, 'String', { + at: function at(pos) { + return $at(this, pos); + } + }); + + +/***/ }), +/* 264 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/tc39/proposal-string-pad-start-end + var $export = __webpack_require__(8); + var $pad = __webpack_require__(265); + var userAgent = __webpack_require__(218); + + // https://github.com/zloirock/core-js/issues/280 + var WEBKIT_BUG = /Version\/10\.\d+(\.\d+)?( Mobile\/\w+)? Safari\//.test(userAgent); + + $export($export.P + $export.F * WEBKIT_BUG, 'String', { + padStart: function padStart(maxLength /* , fillString = ' ' */) { + return $pad(this, maxLength, arguments.length > 1 ? arguments[1] : undefined, true); + } + }); + + +/***/ }), +/* 265 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/tc39/proposal-string-pad-start-end + var toLength = __webpack_require__(38); + var repeat = __webpack_require__(91); + var defined = __webpack_require__(36); + + module.exports = function (that, maxLength, fillString, left) { + var S = String(defined(that)); + var stringLength = S.length; + var fillStr = fillString === undefined ? ' ' : String(fillString); + var intMaxLength = toLength(maxLength); + if (intMaxLength <= stringLength || fillStr == '') return S; + var fillLen = intMaxLength - stringLength; + var stringFiller = repeat.call(fillStr, Math.ceil(fillLen / fillStr.length)); + if (stringFiller.length > fillLen) stringFiller = stringFiller.slice(0, fillLen); + return left ? stringFiller + S : S + stringFiller; + }; + + +/***/ }), +/* 266 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/tc39/proposal-string-pad-start-end + var $export = __webpack_require__(8); + var $pad = __webpack_require__(265); + var userAgent = __webpack_require__(218); + + // https://github.com/zloirock/core-js/issues/280 + var WEBKIT_BUG = /Version\/10\.\d+(\.\d+)?( Mobile\/\w+)? Safari\//.test(userAgent); + + $export($export.P + $export.F * WEBKIT_BUG, 'String', { + padEnd: function padEnd(maxLength /* , fillString = ' ' */) { + return $pad(this, maxLength, arguments.length > 1 ? arguments[1] : undefined, false); + } + }); + + +/***/ }), +/* 267 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/sebmarkbage/ecmascript-string-left-right-trim + __webpack_require__(83)('trimLeft', function ($trim) { + return function trimLeft() { + return $trim(this, 1); + }; + }, 'trimStart'); + + +/***/ }), +/* 268 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/sebmarkbage/ecmascript-string-left-right-trim + __webpack_require__(83)('trimRight', function ($trim) { + return function trimRight() { + return $trim(this, 2); + }; + }, 'trimEnd'); + + +/***/ }), +/* 269 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://tc39.github.io/String.prototype.matchAll/ + var $export = __webpack_require__(8); + var defined = __webpack_require__(36); + var toLength = __webpack_require__(38); + var isRegExp = __webpack_require__(135); + var getFlags = __webpack_require__(198); + var RegExpProto = RegExp.prototype; + + var $RegExpStringIterator = function (regexp, string) { + this._r = regexp; + this._s = string; + }; + + __webpack_require__(131)($RegExpStringIterator, 'RegExp String', function next() { + var match = this._r.exec(this._s); + return { value: match, done: match === null }; + }); + + $export($export.P, 'String', { + matchAll: function matchAll(regexp) { + defined(this); + if (!isRegExp(regexp)) throw TypeError(regexp + ' is not a regexp!'); + var S = String(this); + var flags = 'flags' in RegExpProto ? String(regexp.flags) : getFlags.call(regexp); + var rx = new RegExp(regexp.source, ~flags.indexOf('g') ? flags : 'g' + flags); + rx.lastIndex = toLength(regexp.lastIndex); + return new $RegExpStringIterator(rx, S); + } + }); + + +/***/ }), +/* 270 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(29)('asyncIterator'); + + +/***/ }), +/* 271 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(29)('observable'); + + +/***/ }), +/* 272 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/tc39/proposal-object-getownpropertydescriptors + var $export = __webpack_require__(8); + var ownKeys = __webpack_require__(255); + var toIObject = __webpack_require__(33); + var gOPD = __webpack_require__(52); + var createProperty = __webpack_require__(165); + + $export($export.S, 'Object', { + getOwnPropertyDescriptors: function getOwnPropertyDescriptors(object) { + var O = toIObject(object); + var getDesc = gOPD.f; + var keys = ownKeys(O); + var result = {}; + var i = 0; + var key, desc; + while (keys.length > i) { + desc = getDesc(O, key = keys[i++]); + if (desc !== undefined) createProperty(result, key, desc); + } + return result; + } + }); + + +/***/ }), +/* 273 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/tc39/proposal-object-values-entries + var $export = __webpack_require__(8); + var $values = __webpack_require__(274)(false); + + $export($export.S, 'Object', { + values: function values(it) { + return $values(it); + } + }); + + +/***/ }), +/* 274 */ +/***/ (function(module, exports, __webpack_require__) { + + var DESCRIPTORS = __webpack_require__(6); + var getKeys = __webpack_require__(31); + var toIObject = __webpack_require__(33); + var isEnum = __webpack_require__(44).f; + module.exports = function (isEntries) { + return function (it) { + var O = toIObject(it); + var keys = getKeys(O); + var length = keys.length; + var i = 0; + var result = []; + var key; + while (length > i) { + key = keys[i++]; + if (!DESCRIPTORS || isEnum.call(O, key)) { + result.push(isEntries ? [key, O[key]] : O[key]); + } + } + return result; + }; + }; + + +/***/ }), +/* 275 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/tc39/proposal-object-values-entries + var $export = __webpack_require__(8); + var $entries = __webpack_require__(274)(true); + + $export($export.S, 'Object', { + entries: function entries(it) { + return $entries(it); + } + }); + + +/***/ }), +/* 276 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var toObject = __webpack_require__(46); + var aFunction = __webpack_require__(24); + var $defineProperty = __webpack_require__(11); + + // B.2.2.2 Object.prototype.__defineGetter__(P, getter) + __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', { + __defineGetter__: function __defineGetter__(P, getter) { + $defineProperty.f(toObject(this), P, { get: aFunction(getter), enumerable: true, configurable: true }); + } + }); + + +/***/ }), +/* 277 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // Forced replacement prototype accessors methods + module.exports = __webpack_require__(22) || !__webpack_require__(7)(function () { + var K = Math.random(); + // In FF throws only define methods + // eslint-disable-next-line no-undef, no-useless-call + __defineSetter__.call(null, K, function () { /* empty */ }); + delete __webpack_require__(4)[K]; + }); + + +/***/ }), +/* 278 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var toObject = __webpack_require__(46); + var aFunction = __webpack_require__(24); + var $defineProperty = __webpack_require__(11); + + // B.2.2.3 Object.prototype.__defineSetter__(P, setter) + __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', { + __defineSetter__: function __defineSetter__(P, setter) { + $defineProperty.f(toObject(this), P, { set: aFunction(setter), enumerable: true, configurable: true }); + } + }); + + +/***/ }), +/* 279 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var toObject = __webpack_require__(46); + var toPrimitive = __webpack_require__(16); + var getPrototypeOf = __webpack_require__(59); + var getOwnPropertyDescriptor = __webpack_require__(52).f; + + // B.2.2.4 Object.prototype.__lookupGetter__(P) + __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', { + __lookupGetter__: function __lookupGetter__(P) { + var O = toObject(this); + var K = toPrimitive(P, true); + var D; + do { + if (D = getOwnPropertyDescriptor(O, K)) return D.get; + } while (O = getPrototypeOf(O)); + } + }); + + +/***/ }), +/* 280 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + var $export = __webpack_require__(8); + var toObject = __webpack_require__(46); + var toPrimitive = __webpack_require__(16); + var getPrototypeOf = __webpack_require__(59); + var getOwnPropertyDescriptor = __webpack_require__(52).f; + + // B.2.2.5 Object.prototype.__lookupSetter__(P) + __webpack_require__(6) && $export($export.P + __webpack_require__(277), 'Object', { + __lookupSetter__: function __lookupSetter__(P) { + var O = toObject(this); + var K = toPrimitive(P, true); + var D; + do { + if (D = getOwnPropertyDescriptor(O, K)) return D.set; + } while (O = getPrototypeOf(O)); + } + }); + + +/***/ }), +/* 281 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/DavidBruant/Map-Set.prototype.toJSON + var $export = __webpack_require__(8); + + $export($export.P + $export.R, 'Map', { toJSON: __webpack_require__(282)('Map') }); + + +/***/ }), +/* 282 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/DavidBruant/Map-Set.prototype.toJSON + var classof = __webpack_require__(75); + var from = __webpack_require__(283); + module.exports = function (NAME) { + return function toJSON() { + if (classof(this) != NAME) throw TypeError(NAME + "#toJSON isn't generic"); + return from(this); + }; + }; + + +/***/ }), +/* 283 */ +/***/ (function(module, exports, __webpack_require__) { + + var forOf = __webpack_require__(213); + + module.exports = function (iter, ITERATOR) { + var result = []; + forOf(iter, false, result.push, result, ITERATOR); + return result; + }; + + +/***/ }), +/* 284 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/DavidBruant/Map-Set.prototype.toJSON + var $export = __webpack_require__(8); + + $export($export.P + $export.R, 'Set', { toJSON: __webpack_require__(282)('Set') }); + + +/***/ }), +/* 285 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-map.of + __webpack_require__(286)('Map'); + + +/***/ }), +/* 286 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://tc39.github.io/proposal-setmap-offrom/ + var $export = __webpack_require__(8); + + module.exports = function (COLLECTION) { + $export($export.S, COLLECTION, { of: function of() { + var length = arguments.length; + var A = new Array(length); + while (length--) A[length] = arguments[length]; + return new this(A); + } }); + }; + + +/***/ }), +/* 287 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-set.of + __webpack_require__(286)('Set'); + + +/***/ }), +/* 288 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-weakmap.of + __webpack_require__(286)('WeakMap'); + + +/***/ }), +/* 289 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-weakset.of + __webpack_require__(286)('WeakSet'); + + +/***/ }), +/* 290 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-map.from + __webpack_require__(291)('Map'); + + +/***/ }), +/* 291 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://tc39.github.io/proposal-setmap-offrom/ + var $export = __webpack_require__(8); + var aFunction = __webpack_require__(24); + var ctx = __webpack_require__(23); + var forOf = __webpack_require__(213); + + module.exports = function (COLLECTION) { + $export($export.S, COLLECTION, { from: function from(source /* , mapFn, thisArg */) { + var mapFn = arguments[1]; + var mapping, A, n, cb; + aFunction(this); + mapping = mapFn !== undefined; + if (mapping) aFunction(mapFn); + if (source == undefined) return new this(); + A = []; + if (mapping) { + n = 0; + cb = ctx(mapFn, arguments[2], 2); + forOf(source, false, function (nextItem) { + A.push(cb(nextItem, n++)); + }); + } else { + forOf(source, false, A.push, A); + } + return new this(A); + } }); + }; + + +/***/ }), +/* 292 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-set.from + __webpack_require__(291)('Set'); + + +/***/ }), +/* 293 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-weakmap.from + __webpack_require__(291)('WeakMap'); + + +/***/ }), +/* 294 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://tc39.github.io/proposal-setmap-offrom/#sec-weakset.from + __webpack_require__(291)('WeakSet'); + + +/***/ }), +/* 295 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/tc39/proposal-global + var $export = __webpack_require__(8); + + $export($export.G, { global: __webpack_require__(4) }); + + +/***/ }), +/* 296 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/tc39/proposal-global + var $export = __webpack_require__(8); + + $export($export.S, 'System', { global: __webpack_require__(4) }); + + +/***/ }), +/* 297 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/ljharb/proposal-is-error + var $export = __webpack_require__(8); + var cof = __webpack_require__(35); + + $export($export.S, 'Error', { + isError: function isError(it) { + return cof(it) === 'Error'; + } + }); + + +/***/ }), +/* 298 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://rwaldron.github.io/proposal-math-extensions/ + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + clamp: function clamp(x, lower, upper) { + return Math.min(upper, Math.max(lower, x)); + } + }); + + +/***/ }), +/* 299 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://rwaldron.github.io/proposal-math-extensions/ + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { DEG_PER_RAD: Math.PI / 180 }); + + +/***/ }), +/* 300 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://rwaldron.github.io/proposal-math-extensions/ + var $export = __webpack_require__(8); + var RAD_PER_DEG = 180 / Math.PI; + + $export($export.S, 'Math', { + degrees: function degrees(radians) { + return radians * RAD_PER_DEG; + } + }); + + +/***/ }), +/* 301 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://rwaldron.github.io/proposal-math-extensions/ + var $export = __webpack_require__(8); + var scale = __webpack_require__(302); + var fround = __webpack_require__(114); + + $export($export.S, 'Math', { + fscale: function fscale(x, inLow, inHigh, outLow, outHigh) { + return fround(scale(x, inLow, inHigh, outLow, outHigh)); + } + }); + + +/***/ }), +/* 302 */ +/***/ (function(module, exports) { + + // https://rwaldron.github.io/proposal-math-extensions/ + module.exports = Math.scale || function scale(x, inLow, inHigh, outLow, outHigh) { + if ( + arguments.length === 0 + // eslint-disable-next-line no-self-compare + || x != x + // eslint-disable-next-line no-self-compare + || inLow != inLow + // eslint-disable-next-line no-self-compare + || inHigh != inHigh + // eslint-disable-next-line no-self-compare + || outLow != outLow + // eslint-disable-next-line no-self-compare + || outHigh != outHigh + ) return NaN; + if (x === Infinity || x === -Infinity) return x; + return (x - inLow) * (outHigh - outLow) / (inHigh - inLow) + outLow; + }; + + +/***/ }), +/* 303 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://gist.github.com/BrendanEich/4294d5c212a6d2254703 + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + iaddh: function iaddh(x0, x1, y0, y1) { + var $x0 = x0 >>> 0; + var $x1 = x1 >>> 0; + var $y0 = y0 >>> 0; + return $x1 + (y1 >>> 0) + (($x0 & $y0 | ($x0 | $y0) & ~($x0 + $y0 >>> 0)) >>> 31) | 0; + } + }); + + +/***/ }), +/* 304 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://gist.github.com/BrendanEich/4294d5c212a6d2254703 + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + isubh: function isubh(x0, x1, y0, y1) { + var $x0 = x0 >>> 0; + var $x1 = x1 >>> 0; + var $y0 = y0 >>> 0; + return $x1 - (y1 >>> 0) - ((~$x0 & $y0 | ~($x0 ^ $y0) & $x0 - $y0 >>> 0) >>> 31) | 0; + } + }); + + +/***/ }), +/* 305 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://gist.github.com/BrendanEich/4294d5c212a6d2254703 + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + imulh: function imulh(u, v) { + var UINT16 = 0xffff; + var $u = +u; + var $v = +v; + var u0 = $u & UINT16; + var v0 = $v & UINT16; + var u1 = $u >> 16; + var v1 = $v >> 16; + var t = (u1 * v0 >>> 0) + (u0 * v0 >>> 16); + return u1 * v1 + (t >> 16) + ((u0 * v1 >>> 0) + (t & UINT16) >> 16); + } + }); + + +/***/ }), +/* 306 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://rwaldron.github.io/proposal-math-extensions/ + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { RAD_PER_DEG: 180 / Math.PI }); + + +/***/ }), +/* 307 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://rwaldron.github.io/proposal-math-extensions/ + var $export = __webpack_require__(8); + var DEG_PER_RAD = Math.PI / 180; + + $export($export.S, 'Math', { + radians: function radians(degrees) { + return degrees * DEG_PER_RAD; + } + }); + + +/***/ }), +/* 308 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://rwaldron.github.io/proposal-math-extensions/ + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { scale: __webpack_require__(302) }); + + +/***/ }), +/* 309 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://gist.github.com/BrendanEich/4294d5c212a6d2254703 + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { + umulh: function umulh(u, v) { + var UINT16 = 0xffff; + var $u = +u; + var $v = +v; + var u0 = $u & UINT16; + var v0 = $v & UINT16; + var u1 = $u >>> 16; + var v1 = $v >>> 16; + var t = (u1 * v0 >>> 0) + (u0 * v0 >>> 16); + return u1 * v1 + (t >>> 16) + ((u0 * v1 >>> 0) + (t & UINT16) >>> 16); + } + }); + + +/***/ }), +/* 310 */ +/***/ (function(module, exports, __webpack_require__) { + + // http://jfbastien.github.io/papers/Math.signbit.html + var $export = __webpack_require__(8); + + $export($export.S, 'Math', { signbit: function signbit(x) { + // eslint-disable-next-line no-self-compare + return (x = +x) != x ? x : x == 0 ? 1 / x == Infinity : x > 0; + } }); + + +/***/ }), +/* 311 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/tc39/proposal-promise-finally + 'use strict'; + var $export = __webpack_require__(8); + var core = __webpack_require__(9); + var global = __webpack_require__(4); + var speciesConstructor = __webpack_require__(210); + var promiseResolve = __webpack_require__(219); + + $export($export.P + $export.R, 'Promise', { 'finally': function (onFinally) { + var C = speciesConstructor(this, core.Promise || global.Promise); + var isFunction = typeof onFinally == 'function'; + return this.then( + isFunction ? function (x) { + return promiseResolve(C, onFinally()).then(function () { return x; }); + } : onFinally, + isFunction ? function (e) { + return promiseResolve(C, onFinally()).then(function () { throw e; }); + } : onFinally + ); + } }); + + +/***/ }), +/* 312 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/tc39/proposal-promise-try + var $export = __webpack_require__(8); + var newPromiseCapability = __webpack_require__(216); + var perform = __webpack_require__(217); + + $export($export.S, 'Promise', { 'try': function (callbackfn) { + var promiseCapability = newPromiseCapability.f(this); + var result = perform(callbackfn); + (result.e ? promiseCapability.reject : promiseCapability.resolve)(result.v); + return promiseCapability.promise; + } }); + + +/***/ }), +/* 313 */ +/***/ (function(module, exports, __webpack_require__) { + + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var toMetaKey = metadata.key; + var ordinaryDefineOwnMetadata = metadata.set; + + metadata.exp({ defineMetadata: function defineMetadata(metadataKey, metadataValue, target, targetKey) { + ordinaryDefineOwnMetadata(metadataKey, metadataValue, anObject(target), toMetaKey(targetKey)); + } }); + + +/***/ }), +/* 314 */ +/***/ (function(module, exports, __webpack_require__) { + + var Map = __webpack_require__(221); + var $export = __webpack_require__(8); + var shared = __webpack_require__(21)('metadata'); + var store = shared.store || (shared.store = new (__webpack_require__(226))()); + + var getOrCreateMetadataMap = function (target, targetKey, create) { + var targetMetadata = store.get(target); + if (!targetMetadata) { + if (!create) return undefined; + store.set(target, targetMetadata = new Map()); + } + var keyMetadata = targetMetadata.get(targetKey); + if (!keyMetadata) { + if (!create) return undefined; + targetMetadata.set(targetKey, keyMetadata = new Map()); + } return keyMetadata; + }; + var ordinaryHasOwnMetadata = function (MetadataKey, O, P) { + var metadataMap = getOrCreateMetadataMap(O, P, false); + return metadataMap === undefined ? false : metadataMap.has(MetadataKey); + }; + var ordinaryGetOwnMetadata = function (MetadataKey, O, P) { + var metadataMap = getOrCreateMetadataMap(O, P, false); + return metadataMap === undefined ? undefined : metadataMap.get(MetadataKey); + }; + var ordinaryDefineOwnMetadata = function (MetadataKey, MetadataValue, O, P) { + getOrCreateMetadataMap(O, P, true).set(MetadataKey, MetadataValue); + }; + var ordinaryOwnMetadataKeys = function (target, targetKey) { + var metadataMap = getOrCreateMetadataMap(target, targetKey, false); + var keys = []; + if (metadataMap) metadataMap.forEach(function (_, key) { keys.push(key); }); + return keys; + }; + var toMetaKey = function (it) { + return it === undefined || typeof it == 'symbol' ? it : String(it); + }; + var exp = function (O) { + $export($export.S, 'Reflect', O); + }; + + module.exports = { + store: store, + map: getOrCreateMetadataMap, + has: ordinaryHasOwnMetadata, + get: ordinaryGetOwnMetadata, + set: ordinaryDefineOwnMetadata, + keys: ordinaryOwnMetadataKeys, + key: toMetaKey, + exp: exp + }; + + +/***/ }), +/* 315 */ +/***/ (function(module, exports, __webpack_require__) { + + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var toMetaKey = metadata.key; + var getOrCreateMetadataMap = metadata.map; + var store = metadata.store; + + metadata.exp({ deleteMetadata: function deleteMetadata(metadataKey, target /* , targetKey */) { + var targetKey = arguments.length < 3 ? undefined : toMetaKey(arguments[2]); + var metadataMap = getOrCreateMetadataMap(anObject(target), targetKey, false); + if (metadataMap === undefined || !metadataMap['delete'](metadataKey)) return false; + if (metadataMap.size) return true; + var targetMetadata = store.get(target); + targetMetadata['delete'](targetKey); + return !!targetMetadata.size || store['delete'](target); + } }); + + +/***/ }), +/* 316 */ +/***/ (function(module, exports, __webpack_require__) { + + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var getPrototypeOf = __webpack_require__(59); + var ordinaryHasOwnMetadata = metadata.has; + var ordinaryGetOwnMetadata = metadata.get; + var toMetaKey = metadata.key; + + var ordinaryGetMetadata = function (MetadataKey, O, P) { + var hasOwn = ordinaryHasOwnMetadata(MetadataKey, O, P); + if (hasOwn) return ordinaryGetOwnMetadata(MetadataKey, O, P); + var parent = getPrototypeOf(O); + return parent !== null ? ordinaryGetMetadata(MetadataKey, parent, P) : undefined; + }; + + metadata.exp({ getMetadata: function getMetadata(metadataKey, target /* , targetKey */) { + return ordinaryGetMetadata(metadataKey, anObject(target), arguments.length < 3 ? undefined : toMetaKey(arguments[2])); + } }); + + +/***/ }), +/* 317 */ +/***/ (function(module, exports, __webpack_require__) { + + var Set = __webpack_require__(225); + var from = __webpack_require__(283); + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var getPrototypeOf = __webpack_require__(59); + var ordinaryOwnMetadataKeys = metadata.keys; + var toMetaKey = metadata.key; + + var ordinaryMetadataKeys = function (O, P) { + var oKeys = ordinaryOwnMetadataKeys(O, P); + var parent = getPrototypeOf(O); + if (parent === null) return oKeys; + var pKeys = ordinaryMetadataKeys(parent, P); + return pKeys.length ? oKeys.length ? from(new Set(oKeys.concat(pKeys))) : pKeys : oKeys; + }; + + metadata.exp({ getMetadataKeys: function getMetadataKeys(target /* , targetKey */) { + return ordinaryMetadataKeys(anObject(target), arguments.length < 2 ? undefined : toMetaKey(arguments[1])); + } }); + + +/***/ }), +/* 318 */ +/***/ (function(module, exports, __webpack_require__) { + + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var ordinaryGetOwnMetadata = metadata.get; + var toMetaKey = metadata.key; + + metadata.exp({ getOwnMetadata: function getOwnMetadata(metadataKey, target /* , targetKey */) { + return ordinaryGetOwnMetadata(metadataKey, anObject(target) + , arguments.length < 3 ? undefined : toMetaKey(arguments[2])); + } }); + + +/***/ }), +/* 319 */ +/***/ (function(module, exports, __webpack_require__) { + + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var ordinaryOwnMetadataKeys = metadata.keys; + var toMetaKey = metadata.key; + + metadata.exp({ getOwnMetadataKeys: function getOwnMetadataKeys(target /* , targetKey */) { + return ordinaryOwnMetadataKeys(anObject(target), arguments.length < 2 ? undefined : toMetaKey(arguments[1])); + } }); + + +/***/ }), +/* 320 */ +/***/ (function(module, exports, __webpack_require__) { + + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var getPrototypeOf = __webpack_require__(59); + var ordinaryHasOwnMetadata = metadata.has; + var toMetaKey = metadata.key; + + var ordinaryHasMetadata = function (MetadataKey, O, P) { + var hasOwn = ordinaryHasOwnMetadata(MetadataKey, O, P); + if (hasOwn) return true; + var parent = getPrototypeOf(O); + return parent !== null ? ordinaryHasMetadata(MetadataKey, parent, P) : false; + }; + + metadata.exp({ hasMetadata: function hasMetadata(metadataKey, target /* , targetKey */) { + return ordinaryHasMetadata(metadataKey, anObject(target), arguments.length < 3 ? undefined : toMetaKey(arguments[2])); + } }); + + +/***/ }), +/* 321 */ +/***/ (function(module, exports, __webpack_require__) { + + var metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var ordinaryHasOwnMetadata = metadata.has; + var toMetaKey = metadata.key; + + metadata.exp({ hasOwnMetadata: function hasOwnMetadata(metadataKey, target /* , targetKey */) { + return ordinaryHasOwnMetadata(metadataKey, anObject(target) + , arguments.length < 3 ? undefined : toMetaKey(arguments[2])); + } }); + + +/***/ }), +/* 322 */ +/***/ (function(module, exports, __webpack_require__) { + + var $metadata = __webpack_require__(314); + var anObject = __webpack_require__(12); + var aFunction = __webpack_require__(24); + var toMetaKey = $metadata.key; + var ordinaryDefineOwnMetadata = $metadata.set; + + $metadata.exp({ metadata: function metadata(metadataKey, metadataValue) { + return function decorator(target, targetKey) { + ordinaryDefineOwnMetadata( + metadataKey, metadataValue, + (targetKey !== undefined ? anObject : aFunction)(target), + toMetaKey(targetKey) + ); + }; + } }); + + +/***/ }), +/* 323 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/rwaldron/tc39-notes/blob/master/es6/2014-09/sept-25.md#510-globalasap-for-enqueuing-a-microtask + var $export = __webpack_require__(8); + var microtask = __webpack_require__(215)(); + var process = __webpack_require__(4).process; + var isNode = __webpack_require__(35)(process) == 'process'; + + $export($export.G, { + asap: function asap(fn) { + var domain = isNode && process.domain; + microtask(domain ? domain.bind(fn) : fn); + } + }); + + +/***/ }), +/* 324 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + // https://github.com/zenparsing/es-observable + var $export = __webpack_require__(8); + var global = __webpack_require__(4); + var core = __webpack_require__(9); + var microtask = __webpack_require__(215)(); + var OBSERVABLE = __webpack_require__(27)('observable'); + var aFunction = __webpack_require__(24); + var anObject = __webpack_require__(12); + var anInstance = __webpack_require__(212); + var redefineAll = __webpack_require__(220); + var hide = __webpack_require__(10); + var forOf = __webpack_require__(213); + var RETURN = forOf.RETURN; + + var getMethod = function (fn) { + return fn == null ? undefined : aFunction(fn); + }; + + var cleanupSubscription = function (subscription) { + var cleanup = subscription._c; + if (cleanup) { + subscription._c = undefined; + cleanup(); + } + }; + + var subscriptionClosed = function (subscription) { + return subscription._o === undefined; + }; + + var closeSubscription = function (subscription) { + if (!subscriptionClosed(subscription)) { + subscription._o = undefined; + cleanupSubscription(subscription); + } + }; + + var Subscription = function (observer, subscriber) { + anObject(observer); + this._c = undefined; + this._o = observer; + observer = new SubscriptionObserver(this); + try { + var cleanup = subscriber(observer); + var subscription = cleanup; + if (cleanup != null) { + if (typeof cleanup.unsubscribe === 'function') cleanup = function () { subscription.unsubscribe(); }; + else aFunction(cleanup); + this._c = cleanup; + } + } catch (e) { + observer.error(e); + return; + } if (subscriptionClosed(this)) cleanupSubscription(this); + }; + + Subscription.prototype = redefineAll({}, { + unsubscribe: function unsubscribe() { closeSubscription(this); } + }); + + var SubscriptionObserver = function (subscription) { + this._s = subscription; + }; + + SubscriptionObserver.prototype = redefineAll({}, { + next: function next(value) { + var subscription = this._s; + if (!subscriptionClosed(subscription)) { + var observer = subscription._o; + try { + var m = getMethod(observer.next); + if (m) return m.call(observer, value); + } catch (e) { + try { + closeSubscription(subscription); + } finally { + throw e; + } + } + } + }, + error: function error(value) { + var subscription = this._s; + if (subscriptionClosed(subscription)) throw value; + var observer = subscription._o; + subscription._o = undefined; + try { + var m = getMethod(observer.error); + if (!m) throw value; + value = m.call(observer, value); + } catch (e) { + try { + cleanupSubscription(subscription); + } finally { + throw e; + } + } cleanupSubscription(subscription); + return value; + }, + complete: function complete(value) { + var subscription = this._s; + if (!subscriptionClosed(subscription)) { + var observer = subscription._o; + subscription._o = undefined; + try { + var m = getMethod(observer.complete); + value = m ? m.call(observer, value) : undefined; + } catch (e) { + try { + cleanupSubscription(subscription); + } finally { + throw e; + } + } cleanupSubscription(subscription); + return value; + } + } + }); + + var $Observable = function Observable(subscriber) { + anInstance(this, $Observable, 'Observable', '_f')._f = aFunction(subscriber); + }; + + redefineAll($Observable.prototype, { + subscribe: function subscribe(observer) { + return new Subscription(observer, this._f); + }, + forEach: function forEach(fn) { + var that = this; + return new (core.Promise || global.Promise)(function (resolve, reject) { + aFunction(fn); + var subscription = that.subscribe({ + next: function (value) { + try { + return fn(value); + } catch (e) { + reject(e); + subscription.unsubscribe(); + } + }, + error: reject, + complete: resolve + }); + }); + } + }); + + redefineAll($Observable, { + from: function from(x) { + var C = typeof this === 'function' ? this : $Observable; + var method = getMethod(anObject(x)[OBSERVABLE]); + if (method) { + var observable = anObject(method.call(x)); + return observable.constructor === C ? observable : new C(function (observer) { + return observable.subscribe(observer); + }); + } + return new C(function (observer) { + var done = false; + microtask(function () { + if (!done) { + try { + if (forOf(x, false, function (it) { + observer.next(it); + if (done) return RETURN; + }) === RETURN) return; + } catch (e) { + if (done) throw e; + observer.error(e); + return; + } observer.complete(); + } + }); + return function () { done = true; }; + }); + }, + of: function of() { + for (var i = 0, l = arguments.length, items = new Array(l); i < l;) items[i] = arguments[i++]; + return new (typeof this === 'function' ? this : $Observable)(function (observer) { + var done = false; + microtask(function () { + if (!done) { + for (var j = 0; j < items.length; ++j) { + observer.next(items[j]); + if (done) return; + } observer.complete(); + } + }); + return function () { done = true; }; + }); + } + }); + + hide($Observable.prototype, OBSERVABLE, function () { return this; }); + + $export($export.G, { Observable: $Observable }); + + __webpack_require__(194)('Observable'); + + +/***/ }), +/* 325 */ +/***/ (function(module, exports, __webpack_require__) { + + // ie9- setTimeout & setInterval additional parameters fix + var global = __webpack_require__(4); + var $export = __webpack_require__(8); + var userAgent = __webpack_require__(218); + var slice = [].slice; + var MSIE = /MSIE .\./.test(userAgent); // <- dirty ie9- check + var wrap = function (set) { + return function (fn, time /* , ...args */) { + var boundArgs = arguments.length > 2; + var args = boundArgs ? slice.call(arguments, 2) : false; + return set(boundArgs ? function () { + // eslint-disable-next-line no-new-func + (typeof fn == 'function' ? fn : Function(fn)).apply(this, args); + } : fn, time); + }; + }; + $export($export.G + $export.B + $export.F * MSIE, { + setTimeout: wrap(global.setTimeout), + setInterval: wrap(global.setInterval) + }); + + +/***/ }), +/* 326 */ +/***/ (function(module, exports, __webpack_require__) { + + var $export = __webpack_require__(8); + var $task = __webpack_require__(214); + $export($export.G + $export.B, { + setImmediate: $task.set, + clearImmediate: $task.clear + }); + + +/***/ }), +/* 327 */ +/***/ (function(module, exports, __webpack_require__) { + + var $iterators = __webpack_require__(195); + var getKeys = __webpack_require__(31); + var redefine = __webpack_require__(18); + var global = __webpack_require__(4); + var hide = __webpack_require__(10); + var Iterators = __webpack_require__(130); + var wks = __webpack_require__(27); + var ITERATOR = wks('iterator'); + var TO_STRING_TAG = wks('toStringTag'); + var ArrayValues = Iterators.Array; + + var DOMIterables = { + CSSRuleList: true, // TODO: Not spec compliant, should be false. + CSSStyleDeclaration: false, + CSSValueList: false, + ClientRectList: false, + DOMRectList: false, + DOMStringList: false, + DOMTokenList: true, + DataTransferItemList: false, + FileList: false, + HTMLAllCollection: false, + HTMLCollection: false, + HTMLFormElement: false, + HTMLSelectElement: false, + MediaList: true, // TODO: Not spec compliant, should be false. + MimeTypeArray: false, + NamedNodeMap: false, + NodeList: true, + PaintRequestList: false, + Plugin: false, + PluginArray: false, + SVGLengthList: false, + SVGNumberList: false, + SVGPathSegList: false, + SVGPointList: false, + SVGStringList: false, + SVGTransformList: false, + SourceBufferList: false, + StyleSheetList: true, // TODO: Not spec compliant, should be false. + TextTrackCueList: false, + TextTrackList: false, + TouchList: false + }; + + for (var collections = getKeys(DOMIterables), i = 0; i < collections.length; i++) { + var NAME = collections[i]; + var explicit = DOMIterables[NAME]; + var Collection = global[NAME]; + var proto = Collection && Collection.prototype; + var key; + if (proto) { + if (!proto[ITERATOR]) hide(proto, ITERATOR, ArrayValues); + if (!proto[TO_STRING_TAG]) hide(proto, TO_STRING_TAG, NAME); + Iterators[NAME] = ArrayValues; + if (explicit) for (key in $iterators) if (!proto[key]) redefine(proto, key, $iterators[key], true); + } + } + + +/***/ }), +/* 328 */ +/***/ (function(module, exports) { + + /* WEBPACK VAR INJECTION */(function(global) {/** + * Copyright (c) 2014, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * https://raw.github.com/facebook/regenerator/master/LICENSE file. An + * additional grant of patent rights can be found in the PATENTS file in + * the same directory. + */ + + !(function(global) { + "use strict"; + + var Op = Object.prototype; + var hasOwn = Op.hasOwnProperty; + var undefined; // More compressible than void 0. + var $Symbol = typeof Symbol === "function" ? Symbol : {}; + var iteratorSymbol = $Symbol.iterator || "@@iterator"; + var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator"; + var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag"; + + var inModule = typeof module === "object"; + var runtime = global.regeneratorRuntime; + if (runtime) { + if (inModule) { + // If regeneratorRuntime is defined globally and we're in a module, + // make the exports object identical to regeneratorRuntime. + module.exports = runtime; + } + // Don't bother evaluating the rest of this file if the runtime was + // already defined globally. + return; + } + + // Define the runtime globally (as expected by generated code) as either + // module.exports (if we're in a module) or a new, empty object. + runtime = global.regeneratorRuntime = inModule ? module.exports : {}; + + function wrap(innerFn, outerFn, self, tryLocsList) { + // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator. + var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator; + var generator = Object.create(protoGenerator.prototype); + var context = new Context(tryLocsList || []); + + // The ._invoke method unifies the implementations of the .next, + // .throw, and .return methods. + generator._invoke = makeInvokeMethod(innerFn, self, context); + + return generator; + } + runtime.wrap = wrap; + + // Try/catch helper to minimize deoptimizations. Returns a completion + // record like context.tryEntries[i].completion. This interface could + // have been (and was previously) designed to take a closure to be + // invoked without arguments, but in all the cases we care about we + // already have an existing method we want to call, so there's no need + // to create a new function object. We can even get away with assuming + // the method takes exactly one argument, since that happens to be true + // in every case, so we don't have to touch the arguments object. The + // only additional allocation required is the completion record, which + // has a stable shape and so hopefully should be cheap to allocate. + function tryCatch(fn, obj, arg) { + try { + return { type: "normal", arg: fn.call(obj, arg) }; + } catch (err) { + return { type: "throw", arg: err }; + } + } + + var GenStateSuspendedStart = "suspendedStart"; + var GenStateSuspendedYield = "suspendedYield"; + var GenStateExecuting = "executing"; + var GenStateCompleted = "completed"; + + // Returning this object from the innerFn has the same effect as + // breaking out of the dispatch switch statement. + var ContinueSentinel = {}; + + // Dummy constructor functions that we use as the .constructor and + // .constructor.prototype properties for functions that return Generator + // objects. For full spec compliance, you may wish to configure your + // minifier not to mangle the names of these two functions. + function Generator() {} + function GeneratorFunction() {} + function GeneratorFunctionPrototype() {} + + // This is a polyfill for %IteratorPrototype% for environments that + // don't natively support it. + var IteratorPrototype = {}; + IteratorPrototype[iteratorSymbol] = function () { + return this; + }; + + var getProto = Object.getPrototypeOf; + var NativeIteratorPrototype = getProto && getProto(getProto(values([]))); + if (NativeIteratorPrototype && + NativeIteratorPrototype !== Op && + hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) { + // This environment has a native %IteratorPrototype%; use it instead + // of the polyfill. + IteratorPrototype = NativeIteratorPrototype; + } + + var Gp = GeneratorFunctionPrototype.prototype = + Generator.prototype = Object.create(IteratorPrototype); + GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype; + GeneratorFunctionPrototype.constructor = GeneratorFunction; + GeneratorFunctionPrototype[toStringTagSymbol] = + GeneratorFunction.displayName = "GeneratorFunction"; + + // Helper for defining the .next, .throw, and .return methods of the + // Iterator interface in terms of a single ._invoke method. + function defineIteratorMethods(prototype) { + ["next", "throw", "return"].forEach(function(method) { + prototype[method] = function(arg) { + return this._invoke(method, arg); + }; + }); + } + + runtime.isGeneratorFunction = function(genFun) { + var ctor = typeof genFun === "function" && genFun.constructor; + return ctor + ? ctor === GeneratorFunction || + // For the native GeneratorFunction constructor, the best we can + // do is to check its .name property. + (ctor.displayName || ctor.name) === "GeneratorFunction" + : false; + }; + + runtime.mark = function(genFun) { + if (Object.setPrototypeOf) { + Object.setPrototypeOf(genFun, GeneratorFunctionPrototype); + } else { + genFun.__proto__ = GeneratorFunctionPrototype; + if (!(toStringTagSymbol in genFun)) { + genFun[toStringTagSymbol] = "GeneratorFunction"; + } + } + genFun.prototype = Object.create(Gp); + return genFun; + }; + + // Within the body of any async function, `await x` is transformed to + // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test + // `hasOwn.call(value, "__await")` to determine if the yielded value is + // meant to be awaited. + runtime.awrap = function(arg) { + return { __await: arg }; + }; + + function AsyncIterator(generator) { + function invoke(method, arg, resolve, reject) { + var record = tryCatch(generator[method], generator, arg); + if (record.type === "throw") { + reject(record.arg); + } else { + var result = record.arg; + var value = result.value; + if (value && + typeof value === "object" && + hasOwn.call(value, "__await")) { + return Promise.resolve(value.__await).then(function(value) { + invoke("next", value, resolve, reject); + }, function(err) { + invoke("throw", err, resolve, reject); + }); + } + + return Promise.resolve(value).then(function(unwrapped) { + // When a yielded Promise is resolved, its final value becomes + // the .value of the Promise<{value,done}> result for the + // current iteration. If the Promise is rejected, however, the + // result for this iteration will be rejected with the same + // reason. Note that rejections of yielded Promises are not + // thrown back into the generator function, as is the case + // when an awaited Promise is rejected. This difference in + // behavior between yield and await is important, because it + // allows the consumer to decide what to do with the yielded + // rejection (swallow it and continue, manually .throw it back + // into the generator, abandon iteration, whatever). With + // await, by contrast, there is no opportunity to examine the + // rejection reason outside the generator function, so the + // only option is to throw it from the await expression, and + // let the generator function handle the exception. + result.value = unwrapped; + resolve(result); + }, reject); + } + } + + if (typeof global.process === "object" && global.process.domain) { + invoke = global.process.domain.bind(invoke); + } + + var previousPromise; + + function enqueue(method, arg) { + function callInvokeWithMethodAndArg() { + return new Promise(function(resolve, reject) { + invoke(method, arg, resolve, reject); + }); + } + + return previousPromise = + // If enqueue has been called before, then we want to wait until + // all previous Promises have been resolved before calling invoke, + // so that results are always delivered in the correct order. If + // enqueue has not been called before, then it is important to + // call invoke immediately, without waiting on a callback to fire, + // so that the async generator function has the opportunity to do + // any necessary setup in a predictable way. This predictability + // is why the Promise constructor synchronously invokes its + // executor callback, and why async functions synchronously + // execute code before the first await. Since we implement simple + // async functions in terms of async generators, it is especially + // important to get this right, even though it requires care. + previousPromise ? previousPromise.then( + callInvokeWithMethodAndArg, + // Avoid propagating failures to Promises returned by later + // invocations of the iterator. + callInvokeWithMethodAndArg + ) : callInvokeWithMethodAndArg(); + } + + // Define the unified helper method that is used to implement .next, + // .throw, and .return (see defineIteratorMethods). + this._invoke = enqueue; + } + + defineIteratorMethods(AsyncIterator.prototype); + AsyncIterator.prototype[asyncIteratorSymbol] = function () { + return this; + }; + runtime.AsyncIterator = AsyncIterator; + + // Note that simple async functions are implemented on top of + // AsyncIterator objects; they just return a Promise for the value of + // the final result produced by the iterator. + runtime.async = function(innerFn, outerFn, self, tryLocsList) { + var iter = new AsyncIterator( + wrap(innerFn, outerFn, self, tryLocsList) + ); + + return runtime.isGeneratorFunction(outerFn) + ? iter // If outerFn is a generator, return the full iterator. + : iter.next().then(function(result) { + return result.done ? result.value : iter.next(); + }); + }; + + function makeInvokeMethod(innerFn, self, context) { + var state = GenStateSuspendedStart; + + return function invoke(method, arg) { + if (state === GenStateExecuting) { + throw new Error("Generator is already running"); + } + + if (state === GenStateCompleted) { + if (method === "throw") { + throw arg; + } + + // Be forgiving, per 25.3.3.3.3 of the spec: + // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume + return doneResult(); + } + + context.method = method; + context.arg = arg; + + while (true) { + var delegate = context.delegate; + if (delegate) { + var delegateResult = maybeInvokeDelegate(delegate, context); + if (delegateResult) { + if (delegateResult === ContinueSentinel) continue; + return delegateResult; + } + } + + if (context.method === "next") { + // Setting context._sent for legacy support of Babel's + // function.sent implementation. + context.sent = context._sent = context.arg; + + } else if (context.method === "throw") { + if (state === GenStateSuspendedStart) { + state = GenStateCompleted; + throw context.arg; + } + + context.dispatchException(context.arg); + + } else if (context.method === "return") { + context.abrupt("return", context.arg); + } + + state = GenStateExecuting; + + var record = tryCatch(innerFn, self, context); + if (record.type === "normal") { + // If an exception is thrown from innerFn, we leave state === + // GenStateExecuting and loop back for another invocation. + state = context.done + ? GenStateCompleted + : GenStateSuspendedYield; + + if (record.arg === ContinueSentinel) { + continue; + } + + return { + value: record.arg, + done: context.done + }; + + } else if (record.type === "throw") { + state = GenStateCompleted; + // Dispatch the exception by looping back around to the + // context.dispatchException(context.arg) call above. + context.method = "throw"; + context.arg = record.arg; + } + } + }; + } + + // Call delegate.iterator[context.method](context.arg) and handle the + // result, either by returning a { value, done } result from the + // delegate iterator, or by modifying context.method and context.arg, + // setting context.delegate to null, and returning the ContinueSentinel. + function maybeInvokeDelegate(delegate, context) { + var method = delegate.iterator[context.method]; + if (method === undefined) { + // A .throw or .return when the delegate iterator has no .throw + // method always terminates the yield* loop. + context.delegate = null; + + if (context.method === "throw") { + if (delegate.iterator.return) { + // If the delegate iterator has a return method, give it a + // chance to clean up. + context.method = "return"; + context.arg = undefined; + maybeInvokeDelegate(delegate, context); + + if (context.method === "throw") { + // If maybeInvokeDelegate(context) changed context.method from + // "return" to "throw", let that override the TypeError below. + return ContinueSentinel; + } + } + + context.method = "throw"; + context.arg = new TypeError( + "The iterator does not provide a 'throw' method"); + } + + return ContinueSentinel; + } + + var record = tryCatch(method, delegate.iterator, context.arg); + + if (record.type === "throw") { + context.method = "throw"; + context.arg = record.arg; + context.delegate = null; + return ContinueSentinel; + } + + var info = record.arg; + + if (! info) { + context.method = "throw"; + context.arg = new TypeError("iterator result is not an object"); + context.delegate = null; + return ContinueSentinel; + } + + if (info.done) { + // Assign the result of the finished delegate to the temporary + // variable specified by delegate.resultName (see delegateYield). + context[delegate.resultName] = info.value; + + // Resume execution at the desired location (see delegateYield). + context.next = delegate.nextLoc; + + // If context.method was "throw" but the delegate handled the + // exception, let the outer generator proceed normally. If + // context.method was "next", forget context.arg since it has been + // "consumed" by the delegate iterator. If context.method was + // "return", allow the original .return call to continue in the + // outer generator. + if (context.method !== "return") { + context.method = "next"; + context.arg = undefined; + } + + } else { + // Re-yield the result returned by the delegate method. + return info; + } + + // The delegate iterator is finished, so forget it and continue with + // the outer generator. + context.delegate = null; + return ContinueSentinel; + } + + // Define Generator.prototype.{next,throw,return} in terms of the + // unified ._invoke helper method. + defineIteratorMethods(Gp); + + Gp[toStringTagSymbol] = "Generator"; + + // A Generator should always return itself as the iterator object when the + // @@iterator function is called on it. Some browsers' implementations of the + // iterator prototype chain incorrectly implement this, causing the Generator + // object to not be returned from this call. This ensures that doesn't happen. + // See https://github.com/facebook/regenerator/issues/274 for more details. + Gp[iteratorSymbol] = function() { + return this; + }; + + Gp.toString = function() { + return "[object Generator]"; + }; + + function pushTryEntry(locs) { + var entry = { tryLoc: locs[0] }; + + if (1 in locs) { + entry.catchLoc = locs[1]; + } + + if (2 in locs) { + entry.finallyLoc = locs[2]; + entry.afterLoc = locs[3]; + } + + this.tryEntries.push(entry); + } + + function resetTryEntry(entry) { + var record = entry.completion || {}; + record.type = "normal"; + delete record.arg; + entry.completion = record; + } + + function Context(tryLocsList) { + // The root entry object (effectively a try statement without a catch + // or a finally block) gives us a place to store values thrown from + // locations where there is no enclosing try statement. + this.tryEntries = [{ tryLoc: "root" }]; + tryLocsList.forEach(pushTryEntry, this); + this.reset(true); + } + + runtime.keys = function(object) { + var keys = []; + for (var key in object) { + keys.push(key); + } + keys.reverse(); + + // Rather than returning an object with a next method, we keep + // things simple and return the next function itself. + return function next() { + while (keys.length) { + var key = keys.pop(); + if (key in object) { + next.value = key; + next.done = false; + return next; + } + } + + // To avoid creating an additional object, we just hang the .value + // and .done properties off the next function object itself. This + // also ensures that the minifier will not anonymize the function. + next.done = true; + return next; + }; + }; + + function values(iterable) { + if (iterable) { + var iteratorMethod = iterable[iteratorSymbol]; + if (iteratorMethod) { + return iteratorMethod.call(iterable); + } + + if (typeof iterable.next === "function") { + return iterable; + } + + if (!isNaN(iterable.length)) { + var i = -1, next = function next() { + while (++i < iterable.length) { + if (hasOwn.call(iterable, i)) { + next.value = iterable[i]; + next.done = false; + return next; + } + } + + next.value = undefined; + next.done = true; + + return next; + }; + + return next.next = next; + } + } + + // Return an iterator with no values. + return { next: doneResult }; + } + runtime.values = values; + + function doneResult() { + return { value: undefined, done: true }; + } + + Context.prototype = { + constructor: Context, + + reset: function(skipTempReset) { + this.prev = 0; + this.next = 0; + // Resetting context._sent for legacy support of Babel's + // function.sent implementation. + this.sent = this._sent = undefined; + this.done = false; + this.delegate = null; + + this.method = "next"; + this.arg = undefined; + + this.tryEntries.forEach(resetTryEntry); + + if (!skipTempReset) { + for (var name in this) { + // Not sure about the optimal order of these conditions: + if (name.charAt(0) === "t" && + hasOwn.call(this, name) && + !isNaN(+name.slice(1))) { + this[name] = undefined; + } + } + } + }, + + stop: function() { + this.done = true; + + var rootEntry = this.tryEntries[0]; + var rootRecord = rootEntry.completion; + if (rootRecord.type === "throw") { + throw rootRecord.arg; + } + + return this.rval; + }, + + dispatchException: function(exception) { + if (this.done) { + throw exception; + } + + var context = this; + function handle(loc, caught) { + record.type = "throw"; + record.arg = exception; + context.next = loc; + + if (caught) { + // If the dispatched exception was caught by a catch block, + // then let that catch block handle the exception normally. + context.method = "next"; + context.arg = undefined; + } + + return !! caught; + } + + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + var record = entry.completion; + + if (entry.tryLoc === "root") { + // Exception thrown outside of any try block that could handle + // it, so set the completion value of the entire function to + // throw the exception. + return handle("end"); + } + + if (entry.tryLoc <= this.prev) { + var hasCatch = hasOwn.call(entry, "catchLoc"); + var hasFinally = hasOwn.call(entry, "finallyLoc"); + + if (hasCatch && hasFinally) { + if (this.prev < entry.catchLoc) { + return handle(entry.catchLoc, true); + } else if (this.prev < entry.finallyLoc) { + return handle(entry.finallyLoc); + } + + } else if (hasCatch) { + if (this.prev < entry.catchLoc) { + return handle(entry.catchLoc, true); + } + + } else if (hasFinally) { + if (this.prev < entry.finallyLoc) { + return handle(entry.finallyLoc); + } + + } else { + throw new Error("try statement without catch or finally"); + } + } + } + }, + + abrupt: function(type, arg) { + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + if (entry.tryLoc <= this.prev && + hasOwn.call(entry, "finallyLoc") && + this.prev < entry.finallyLoc) { + var finallyEntry = entry; + break; + } + } + + if (finallyEntry && + (type === "break" || + type === "continue") && + finallyEntry.tryLoc <= arg && + arg <= finallyEntry.finallyLoc) { + // Ignore the finally entry if control is not jumping to a + // location outside the try/catch block. + finallyEntry = null; + } + + var record = finallyEntry ? finallyEntry.completion : {}; + record.type = type; + record.arg = arg; + + if (finallyEntry) { + this.method = "next"; + this.next = finallyEntry.finallyLoc; + return ContinueSentinel; + } + + return this.complete(record); + }, + + complete: function(record, afterLoc) { + if (record.type === "throw") { + throw record.arg; + } + + if (record.type === "break" || + record.type === "continue") { + this.next = record.arg; + } else if (record.type === "return") { + this.rval = this.arg = record.arg; + this.method = "return"; + this.next = "end"; + } else if (record.type === "normal" && afterLoc) { + this.next = afterLoc; + } + + return ContinueSentinel; + }, + + finish: function(finallyLoc) { + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + if (entry.finallyLoc === finallyLoc) { + this.complete(entry.completion, entry.afterLoc); + resetTryEntry(entry); + return ContinueSentinel; + } + } + }, + + "catch": function(tryLoc) { + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + if (entry.tryLoc === tryLoc) { + var record = entry.completion; + if (record.type === "throw") { + var thrown = record.arg; + resetTryEntry(entry); + } + return thrown; + } + } + + // The context.catch method must only be called with a location + // argument that corresponds to a known catch block. + throw new Error("illegal catch attempt"); + }, + + delegateYield: function(iterable, resultName, nextLoc) { + this.delegate = { + iterator: values(iterable), + resultName: resultName, + nextLoc: nextLoc + }; + + if (this.method === "next") { + // Deliberately forget the last sent value so that we don't + // accidentally pass it on to the delegate. + this.arg = undefined; + } + + return ContinueSentinel; + } + }; + })( + // Among the various tricks for obtaining a reference to the global + // object, this seems to be the most reliable technique that does not + // use indirect eval (which violates Content Security Policy). + typeof global === "object" ? global : + typeof window === "object" ? window : + typeof self === "object" ? self : this + ); + + /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()))) + +/***/ }), +/* 329 */ +/***/ (function(module, exports, __webpack_require__) { + + __webpack_require__(330); + module.exports = __webpack_require__(9).RegExp.escape; + + +/***/ }), +/* 330 */ +/***/ (function(module, exports, __webpack_require__) { + + // https://github.com/benjamingr/RexExp.escape + var $export = __webpack_require__(8); + var $re = __webpack_require__(331)(/[\\^$*+?.()|[\]{}]/g, '\\$&'); + + $export($export.S, 'RegExp', { escape: function escape(it) { return $re(it); } }); + + +/***/ }), +/* 331 */ +/***/ (function(module, exports) { + + module.exports = function (regExp, replace) { + var replacer = replace === Object(replace) ? function (part) { + return replace[part]; + } : replace; + return function (it) { + return String(it).replace(regExp, replacer); + }; + }; + + +/***/ }), +/* 332 */ +/***/ (function(module, exports, __webpack_require__) { + + var BSON = __webpack_require__(333), + Binary = __webpack_require__(356), + Code = __webpack_require__(351), + DBRef = __webpack_require__(355), + Decimal128 = __webpack_require__(352), + Double = __webpack_require__(336), + Int32 = __webpack_require__(350), + Long = __webpack_require__(335), + Map = __webpack_require__(334), + MaxKey = __webpack_require__(354), + MinKey = __webpack_require__(353), + ObjectId = __webpack_require__(338), + BSONRegExp = __webpack_require__(348), + Symbol = __webpack_require__(349), + Timestamp = __webpack_require__(337); + + // BSON MAX VALUES + BSON.BSON_INT32_MAX = 0x7fffffff; + BSON.BSON_INT32_MIN = -0x80000000; + + BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; + BSON.BSON_INT64_MIN = -Math.pow(2, 63); + + // JS MAX PRECISE VALUES + BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. + BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + + // Add BSON types to function creation + BSON.Binary = Binary; + BSON.Code = Code; + BSON.DBRef = DBRef; + BSON.Decimal128 = Decimal128; + BSON.Double = Double; + BSON.Int32 = Int32; + BSON.Long = Long; + BSON.Map = Map; + BSON.MaxKey = MaxKey; + BSON.MinKey = MinKey; + BSON.ObjectId = ObjectId; + BSON.ObjectID = ObjectId; + BSON.BSONRegExp = BSONRegExp; + BSON.Symbol = Symbol; + BSON.Timestamp = Timestamp; + + // Return the BSON + module.exports = BSON; + +/***/ }), +/* 333 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var Map = __webpack_require__(334), + Long = __webpack_require__(335), + Double = __webpack_require__(336), + Timestamp = __webpack_require__(337), + ObjectID = __webpack_require__(338), + BSONRegExp = __webpack_require__(348), + Symbol = __webpack_require__(349), + Int32 = __webpack_require__(350), + Code = __webpack_require__(351), + Decimal128 = __webpack_require__(352), + MinKey = __webpack_require__(353), + MaxKey = __webpack_require__(354), + DBRef = __webpack_require__(355), + Binary = __webpack_require__(356); + + // Parts of the parser + var deserialize = __webpack_require__(357), + serializer = __webpack_require__(358), + calculateObjectSize = __webpack_require__(360), + utils = __webpack_require__(344); + + /** + * @ignore + * @api private + */ + // Default Max Size + var MAXSIZE = 1024 * 1024 * 17; + + // Current Internal Temporary Serialization Buffer + var buffer = utils.allocBuffer(MAXSIZE); + + var BSON = function () {}; + + /** + * Serialize a Javascript object. + * + * @param {Object} object the Javascript object to serialize. + * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid. + * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**. + * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**. + * @param {Number} [options.minInternalBufferSize=1024*1024*17] minimum size of the internal temporary serialization buffer **(default:1024*1024*17)**. + * @return {Buffer} returns the Buffer object containing the serialized object. + * @api public + */ + BSON.prototype.serialize = function serialize(object, options) { + options = options || {}; + // Unpack the options + var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false; + var serializeFunctions = typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false; + var ignoreUndefined = typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true; + var minInternalBufferSize = typeof options.minInternalBufferSize === 'number' ? options.minInternalBufferSize : MAXSIZE; + + // Resize the internal serialization buffer if needed + if (buffer.length < minInternalBufferSize) { + buffer = utils.allocBuffer(minInternalBufferSize); + } + + // Attempt to serialize + var serializationIndex = serializer(buffer, object, checkKeys, 0, 0, serializeFunctions, ignoreUndefined, []); + // Create the final buffer + var finishedBuffer = utils.allocBuffer(serializationIndex); + // Copy into the finished buffer + buffer.copy(finishedBuffer, 0, 0, finishedBuffer.length); + // Return the buffer + return finishedBuffer; + }; + + /** + * Serialize a Javascript object using a predefined Buffer and index into the buffer, useful when pre-allocating the space for serialization. + * + * @param {Object} object the Javascript object to serialize. + * @param {Buffer} buffer the Buffer you pre-allocated to store the serialized BSON object. + * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid. + * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**. + * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**. + * @param {Number} [options.index] the index in the buffer where we wish to start serializing into. + * @return {Number} returns the index pointing to the last written byte in the buffer. + * @api public + */ + BSON.prototype.serializeWithBufferAndIndex = function (object, finalBuffer, options) { + options = options || {}; + // Unpack the options + var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false; + var serializeFunctions = typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false; + var ignoreUndefined = typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true; + var startIndex = typeof options.index === 'number' ? options.index : 0; + + // Attempt to serialize + var serializationIndex = serializer(finalBuffer, object, checkKeys, startIndex || 0, 0, serializeFunctions, ignoreUndefined); + + // Return the index + return serializationIndex - 1; + }; + + /** + * Deserialize data as BSON. + * + * @param {Buffer} buffer the buffer containing the serialized set of BSON documents. + * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized. + * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse. + * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function. + * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits + * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance. + * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types. + * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer. + * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances. + * @return {Object} returns the deserialized Javascript Object. + * @api public + */ + BSON.prototype.deserialize = function (buffer, options) { + return deserialize(buffer, options); + }; + + /** + * Calculate the bson size for a passed in Javascript object. + * + * @param {Object} object the Javascript object to calculate the BSON byte size for. + * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**. + * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**. + * @return {Number} returns the number of bytes the BSON object will take up. + * @api public + */ + BSON.prototype.calculateObjectSize = function (object, options) { + options = options || {}; + + var serializeFunctions = typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false; + var ignoreUndefined = typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true; + + return calculateObjectSize(object, serializeFunctions, ignoreUndefined); + }; + + /** + * Deserialize stream data as BSON documents. + * + * @param {Buffer} data the buffer containing the serialized set of BSON documents. + * @param {Number} startIndex the start index in the data Buffer where the deserialization is to start. + * @param {Number} numberOfDocuments number of documents to deserialize. + * @param {Array} documents an array where to store the deserialized documents. + * @param {Number} docStartIndex the index in the documents array from where to start inserting documents. + * @param {Object} [options] additional options used for the deserialization. + * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized. + * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse. + * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function. + * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits + * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance. + * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types. + * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer. + * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances. + * @return {Number} returns the next index in the buffer after deserialization **x** numbers of documents. + * @api public + */ + BSON.prototype.deserializeStream = function (data, startIndex, numberOfDocuments, documents, docStartIndex, options) { + options = options != null ? options : {}; + var index = startIndex; + // Loop over all documents + for (var i = 0; i < numberOfDocuments; i++) { + // Find size of the document + var size = data[index] | data[index + 1] << 8 | data[index + 2] << 16 | data[index + 3] << 24; + // Update options with index + options['index'] = index; + // Parse the document at this point + documents[docStartIndex + i] = this.deserialize(data, options); + // Adjust index by the document size + index = index + size; + } + + // Return object containing end index of parsing and list of documents + return index; + }; + + /** + * @ignore + * @api private + */ + // BSON MAX VALUES + BSON.BSON_INT32_MAX = 0x7fffffff; + BSON.BSON_INT32_MIN = -0x80000000; + + BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; + BSON.BSON_INT64_MIN = -Math.pow(2, 63); + + // JS MAX PRECISE VALUES + BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. + BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + + // Internal long versions + // var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double. + // var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double. + + /** + * Number BSON Type + * + * @classconstant BSON_DATA_NUMBER + **/ + BSON.BSON_DATA_NUMBER = 1; + /** + * String BSON Type + * + * @classconstant BSON_DATA_STRING + **/ + BSON.BSON_DATA_STRING = 2; + /** + * Object BSON Type + * + * @classconstant BSON_DATA_OBJECT + **/ + BSON.BSON_DATA_OBJECT = 3; + /** + * Array BSON Type + * + * @classconstant BSON_DATA_ARRAY + **/ + BSON.BSON_DATA_ARRAY = 4; + /** + * Binary BSON Type + * + * @classconstant BSON_DATA_BINARY + **/ + BSON.BSON_DATA_BINARY = 5; + /** + * ObjectID BSON Type + * + * @classconstant BSON_DATA_OID + **/ + BSON.BSON_DATA_OID = 7; + /** + * Boolean BSON Type + * + * @classconstant BSON_DATA_BOOLEAN + **/ + BSON.BSON_DATA_BOOLEAN = 8; + /** + * Date BSON Type + * + * @classconstant BSON_DATA_DATE + **/ + BSON.BSON_DATA_DATE = 9; + /** + * null BSON Type + * + * @classconstant BSON_DATA_NULL + **/ + BSON.BSON_DATA_NULL = 10; + /** + * RegExp BSON Type + * + * @classconstant BSON_DATA_REGEXP + **/ + BSON.BSON_DATA_REGEXP = 11; + /** + * Code BSON Type + * + * @classconstant BSON_DATA_CODE + **/ + BSON.BSON_DATA_CODE = 13; + /** + * Symbol BSON Type + * + * @classconstant BSON_DATA_SYMBOL + **/ + BSON.BSON_DATA_SYMBOL = 14; + /** + * Code with Scope BSON Type + * + * @classconstant BSON_DATA_CODE_W_SCOPE + **/ + BSON.BSON_DATA_CODE_W_SCOPE = 15; + /** + * 32 bit Integer BSON Type + * + * @classconstant BSON_DATA_INT + **/ + BSON.BSON_DATA_INT = 16; + /** + * Timestamp BSON Type + * + * @classconstant BSON_DATA_TIMESTAMP + **/ + BSON.BSON_DATA_TIMESTAMP = 17; + /** + * Long BSON Type + * + * @classconstant BSON_DATA_LONG + **/ + BSON.BSON_DATA_LONG = 18; + /** + * MinKey BSON Type + * + * @classconstant BSON_DATA_MIN_KEY + **/ + BSON.BSON_DATA_MIN_KEY = 0xff; + /** + * MaxKey BSON Type + * + * @classconstant BSON_DATA_MAX_KEY + **/ + BSON.BSON_DATA_MAX_KEY = 0x7f; + + /** + * Binary Default Type + * + * @classconstant BSON_BINARY_SUBTYPE_DEFAULT + **/ + BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0; + /** + * Binary Function Type + * + * @classconstant BSON_BINARY_SUBTYPE_FUNCTION + **/ + BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1; + /** + * Binary Byte Array Type + * + * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY + **/ + BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2; + /** + * Binary UUID Type + * + * @classconstant BSON_BINARY_SUBTYPE_UUID + **/ + BSON.BSON_BINARY_SUBTYPE_UUID = 3; + /** + * Binary MD5 Type + * + * @classconstant BSON_BINARY_SUBTYPE_MD5 + **/ + BSON.BSON_BINARY_SUBTYPE_MD5 = 4; + /** + * Binary User Defined Type + * + * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED + **/ + BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128; + + // Return BSON + module.exports = BSON; + module.exports.Code = Code; + module.exports.Map = Map; + module.exports.Symbol = Symbol; + module.exports.BSON = BSON; + module.exports.DBRef = DBRef; + module.exports.Binary = Binary; + module.exports.ObjectID = ObjectID; + module.exports.Long = Long; + module.exports.Timestamp = Timestamp; + module.exports.Double = Double; + module.exports.Int32 = Int32; + module.exports.MinKey = MinKey; + module.exports.MaxKey = MaxKey; + module.exports.BSONRegExp = BSONRegExp; + module.exports.Decimal128 = Decimal128; + +/***/ }), +/* 334 */ +/***/ (function(module, exports) { + + /* WEBPACK VAR INJECTION */(function(global) {'use strict'; + + // We have an ES6 Map available, return the native instance + + if (typeof global.Map !== 'undefined') { + module.exports = global.Map; + module.exports.Map = global.Map; + } else { + // We will return a polyfill + var Map = function (array) { + this._keys = []; + this._values = {}; + + for (var i = 0; i < array.length; i++) { + if (array[i] == null) continue; // skip null and undefined + var entry = array[i]; + var key = entry[0]; + var value = entry[1]; + // Add the key to the list of keys in order + this._keys.push(key); + // Add the key and value to the values dictionary with a point + // to the location in the ordered keys list + this._values[key] = { v: value, i: this._keys.length - 1 }; + } + }; + + Map.prototype.clear = function () { + this._keys = []; + this._values = {}; + }; + + Map.prototype.delete = function (key) { + var value = this._values[key]; + if (value == null) return false; + // Delete entry + delete this._values[key]; + // Remove the key from the ordered keys list + this._keys.splice(value.i, 1); + return true; + }; + + Map.prototype.entries = function () { + var self = this; + var index = 0; + + return { + next: function () { + var key = self._keys[index++]; + return { + value: key !== undefined ? [key, self._values[key].v] : undefined, + done: key !== undefined ? false : true + }; + } + }; + }; + + Map.prototype.forEach = function (callback, self) { + self = self || this; + + for (var i = 0; i < this._keys.length; i++) { + var key = this._keys[i]; + // Call the forEach callback + callback.call(self, this._values[key].v, key, self); + } + }; + + Map.prototype.get = function (key) { + return this._values[key] ? this._values[key].v : undefined; + }; + + Map.prototype.has = function (key) { + return this._values[key] != null; + }; + + Map.prototype.keys = function () { + var self = this; + var index = 0; + + return { + next: function () { + var key = self._keys[index++]; + return { + value: key !== undefined ? key : undefined, + done: key !== undefined ? false : true + }; + } + }; + }; + + Map.prototype.set = function (key, value) { + if (this._values[key]) { + this._values[key].v = value; + return this; + } + + // Add the key to the list of keys in order + this._keys.push(key); + // Add the key and value to the values dictionary with a point + // to the location in the ordered keys list + this._values[key] = { v: value, i: this._keys.length - 1 }; + return this; + }; + + Map.prototype.values = function () { + var self = this; + var index = 0; + + return { + next: function () { + var key = self._keys[index++]; + return { + value: key !== undefined ? self._values[key].v : undefined, + done: key !== undefined ? false : true + }; + } + }; + }; + + // Last ismaster + Object.defineProperty(Map.prototype, 'size', { + enumerable: true, + get: function () { + return this._keys.length; + } + }); + + module.exports = Map; + module.exports.Map = Map; + } + /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()))) + +/***/ }), +/* 335 */ +/***/ (function(module, exports) { + + // Licensed under the Apache License, Version 2.0 (the "License"); + // you may not use this file except in compliance with the License. + // You may obtain a copy of the License at + // + // http://www.apache.org/licenses/LICENSE-2.0 + // + // Unless required by applicable law or agreed to in writing, software + // distributed under the License is distributed on an "AS IS" BASIS, + // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + // See the License for the specific language governing permissions and + // limitations under the License. + // + // Copyright 2009 Google Inc. All Rights Reserved + + /** + * Defines a Long class for representing a 64-bit two's-complement + * integer value, which faithfully simulates the behavior of a Java "Long". This + * implementation is derived from LongLib in GWT. + * + * Constructs a 64-bit two's-complement integer, given its low and high 32-bit + * values as *signed* integers. See the from* functions below for more + * convenient ways of constructing Longs. + * + * The internal representation of a Long is the two given signed, 32-bit values. + * We use 32-bit pieces because these are the size of integers on which + * Javascript performs bit-operations. For operations like addition and + * multiplication, we split each number into 16-bit pieces, which can easily be + * multiplied within Javascript's floating-point representation without overflow + * or change in sign. + * + * In the algorithms below, we frequently reduce the negative case to the + * positive case by negating the input(s) and then post-processing the result. + * Note that we must ALWAYS check specially whether those values are MIN_VALUE + * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as + * a positive number, it overflows back into a negative). Not handling this + * case would often result in infinite recursion. + * + * @class + * @param {number} low the low (signed) 32 bits of the Long. + * @param {number} high the high (signed) 32 bits of the Long. + * @return {Long} + */ + function Long(low, high) { + if (!(this instanceof Long)) return new Long(low, high); + + this._bsontype = 'Long'; + /** + * @type {number} + * @ignore + */ + this.low_ = low | 0; // force into 32 signed bits. + + /** + * @type {number} + * @ignore + */ + this.high_ = high | 0; // force into 32 signed bits. + } + + /** + * Return the int value. + * + * @method + * @return {number} the value, assuming it is a 32-bit integer. + */ + Long.prototype.toInt = function () { + return this.low_; + }; + + /** + * Return the Number value. + * + * @method + * @return {number} the closest floating-point representation to this value. + */ + Long.prototype.toNumber = function () { + return this.high_ * Long.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned(); + }; + + /** + * Return the JSON value. + * + * @method + * @return {string} the JSON representation. + */ + Long.prototype.toJSON = function () { + return this.toString(); + }; + + /** + * Return the String value. + * + * @method + * @param {number} [opt_radix] the radix in which the text should be written. + * @return {string} the textual representation of this value. + */ + Long.prototype.toString = function (opt_radix) { + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (this.isZero()) { + return '0'; + } + + if (this.isNegative()) { + if (this.equals(Long.MIN_VALUE)) { + // We need to change the Long value before it can be negated, so we remove + // the bottom-most digit in this base and then recurse to do the rest. + var radixLong = Long.fromNumber(radix); + var div = this.div(radixLong); + var rem = div.multiply(radixLong).subtract(this); + return div.toString(radix) + rem.toInt().toString(radix); + } else { + return '-' + this.negate().toString(radix); + } + } + + // Do several (6) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Long.fromNumber(Math.pow(radix, 6)); + + rem = this; + var result = ''; + + while (!rem.isZero()) { + var remDiv = rem.div(radixToPower); + var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt(); + var digits = intval.toString(radix); + + rem = remDiv; + if (rem.isZero()) { + return digits + result; + } else { + while (digits.length < 6) { + digits = '0' + digits; + } + result = '' + digits + result; + } + } + }; + + /** + * Return the high 32-bits value. + * + * @method + * @return {number} the high 32-bits as a signed value. + */ + Long.prototype.getHighBits = function () { + return this.high_; + }; + + /** + * Return the low 32-bits value. + * + * @method + * @return {number} the low 32-bits as a signed value. + */ + Long.prototype.getLowBits = function () { + return this.low_; + }; + + /** + * Return the low unsigned 32-bits value. + * + * @method + * @return {number} the low 32-bits as an unsigned value. + */ + Long.prototype.getLowBitsUnsigned = function () { + return this.low_ >= 0 ? this.low_ : Long.TWO_PWR_32_DBL_ + this.low_; + }; + + /** + * Returns the number of bits needed to represent the absolute value of this Long. + * + * @method + * @return {number} Returns the number of bits needed to represent the absolute value of this Long. + */ + Long.prototype.getNumBitsAbs = function () { + if (this.isNegative()) { + if (this.equals(Long.MIN_VALUE)) { + return 64; + } else { + return this.negate().getNumBitsAbs(); + } + } else { + var val = this.high_ !== 0 ? this.high_ : this.low_; + for (var bit = 31; bit > 0; bit--) { + if ((val & 1 << bit) !== 0) { + break; + } + } + return this.high_ !== 0 ? bit + 33 : bit + 1; + } + }; + + /** + * Return whether this value is zero. + * + * @method + * @return {boolean} whether this value is zero. + */ + Long.prototype.isZero = function () { + return this.high_ === 0 && this.low_ === 0; + }; + + /** + * Return whether this value is negative. + * + * @method + * @return {boolean} whether this value is negative. + */ + Long.prototype.isNegative = function () { + return this.high_ < 0; + }; + + /** + * Return whether this value is odd. + * + * @method + * @return {boolean} whether this value is odd. + */ + Long.prototype.isOdd = function () { + return (this.low_ & 1) === 1; + }; + + /** + * Return whether this Long equals the other + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long equals the other + */ + Long.prototype.equals = function (other) { + return this.high_ === other.high_ && this.low_ === other.low_; + }; + + /** + * Return whether this Long does not equal the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long does not equal the other. + */ + Long.prototype.notEquals = function (other) { + return this.high_ !== other.high_ || this.low_ !== other.low_; + }; + + /** + * Return whether this Long is less than the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is less than the other. + */ + Long.prototype.lessThan = function (other) { + return this.compare(other) < 0; + }; + + /** + * Return whether this Long is less than or equal to the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is less than or equal to the other. + */ + Long.prototype.lessThanOrEqual = function (other) { + return this.compare(other) <= 0; + }; + + /** + * Return whether this Long is greater than the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is greater than the other. + */ + Long.prototype.greaterThan = function (other) { + return this.compare(other) > 0; + }; + + /** + * Return whether this Long is greater than or equal to the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is greater than or equal to the other. + */ + Long.prototype.greaterThanOrEqual = function (other) { + return this.compare(other) >= 0; + }; + + /** + * Compares this Long with the given one. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater. + */ + Long.prototype.compare = function (other) { + if (this.equals(other)) { + return 0; + } + + var thisNeg = this.isNegative(); + var otherNeg = other.isNegative(); + if (thisNeg && !otherNeg) { + return -1; + } + if (!thisNeg && otherNeg) { + return 1; + } + + // at this point, the signs are the same, so subtraction will not overflow + if (this.subtract(other).isNegative()) { + return -1; + } else { + return 1; + } + }; + + /** + * The negation of this value. + * + * @method + * @return {Long} the negation of this value. + */ + Long.prototype.negate = function () { + if (this.equals(Long.MIN_VALUE)) { + return Long.MIN_VALUE; + } else { + return this.not().add(Long.ONE); + } + }; + + /** + * Returns the sum of this and the given Long. + * + * @method + * @param {Long} other Long to add to this one. + * @return {Long} the sum of this and the given Long. + */ + Long.prototype.add = function (other) { + // Divide each number into 4 chunks of 16 bits, and then sum the chunks. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 + b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 + b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 + b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 + b48; + c48 &= 0xffff; + return Long.fromBits(c16 << 16 | c00, c48 << 16 | c32); + }; + + /** + * Returns the difference of this and the given Long. + * + * @method + * @param {Long} other Long to subtract from this. + * @return {Long} the difference of this and the given Long. + */ + Long.prototype.subtract = function (other) { + return this.add(other.negate()); + }; + + /** + * Returns the product of this and the given Long. + * + * @method + * @param {Long} other Long to multiply with this. + * @return {Long} the product of this and the other. + */ + Long.prototype.multiply = function (other) { + if (this.isZero()) { + return Long.ZERO; + } else if (other.isZero()) { + return Long.ZERO; + } + + if (this.equals(Long.MIN_VALUE)) { + return other.isOdd() ? Long.MIN_VALUE : Long.ZERO; + } else if (other.equals(Long.MIN_VALUE)) { + return this.isOdd() ? Long.MIN_VALUE : Long.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().multiply(other.negate()); + } else { + return this.negate().multiply(other).negate(); + } + } else if (other.isNegative()) { + return this.multiply(other.negate()).negate(); + } + + // If both Longs are small, use float multiplication + if (this.lessThan(Long.TWO_PWR_24_) && other.lessThan(Long.TWO_PWR_24_)) { + return Long.fromNumber(this.toNumber() * other.toNumber()); + } + + // Divide each Long into 4 chunks of 16 bits, and then add up 4x4 products. + // We can skip products that would overflow. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 * b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 * b00; + c32 += c16 >>> 16; + c16 &= 0xffff; + c16 += a00 * b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 * b00; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a16 * b16; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a00 * b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48; + c48 &= 0xffff; + return Long.fromBits(c16 << 16 | c00, c48 << 16 | c32); + }; + + /** + * Returns this Long divided by the given one. + * + * @method + * @param {Long} other Long by which to divide. + * @return {Long} this Long divided by the given one. + */ + Long.prototype.div = function (other) { + if (other.isZero()) { + throw Error('division by zero'); + } else if (this.isZero()) { + return Long.ZERO; + } + + if (this.equals(Long.MIN_VALUE)) { + if (other.equals(Long.ONE) || other.equals(Long.NEG_ONE)) { + return Long.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE + } else if (other.equals(Long.MIN_VALUE)) { + return Long.ONE; + } else { + // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|. + var halfThis = this.shiftRight(1); + var approx = halfThis.div(other).shiftLeft(1); + if (approx.equals(Long.ZERO)) { + return other.isNegative() ? Long.ONE : Long.NEG_ONE; + } else { + var rem = this.subtract(other.multiply(approx)); + var result = approx.add(rem.div(other)); + return result; + } + } + } else if (other.equals(Long.MIN_VALUE)) { + return Long.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().div(other.negate()); + } else { + return this.negate().div(other).negate(); + } + } else if (other.isNegative()) { + return this.div(other.negate()).negate(); + } + + // Repeat the following until the remainder is less than other: find a + // floating-point that approximates remainder / other *from below*, add this + // into the result, and subtract it from the remainder. It is critical that + // the approximate value is less than or equal to the real value so that the + // remainder never becomes negative. + var res = Long.ZERO; + rem = this; + while (rem.greaterThanOrEqual(other)) { + // Approximate the result of division. This may be a little greater or + // smaller than the actual value. + approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber())); + + // We will tweak the approximate result by changing it in the 48-th digit or + // the smallest non-fractional digit, whichever is larger. + var log2 = Math.ceil(Math.log(approx) / Math.LN2); + var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48); + + // Decrease the approximation until it is smaller than the remainder. Note + // that if it is too large, the product overflows and is negative. + var approxRes = Long.fromNumber(approx); + var approxRem = approxRes.multiply(other); + while (approxRem.isNegative() || approxRem.greaterThan(rem)) { + approx -= delta; + approxRes = Long.fromNumber(approx); + approxRem = approxRes.multiply(other); + } + + // We know the answer can't be zero... and actually, zero would cause + // infinite recursion since we would make no progress. + if (approxRes.isZero()) { + approxRes = Long.ONE; + } + + res = res.add(approxRes); + rem = rem.subtract(approxRem); + } + return res; + }; + + /** + * Returns this Long modulo the given one. + * + * @method + * @param {Long} other Long by which to mod. + * @return {Long} this Long modulo the given one. + */ + Long.prototype.modulo = function (other) { + return this.subtract(this.div(other).multiply(other)); + }; + + /** + * The bitwise-NOT of this value. + * + * @method + * @return {Long} the bitwise-NOT of this value. + */ + Long.prototype.not = function () { + return Long.fromBits(~this.low_, ~this.high_); + }; + + /** + * Returns the bitwise-AND of this Long and the given one. + * + * @method + * @param {Long} other the Long with which to AND. + * @return {Long} the bitwise-AND of this and the other. + */ + Long.prototype.and = function (other) { + return Long.fromBits(this.low_ & other.low_, this.high_ & other.high_); + }; + + /** + * Returns the bitwise-OR of this Long and the given one. + * + * @method + * @param {Long} other the Long with which to OR. + * @return {Long} the bitwise-OR of this and the other. + */ + Long.prototype.or = function (other) { + return Long.fromBits(this.low_ | other.low_, this.high_ | other.high_); + }; + + /** + * Returns the bitwise-XOR of this Long and the given one. + * + * @method + * @param {Long} other the Long with which to XOR. + * @return {Long} the bitwise-XOR of this and the other. + */ + Long.prototype.xor = function (other) { + return Long.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_); + }; + + /** + * Returns this Long with bits shifted to the left by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Long} this shifted to the left by the given amount. + */ + Long.prototype.shiftLeft = function (numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var low = this.low_; + if (numBits < 32) { + var high = this.high_; + return Long.fromBits(low << numBits, high << numBits | low >>> 32 - numBits); + } else { + return Long.fromBits(0, low << numBits - 32); + } + } + }; + + /** + * Returns this Long with bits shifted to the right by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Long} this shifted to the right by the given amount. + */ + Long.prototype.shiftRight = function (numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Long.fromBits(low >>> numBits | high << 32 - numBits, high >> numBits); + } else { + return Long.fromBits(high >> numBits - 32, high >= 0 ? 0 : -1); + } + } + }; + + /** + * Returns this Long with bits shifted to the right by the given amount, with the new top bits matching the current sign bit. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Long} this shifted to the right by the given amount, with zeros placed into the new leading bits. + */ + Long.prototype.shiftRightUnsigned = function (numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Long.fromBits(low >>> numBits | high << 32 - numBits, high >>> numBits); + } else if (numBits === 32) { + return Long.fromBits(high, 0); + } else { + return Long.fromBits(high >>> numBits - 32, 0); + } + } + }; + + /** + * Returns a Long representing the given (32-bit) integer value. + * + * @method + * @param {number} value the 32-bit integer in question. + * @return {Long} the corresponding Long value. + */ + Long.fromInt = function (value) { + if (-128 <= value && value < 128) { + var cachedObj = Long.INT_CACHE_[value]; + if (cachedObj) { + return cachedObj; + } + } + + var obj = new Long(value | 0, value < 0 ? -1 : 0); + if (-128 <= value && value < 128) { + Long.INT_CACHE_[value] = obj; + } + return obj; + }; + + /** + * Returns a Long representing the given value, provided that it is a finite number. Otherwise, zero is returned. + * + * @method + * @param {number} value the number in question. + * @return {Long} the corresponding Long value. + */ + Long.fromNumber = function (value) { + if (isNaN(value) || !isFinite(value)) { + return Long.ZERO; + } else if (value <= -Long.TWO_PWR_63_DBL_) { + return Long.MIN_VALUE; + } else if (value + 1 >= Long.TWO_PWR_63_DBL_) { + return Long.MAX_VALUE; + } else if (value < 0) { + return Long.fromNumber(-value).negate(); + } else { + return new Long(value % Long.TWO_PWR_32_DBL_ | 0, value / Long.TWO_PWR_32_DBL_ | 0); + } + }; + + /** + * Returns a Long representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits. + * + * @method + * @param {number} lowBits the low 32-bits. + * @param {number} highBits the high 32-bits. + * @return {Long} the corresponding Long value. + */ + Long.fromBits = function (lowBits, highBits) { + return new Long(lowBits, highBits); + }; + + /** + * Returns a Long representation of the given string, written using the given radix. + * + * @method + * @param {string} str the textual representation of the Long. + * @param {number} opt_radix the radix in which the text is written. + * @return {Long} the corresponding Long value. + */ + Long.fromString = function (str, opt_radix) { + if (str.length === 0) { + throw Error('number format error: empty string'); + } + + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (str.charAt(0) === '-') { + return Long.fromString(str.substring(1), radix).negate(); + } else if (str.indexOf('-') >= 0) { + throw Error('number format error: interior "-" character: ' + str); + } + + // Do several (8) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Long.fromNumber(Math.pow(radix, 8)); + + var result = Long.ZERO; + for (var i = 0; i < str.length; i += 8) { + var size = Math.min(8, str.length - i); + var value = parseInt(str.substring(i, i + size), radix); + if (size < 8) { + var power = Long.fromNumber(Math.pow(radix, size)); + result = result.multiply(power).add(Long.fromNumber(value)); + } else { + result = result.multiply(radixToPower); + result = result.add(Long.fromNumber(value)); + } + } + return result; + }; + + // NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the + // from* methods on which they depend. + + /** + * A cache of the Long representations of small integer values. + * @type {Object} + * @ignore + */ + Long.INT_CACHE_ = {}; + + // NOTE: the compiler should inline these constant values below and then remove + // these variables, so there should be no runtime penalty for these. + + /** + * Number used repeated below in calculations. This must appear before the + * first call to any from* function below. + * @type {number} + * @ignore + */ + Long.TWO_PWR_16_DBL_ = 1 << 16; + + /** + * @type {number} + * @ignore + */ + Long.TWO_PWR_24_DBL_ = 1 << 24; + + /** + * @type {number} + * @ignore + */ + Long.TWO_PWR_32_DBL_ = Long.TWO_PWR_16_DBL_ * Long.TWO_PWR_16_DBL_; + + /** + * @type {number} + * @ignore + */ + Long.TWO_PWR_31_DBL_ = Long.TWO_PWR_32_DBL_ / 2; + + /** + * @type {number} + * @ignore + */ + Long.TWO_PWR_48_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_16_DBL_; + + /** + * @type {number} + * @ignore + */ + Long.TWO_PWR_64_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_32_DBL_; + + /** + * @type {number} + * @ignore + */ + Long.TWO_PWR_63_DBL_ = Long.TWO_PWR_64_DBL_ / 2; + + /** @type {Long} */ + Long.ZERO = Long.fromInt(0); + + /** @type {Long} */ + Long.ONE = Long.fromInt(1); + + /** @type {Long} */ + Long.NEG_ONE = Long.fromInt(-1); + + /** @type {Long} */ + Long.MAX_VALUE = Long.fromBits(0xffffffff | 0, 0x7fffffff | 0); + + /** @type {Long} */ + Long.MIN_VALUE = Long.fromBits(0, 0x80000000 | 0); + + /** + * @type {Long} + * @ignore + */ + Long.TWO_PWR_24_ = Long.fromInt(1 << 24); + + /** + * Expose. + */ + module.exports = Long; + module.exports.Long = Long; + +/***/ }), +/* 336 */ +/***/ (function(module, exports) { + + /** + * A class representation of the BSON Double type. + * + * @class + * @param {number} value the number we want to represent as a double. + * @return {Double} + */ + function Double(value) { + if (!(this instanceof Double)) return new Double(value); + + this._bsontype = 'Double'; + this.value = value; + } + + /** + * Access the number value. + * + * @method + * @return {number} returns the wrapped double number. + */ + Double.prototype.valueOf = function () { + return this.value; + }; + + /** + * @ignore + */ + Double.prototype.toJSON = function () { + return this.value; + }; + + module.exports = Double; + module.exports.Double = Double; + +/***/ }), +/* 337 */ +/***/ (function(module, exports) { + + // Licensed under the Apache License, Version 2.0 (the "License"); + // you may not use this file except in compliance with the License. + // You may obtain a copy of the License at + // + // http://www.apache.org/licenses/LICENSE-2.0 + // + // Unless required by applicable law or agreed to in writing, software + // distributed under the License is distributed on an "AS IS" BASIS, + // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + // See the License for the specific language governing permissions and + // limitations under the License. + // + // Copyright 2009 Google Inc. All Rights Reserved + + /** + * This type is for INTERNAL use in MongoDB only and should not be used in applications. + * The appropriate corresponding type is the JavaScript Date type. + * + * Defines a Timestamp class for representing a 64-bit two's-complement + * integer value, which faithfully simulates the behavior of a Java "Timestamp". This + * implementation is derived from TimestampLib in GWT. + * + * Constructs a 64-bit two's-complement integer, given its low and high 32-bit + * values as *signed* integers. See the from* functions below for more + * convenient ways of constructing Timestamps. + * + * The internal representation of a Timestamp is the two given signed, 32-bit values. + * We use 32-bit pieces because these are the size of integers on which + * Javascript performs bit-operations. For operations like addition and + * multiplication, we split each number into 16-bit pieces, which can easily be + * multiplied within Javascript's floating-point representation without overflow + * or change in sign. + * + * In the algorithms below, we frequently reduce the negative case to the + * positive case by negating the input(s) and then post-processing the result. + * Note that we must ALWAYS check specially whether those values are MIN_VALUE + * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as + * a positive number, it overflows back into a negative). Not handling this + * case would often result in infinite recursion. + * + * @class + * @param {number} low the low (signed) 32 bits of the Timestamp. + * @param {number} high the high (signed) 32 bits of the Timestamp. + */ + function Timestamp(low, high) { + if (!(this instanceof Timestamp)) return new Timestamp(low, high); + this._bsontype = 'Timestamp'; + /** + * @type {number} + * @ignore + */ + this.low_ = low | 0; // force into 32 signed bits. + + /** + * @type {number} + * @ignore + */ + this.high_ = high | 0; // force into 32 signed bits. + } + + /** + * Return the int value. + * + * @return {number} the value, assuming it is a 32-bit integer. + */ + Timestamp.prototype.toInt = function () { + return this.low_; + }; + + /** + * Return the Number value. + * + * @method + * @return {number} the closest floating-point representation to this value. + */ + Timestamp.prototype.toNumber = function () { + return this.high_ * Timestamp.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned(); + }; + + /** + * Return the JSON value. + * + * @method + * @return {string} the JSON representation. + */ + Timestamp.prototype.toJSON = function () { + return this.toString(); + }; + + /** + * Return the String value. + * + * @method + * @param {number} [opt_radix] the radix in which the text should be written. + * @return {string} the textual representation of this value. + */ + Timestamp.prototype.toString = function (opt_radix) { + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (this.isZero()) { + return '0'; + } + + if (this.isNegative()) { + if (this.equals(Timestamp.MIN_VALUE)) { + // We need to change the Timestamp value before it can be negated, so we remove + // the bottom-most digit in this base and then recurse to do the rest. + var radixTimestamp = Timestamp.fromNumber(radix); + var div = this.div(radixTimestamp); + var rem = div.multiply(radixTimestamp).subtract(this); + return div.toString(radix) + rem.toInt().toString(radix); + } else { + return '-' + this.negate().toString(radix); + } + } + + // Do several (6) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Timestamp.fromNumber(Math.pow(radix, 6)); + + rem = this; + var result = ''; + + while (!rem.isZero()) { + var remDiv = rem.div(radixToPower); + var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt(); + var digits = intval.toString(radix); + + rem = remDiv; + if (rem.isZero()) { + return digits + result; + } else { + while (digits.length < 6) { + digits = '0' + digits; + } + result = '' + digits + result; + } + } + }; + + /** + * Return the high 32-bits value. + * + * @method + * @return {number} the high 32-bits as a signed value. + */ + Timestamp.prototype.getHighBits = function () { + return this.high_; + }; + + /** + * Return the low 32-bits value. + * + * @method + * @return {number} the low 32-bits as a signed value. + */ + Timestamp.prototype.getLowBits = function () { + return this.low_; + }; + + /** + * Return the low unsigned 32-bits value. + * + * @method + * @return {number} the low 32-bits as an unsigned value. + */ + Timestamp.prototype.getLowBitsUnsigned = function () { + return this.low_ >= 0 ? this.low_ : Timestamp.TWO_PWR_32_DBL_ + this.low_; + }; + + /** + * Returns the number of bits needed to represent the absolute value of this Timestamp. + * + * @method + * @return {number} Returns the number of bits needed to represent the absolute value of this Timestamp. + */ + Timestamp.prototype.getNumBitsAbs = function () { + if (this.isNegative()) { + if (this.equals(Timestamp.MIN_VALUE)) { + return 64; + } else { + return this.negate().getNumBitsAbs(); + } + } else { + var val = this.high_ !== 0 ? this.high_ : this.low_; + for (var bit = 31; bit > 0; bit--) { + if ((val & 1 << bit) !== 0) { + break; + } + } + return this.high_ !== 0 ? bit + 33 : bit + 1; + } + }; + + /** + * Return whether this value is zero. + * + * @method + * @return {boolean} whether this value is zero. + */ + Timestamp.prototype.isZero = function () { + return this.high_ === 0 && this.low_ === 0; + }; + + /** + * Return whether this value is negative. + * + * @method + * @return {boolean} whether this value is negative. + */ + Timestamp.prototype.isNegative = function () { + return this.high_ < 0; + }; + + /** + * Return whether this value is odd. + * + * @method + * @return {boolean} whether this value is odd. + */ + Timestamp.prototype.isOdd = function () { + return (this.low_ & 1) === 1; + }; + + /** + * Return whether this Timestamp equals the other + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp equals the other + */ + Timestamp.prototype.equals = function (other) { + return this.high_ === other.high_ && this.low_ === other.low_; + }; + + /** + * Return whether this Timestamp does not equal the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp does not equal the other. + */ + Timestamp.prototype.notEquals = function (other) { + return this.high_ !== other.high_ || this.low_ !== other.low_; + }; + + /** + * Return whether this Timestamp is less than the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is less than the other. + */ + Timestamp.prototype.lessThan = function (other) { + return this.compare(other) < 0; + }; + + /** + * Return whether this Timestamp is less than or equal to the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is less than or equal to the other. + */ + Timestamp.prototype.lessThanOrEqual = function (other) { + return this.compare(other) <= 0; + }; + + /** + * Return whether this Timestamp is greater than the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is greater than the other. + */ + Timestamp.prototype.greaterThan = function (other) { + return this.compare(other) > 0; + }; + + /** + * Return whether this Timestamp is greater than or equal to the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is greater than or equal to the other. + */ + Timestamp.prototype.greaterThanOrEqual = function (other) { + return this.compare(other) >= 0; + }; + + /** + * Compares this Timestamp with the given one. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater. + */ + Timestamp.prototype.compare = function (other) { + if (this.equals(other)) { + return 0; + } + + var thisNeg = this.isNegative(); + var otherNeg = other.isNegative(); + if (thisNeg && !otherNeg) { + return -1; + } + if (!thisNeg && otherNeg) { + return 1; + } + + // at this point, the signs are the same, so subtraction will not overflow + if (this.subtract(other).isNegative()) { + return -1; + } else { + return 1; + } + }; + + /** + * The negation of this value. + * + * @method + * @return {Timestamp} the negation of this value. + */ + Timestamp.prototype.negate = function () { + if (this.equals(Timestamp.MIN_VALUE)) { + return Timestamp.MIN_VALUE; + } else { + return this.not().add(Timestamp.ONE); + } + }; + + /** + * Returns the sum of this and the given Timestamp. + * + * @method + * @param {Timestamp} other Timestamp to add to this one. + * @return {Timestamp} the sum of this and the given Timestamp. + */ + Timestamp.prototype.add = function (other) { + // Divide each number into 4 chunks of 16 bits, and then sum the chunks. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 + b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 + b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 + b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 + b48; + c48 &= 0xffff; + return Timestamp.fromBits(c16 << 16 | c00, c48 << 16 | c32); + }; + + /** + * Returns the difference of this and the given Timestamp. + * + * @method + * @param {Timestamp} other Timestamp to subtract from this. + * @return {Timestamp} the difference of this and the given Timestamp. + */ + Timestamp.prototype.subtract = function (other) { + return this.add(other.negate()); + }; + + /** + * Returns the product of this and the given Timestamp. + * + * @method + * @param {Timestamp} other Timestamp to multiply with this. + * @return {Timestamp} the product of this and the other. + */ + Timestamp.prototype.multiply = function (other) { + if (this.isZero()) { + return Timestamp.ZERO; + } else if (other.isZero()) { + return Timestamp.ZERO; + } + + if (this.equals(Timestamp.MIN_VALUE)) { + return other.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO; + } else if (other.equals(Timestamp.MIN_VALUE)) { + return this.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().multiply(other.negate()); + } else { + return this.negate().multiply(other).negate(); + } + } else if (other.isNegative()) { + return this.multiply(other.negate()).negate(); + } + + // If both Timestamps are small, use float multiplication + if (this.lessThan(Timestamp.TWO_PWR_24_) && other.lessThan(Timestamp.TWO_PWR_24_)) { + return Timestamp.fromNumber(this.toNumber() * other.toNumber()); + } + + // Divide each Timestamp into 4 chunks of 16 bits, and then add up 4x4 products. + // We can skip products that would overflow. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 * b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 * b00; + c32 += c16 >>> 16; + c16 &= 0xffff; + c16 += a00 * b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 * b00; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a16 * b16; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a00 * b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48; + c48 &= 0xffff; + return Timestamp.fromBits(c16 << 16 | c00, c48 << 16 | c32); + }; + + /** + * Returns this Timestamp divided by the given one. + * + * @method + * @param {Timestamp} other Timestamp by which to divide. + * @return {Timestamp} this Timestamp divided by the given one. + */ + Timestamp.prototype.div = function (other) { + if (other.isZero()) { + throw Error('division by zero'); + } else if (this.isZero()) { + return Timestamp.ZERO; + } + + if (this.equals(Timestamp.MIN_VALUE)) { + if (other.equals(Timestamp.ONE) || other.equals(Timestamp.NEG_ONE)) { + return Timestamp.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE + } else if (other.equals(Timestamp.MIN_VALUE)) { + return Timestamp.ONE; + } else { + // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|. + var halfThis = this.shiftRight(1); + var approx = halfThis.div(other).shiftLeft(1); + if (approx.equals(Timestamp.ZERO)) { + return other.isNegative() ? Timestamp.ONE : Timestamp.NEG_ONE; + } else { + var rem = this.subtract(other.multiply(approx)); + var result = approx.add(rem.div(other)); + return result; + } + } + } else if (other.equals(Timestamp.MIN_VALUE)) { + return Timestamp.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().div(other.negate()); + } else { + return this.negate().div(other).negate(); + } + } else if (other.isNegative()) { + return this.div(other.negate()).negate(); + } + + // Repeat the following until the remainder is less than other: find a + // floating-point that approximates remainder / other *from below*, add this + // into the result, and subtract it from the remainder. It is critical that + // the approximate value is less than or equal to the real value so that the + // remainder never becomes negative. + var res = Timestamp.ZERO; + rem = this; + while (rem.greaterThanOrEqual(other)) { + // Approximate the result of division. This may be a little greater or + // smaller than the actual value. + approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber())); + + // We will tweak the approximate result by changing it in the 48-th digit or + // the smallest non-fractional digit, whichever is larger. + var log2 = Math.ceil(Math.log(approx) / Math.LN2); + var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48); + + // Decrease the approximation until it is smaller than the remainder. Note + // that if it is too large, the product overflows and is negative. + var approxRes = Timestamp.fromNumber(approx); + var approxRem = approxRes.multiply(other); + while (approxRem.isNegative() || approxRem.greaterThan(rem)) { + approx -= delta; + approxRes = Timestamp.fromNumber(approx); + approxRem = approxRes.multiply(other); + } + + // We know the answer can't be zero... and actually, zero would cause + // infinite recursion since we would make no progress. + if (approxRes.isZero()) { + approxRes = Timestamp.ONE; + } + + res = res.add(approxRes); + rem = rem.subtract(approxRem); + } + return res; + }; + + /** + * Returns this Timestamp modulo the given one. + * + * @method + * @param {Timestamp} other Timestamp by which to mod. + * @return {Timestamp} this Timestamp modulo the given one. + */ + Timestamp.prototype.modulo = function (other) { + return this.subtract(this.div(other).multiply(other)); + }; + + /** + * The bitwise-NOT of this value. + * + * @method + * @return {Timestamp} the bitwise-NOT of this value. + */ + Timestamp.prototype.not = function () { + return Timestamp.fromBits(~this.low_, ~this.high_); + }; + + /** + * Returns the bitwise-AND of this Timestamp and the given one. + * + * @method + * @param {Timestamp} other the Timestamp with which to AND. + * @return {Timestamp} the bitwise-AND of this and the other. + */ + Timestamp.prototype.and = function (other) { + return Timestamp.fromBits(this.low_ & other.low_, this.high_ & other.high_); + }; + + /** + * Returns the bitwise-OR of this Timestamp and the given one. + * + * @method + * @param {Timestamp} other the Timestamp with which to OR. + * @return {Timestamp} the bitwise-OR of this and the other. + */ + Timestamp.prototype.or = function (other) { + return Timestamp.fromBits(this.low_ | other.low_, this.high_ | other.high_); + }; + + /** + * Returns the bitwise-XOR of this Timestamp and the given one. + * + * @method + * @param {Timestamp} other the Timestamp with which to XOR. + * @return {Timestamp} the bitwise-XOR of this and the other. + */ + Timestamp.prototype.xor = function (other) { + return Timestamp.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_); + }; + + /** + * Returns this Timestamp with bits shifted to the left by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Timestamp} this shifted to the left by the given amount. + */ + Timestamp.prototype.shiftLeft = function (numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var low = this.low_; + if (numBits < 32) { + var high = this.high_; + return Timestamp.fromBits(low << numBits, high << numBits | low >>> 32 - numBits); + } else { + return Timestamp.fromBits(0, low << numBits - 32); + } + } + }; + + /** + * Returns this Timestamp with bits shifted to the right by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Timestamp} this shifted to the right by the given amount. + */ + Timestamp.prototype.shiftRight = function (numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Timestamp.fromBits(low >>> numBits | high << 32 - numBits, high >> numBits); + } else { + return Timestamp.fromBits(high >> numBits - 32, high >= 0 ? 0 : -1); + } + } + }; + + /** + * Returns this Timestamp with bits shifted to the right by the given amount, with the new top bits matching the current sign bit. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Timestamp} this shifted to the right by the given amount, with zeros placed into the new leading bits. + */ + Timestamp.prototype.shiftRightUnsigned = function (numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Timestamp.fromBits(low >>> numBits | high << 32 - numBits, high >>> numBits); + } else if (numBits === 32) { + return Timestamp.fromBits(high, 0); + } else { + return Timestamp.fromBits(high >>> numBits - 32, 0); + } + } + }; + + /** + * Returns a Timestamp representing the given (32-bit) integer value. + * + * @method + * @param {number} value the 32-bit integer in question. + * @return {Timestamp} the corresponding Timestamp value. + */ + Timestamp.fromInt = function (value) { + if (-128 <= value && value < 128) { + var cachedObj = Timestamp.INT_CACHE_[value]; + if (cachedObj) { + return cachedObj; + } + } + + var obj = new Timestamp(value | 0, value < 0 ? -1 : 0); + if (-128 <= value && value < 128) { + Timestamp.INT_CACHE_[value] = obj; + } + return obj; + }; + + /** + * Returns a Timestamp representing the given value, provided that it is a finite number. Otherwise, zero is returned. + * + * @method + * @param {number} value the number in question. + * @return {Timestamp} the corresponding Timestamp value. + */ + Timestamp.fromNumber = function (value) { + if (isNaN(value) || !isFinite(value)) { + return Timestamp.ZERO; + } else if (value <= -Timestamp.TWO_PWR_63_DBL_) { + return Timestamp.MIN_VALUE; + } else if (value + 1 >= Timestamp.TWO_PWR_63_DBL_) { + return Timestamp.MAX_VALUE; + } else if (value < 0) { + return Timestamp.fromNumber(-value).negate(); + } else { + return new Timestamp(value % Timestamp.TWO_PWR_32_DBL_ | 0, value / Timestamp.TWO_PWR_32_DBL_ | 0); + } + }; + + /** + * Returns a Timestamp representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits. + * + * @method + * @param {number} lowBits the low 32-bits. + * @param {number} highBits the high 32-bits. + * @return {Timestamp} the corresponding Timestamp value. + */ + Timestamp.fromBits = function (lowBits, highBits) { + return new Timestamp(lowBits, highBits); + }; + + /** + * Returns a Timestamp representation of the given string, written using the given radix. + * + * @method + * @param {string} str the textual representation of the Timestamp. + * @param {number} opt_radix the radix in which the text is written. + * @return {Timestamp} the corresponding Timestamp value. + */ + Timestamp.fromString = function (str, opt_radix) { + if (str.length === 0) { + throw Error('number format error: empty string'); + } + + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (str.charAt(0) === '-') { + return Timestamp.fromString(str.substring(1), radix).negate(); + } else if (str.indexOf('-') >= 0) { + throw Error('number format error: interior "-" character: ' + str); + } + + // Do several (8) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Timestamp.fromNumber(Math.pow(radix, 8)); + + var result = Timestamp.ZERO; + for (var i = 0; i < str.length; i += 8) { + var size = Math.min(8, str.length - i); + var value = parseInt(str.substring(i, i + size), radix); + if (size < 8) { + var power = Timestamp.fromNumber(Math.pow(radix, size)); + result = result.multiply(power).add(Timestamp.fromNumber(value)); + } else { + result = result.multiply(radixToPower); + result = result.add(Timestamp.fromNumber(value)); + } + } + return result; + }; + + // NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the + // from* methods on which they depend. + + /** + * A cache of the Timestamp representations of small integer values. + * @type {Object} + * @ignore + */ + Timestamp.INT_CACHE_ = {}; + + // NOTE: the compiler should inline these constant values below and then remove + // these variables, so there should be no runtime penalty for these. + + /** + * Number used repeated below in calculations. This must appear before the + * first call to any from* function below. + * @type {number} + * @ignore + */ + Timestamp.TWO_PWR_16_DBL_ = 1 << 16; + + /** + * @type {number} + * @ignore + */ + Timestamp.TWO_PWR_24_DBL_ = 1 << 24; + + /** + * @type {number} + * @ignore + */ + Timestamp.TWO_PWR_32_DBL_ = Timestamp.TWO_PWR_16_DBL_ * Timestamp.TWO_PWR_16_DBL_; + + /** + * @type {number} + * @ignore + */ + Timestamp.TWO_PWR_31_DBL_ = Timestamp.TWO_PWR_32_DBL_ / 2; + + /** + * @type {number} + * @ignore + */ + Timestamp.TWO_PWR_48_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_16_DBL_; + + /** + * @type {number} + * @ignore + */ + Timestamp.TWO_PWR_64_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_32_DBL_; + + /** + * @type {number} + * @ignore + */ + Timestamp.TWO_PWR_63_DBL_ = Timestamp.TWO_PWR_64_DBL_ / 2; + + /** @type {Timestamp} */ + Timestamp.ZERO = Timestamp.fromInt(0); + + /** @type {Timestamp} */ + Timestamp.ONE = Timestamp.fromInt(1); + + /** @type {Timestamp} */ + Timestamp.NEG_ONE = Timestamp.fromInt(-1); + + /** @type {Timestamp} */ + Timestamp.MAX_VALUE = Timestamp.fromBits(0xffffffff | 0, 0x7fffffff | 0); + + /** @type {Timestamp} */ + Timestamp.MIN_VALUE = Timestamp.fromBits(0, 0x80000000 | 0); + + /** + * @type {Timestamp} + * @ignore + */ + Timestamp.TWO_PWR_24_ = Timestamp.fromInt(1 << 24); + + /** + * Expose. + */ + module.exports = Timestamp; + module.exports.Timestamp = Timestamp; + +/***/ }), +/* 338 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer, process) {// Custom inspect property name / symbol. + var inspect = 'inspect'; + + var utils = __webpack_require__(344); + + /** + * Machine id. + * + * Create a random 3-byte value (i.e. unique for this + * process). Other drivers use a md5 of the machine id here, but + * that would mean an asyc call to gethostname, so we don't bother. + * @ignore + */ + var MACHINE_ID = parseInt(Math.random() * 0xffffff, 10); + + // Regular expression that checks for hex value + var checkForHexRegExp = new RegExp('^[0-9a-fA-F]{24}$'); + + // Check if buffer exists + try { + if (Buffer && Buffer.from) { + var hasBufferType = true; + inspect = __webpack_require__(345).inspect.custom || 'inspect'; + } + } catch (err) { + hasBufferType = false; + } + + /** + * Create a new ObjectID instance + * + * @class + * @param {(string|number)} id Can be a 24 byte hex string, 12 byte binary string or a Number. + * @property {number} generationTime The generation time of this ObjectId instance + * @return {ObjectID} instance of ObjectID. + */ + var ObjectID = function ObjectID(id) { + // Duck-typing to support ObjectId from different npm packages + if (id instanceof ObjectID) return id; + if (!(this instanceof ObjectID)) return new ObjectID(id); + + this._bsontype = 'ObjectID'; + + // The most common usecase (blank id, new objectId instance) + if (id == null || typeof id === 'number') { + // Generate a new id + this.id = this.generate(id); + // If we are caching the hex string + if (ObjectID.cacheHexString) this.__id = this.toString('hex'); + // Return the object + return; + } + + // Check if the passed in id is valid + var valid = ObjectID.isValid(id); + + // Throw an error if it's not a valid setup + if (!valid && id != null) { + throw new Error('Argument passed in must be a single String of 12 bytes or a string of 24 hex characters'); + } else if (valid && typeof id === 'string' && id.length === 24 && hasBufferType) { + return new ObjectID(utils.toBuffer(id, 'hex')); + } else if (valid && typeof id === 'string' && id.length === 24) { + return ObjectID.createFromHexString(id); + } else if (id != null && id.length === 12) { + // assume 12 byte string + this.id = id; + } else if (id != null && id.toHexString) { + // Duck-typing to support ObjectId from different npm packages + return id; + } else { + throw new Error('Argument passed in must be a single String of 12 bytes or a string of 24 hex characters'); + } + + if (ObjectID.cacheHexString) this.__id = this.toString('hex'); + }; + + // Allow usage of ObjectId as well as ObjectID + // var ObjectId = ObjectID; + + // Precomputed hex table enables speedy hex string conversion + var hexTable = []; + for (var i = 0; i < 256; i++) { + hexTable[i] = (i <= 15 ? '0' : '') + i.toString(16); + } + + /** + * Return the ObjectID id as a 24 byte hex string representation + * + * @method + * @return {string} return the 24 byte hex string representation. + */ + ObjectID.prototype.toHexString = function () { + if (ObjectID.cacheHexString && this.__id) return this.__id; + + var hexString = ''; + if (!this.id || !this.id.length) { + throw new Error('invalid ObjectId, ObjectId.id must be either a string or a Buffer, but is [' + JSON.stringify(this.id) + ']'); + } + + if (this.id instanceof _Buffer) { + hexString = convertToHex(this.id); + if (ObjectID.cacheHexString) this.__id = hexString; + return hexString; + } + + for (var i = 0; i < this.id.length; i++) { + hexString += hexTable[this.id.charCodeAt(i)]; + } + + if (ObjectID.cacheHexString) this.__id = hexString; + return hexString; + }; + + /** + * Update the ObjectID index used in generating new ObjectID's on the driver + * + * @method + * @return {number} returns next index value. + * @ignore + */ + ObjectID.prototype.get_inc = function () { + return ObjectID.index = (ObjectID.index + 1) % 0xffffff; + }; + + /** + * Update the ObjectID index used in generating new ObjectID's on the driver + * + * @method + * @return {number} returns next index value. + * @ignore + */ + ObjectID.prototype.getInc = function () { + return this.get_inc(); + }; + + /** + * Generate a 12 byte id buffer used in ObjectID's + * + * @method + * @param {number} [time] optional parameter allowing to pass in a second based timestamp. + * @return {Buffer} return the 12 byte id buffer string. + */ + ObjectID.prototype.generate = function (time) { + if ('number' !== typeof time) { + time = ~~(Date.now() / 1000); + } + + // Use pid + var pid = (typeof process === 'undefined' || process.pid === 1 ? Math.floor(Math.random() * 100000) : process.pid) % 0xffff; + var inc = this.get_inc(); + // Buffer used + var buffer = utils.allocBuffer(12); + // Encode time + buffer[3] = time & 0xff; + buffer[2] = time >> 8 & 0xff; + buffer[1] = time >> 16 & 0xff; + buffer[0] = time >> 24 & 0xff; + // Encode machine + buffer[6] = MACHINE_ID & 0xff; + buffer[5] = MACHINE_ID >> 8 & 0xff; + buffer[4] = MACHINE_ID >> 16 & 0xff; + // Encode pid + buffer[8] = pid & 0xff; + buffer[7] = pid >> 8 & 0xff; + // Encode index + buffer[11] = inc & 0xff; + buffer[10] = inc >> 8 & 0xff; + buffer[9] = inc >> 16 & 0xff; + // Return the buffer + return buffer; + }; + + /** + * Converts the id into a 24 byte hex string for printing + * + * @param {String} format The Buffer toString format parameter. + * @return {String} return the 24 byte hex string representation. + * @ignore + */ + ObjectID.prototype.toString = function (format) { + // Is the id a buffer then use the buffer toString method to return the format + if (this.id && this.id.copy) { + return this.id.toString(typeof format === 'string' ? format : 'hex'); + } + + // if(this.buffer ) + return this.toHexString(); + }; + + /** + * Converts to a string representation of this Id. + * + * @return {String} return the 24 byte hex string representation. + * @ignore + */ + ObjectID.prototype[inspect] = ObjectID.prototype.toString; + + /** + * Converts to its JSON representation. + * + * @return {String} return the 24 byte hex string representation. + * @ignore + */ + ObjectID.prototype.toJSON = function () { + return this.toHexString(); + }; + + /** + * Compares the equality of this ObjectID with `otherID`. + * + * @method + * @param {object} otherID ObjectID instance to compare against. + * @return {boolean} the result of comparing two ObjectID's + */ + ObjectID.prototype.equals = function equals(otherId) { + // var id; + + if (otherId instanceof ObjectID) { + return this.toString() === otherId.toString(); + } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 12 && this.id instanceof _Buffer) { + return otherId === this.id.toString('binary'); + } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 24) { + return otherId.toLowerCase() === this.toHexString(); + } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 12) { + return otherId === this.id; + } else if (otherId != null && (otherId instanceof ObjectID || otherId.toHexString)) { + return otherId.toHexString() === this.toHexString(); + } else { + return false; + } + }; + + /** + * Returns the generation date (accurate up to the second) that this ID was generated. + * + * @method + * @return {date} the generation date + */ + ObjectID.prototype.getTimestamp = function () { + var timestamp = new Date(); + var time = this.id[3] | this.id[2] << 8 | this.id[1] << 16 | this.id[0] << 24; + timestamp.setTime(Math.floor(time) * 1000); + return timestamp; + }; + + /** + * @ignore + */ + ObjectID.index = ~~(Math.random() * 0xffffff); + + /** + * @ignore + */ + ObjectID.createPk = function createPk() { + return new ObjectID(); + }; + + /** + * Creates an ObjectID from a second based number, with the rest of the ObjectID zeroed out. Used for comparisons or sorting the ObjectID. + * + * @method + * @param {number} time an integer number representing a number of seconds. + * @return {ObjectID} return the created ObjectID + */ + ObjectID.createFromTime = function createFromTime(time) { + var buffer = utils.toBuffer([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]); + // Encode time into first 4 bytes + buffer[3] = time & 0xff; + buffer[2] = time >> 8 & 0xff; + buffer[1] = time >> 16 & 0xff; + buffer[0] = time >> 24 & 0xff; + // Return the new objectId + return new ObjectID(buffer); + }; + + // Lookup tables + //var encodeLookup = '0123456789abcdef'.split(''); + var decodeLookup = []; + i = 0; + while (i < 10) decodeLookup[0x30 + i] = i++; + while (i < 16) decodeLookup[0x41 - 10 + i] = decodeLookup[0x61 - 10 + i] = i++; + + var _Buffer = Buffer; + var convertToHex = function (bytes) { + return bytes.toString('hex'); + }; + + /** + * Creates an ObjectID from a hex string representation of an ObjectID. + * + * @method + * @param {string} hexString create a ObjectID from a passed in 24 byte hexstring. + * @return {ObjectID} return the created ObjectID + */ + ObjectID.createFromHexString = function createFromHexString(string) { + // Throw an error if it's not a valid setup + if (typeof string === 'undefined' || string != null && string.length !== 24) { + throw new Error('Argument passed in must be a single String of 12 bytes or a string of 24 hex characters'); + } + + // Use Buffer.from method if available + if (hasBufferType) return new ObjectID(utils.toBuffer(string, 'hex')); + + // Calculate lengths + var array = new _Buffer(12); + var n = 0; + var i = 0; + + while (i < 24) { + array[n++] = decodeLookup[string.charCodeAt(i++)] << 4 | decodeLookup[string.charCodeAt(i++)]; + } + + return new ObjectID(array); + }; + + /** + * Checks if a value is a valid bson ObjectId + * + * @method + * @return {boolean} return true if the value is a valid bson ObjectId, return false otherwise. + */ + ObjectID.isValid = function isValid(id) { + if (id == null) return false; + + if (typeof id === 'number') { + return true; + } + + if (typeof id === 'string') { + return id.length === 12 || id.length === 24 && checkForHexRegExp.test(id); + } + + if (id instanceof ObjectID) { + return true; + } + + if (id instanceof _Buffer) { + return true; + } + + // Duck-Typing detection of ObjectId like objects + if (id.toHexString) { + return id.id.length === 12 || id.id.length === 24 && checkForHexRegExp.test(id.id); + } + + return false; + }; + + /** + * @ignore + */ + Object.defineProperty(ObjectID.prototype, 'generationTime', { + enumerable: true, + get: function () { + return this.id[3] | this.id[2] << 8 | this.id[1] << 16 | this.id[0] << 24; + }, + set: function (value) { + // Encode time into first 4 bytes + this.id[3] = value & 0xff; + this.id[2] = value >> 8 & 0xff; + this.id[1] = value >> 16 & 0xff; + this.id[0] = value >> 24 & 0xff; + } + }); + + /** + * Expose. + */ + module.exports = ObjectID; + module.exports.ObjectID = ObjectID; + module.exports.ObjectId = ObjectID; + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer, __webpack_require__(343))) + +/***/ }), +/* 339 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(global) {/*! + * The buffer module from node.js, for the browser. + * + * @author Feross Aboukhadijeh + * @license MIT + */ + /* eslint-disable no-proto */ + + 'use strict' + + var base64 = __webpack_require__(340) + var ieee754 = __webpack_require__(341) + var isArray = __webpack_require__(342) + + exports.Buffer = Buffer + exports.SlowBuffer = SlowBuffer + exports.INSPECT_MAX_BYTES = 50 + + /** + * If `Buffer.TYPED_ARRAY_SUPPORT`: + * === true Use Uint8Array implementation (fastest) + * === false Use Object implementation (most compatible, even IE6) + * + * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+, + * Opera 11.6+, iOS 4.2+. + * + * Due to various browser bugs, sometimes the Object implementation will be used even + * when the browser supports typed arrays. + * + * Note: + * + * - Firefox 4-29 lacks support for adding new properties to `Uint8Array` instances, + * See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438. + * + * - Chrome 9-10 is missing the `TypedArray.prototype.subarray` function. + * + * - IE10 has a broken `TypedArray.prototype.subarray` function which returns arrays of + * incorrect length in some situations. + + * We detect these buggy browsers and set `Buffer.TYPED_ARRAY_SUPPORT` to `false` so they + * get the Object implementation, which is slower but behaves correctly. + */ + Buffer.TYPED_ARRAY_SUPPORT = global.TYPED_ARRAY_SUPPORT !== undefined + ? global.TYPED_ARRAY_SUPPORT + : typedArraySupport() + + /* + * Export kMaxLength after typed array support is determined. + */ + exports.kMaxLength = kMaxLength() + + function typedArraySupport () { + try { + var arr = new Uint8Array(1) + arr.__proto__ = {__proto__: Uint8Array.prototype, foo: function () { return 42 }} + return arr.foo() === 42 && // typed array instances can be augmented + typeof arr.subarray === 'function' && // chrome 9-10 lack `subarray` + arr.subarray(1, 1).byteLength === 0 // ie10 has broken `subarray` + } catch (e) { + return false + } + } + + function kMaxLength () { + return Buffer.TYPED_ARRAY_SUPPORT + ? 0x7fffffff + : 0x3fffffff + } + + function createBuffer (that, length) { + if (kMaxLength() < length) { + throw new RangeError('Invalid typed array length') + } + if (Buffer.TYPED_ARRAY_SUPPORT) { + // Return an augmented `Uint8Array` instance, for best performance + that = new Uint8Array(length) + that.__proto__ = Buffer.prototype + } else { + // Fallback: Return an object instance of the Buffer class + if (that === null) { + that = new Buffer(length) + } + that.length = length + } + + return that + } + + /** + * The Buffer constructor returns instances of `Uint8Array` that have their + * prototype changed to `Buffer.prototype`. Furthermore, `Buffer` is a subclass of + * `Uint8Array`, so the returned instances will have all the node `Buffer` methods + * and the `Uint8Array` methods. Square bracket notation works as expected -- it + * returns a single octet. + * + * The `Uint8Array` prototype remains unmodified. + */ + + function Buffer (arg, encodingOrOffset, length) { + if (!Buffer.TYPED_ARRAY_SUPPORT && !(this instanceof Buffer)) { + return new Buffer(arg, encodingOrOffset, length) + } + + // Common case. + if (typeof arg === 'number') { + if (typeof encodingOrOffset === 'string') { + throw new Error( + 'If encoding is specified then the first argument must be a string' + ) + } + return allocUnsafe(this, arg) + } + return from(this, arg, encodingOrOffset, length) + } + + Buffer.poolSize = 8192 // not used by this implementation + + // TODO: Legacy, not needed anymore. Remove in next major version. + Buffer._augment = function (arr) { + arr.__proto__ = Buffer.prototype + return arr + } + + function from (that, value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('"value" argument must not be a number') + } + + if (typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer) { + return fromArrayBuffer(that, value, encodingOrOffset, length) + } + + if (typeof value === 'string') { + return fromString(that, value, encodingOrOffset) + } + + return fromObject(that, value) + } + + /** + * Functionally equivalent to Buffer(arg, encoding) but throws a TypeError + * if value is a number. + * Buffer.from(str[, encoding]) + * Buffer.from(array) + * Buffer.from(buffer) + * Buffer.from(arrayBuffer[, byteOffset[, length]]) + **/ + Buffer.from = function (value, encodingOrOffset, length) { + return from(null, value, encodingOrOffset, length) + } + + if (Buffer.TYPED_ARRAY_SUPPORT) { + Buffer.prototype.__proto__ = Uint8Array.prototype + Buffer.__proto__ = Uint8Array + if (typeof Symbol !== 'undefined' && Symbol.species && + Buffer[Symbol.species] === Buffer) { + // Fix subarray() in ES2016. See: https://github.com/feross/buffer/pull/97 + Object.defineProperty(Buffer, Symbol.species, { + value: null, + configurable: true + }) + } + } + + function assertSize (size) { + if (typeof size !== 'number') { + throw new TypeError('"size" argument must be a number') + } else if (size < 0) { + throw new RangeError('"size" argument must not be negative') + } + } + + function alloc (that, size, fill, encoding) { + assertSize(size) + if (size <= 0) { + return createBuffer(that, size) + } + if (fill !== undefined) { + // Only pay attention to encoding if it's a string. This + // prevents accidentally sending in a number that would + // be interpretted as a start offset. + return typeof encoding === 'string' + ? createBuffer(that, size).fill(fill, encoding) + : createBuffer(that, size).fill(fill) + } + return createBuffer(that, size) + } + + /** + * Creates a new filled Buffer instance. + * alloc(size[, fill[, encoding]]) + **/ + Buffer.alloc = function (size, fill, encoding) { + return alloc(null, size, fill, encoding) + } + + function allocUnsafe (that, size) { + assertSize(size) + that = createBuffer(that, size < 0 ? 0 : checked(size) | 0) + if (!Buffer.TYPED_ARRAY_SUPPORT) { + for (var i = 0; i < size; ++i) { + that[i] = 0 + } + } + return that + } + + /** + * Equivalent to Buffer(num), by default creates a non-zero-filled Buffer instance. + * */ + Buffer.allocUnsafe = function (size) { + return allocUnsafe(null, size) + } + /** + * Equivalent to SlowBuffer(num), by default creates a non-zero-filled Buffer instance. + */ + Buffer.allocUnsafeSlow = function (size) { + return allocUnsafe(null, size) + } + + function fromString (that, string, encoding) { + if (typeof encoding !== 'string' || encoding === '') { + encoding = 'utf8' + } + + if (!Buffer.isEncoding(encoding)) { + throw new TypeError('"encoding" must be a valid string encoding') + } + + var length = byteLength(string, encoding) | 0 + that = createBuffer(that, length) + + var actual = that.write(string, encoding) + + if (actual !== length) { + // Writing a hex string, for example, that contains invalid characters will + // cause everything after the first invalid character to be ignored. (e.g. + // 'abxxcd' will be treated as 'ab') + that = that.slice(0, actual) + } + + return that + } + + function fromArrayLike (that, array) { + var length = array.length < 0 ? 0 : checked(array.length) | 0 + that = createBuffer(that, length) + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that + } + + function fromArrayBuffer (that, array, byteOffset, length) { + array.byteLength // this throws if `array` is not a valid ArrayBuffer + + if (byteOffset < 0 || array.byteLength < byteOffset) { + throw new RangeError('\'offset\' is out of bounds') + } + + if (array.byteLength < byteOffset + (length || 0)) { + throw new RangeError('\'length\' is out of bounds') + } + + if (byteOffset === undefined && length === undefined) { + array = new Uint8Array(array) + } else if (length === undefined) { + array = new Uint8Array(array, byteOffset) + } else { + array = new Uint8Array(array, byteOffset, length) + } + + if (Buffer.TYPED_ARRAY_SUPPORT) { + // Return an augmented `Uint8Array` instance, for best performance + that = array + that.__proto__ = Buffer.prototype + } else { + // Fallback: Return an object instance of the Buffer class + that = fromArrayLike(that, array) + } + return that + } + + function fromObject (that, obj) { + if (Buffer.isBuffer(obj)) { + var len = checked(obj.length) | 0 + that = createBuffer(that, len) + + if (that.length === 0) { + return that + } + + obj.copy(that, 0, 0, len) + return that + } + + if (obj) { + if ((typeof ArrayBuffer !== 'undefined' && + obj.buffer instanceof ArrayBuffer) || 'length' in obj) { + if (typeof obj.length !== 'number' || isnan(obj.length)) { + return createBuffer(that, 0) + } + return fromArrayLike(that, obj) + } + + if (obj.type === 'Buffer' && isArray(obj.data)) { + return fromArrayLike(that, obj.data) + } + } + + throw new TypeError('First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object.') + } + + function checked (length) { + // Note: cannot use `length < kMaxLength()` here because that fails when + // length is NaN (which is otherwise coerced to zero.) + if (length >= kMaxLength()) { + throw new RangeError('Attempt to allocate Buffer larger than maximum ' + + 'size: 0x' + kMaxLength().toString(16) + ' bytes') + } + return length | 0 + } + + function SlowBuffer (length) { + if (+length != length) { // eslint-disable-line eqeqeq + length = 0 + } + return Buffer.alloc(+length) + } + + Buffer.isBuffer = function isBuffer (b) { + return !!(b != null && b._isBuffer) + } + + Buffer.compare = function compare (a, b) { + if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) { + throw new TypeError('Arguments must be Buffers') + } + + if (a === b) return 0 + + var x = a.length + var y = b.length + + for (var i = 0, len = Math.min(x, y); i < len; ++i) { + if (a[i] !== b[i]) { + x = a[i] + y = b[i] + break + } + } + + if (x < y) return -1 + if (y < x) return 1 + return 0 + } + + Buffer.isEncoding = function isEncoding (encoding) { + switch (String(encoding).toLowerCase()) { + case 'hex': + case 'utf8': + case 'utf-8': + case 'ascii': + case 'latin1': + case 'binary': + case 'base64': + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return true + default: + return false + } + } + + Buffer.concat = function concat (list, length) { + if (!isArray(list)) { + throw new TypeError('"list" argument must be an Array of Buffers') + } + + if (list.length === 0) { + return Buffer.alloc(0) + } + + var i + if (length === undefined) { + length = 0 + for (i = 0; i < list.length; ++i) { + length += list[i].length + } + } + + var buffer = Buffer.allocUnsafe(length) + var pos = 0 + for (i = 0; i < list.length; ++i) { + var buf = list[i] + if (!Buffer.isBuffer(buf)) { + throw new TypeError('"list" argument must be an Array of Buffers') + } + buf.copy(buffer, pos) + pos += buf.length + } + return buffer + } + + function byteLength (string, encoding) { + if (Buffer.isBuffer(string)) { + return string.length + } + if (typeof ArrayBuffer !== 'undefined' && typeof ArrayBuffer.isView === 'function' && + (ArrayBuffer.isView(string) || string instanceof ArrayBuffer)) { + return string.byteLength + } + if (typeof string !== 'string') { + string = '' + string + } + + var len = string.length + if (len === 0) return 0 + + // Use a for loop to avoid recursion + var loweredCase = false + for (;;) { + switch (encoding) { + case 'ascii': + case 'latin1': + case 'binary': + return len + case 'utf8': + case 'utf-8': + case undefined: + return utf8ToBytes(string).length + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return len * 2 + case 'hex': + return len >>> 1 + case 'base64': + return base64ToBytes(string).length + default: + if (loweredCase) return utf8ToBytes(string).length // assume utf8 + encoding = ('' + encoding).toLowerCase() + loweredCase = true + } + } + } + Buffer.byteLength = byteLength + + function slowToString (encoding, start, end) { + var loweredCase = false + + // No need to verify that "this.length <= MAX_UINT32" since it's a read-only + // property of a typed array. + + // This behaves neither like String nor Uint8Array in that we set start/end + // to their upper/lower bounds if the value passed is out of range. + // undefined is handled specially as per ECMA-262 6th Edition, + // Section 13.3.3.7 Runtime Semantics: KeyedBindingInitialization. + if (start === undefined || start < 0) { + start = 0 + } + // Return early if start > this.length. Done here to prevent potential uint32 + // coercion fail below. + if (start > this.length) { + return '' + } + + if (end === undefined || end > this.length) { + end = this.length + } + + if (end <= 0) { + return '' + } + + // Force coersion to uint32. This will also coerce falsey/NaN values to 0. + end >>>= 0 + start >>>= 0 + + if (end <= start) { + return '' + } + + if (!encoding) encoding = 'utf8' + + while (true) { + switch (encoding) { + case 'hex': + return hexSlice(this, start, end) + + case 'utf8': + case 'utf-8': + return utf8Slice(this, start, end) + + case 'ascii': + return asciiSlice(this, start, end) + + case 'latin1': + case 'binary': + return latin1Slice(this, start, end) + + case 'base64': + return base64Slice(this, start, end) + + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return utf16leSlice(this, start, end) + + default: + if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding) + encoding = (encoding + '').toLowerCase() + loweredCase = true + } + } + } + + // The property is used by `Buffer.isBuffer` and `is-buffer` (in Safari 5-7) to detect + // Buffer instances. + Buffer.prototype._isBuffer = true + + function swap (b, n, m) { + var i = b[n] + b[n] = b[m] + b[m] = i + } + + Buffer.prototype.swap16 = function swap16 () { + var len = this.length + if (len % 2 !== 0) { + throw new RangeError('Buffer size must be a multiple of 16-bits') + } + for (var i = 0; i < len; i += 2) { + swap(this, i, i + 1) + } + return this + } + + Buffer.prototype.swap32 = function swap32 () { + var len = this.length + if (len % 4 !== 0) { + throw new RangeError('Buffer size must be a multiple of 32-bits') + } + for (var i = 0; i < len; i += 4) { + swap(this, i, i + 3) + swap(this, i + 1, i + 2) + } + return this + } + + Buffer.prototype.swap64 = function swap64 () { + var len = this.length + if (len % 8 !== 0) { + throw new RangeError('Buffer size must be a multiple of 64-bits') + } + for (var i = 0; i < len; i += 8) { + swap(this, i, i + 7) + swap(this, i + 1, i + 6) + swap(this, i + 2, i + 5) + swap(this, i + 3, i + 4) + } + return this + } + + Buffer.prototype.toString = function toString () { + var length = this.length | 0 + if (length === 0) return '' + if (arguments.length === 0) return utf8Slice(this, 0, length) + return slowToString.apply(this, arguments) + } + + Buffer.prototype.equals = function equals (b) { + if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer') + if (this === b) return true + return Buffer.compare(this, b) === 0 + } + + Buffer.prototype.inspect = function inspect () { + var str = '' + var max = exports.INSPECT_MAX_BYTES + if (this.length > 0) { + str = this.toString('hex', 0, max).match(/.{2}/g).join(' ') + if (this.length > max) str += ' ... ' + } + return '' + } + + Buffer.prototype.compare = function compare (target, start, end, thisStart, thisEnd) { + if (!Buffer.isBuffer(target)) { + throw new TypeError('Argument must be a Buffer') + } + + if (start === undefined) { + start = 0 + } + if (end === undefined) { + end = target ? target.length : 0 + } + if (thisStart === undefined) { + thisStart = 0 + } + if (thisEnd === undefined) { + thisEnd = this.length + } + + if (start < 0 || end > target.length || thisStart < 0 || thisEnd > this.length) { + throw new RangeError('out of range index') + } + + if (thisStart >= thisEnd && start >= end) { + return 0 + } + if (thisStart >= thisEnd) { + return -1 + } + if (start >= end) { + return 1 + } + + start >>>= 0 + end >>>= 0 + thisStart >>>= 0 + thisEnd >>>= 0 + + if (this === target) return 0 + + var x = thisEnd - thisStart + var y = end - start + var len = Math.min(x, y) + + var thisCopy = this.slice(thisStart, thisEnd) + var targetCopy = target.slice(start, end) + + for (var i = 0; i < len; ++i) { + if (thisCopy[i] !== targetCopy[i]) { + x = thisCopy[i] + y = targetCopy[i] + break + } + } + + if (x < y) return -1 + if (y < x) return 1 + return 0 + } + + // Finds either the first index of `val` in `buffer` at offset >= `byteOffset`, + // OR the last index of `val` in `buffer` at offset <= `byteOffset`. + // + // Arguments: + // - buffer - a Buffer to search + // - val - a string, Buffer, or number + // - byteOffset - an index into `buffer`; will be clamped to an int32 + // - encoding - an optional encoding, relevant is val is a string + // - dir - true for indexOf, false for lastIndexOf + function bidirectionalIndexOf (buffer, val, byteOffset, encoding, dir) { + // Empty buffer means no match + if (buffer.length === 0) return -1 + + // Normalize byteOffset + if (typeof byteOffset === 'string') { + encoding = byteOffset + byteOffset = 0 + } else if (byteOffset > 0x7fffffff) { + byteOffset = 0x7fffffff + } else if (byteOffset < -0x80000000) { + byteOffset = -0x80000000 + } + byteOffset = +byteOffset // Coerce to Number. + if (isNaN(byteOffset)) { + // byteOffset: it it's undefined, null, NaN, "foo", etc, search whole buffer + byteOffset = dir ? 0 : (buffer.length - 1) + } + + // Normalize byteOffset: negative offsets start from the end of the buffer + if (byteOffset < 0) byteOffset = buffer.length + byteOffset + if (byteOffset >= buffer.length) { + if (dir) return -1 + else byteOffset = buffer.length - 1 + } else if (byteOffset < 0) { + if (dir) byteOffset = 0 + else return -1 + } + + // Normalize val + if (typeof val === 'string') { + val = Buffer.from(val, encoding) + } + + // Finally, search either indexOf (if dir is true) or lastIndexOf + if (Buffer.isBuffer(val)) { + // Special case: looking for empty string/buffer always fails + if (val.length === 0) { + return -1 + } + return arrayIndexOf(buffer, val, byteOffset, encoding, dir) + } else if (typeof val === 'number') { + val = val & 0xFF // Search for a byte value [0-255] + if (Buffer.TYPED_ARRAY_SUPPORT && + typeof Uint8Array.prototype.indexOf === 'function') { + if (dir) { + return Uint8Array.prototype.indexOf.call(buffer, val, byteOffset) + } else { + return Uint8Array.prototype.lastIndexOf.call(buffer, val, byteOffset) + } + } + return arrayIndexOf(buffer, [ val ], byteOffset, encoding, dir) + } + + throw new TypeError('val must be string, number or Buffer') + } + + function arrayIndexOf (arr, val, byteOffset, encoding, dir) { + var indexSize = 1 + var arrLength = arr.length + var valLength = val.length + + if (encoding !== undefined) { + encoding = String(encoding).toLowerCase() + if (encoding === 'ucs2' || encoding === 'ucs-2' || + encoding === 'utf16le' || encoding === 'utf-16le') { + if (arr.length < 2 || val.length < 2) { + return -1 + } + indexSize = 2 + arrLength /= 2 + valLength /= 2 + byteOffset /= 2 + } + } + + function read (buf, i) { + if (indexSize === 1) { + return buf[i] + } else { + return buf.readUInt16BE(i * indexSize) + } + } + + var i + if (dir) { + var foundIndex = -1 + for (i = byteOffset; i < arrLength; i++) { + if (read(arr, i) === read(val, foundIndex === -1 ? 0 : i - foundIndex)) { + if (foundIndex === -1) foundIndex = i + if (i - foundIndex + 1 === valLength) return foundIndex * indexSize + } else { + if (foundIndex !== -1) i -= i - foundIndex + foundIndex = -1 + } + } + } else { + if (byteOffset + valLength > arrLength) byteOffset = arrLength - valLength + for (i = byteOffset; i >= 0; i--) { + var found = true + for (var j = 0; j < valLength; j++) { + if (read(arr, i + j) !== read(val, j)) { + found = false + break + } + } + if (found) return i + } + } + + return -1 + } + + Buffer.prototype.includes = function includes (val, byteOffset, encoding) { + return this.indexOf(val, byteOffset, encoding) !== -1 + } + + Buffer.prototype.indexOf = function indexOf (val, byteOffset, encoding) { + return bidirectionalIndexOf(this, val, byteOffset, encoding, true) + } + + Buffer.prototype.lastIndexOf = function lastIndexOf (val, byteOffset, encoding) { + return bidirectionalIndexOf(this, val, byteOffset, encoding, false) + } + + function hexWrite (buf, string, offset, length) { + offset = Number(offset) || 0 + var remaining = buf.length - offset + if (!length) { + length = remaining + } else { + length = Number(length) + if (length > remaining) { + length = remaining + } + } + + // must be an even number of digits + var strLen = string.length + if (strLen % 2 !== 0) throw new TypeError('Invalid hex string') + + if (length > strLen / 2) { + length = strLen / 2 + } + for (var i = 0; i < length; ++i) { + var parsed = parseInt(string.substr(i * 2, 2), 16) + if (isNaN(parsed)) return i + buf[offset + i] = parsed + } + return i + } + + function utf8Write (buf, string, offset, length) { + return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length) + } + + function asciiWrite (buf, string, offset, length) { + return blitBuffer(asciiToBytes(string), buf, offset, length) + } + + function latin1Write (buf, string, offset, length) { + return asciiWrite(buf, string, offset, length) + } + + function base64Write (buf, string, offset, length) { + return blitBuffer(base64ToBytes(string), buf, offset, length) + } + + function ucs2Write (buf, string, offset, length) { + return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length) + } + + Buffer.prototype.write = function write (string, offset, length, encoding) { + // Buffer#write(string) + if (offset === undefined) { + encoding = 'utf8' + length = this.length + offset = 0 + // Buffer#write(string, encoding) + } else if (length === undefined && typeof offset === 'string') { + encoding = offset + length = this.length + offset = 0 + // Buffer#write(string, offset[, length][, encoding]) + } else if (isFinite(offset)) { + offset = offset | 0 + if (isFinite(length)) { + length = length | 0 + if (encoding === undefined) encoding = 'utf8' + } else { + encoding = length + length = undefined + } + // legacy write(string, encoding, offset, length) - remove in v0.13 + } else { + throw new Error( + 'Buffer.write(string, encoding, offset[, length]) is no longer supported' + ) + } + + var remaining = this.length - offset + if (length === undefined || length > remaining) length = remaining + + if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) { + throw new RangeError('Attempt to write outside buffer bounds') + } + + if (!encoding) encoding = 'utf8' + + var loweredCase = false + for (;;) { + switch (encoding) { + case 'hex': + return hexWrite(this, string, offset, length) + + case 'utf8': + case 'utf-8': + return utf8Write(this, string, offset, length) + + case 'ascii': + return asciiWrite(this, string, offset, length) + + case 'latin1': + case 'binary': + return latin1Write(this, string, offset, length) + + case 'base64': + // Warning: maxLength not taken into account in base64Write + return base64Write(this, string, offset, length) + + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return ucs2Write(this, string, offset, length) + + default: + if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding) + encoding = ('' + encoding).toLowerCase() + loweredCase = true + } + } + } + + Buffer.prototype.toJSON = function toJSON () { + return { + type: 'Buffer', + data: Array.prototype.slice.call(this._arr || this, 0) + } + } + + function base64Slice (buf, start, end) { + if (start === 0 && end === buf.length) { + return base64.fromByteArray(buf) + } else { + return base64.fromByteArray(buf.slice(start, end)) + } + } + + function utf8Slice (buf, start, end) { + end = Math.min(buf.length, end) + var res = [] + + var i = start + while (i < end) { + var firstByte = buf[i] + var codePoint = null + var bytesPerSequence = (firstByte > 0xEF) ? 4 + : (firstByte > 0xDF) ? 3 + : (firstByte > 0xBF) ? 2 + : 1 + + if (i + bytesPerSequence <= end) { + var secondByte, thirdByte, fourthByte, tempCodePoint + + switch (bytesPerSequence) { + case 1: + if (firstByte < 0x80) { + codePoint = firstByte + } + break + case 2: + secondByte = buf[i + 1] + if ((secondByte & 0xC0) === 0x80) { + tempCodePoint = (firstByte & 0x1F) << 0x6 | (secondByte & 0x3F) + if (tempCodePoint > 0x7F) { + codePoint = tempCodePoint + } + } + break + case 3: + secondByte = buf[i + 1] + thirdByte = buf[i + 2] + if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80) { + tempCodePoint = (firstByte & 0xF) << 0xC | (secondByte & 0x3F) << 0x6 | (thirdByte & 0x3F) + if (tempCodePoint > 0x7FF && (tempCodePoint < 0xD800 || tempCodePoint > 0xDFFF)) { + codePoint = tempCodePoint + } + } + break + case 4: + secondByte = buf[i + 1] + thirdByte = buf[i + 2] + fourthByte = buf[i + 3] + if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80 && (fourthByte & 0xC0) === 0x80) { + tempCodePoint = (firstByte & 0xF) << 0x12 | (secondByte & 0x3F) << 0xC | (thirdByte & 0x3F) << 0x6 | (fourthByte & 0x3F) + if (tempCodePoint > 0xFFFF && tempCodePoint < 0x110000) { + codePoint = tempCodePoint + } + } + } + } + + if (codePoint === null) { + // we did not generate a valid codePoint so insert a + // replacement char (U+FFFD) and advance only 1 byte + codePoint = 0xFFFD + bytesPerSequence = 1 + } else if (codePoint > 0xFFFF) { + // encode to utf16 (surrogate pair dance) + codePoint -= 0x10000 + res.push(codePoint >>> 10 & 0x3FF | 0xD800) + codePoint = 0xDC00 | codePoint & 0x3FF + } + + res.push(codePoint) + i += bytesPerSequence + } + + return decodeCodePointsArray(res) + } + + // Based on http://stackoverflow.com/a/22747272/680742, the browser with + // the lowest limit is Chrome, with 0x10000 args. + // We go 1 magnitude less, for safety + var MAX_ARGUMENTS_LENGTH = 0x1000 + + function decodeCodePointsArray (codePoints) { + var len = codePoints.length + if (len <= MAX_ARGUMENTS_LENGTH) { + return String.fromCharCode.apply(String, codePoints) // avoid extra slice() + } + + // Decode in chunks to avoid "call stack size exceeded". + var res = '' + var i = 0 + while (i < len) { + res += String.fromCharCode.apply( + String, + codePoints.slice(i, i += MAX_ARGUMENTS_LENGTH) + ) + } + return res + } + + function asciiSlice (buf, start, end) { + var ret = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; ++i) { + ret += String.fromCharCode(buf[i] & 0x7F) + } + return ret + } + + function latin1Slice (buf, start, end) { + var ret = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; ++i) { + ret += String.fromCharCode(buf[i]) + } + return ret + } + + function hexSlice (buf, start, end) { + var len = buf.length + + if (!start || start < 0) start = 0 + if (!end || end < 0 || end > len) end = len + + var out = '' + for (var i = start; i < end; ++i) { + out += toHex(buf[i]) + } + return out + } + + function utf16leSlice (buf, start, end) { + var bytes = buf.slice(start, end) + var res = '' + for (var i = 0; i < bytes.length; i += 2) { + res += String.fromCharCode(bytes[i] + bytes[i + 1] * 256) + } + return res + } + + Buffer.prototype.slice = function slice (start, end) { + var len = this.length + start = ~~start + end = end === undefined ? len : ~~end + + if (start < 0) { + start += len + if (start < 0) start = 0 + } else if (start > len) { + start = len + } + + if (end < 0) { + end += len + if (end < 0) end = 0 + } else if (end > len) { + end = len + } + + if (end < start) end = start + + var newBuf + if (Buffer.TYPED_ARRAY_SUPPORT) { + newBuf = this.subarray(start, end) + newBuf.__proto__ = Buffer.prototype + } else { + var sliceLen = end - start + newBuf = new Buffer(sliceLen, undefined) + for (var i = 0; i < sliceLen; ++i) { + newBuf[i] = this[i + start] + } + } + + return newBuf + } + + /* + * Need to make sure that buffer isn't trying to write out of bounds. + */ + function checkOffset (offset, ext, length) { + if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint') + if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length') + } + + Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var val = this[offset] + var mul = 1 + var i = 0 + while (++i < byteLength && (mul *= 0x100)) { + val += this[offset + i] * mul + } + + return val + } + + Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) { + checkOffset(offset, byteLength, this.length) + } + + var val = this[offset + --byteLength] + var mul = 1 + while (byteLength > 0 && (mul *= 0x100)) { + val += this[offset + --byteLength] * mul + } + + return val + } + + Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) { + if (!noAssert) checkOffset(offset, 1, this.length) + return this[offset] + } + + Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + return this[offset] | (this[offset + 1] << 8) + } + + Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + return (this[offset] << 8) | this[offset + 1] + } + + Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return ((this[offset]) | + (this[offset + 1] << 8) | + (this[offset + 2] << 16)) + + (this[offset + 3] * 0x1000000) + } + + Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset] * 0x1000000) + + ((this[offset + 1] << 16) | + (this[offset + 2] << 8) | + this[offset + 3]) + } + + Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var val = this[offset] + var mul = 1 + var i = 0 + while (++i < byteLength && (mul *= 0x100)) { + val += this[offset + i] * mul + } + mul *= 0x80 + + if (val >= mul) val -= Math.pow(2, 8 * byteLength) + + return val + } + + Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var i = byteLength + var mul = 1 + var val = this[offset + --i] + while (i > 0 && (mul *= 0x100)) { + val += this[offset + --i] * mul + } + mul *= 0x80 + + if (val >= mul) val -= Math.pow(2, 8 * byteLength) + + return val + } + + Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) { + if (!noAssert) checkOffset(offset, 1, this.length) + if (!(this[offset] & 0x80)) return (this[offset]) + return ((0xff - this[offset] + 1) * -1) + } + + Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + var val = this[offset] | (this[offset + 1] << 8) + return (val & 0x8000) ? val | 0xFFFF0000 : val + } + + Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + var val = this[offset + 1] | (this[offset] << 8) + return (val & 0x8000) ? val | 0xFFFF0000 : val + } + + Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset]) | + (this[offset + 1] << 8) | + (this[offset + 2] << 16) | + (this[offset + 3] << 24) + } + + Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset] << 24) | + (this[offset + 1] << 16) | + (this[offset + 2] << 8) | + (this[offset + 3]) + } + + Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + return ieee754.read(this, offset, true, 23, 4) + } + + Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + return ieee754.read(this, offset, false, 23, 4) + } + + Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 8, this.length) + return ieee754.read(this, offset, true, 52, 8) + } + + Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 8, this.length) + return ieee754.read(this, offset, false, 52, 8) + } + + function checkInt (buf, value, offset, ext, max, min) { + if (!Buffer.isBuffer(buf)) throw new TypeError('"buffer" argument must be a Buffer instance') + if (value > max || value < min) throw new RangeError('"value" argument is out of bounds') + if (offset + ext > buf.length) throw new RangeError('Index out of range') + } + + Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) { + var maxBytes = Math.pow(2, 8 * byteLength) - 1 + checkInt(this, value, offset, byteLength, maxBytes, 0) + } + + var mul = 1 + var i = 0 + this[offset] = value & 0xFF + while (++i < byteLength && (mul *= 0x100)) { + this[offset + i] = (value / mul) & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) { + var maxBytes = Math.pow(2, 8 * byteLength) - 1 + checkInt(this, value, offset, byteLength, maxBytes, 0) + } + + var i = byteLength - 1 + var mul = 1 + this[offset + i] = value & 0xFF + while (--i >= 0 && (mul *= 0x100)) { + this[offset + i] = (value / mul) & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0) + if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value) + this[offset] = (value & 0xff) + return offset + 1 + } + + function objectWriteUInt16 (buf, value, offset, littleEndian) { + if (value < 0) value = 0xffff + value + 1 + for (var i = 0, j = Math.min(buf.length - offset, 2); i < j; ++i) { + buf[offset + i] = (value & (0xff << (8 * (littleEndian ? i : 1 - i)))) >>> + (littleEndian ? i : 1 - i) * 8 + } + } + + Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value & 0xff) + this[offset + 1] = (value >>> 8) + } else { + objectWriteUInt16(this, value, offset, true) + } + return offset + 2 + } + + Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 8) + this[offset + 1] = (value & 0xff) + } else { + objectWriteUInt16(this, value, offset, false) + } + return offset + 2 + } + + function objectWriteUInt32 (buf, value, offset, littleEndian) { + if (value < 0) value = 0xffffffff + value + 1 + for (var i = 0, j = Math.min(buf.length - offset, 4); i < j; ++i) { + buf[offset + i] = (value >>> (littleEndian ? i : 3 - i) * 8) & 0xff + } + } + + Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset + 3] = (value >>> 24) + this[offset + 2] = (value >>> 16) + this[offset + 1] = (value >>> 8) + this[offset] = (value & 0xff) + } else { + objectWriteUInt32(this, value, offset, true) + } + return offset + 4 + } + + Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 24) + this[offset + 1] = (value >>> 16) + this[offset + 2] = (value >>> 8) + this[offset + 3] = (value & 0xff) + } else { + objectWriteUInt32(this, value, offset, false) + } + return offset + 4 + } + + Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) { + var limit = Math.pow(2, 8 * byteLength - 1) + + checkInt(this, value, offset, byteLength, limit - 1, -limit) + } + + var i = 0 + var mul = 1 + var sub = 0 + this[offset] = value & 0xFF + while (++i < byteLength && (mul *= 0x100)) { + if (value < 0 && sub === 0 && this[offset + i - 1] !== 0) { + sub = 1 + } + this[offset + i] = ((value / mul) >> 0) - sub & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) { + var limit = Math.pow(2, 8 * byteLength - 1) + + checkInt(this, value, offset, byteLength, limit - 1, -limit) + } + + var i = byteLength - 1 + var mul = 1 + var sub = 0 + this[offset + i] = value & 0xFF + while (--i >= 0 && (mul *= 0x100)) { + if (value < 0 && sub === 0 && this[offset + i + 1] !== 0) { + sub = 1 + } + this[offset + i] = ((value / mul) >> 0) - sub & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80) + if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value) + if (value < 0) value = 0xff + value + 1 + this[offset] = (value & 0xff) + return offset + 1 + } + + Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value & 0xff) + this[offset + 1] = (value >>> 8) + } else { + objectWriteUInt16(this, value, offset, true) + } + return offset + 2 + } + + Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 8) + this[offset + 1] = (value & 0xff) + } else { + objectWriteUInt16(this, value, offset, false) + } + return offset + 2 + } + + Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value & 0xff) + this[offset + 1] = (value >>> 8) + this[offset + 2] = (value >>> 16) + this[offset + 3] = (value >>> 24) + } else { + objectWriteUInt32(this, value, offset, true) + } + return offset + 4 + } + + Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000) + if (value < 0) value = 0xffffffff + value + 1 + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 24) + this[offset + 1] = (value >>> 16) + this[offset + 2] = (value >>> 8) + this[offset + 3] = (value & 0xff) + } else { + objectWriteUInt32(this, value, offset, false) + } + return offset + 4 + } + + function checkIEEE754 (buf, value, offset, ext, max, min) { + if (offset + ext > buf.length) throw new RangeError('Index out of range') + if (offset < 0) throw new RangeError('Index out of range') + } + + function writeFloat (buf, value, offset, littleEndian, noAssert) { + if (!noAssert) { + checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38) + } + ieee754.write(buf, value, offset, littleEndian, 23, 4) + return offset + 4 + } + + Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) { + return writeFloat(this, value, offset, true, noAssert) + } + + Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) { + return writeFloat(this, value, offset, false, noAssert) + } + + function writeDouble (buf, value, offset, littleEndian, noAssert) { + if (!noAssert) { + checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308) + } + ieee754.write(buf, value, offset, littleEndian, 52, 8) + return offset + 8 + } + + Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) { + return writeDouble(this, value, offset, true, noAssert) + } + + Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) { + return writeDouble(this, value, offset, false, noAssert) + } + + // copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length) + Buffer.prototype.copy = function copy (target, targetStart, start, end) { + if (!start) start = 0 + if (!end && end !== 0) end = this.length + if (targetStart >= target.length) targetStart = target.length + if (!targetStart) targetStart = 0 + if (end > 0 && end < start) end = start + + // Copy 0 bytes; we're done + if (end === start) return 0 + if (target.length === 0 || this.length === 0) return 0 + + // Fatal error conditions + if (targetStart < 0) { + throw new RangeError('targetStart out of bounds') + } + if (start < 0 || start >= this.length) throw new RangeError('sourceStart out of bounds') + if (end < 0) throw new RangeError('sourceEnd out of bounds') + + // Are we oob? + if (end > this.length) end = this.length + if (target.length - targetStart < end - start) { + end = target.length - targetStart + start + } + + var len = end - start + var i + + if (this === target && start < targetStart && targetStart < end) { + // descending copy from end + for (i = len - 1; i >= 0; --i) { + target[i + targetStart] = this[i + start] + } + } else if (len < 1000 || !Buffer.TYPED_ARRAY_SUPPORT) { + // ascending copy from start + for (i = 0; i < len; ++i) { + target[i + targetStart] = this[i + start] + } + } else { + Uint8Array.prototype.set.call( + target, + this.subarray(start, start + len), + targetStart + ) + } + + return len + } + + // Usage: + // buffer.fill(number[, offset[, end]]) + // buffer.fill(buffer[, offset[, end]]) + // buffer.fill(string[, offset[, end]][, encoding]) + Buffer.prototype.fill = function fill (val, start, end, encoding) { + // Handle string cases: + if (typeof val === 'string') { + if (typeof start === 'string') { + encoding = start + start = 0 + end = this.length + } else if (typeof end === 'string') { + encoding = end + end = this.length + } + if (val.length === 1) { + var code = val.charCodeAt(0) + if (code < 256) { + val = code + } + } + if (encoding !== undefined && typeof encoding !== 'string') { + throw new TypeError('encoding must be a string') + } + if (typeof encoding === 'string' && !Buffer.isEncoding(encoding)) { + throw new TypeError('Unknown encoding: ' + encoding) + } + } else if (typeof val === 'number') { + val = val & 255 + } + + // Invalid ranges are not set to a default, so can range check early. + if (start < 0 || this.length < start || this.length < end) { + throw new RangeError('Out of range index') + } + + if (end <= start) { + return this + } + + start = start >>> 0 + end = end === undefined ? this.length : end >>> 0 + + if (!val) val = 0 + + var i + if (typeof val === 'number') { + for (i = start; i < end; ++i) { + this[i] = val + } + } else { + var bytes = Buffer.isBuffer(val) + ? val + : utf8ToBytes(new Buffer(val, encoding).toString()) + var len = bytes.length + for (i = 0; i < end - start; ++i) { + this[i + start] = bytes[i % len] + } + } + + return this + } + + // HELPER FUNCTIONS + // ================ + + var INVALID_BASE64_RE = /[^+\/0-9A-Za-z-_]/g + + function base64clean (str) { + // Node strips out invalid characters like \n and \t from the string, base64-js does not + str = stringtrim(str).replace(INVALID_BASE64_RE, '') + // Node converts strings with length < 2 to '' + if (str.length < 2) return '' + // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not + while (str.length % 4 !== 0) { + str = str + '=' + } + return str + } + + function stringtrim (str) { + if (str.trim) return str.trim() + return str.replace(/^\s+|\s+$/g, '') + } + + function toHex (n) { + if (n < 16) return '0' + n.toString(16) + return n.toString(16) + } + + function utf8ToBytes (string, units) { + units = units || Infinity + var codePoint + var length = string.length + var leadSurrogate = null + var bytes = [] + + for (var i = 0; i < length; ++i) { + codePoint = string.charCodeAt(i) + + // is surrogate component + if (codePoint > 0xD7FF && codePoint < 0xE000) { + // last char was a lead + if (!leadSurrogate) { + // no lead yet + if (codePoint > 0xDBFF) { + // unexpected trail + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + continue + } else if (i + 1 === length) { + // unpaired lead + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + continue + } + + // valid lead + leadSurrogate = codePoint + + continue + } + + // 2 leads in a row + if (codePoint < 0xDC00) { + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + leadSurrogate = codePoint + continue + } + + // valid surrogate pair + codePoint = (leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00) + 0x10000 + } else if (leadSurrogate) { + // valid bmp char, but last char was a lead + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + } + + leadSurrogate = null + + // encode utf8 + if (codePoint < 0x80) { + if ((units -= 1) < 0) break + bytes.push(codePoint) + } else if (codePoint < 0x800) { + if ((units -= 2) < 0) break + bytes.push( + codePoint >> 0x6 | 0xC0, + codePoint & 0x3F | 0x80 + ) + } else if (codePoint < 0x10000) { + if ((units -= 3) < 0) break + bytes.push( + codePoint >> 0xC | 0xE0, + codePoint >> 0x6 & 0x3F | 0x80, + codePoint & 0x3F | 0x80 + ) + } else if (codePoint < 0x110000) { + if ((units -= 4) < 0) break + bytes.push( + codePoint >> 0x12 | 0xF0, + codePoint >> 0xC & 0x3F | 0x80, + codePoint >> 0x6 & 0x3F | 0x80, + codePoint & 0x3F | 0x80 + ) + } else { + throw new Error('Invalid code point') + } + } + + return bytes + } + + function asciiToBytes (str) { + var byteArray = [] + for (var i = 0; i < str.length; ++i) { + // Node's code seems to be doing this and not & 0x7F.. + byteArray.push(str.charCodeAt(i) & 0xFF) + } + return byteArray + } + + function utf16leToBytes (str, units) { + var c, hi, lo + var byteArray = [] + for (var i = 0; i < str.length; ++i) { + if ((units -= 2) < 0) break + + c = str.charCodeAt(i) + hi = c >> 8 + lo = c % 256 + byteArray.push(lo) + byteArray.push(hi) + } + + return byteArray + } + + function base64ToBytes (str) { + return base64.toByteArray(base64clean(str)) + } + + function blitBuffer (src, dst, offset, length) { + for (var i = 0; i < length; ++i) { + if ((i + offset >= dst.length) || (i >= src.length)) break + dst[i + offset] = src[i] + } + return i + } + + function isnan (val) { + return val !== val // eslint-disable-line no-self-compare + } + + /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()))) + +/***/ }), +/* 340 */ +/***/ (function(module, exports) { + + 'use strict' + + exports.byteLength = byteLength + exports.toByteArray = toByteArray + exports.fromByteArray = fromByteArray + + var lookup = [] + var revLookup = [] + var Arr = typeof Uint8Array !== 'undefined' ? Uint8Array : Array + + var code = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/' + for (var i = 0, len = code.length; i < len; ++i) { + lookup[i] = code[i] + revLookup[code.charCodeAt(i)] = i + } + + // Support decoding URL-safe base64 strings, as Node.js does. + // See: https://en.wikipedia.org/wiki/Base64#URL_applications + revLookup['-'.charCodeAt(0)] = 62 + revLookup['_'.charCodeAt(0)] = 63 + + function getLens (b64) { + var len = b64.length + + if (len % 4 > 0) { + throw new Error('Invalid string. Length must be a multiple of 4') + } + + // Trim off extra bytes after placeholder bytes are found + // See: https://github.com/beatgammit/base64-js/issues/42 + var validLen = b64.indexOf('=') + if (validLen === -1) validLen = len + + var placeHoldersLen = validLen === len + ? 0 + : 4 - (validLen % 4) + + return [validLen, placeHoldersLen] + } + + // base64 is 4/3 + up to two characters of the original data + function byteLength (b64) { + var lens = getLens(b64) + var validLen = lens[0] + var placeHoldersLen = lens[1] + return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen + } + + function _byteLength (b64, validLen, placeHoldersLen) { + return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen + } + + function toByteArray (b64) { + var tmp + var lens = getLens(b64) + var validLen = lens[0] + var placeHoldersLen = lens[1] + + var arr = new Arr(_byteLength(b64, validLen, placeHoldersLen)) + + var curByte = 0 + + // if there are placeholders, only get up to the last complete 4 chars + var len = placeHoldersLen > 0 + ? validLen - 4 + : validLen + + var i + for (i = 0; i < len; i += 4) { + tmp = + (revLookup[b64.charCodeAt(i)] << 18) | + (revLookup[b64.charCodeAt(i + 1)] << 12) | + (revLookup[b64.charCodeAt(i + 2)] << 6) | + revLookup[b64.charCodeAt(i + 3)] + arr[curByte++] = (tmp >> 16) & 0xFF + arr[curByte++] = (tmp >> 8) & 0xFF + arr[curByte++] = tmp & 0xFF + } + + if (placeHoldersLen === 2) { + tmp = + (revLookup[b64.charCodeAt(i)] << 2) | + (revLookup[b64.charCodeAt(i + 1)] >> 4) + arr[curByte++] = tmp & 0xFF + } + + if (placeHoldersLen === 1) { + tmp = + (revLookup[b64.charCodeAt(i)] << 10) | + (revLookup[b64.charCodeAt(i + 1)] << 4) | + (revLookup[b64.charCodeAt(i + 2)] >> 2) + arr[curByte++] = (tmp >> 8) & 0xFF + arr[curByte++] = tmp & 0xFF + } + + return arr + } + + function tripletToBase64 (num) { + return lookup[num >> 18 & 0x3F] + + lookup[num >> 12 & 0x3F] + + lookup[num >> 6 & 0x3F] + + lookup[num & 0x3F] + } + + function encodeChunk (uint8, start, end) { + var tmp + var output = [] + for (var i = start; i < end; i += 3) { + tmp = + ((uint8[i] << 16) & 0xFF0000) + + ((uint8[i + 1] << 8) & 0xFF00) + + (uint8[i + 2] & 0xFF) + output.push(tripletToBase64(tmp)) + } + return output.join('') + } + + function fromByteArray (uint8) { + var tmp + var len = uint8.length + var extraBytes = len % 3 // if we have 1 byte left, pad 2 bytes + var parts = [] + var maxChunkLength = 16383 // must be multiple of 3 + + // go through the array every three bytes, we'll deal with trailing stuff later + for (var i = 0, len2 = len - extraBytes; i < len2; i += maxChunkLength) { + parts.push(encodeChunk( + uint8, i, (i + maxChunkLength) > len2 ? len2 : (i + maxChunkLength) + )) + } + + // pad the end with zeros, but make sure to not forget the extra bytes + if (extraBytes === 1) { + tmp = uint8[len - 1] + parts.push( + lookup[tmp >> 2] + + lookup[(tmp << 4) & 0x3F] + + '==' + ) + } else if (extraBytes === 2) { + tmp = (uint8[len - 2] << 8) + uint8[len - 1] + parts.push( + lookup[tmp >> 10] + + lookup[(tmp >> 4) & 0x3F] + + lookup[(tmp << 2) & 0x3F] + + '=' + ) + } + + return parts.join('') + } + + +/***/ }), +/* 341 */ +/***/ (function(module, exports) { + + exports.read = function (buffer, offset, isLE, mLen, nBytes) { + var e, m + var eLen = (nBytes * 8) - mLen - 1 + var eMax = (1 << eLen) - 1 + var eBias = eMax >> 1 + var nBits = -7 + var i = isLE ? (nBytes - 1) : 0 + var d = isLE ? -1 : 1 + var s = buffer[offset + i] + + i += d + + e = s & ((1 << (-nBits)) - 1) + s >>= (-nBits) + nBits += eLen + for (; nBits > 0; e = (e * 256) + buffer[offset + i], i += d, nBits -= 8) {} + + m = e & ((1 << (-nBits)) - 1) + e >>= (-nBits) + nBits += mLen + for (; nBits > 0; m = (m * 256) + buffer[offset + i], i += d, nBits -= 8) {} + + if (e === 0) { + e = 1 - eBias + } else if (e === eMax) { + return m ? NaN : ((s ? -1 : 1) * Infinity) + } else { + m = m + Math.pow(2, mLen) + e = e - eBias + } + return (s ? -1 : 1) * m * Math.pow(2, e - mLen) + } + + exports.write = function (buffer, value, offset, isLE, mLen, nBytes) { + var e, m, c + var eLen = (nBytes * 8) - mLen - 1 + var eMax = (1 << eLen) - 1 + var eBias = eMax >> 1 + var rt = (mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0) + var i = isLE ? 0 : (nBytes - 1) + var d = isLE ? 1 : -1 + var s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0 + + value = Math.abs(value) + + if (isNaN(value) || value === Infinity) { + m = isNaN(value) ? 1 : 0 + e = eMax + } else { + e = Math.floor(Math.log(value) / Math.LN2) + if (value * (c = Math.pow(2, -e)) < 1) { + e-- + c *= 2 + } + if (e + eBias >= 1) { + value += rt / c + } else { + value += rt * Math.pow(2, 1 - eBias) + } + if (value * c >= 2) { + e++ + c /= 2 + } + + if (e + eBias >= eMax) { + m = 0 + e = eMax + } else if (e + eBias >= 1) { + m = ((value * c) - 1) * Math.pow(2, mLen) + e = e + eBias + } else { + m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen) + e = 0 + } + } + + for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8) {} + + e = (e << mLen) | m + eLen += mLen + for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8) {} + + buffer[offset + i - d] |= s * 128 + } + + +/***/ }), +/* 342 */ +/***/ (function(module, exports) { + + var toString = {}.toString; + + module.exports = Array.isArray || function (arr) { + return toString.call(arr) == '[object Array]'; + }; + + +/***/ }), +/* 343 */ +/***/ (function(module, exports) { + + // shim for using process in browser + var process = module.exports = {}; + + // cached from whatever global is present so that test runners that stub it + // don't break things. But we need to wrap it in a try catch in case it is + // wrapped in strict mode code which doesn't define any globals. It's inside a + // function because try/catches deoptimize in certain engines. + + var cachedSetTimeout; + var cachedClearTimeout; + + function defaultSetTimout() { + throw new Error('setTimeout has not been defined'); + } + function defaultClearTimeout () { + throw new Error('clearTimeout has not been defined'); + } + (function () { + try { + if (typeof setTimeout === 'function') { + cachedSetTimeout = setTimeout; + } else { + cachedSetTimeout = defaultSetTimout; + } + } catch (e) { + cachedSetTimeout = defaultSetTimout; + } + try { + if (typeof clearTimeout === 'function') { + cachedClearTimeout = clearTimeout; + } else { + cachedClearTimeout = defaultClearTimeout; + } + } catch (e) { + cachedClearTimeout = defaultClearTimeout; + } + } ()) + function runTimeout(fun) { + if (cachedSetTimeout === setTimeout) { + //normal enviroments in sane situations + return setTimeout(fun, 0); + } + // if setTimeout wasn't available but was latter defined + if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) { + cachedSetTimeout = setTimeout; + return setTimeout(fun, 0); + } + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedSetTimeout(fun, 0); + } catch(e){ + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedSetTimeout.call(null, fun, 0); + } catch(e){ + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error + return cachedSetTimeout.call(this, fun, 0); + } + } + + + } + function runClearTimeout(marker) { + if (cachedClearTimeout === clearTimeout) { + //normal enviroments in sane situations + return clearTimeout(marker); + } + // if clearTimeout wasn't available but was latter defined + if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) { + cachedClearTimeout = clearTimeout; + return clearTimeout(marker); + } + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedClearTimeout(marker); + } catch (e){ + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedClearTimeout.call(null, marker); + } catch (e){ + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error. + // Some versions of I.E. have different rules for clearTimeout vs setTimeout + return cachedClearTimeout.call(this, marker); + } + } + + + + } + var queue = []; + var draining = false; + var currentQueue; + var queueIndex = -1; + + function cleanUpNextTick() { + if (!draining || !currentQueue) { + return; + } + draining = false; + if (currentQueue.length) { + queue = currentQueue.concat(queue); + } else { + queueIndex = -1; + } + if (queue.length) { + drainQueue(); + } + } + + function drainQueue() { + if (draining) { + return; + } + var timeout = runTimeout(cleanUpNextTick); + draining = true; + + var len = queue.length; + while(len) { + currentQueue = queue; + queue = []; + while (++queueIndex < len) { + if (currentQueue) { + currentQueue[queueIndex].run(); + } + } + queueIndex = -1; + len = queue.length; + } + currentQueue = null; + draining = false; + runClearTimeout(timeout); + } + + process.nextTick = function (fun) { + var args = new Array(arguments.length - 1); + if (arguments.length > 1) { + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + } + queue.push(new Item(fun, args)); + if (queue.length === 1 && !draining) { + runTimeout(drainQueue); + } + }; + + // v8 likes predictible objects + function Item(fun, array) { + this.fun = fun; + this.array = array; + } + Item.prototype.run = function () { + this.fun.apply(null, this.array); + }; + process.title = 'browser'; + process.browser = true; + process.env = {}; + process.argv = []; + process.version = ''; // empty string to avoid regexp issues + process.versions = {}; + + function noop() {} + + process.on = noop; + process.addListener = noop; + process.once = noop; + process.off = noop; + process.removeListener = noop; + process.removeAllListeners = noop; + process.emit = noop; + process.prependListener = noop; + process.prependOnceListener = noop; + + process.listeners = function (name) { return [] } + + process.binding = function (name) { + throw new Error('process.binding is not supported'); + }; + + process.cwd = function () { return '/' }; + process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); + }; + process.umask = function() { return 0; }; + + +/***/ }), +/* 344 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer) {'use strict'; + + /** + * Normalizes our expected stringified form of a function across versions of node + * @param {Function} fn The function to stringify + */ + + function normalizedFunctionString(fn) { + return fn.toString().replace(/function *\(/, 'function ('); + } + + function newBuffer(item, encoding) { + return new Buffer(item, encoding); + } + + function allocBuffer() { + return Buffer.alloc.apply(Buffer, arguments); + } + + function toBuffer() { + return Buffer.from.apply(Buffer, arguments); + } + + module.exports = { + normalizedFunctionString: normalizedFunctionString, + allocBuffer: typeof Buffer.alloc === 'function' ? allocBuffer : newBuffer, + toBuffer: typeof Buffer.from === 'function' ? toBuffer : newBuffer + }; + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer)) + +/***/ }), +/* 345 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(global, process) {// Copyright Joyent, Inc. and other Node contributors. + // + // Permission is hereby granted, free of charge, to any person obtaining a + // copy of this software and associated documentation files (the + // "Software"), to deal in the Software without restriction, including + // without limitation the rights to use, copy, modify, merge, publish, + // distribute, sublicense, and/or sell copies of the Software, and to permit + // persons to whom the Software is furnished to do so, subject to the + // following conditions: + // + // The above copyright notice and this permission notice shall be included + // in all copies or substantial portions of the Software. + // + // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS + // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN + // NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, + // DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR + // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE + // USE OR OTHER DEALINGS IN THE SOFTWARE. + + var formatRegExp = /%[sdj%]/g; + exports.format = function(f) { + if (!isString(f)) { + var objects = []; + for (var i = 0; i < arguments.length; i++) { + objects.push(inspect(arguments[i])); + } + return objects.join(' '); + } + + var i = 1; + var args = arguments; + var len = args.length; + var str = String(f).replace(formatRegExp, function(x) { + if (x === '%%') return '%'; + if (i >= len) return x; + switch (x) { + case '%s': return String(args[i++]); + case '%d': return Number(args[i++]); + case '%j': + try { + return JSON.stringify(args[i++]); + } catch (_) { + return '[Circular]'; + } + default: + return x; + } + }); + for (var x = args[i]; i < len; x = args[++i]) { + if (isNull(x) || !isObject(x)) { + str += ' ' + x; + } else { + str += ' ' + inspect(x); + } + } + return str; + }; + + + // Mark that a method should not be used. + // Returns a modified function which warns once by default. + // If --no-deprecation is set, then it is a no-op. + exports.deprecate = function(fn, msg) { + // Allow for deprecating things in the process of starting up. + if (isUndefined(global.process)) { + return function() { + return exports.deprecate(fn, msg).apply(this, arguments); + }; + } + + if (process.noDeprecation === true) { + return fn; + } + + var warned = false; + function deprecated() { + if (!warned) { + if (process.throwDeprecation) { + throw new Error(msg); + } else if (process.traceDeprecation) { + console.trace(msg); + } else { + console.error(msg); + } + warned = true; + } + return fn.apply(this, arguments); + } + + return deprecated; + }; + + + var debugs = {}; + var debugEnviron; + exports.debuglog = function(set) { + if (isUndefined(debugEnviron)) + debugEnviron = process.env.NODE_DEBUG || ''; + set = set.toUpperCase(); + if (!debugs[set]) { + if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) { + var pid = process.pid; + debugs[set] = function() { + var msg = exports.format.apply(exports, arguments); + console.error('%s %d: %s', set, pid, msg); + }; + } else { + debugs[set] = function() {}; + } + } + return debugs[set]; + }; + + + /** + * Echos the value of a value. Trys to print the value out + * in the best way possible given the different types. + * + * @param {Object} obj The object to print out. + * @param {Object} opts Optional options object that alters the output. + */ + /* legacy: obj, showHidden, depth, colors*/ + function inspect(obj, opts) { + // default options + var ctx = { + seen: [], + stylize: stylizeNoColor + }; + // legacy... + if (arguments.length >= 3) ctx.depth = arguments[2]; + if (arguments.length >= 4) ctx.colors = arguments[3]; + if (isBoolean(opts)) { + // legacy... + ctx.showHidden = opts; + } else if (opts) { + // got an "options" object + exports._extend(ctx, opts); + } + // set default options + if (isUndefined(ctx.showHidden)) ctx.showHidden = false; + if (isUndefined(ctx.depth)) ctx.depth = 2; + if (isUndefined(ctx.colors)) ctx.colors = false; + if (isUndefined(ctx.customInspect)) ctx.customInspect = true; + if (ctx.colors) ctx.stylize = stylizeWithColor; + return formatValue(ctx, obj, ctx.depth); + } + exports.inspect = inspect; + + + // http://en.wikipedia.org/wiki/ANSI_escape_code#graphics + inspect.colors = { + 'bold' : [1, 22], + 'italic' : [3, 23], + 'underline' : [4, 24], + 'inverse' : [7, 27], + 'white' : [37, 39], + 'grey' : [90, 39], + 'black' : [30, 39], + 'blue' : [34, 39], + 'cyan' : [36, 39], + 'green' : [32, 39], + 'magenta' : [35, 39], + 'red' : [31, 39], + 'yellow' : [33, 39] + }; + + // Don't use 'blue' not visible on cmd.exe + inspect.styles = { + 'special': 'cyan', + 'number': 'yellow', + 'boolean': 'yellow', + 'undefined': 'grey', + 'null': 'bold', + 'string': 'green', + 'date': 'magenta', + // "name": intentionally not styling + 'regexp': 'red' + }; + + + function stylizeWithColor(str, styleType) { + var style = inspect.styles[styleType]; + + if (style) { + return '\u001b[' + inspect.colors[style][0] + 'm' + str + + '\u001b[' + inspect.colors[style][1] + 'm'; + } else { + return str; + } + } + + + function stylizeNoColor(str, styleType) { + return str; + } + + + function arrayToHash(array) { + var hash = {}; + + array.forEach(function(val, idx) { + hash[val] = true; + }); + + return hash; + } + + + function formatValue(ctx, value, recurseTimes) { + // Provide a hook for user-specified inspect functions. + // Check that value is an object with an inspect function on it + if (ctx.customInspect && + value && + isFunction(value.inspect) && + // Filter out the util module, it's inspect function is special + value.inspect !== exports.inspect && + // Also filter out any prototype objects using the circular check. + !(value.constructor && value.constructor.prototype === value)) { + var ret = value.inspect(recurseTimes, ctx); + if (!isString(ret)) { + ret = formatValue(ctx, ret, recurseTimes); + } + return ret; + } + + // Primitive types cannot have properties + var primitive = formatPrimitive(ctx, value); + if (primitive) { + return primitive; + } + + // Look up the keys of the object. + var keys = Object.keys(value); + var visibleKeys = arrayToHash(keys); + + if (ctx.showHidden) { + keys = Object.getOwnPropertyNames(value); + } + + // IE doesn't make error fields non-enumerable + // http://msdn.microsoft.com/en-us/library/ie/dww52sbt(v=vs.94).aspx + if (isError(value) + && (keys.indexOf('message') >= 0 || keys.indexOf('description') >= 0)) { + return formatError(value); + } + + // Some type of object without properties can be shortcutted. + if (keys.length === 0) { + if (isFunction(value)) { + var name = value.name ? ': ' + value.name : ''; + return ctx.stylize('[Function' + name + ']', 'special'); + } + if (isRegExp(value)) { + return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); + } + if (isDate(value)) { + return ctx.stylize(Date.prototype.toString.call(value), 'date'); + } + if (isError(value)) { + return formatError(value); + } + } + + var base = '', array = false, braces = ['{', '}']; + + // Make Array say that they are Array + if (isArray(value)) { + array = true; + braces = ['[', ']']; + } + + // Make functions say that they are functions + if (isFunction(value)) { + var n = value.name ? ': ' + value.name : ''; + base = ' [Function' + n + ']'; + } + + // Make RegExps say that they are RegExps + if (isRegExp(value)) { + base = ' ' + RegExp.prototype.toString.call(value); + } + + // Make dates with properties first say the date + if (isDate(value)) { + base = ' ' + Date.prototype.toUTCString.call(value); + } + + // Make error with message first say the error + if (isError(value)) { + base = ' ' + formatError(value); + } + + if (keys.length === 0 && (!array || value.length == 0)) { + return braces[0] + base + braces[1]; + } + + if (recurseTimes < 0) { + if (isRegExp(value)) { + return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); + } else { + return ctx.stylize('[Object]', 'special'); + } + } + + ctx.seen.push(value); + + var output; + if (array) { + output = formatArray(ctx, value, recurseTimes, visibleKeys, keys); + } else { + output = keys.map(function(key) { + return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array); + }); + } + + ctx.seen.pop(); + + return reduceToSingleString(output, base, braces); + } + + + function formatPrimitive(ctx, value) { + if (isUndefined(value)) + return ctx.stylize('undefined', 'undefined'); + if (isString(value)) { + var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '') + .replace(/'/g, "\\'") + .replace(/\\"/g, '"') + '\''; + return ctx.stylize(simple, 'string'); + } + if (isNumber(value)) + return ctx.stylize('' + value, 'number'); + if (isBoolean(value)) + return ctx.stylize('' + value, 'boolean'); + // For some reason typeof null is "object", so special case here. + if (isNull(value)) + return ctx.stylize('null', 'null'); + } + + + function formatError(value) { + return '[' + Error.prototype.toString.call(value) + ']'; + } + + + function formatArray(ctx, value, recurseTimes, visibleKeys, keys) { + var output = []; + for (var i = 0, l = value.length; i < l; ++i) { + if (hasOwnProperty(value, String(i))) { + output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, + String(i), true)); + } else { + output.push(''); + } + } + keys.forEach(function(key) { + if (!key.match(/^\d+$/)) { + output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, + key, true)); + } + }); + return output; + } + + + function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) { + var name, str, desc; + desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] }; + if (desc.get) { + if (desc.set) { + str = ctx.stylize('[Getter/Setter]', 'special'); + } else { + str = ctx.stylize('[Getter]', 'special'); + } + } else { + if (desc.set) { + str = ctx.stylize('[Setter]', 'special'); + } + } + if (!hasOwnProperty(visibleKeys, key)) { + name = '[' + key + ']'; + } + if (!str) { + if (ctx.seen.indexOf(desc.value) < 0) { + if (isNull(recurseTimes)) { + str = formatValue(ctx, desc.value, null); + } else { + str = formatValue(ctx, desc.value, recurseTimes - 1); + } + if (str.indexOf('\n') > -1) { + if (array) { + str = str.split('\n').map(function(line) { + return ' ' + line; + }).join('\n').substr(2); + } else { + str = '\n' + str.split('\n').map(function(line) { + return ' ' + line; + }).join('\n'); + } + } + } else { + str = ctx.stylize('[Circular]', 'special'); + } + } + if (isUndefined(name)) { + if (array && key.match(/^\d+$/)) { + return str; + } + name = JSON.stringify('' + key); + if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { + name = name.substr(1, name.length - 2); + name = ctx.stylize(name, 'name'); + } else { + name = name.replace(/'/g, "\\'") + .replace(/\\"/g, '"') + .replace(/(^"|"$)/g, "'"); + name = ctx.stylize(name, 'string'); + } + } + + return name + ': ' + str; + } + + + function reduceToSingleString(output, base, braces) { + var numLinesEst = 0; + var length = output.reduce(function(prev, cur) { + numLinesEst++; + if (cur.indexOf('\n') >= 0) numLinesEst++; + return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1; + }, 0); + + if (length > 60) { + return braces[0] + + (base === '' ? '' : base + '\n ') + + ' ' + + output.join(',\n ') + + ' ' + + braces[1]; + } + + return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; + } + + + // NOTE: These type checking functions intentionally don't use `instanceof` + // because it is fragile and can be easily faked with `Object.create()`. + function isArray(ar) { + return Array.isArray(ar); + } + exports.isArray = isArray; + + function isBoolean(arg) { + return typeof arg === 'boolean'; + } + exports.isBoolean = isBoolean; + + function isNull(arg) { + return arg === null; + } + exports.isNull = isNull; + + function isNullOrUndefined(arg) { + return arg == null; + } + exports.isNullOrUndefined = isNullOrUndefined; + + function isNumber(arg) { + return typeof arg === 'number'; + } + exports.isNumber = isNumber; + + function isString(arg) { + return typeof arg === 'string'; + } + exports.isString = isString; + + function isSymbol(arg) { + return typeof arg === 'symbol'; + } + exports.isSymbol = isSymbol; + + function isUndefined(arg) { + return arg === void 0; + } + exports.isUndefined = isUndefined; + + function isRegExp(re) { + return isObject(re) && objectToString(re) === '[object RegExp]'; + } + exports.isRegExp = isRegExp; + + function isObject(arg) { + return typeof arg === 'object' && arg !== null; + } + exports.isObject = isObject; + + function isDate(d) { + return isObject(d) && objectToString(d) === '[object Date]'; + } + exports.isDate = isDate; + + function isError(e) { + return isObject(e) && + (objectToString(e) === '[object Error]' || e instanceof Error); + } + exports.isError = isError; + + function isFunction(arg) { + return typeof arg === 'function'; + } + exports.isFunction = isFunction; + + function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; + } + exports.isPrimitive = isPrimitive; + + exports.isBuffer = __webpack_require__(346); + + function objectToString(o) { + return Object.prototype.toString.call(o); + } + + + function pad(n) { + return n < 10 ? '0' + n.toString(10) : n.toString(10); + } + + + var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', + 'Oct', 'Nov', 'Dec']; + + // 26 Feb 16:19:34 + function timestamp() { + var d = new Date(); + var time = [pad(d.getHours()), + pad(d.getMinutes()), + pad(d.getSeconds())].join(':'); + return [d.getDate(), months[d.getMonth()], time].join(' '); + } + + + // log is just a thin wrapper to console.log that prepends a timestamp + exports.log = function() { + console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments)); + }; + + + /** + * Inherit the prototype methods from one constructor into another. + * + * The Function.prototype.inherits from lang.js rewritten as a standalone + * function (not on Function.prototype). NOTE: If this file is to be loaded + * during bootstrapping this function needs to be rewritten using some native + * functions as prototype setup using normal JavaScript does not work as + * expected during bootstrapping (see mirror.js in r114903). + * + * @param {function} ctor Constructor function which needs to inherit the + * prototype. + * @param {function} superCtor Constructor function to inherit prototype from. + */ + exports.inherits = __webpack_require__(347); + + exports._extend = function(origin, add) { + // Don't do anything if add isn't an object + if (!add || !isObject(add)) return origin; + + var keys = Object.keys(add); + var i = keys.length; + while (i--) { + origin[keys[i]] = add[keys[i]]; + } + return origin; + }; + + function hasOwnProperty(obj, prop) { + return Object.prototype.hasOwnProperty.call(obj, prop); + } + + /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()), __webpack_require__(343))) + +/***/ }), +/* 346 */ +/***/ (function(module, exports) { + + module.exports = function isBuffer(arg) { + return arg && typeof arg === 'object' + && typeof arg.copy === 'function' + && typeof arg.fill === 'function' + && typeof arg.readUInt8 === 'function'; + } + +/***/ }), +/* 347 */ +/***/ (function(module, exports) { + + if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }); + }; + } else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor + } + } + + +/***/ }), +/* 348 */ +/***/ (function(module, exports) { + + /** + * A class representation of the BSON RegExp type. + * + * @class + * @return {BSONRegExp} A MinKey instance + */ + function BSONRegExp(pattern, options) { + if (!(this instanceof BSONRegExp)) return new BSONRegExp(); + + // Execute + this._bsontype = 'BSONRegExp'; + this.pattern = pattern || ''; + this.options = options || ''; + + // Validate options + for (var i = 0; i < this.options.length; i++) { + if (!(this.options[i] === 'i' || this.options[i] === 'm' || this.options[i] === 'x' || this.options[i] === 'l' || this.options[i] === 's' || this.options[i] === 'u')) { + throw new Error('the regular expression options [' + this.options[i] + '] is not supported'); + } + } + } + + module.exports = BSONRegExp; + module.exports.BSONRegExp = BSONRegExp; + +/***/ }), +/* 349 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer) {// Custom inspect property name / symbol. + var inspect = Buffer ? __webpack_require__(345).inspect.custom || 'inspect' : 'inspect'; + + /** + * A class representation of the BSON Symbol type. + * + * @class + * @deprecated + * @param {string} value the string representing the symbol. + * @return {Symbol} + */ + function Symbol(value) { + if (!(this instanceof Symbol)) return new Symbol(value); + this._bsontype = 'Symbol'; + this.value = value; + } + + /** + * Access the wrapped string value. + * + * @method + * @return {String} returns the wrapped string. + */ + Symbol.prototype.valueOf = function () { + return this.value; + }; + + /** + * @ignore + */ + Symbol.prototype.toString = function () { + return this.value; + }; + + /** + * @ignore + */ + Symbol.prototype[inspect] = function () { + return this.value; + }; + + /** + * @ignore + */ + Symbol.prototype.toJSON = function () { + return this.value; + }; + + module.exports = Symbol; + module.exports.Symbol = Symbol; + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer)) + +/***/ }), +/* 350 */ +/***/ (function(module, exports) { + + /** + * A class representation of a BSON Int32 type. + * + * @class + * @param {number} value the number we want to represent as an int32. + * @return {Int32} + */ + var Int32 = function (value) { + if (!(this instanceof Int32)) return new Int32(value); + + this._bsontype = 'Int32'; + this.value = value; + }; + + /** + * Access the number value. + * + * @method + * @return {number} returns the wrapped int32 number. + */ + Int32.prototype.valueOf = function () { + return this.value; + }; + + /** + * @ignore + */ + Int32.prototype.toJSON = function () { + return this.value; + }; + + module.exports = Int32; + module.exports.Int32 = Int32; + +/***/ }), +/* 351 */ +/***/ (function(module, exports) { + + /** + * A class representation of the BSON Code type. + * + * @class + * @param {(string|function)} code a string or function. + * @param {Object} [scope] an optional scope for the function. + * @return {Code} + */ + var Code = function Code(code, scope) { + if (!(this instanceof Code)) return new Code(code, scope); + this._bsontype = 'Code'; + this.code = code; + this.scope = scope; + }; + + /** + * @ignore + */ + Code.prototype.toJSON = function () { + return { scope: this.scope, code: this.code }; + }; + + module.exports = Code; + module.exports.Code = Code; + +/***/ }), +/* 352 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var Long = __webpack_require__(335); + + var PARSE_STRING_REGEXP = /^(\+|-)?(\d+|(\d*\.\d*))?(E|e)?([-+])?(\d+)?$/; + var PARSE_INF_REGEXP = /^(\+|-)?(Infinity|inf)$/i; + var PARSE_NAN_REGEXP = /^(\+|-)?NaN$/i; + + var EXPONENT_MAX = 6111; + var EXPONENT_MIN = -6176; + var EXPONENT_BIAS = 6176; + var MAX_DIGITS = 34; + + // Nan value bits as 32 bit values (due to lack of longs) + var NAN_BUFFER = [0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00].reverse(); + // Infinity value bits 32 bit values (due to lack of longs) + var INF_NEGATIVE_BUFFER = [0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00].reverse(); + var INF_POSITIVE_BUFFER = [0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00].reverse(); + + var EXPONENT_REGEX = /^([-+])?(\d+)?$/; + + var utils = __webpack_require__(344); + + // Detect if the value is a digit + var isDigit = function (value) { + return !isNaN(parseInt(value, 10)); + }; + + // Divide two uint128 values + var divideu128 = function (value) { + var DIVISOR = Long.fromNumber(1000 * 1000 * 1000); + var _rem = Long.fromNumber(0); + var i = 0; + + if (!value.parts[0] && !value.parts[1] && !value.parts[2] && !value.parts[3]) { + return { quotient: value, rem: _rem }; + } + + for (i = 0; i <= 3; i++) { + // Adjust remainder to match value of next dividend + _rem = _rem.shiftLeft(32); + // Add the divided to _rem + _rem = _rem.add(new Long(value.parts[i], 0)); + value.parts[i] = _rem.div(DIVISOR).low_; + _rem = _rem.modulo(DIVISOR); + } + + return { quotient: value, rem: _rem }; + }; + + // Multiply two Long values and return the 128 bit value + var multiply64x2 = function (left, right) { + if (!left && !right) { + return { high: Long.fromNumber(0), low: Long.fromNumber(0) }; + } + + var leftHigh = left.shiftRightUnsigned(32); + var leftLow = new Long(left.getLowBits(), 0); + var rightHigh = right.shiftRightUnsigned(32); + var rightLow = new Long(right.getLowBits(), 0); + + var productHigh = leftHigh.multiply(rightHigh); + var productMid = leftHigh.multiply(rightLow); + var productMid2 = leftLow.multiply(rightHigh); + var productLow = leftLow.multiply(rightLow); + + productHigh = productHigh.add(productMid.shiftRightUnsigned(32)); + productMid = new Long(productMid.getLowBits(), 0).add(productMid2).add(productLow.shiftRightUnsigned(32)); + + productHigh = productHigh.add(productMid.shiftRightUnsigned(32)); + productLow = productMid.shiftLeft(32).add(new Long(productLow.getLowBits(), 0)); + + // Return the 128 bit result + return { high: productHigh, low: productLow }; + }; + + var lessThan = function (left, right) { + // Make values unsigned + var uhleft = left.high_ >>> 0; + var uhright = right.high_ >>> 0; + + // Compare high bits first + if (uhleft < uhright) { + return true; + } else if (uhleft === uhright) { + var ulleft = left.low_ >>> 0; + var ulright = right.low_ >>> 0; + if (ulleft < ulright) return true; + } + + return false; + }; + + // var longtoHex = function(value) { + // var buffer = utils.allocBuffer(8); + // var index = 0; + // // Encode the low 64 bits of the decimal + // // Encode low bits + // buffer[index++] = value.low_ & 0xff; + // buffer[index++] = (value.low_ >> 8) & 0xff; + // buffer[index++] = (value.low_ >> 16) & 0xff; + // buffer[index++] = (value.low_ >> 24) & 0xff; + // // Encode high bits + // buffer[index++] = value.high_ & 0xff; + // buffer[index++] = (value.high_ >> 8) & 0xff; + // buffer[index++] = (value.high_ >> 16) & 0xff; + // buffer[index++] = (value.high_ >> 24) & 0xff; + // return buffer.reverse().toString('hex'); + // }; + + // var int32toHex = function(value) { + // var buffer = utils.allocBuffer(4); + // var index = 0; + // // Encode the low 64 bits of the decimal + // // Encode low bits + // buffer[index++] = value & 0xff; + // buffer[index++] = (value >> 8) & 0xff; + // buffer[index++] = (value >> 16) & 0xff; + // buffer[index++] = (value >> 24) & 0xff; + // return buffer.reverse().toString('hex'); + // }; + + /** + * A class representation of the BSON Decimal128 type. + * + * @class + * @param {Buffer} bytes a buffer containing the raw Decimal128 bytes. + * @return {Double} + */ + var Decimal128 = function (bytes) { + this._bsontype = 'Decimal128'; + this.bytes = bytes; + }; + + /** + * Create a Decimal128 instance from a string representation + * + * @method + * @param {string} string a numeric string representation. + * @return {Decimal128} returns a Decimal128 instance. + */ + Decimal128.fromString = function (string) { + // Parse state tracking + var isNegative = false; + var sawRadix = false; + var foundNonZero = false; + + // Total number of significant digits (no leading or trailing zero) + var significantDigits = 0; + // Total number of significand digits read + var nDigitsRead = 0; + // Total number of digits (no leading zeros) + var nDigits = 0; + // The number of the digits after radix + var radixPosition = 0; + // The index of the first non-zero in *str* + var firstNonZero = 0; + + // Digits Array + var digits = [0]; + // The number of digits in digits + var nDigitsStored = 0; + // Insertion pointer for digits + var digitsInsert = 0; + // The index of the first non-zero digit + var firstDigit = 0; + // The index of the last digit + var lastDigit = 0; + + // Exponent + var exponent = 0; + // loop index over array + var i = 0; + // The high 17 digits of the significand + var significandHigh = [0, 0]; + // The low 17 digits of the significand + var significandLow = [0, 0]; + // The biased exponent + var biasedExponent = 0; + + // Read index + var index = 0; + + // Trim the string + string = string.trim(); + + // Naively prevent against REDOS attacks. + // TODO: implementing a custom parsing for this, or refactoring the regex would yield + // further gains. + if (string.length >= 7000) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Results + var stringMatch = string.match(PARSE_STRING_REGEXP); + var infMatch = string.match(PARSE_INF_REGEXP); + var nanMatch = string.match(PARSE_NAN_REGEXP); + + // Validate the string + if (!stringMatch && !infMatch && !nanMatch || string.length === 0) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Check if we have an illegal exponent format + if (stringMatch && stringMatch[4] && stringMatch[2] === undefined) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Get the negative or positive sign + if (string[index] === '+' || string[index] === '-') { + isNegative = string[index++] === '-'; + } + + // Check if user passed Infinity or NaN + if (!isDigit(string[index]) && string[index] !== '.') { + if (string[index] === 'i' || string[index] === 'I') { + return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)); + } else if (string[index] === 'N') { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + } + + // Read all the digits + while (isDigit(string[index]) || string[index] === '.') { + if (string[index] === '.') { + if (sawRadix) { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + + sawRadix = true; + index = index + 1; + continue; + } + + if (nDigitsStored < 34) { + if (string[index] !== '0' || foundNonZero) { + if (!foundNonZero) { + firstNonZero = nDigitsRead; + } + + foundNonZero = true; + + // Only store 34 digits + digits[digitsInsert++] = parseInt(string[index], 10); + nDigitsStored = nDigitsStored + 1; + } + } + + if (foundNonZero) { + nDigits = nDigits + 1; + } + + if (sawRadix) { + radixPosition = radixPosition + 1; + } + + nDigitsRead = nDigitsRead + 1; + index = index + 1; + } + + if (sawRadix && !nDigitsRead) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Read exponent if exists + if (string[index] === 'e' || string[index] === 'E') { + // Read exponent digits + var match = string.substr(++index).match(EXPONENT_REGEX); + + // No digits read + if (!match || !match[2]) { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + + // Get exponent + exponent = parseInt(match[0], 10); + + // Adjust the index + index = index + match[0].length; + } + + // Return not a number + if (string[index]) { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + + // Done reading input + // Find first non-zero digit in digits + firstDigit = 0; + + if (!nDigitsStored) { + firstDigit = 0; + lastDigit = 0; + digits[0] = 0; + nDigits = 1; + nDigitsStored = 1; + significantDigits = 0; + } else { + lastDigit = nDigitsStored - 1; + significantDigits = nDigits; + + if (exponent !== 0 && significantDigits !== 1) { + while (string[firstNonZero + significantDigits - 1] === '0') { + significantDigits = significantDigits - 1; + } + } + } + + // Normalization of exponent + // Correct exponent based on radix position, and shift significand as needed + // to represent user input + + // Overflow prevention + if (exponent <= radixPosition && radixPosition - exponent > 1 << 14) { + exponent = EXPONENT_MIN; + } else { + exponent = exponent - radixPosition; + } + + // Attempt to normalize the exponent + while (exponent > EXPONENT_MAX) { + // Shift exponent to significand and decrease + lastDigit = lastDigit + 1; + + if (lastDigit - firstDigit > MAX_DIGITS) { + // Check if we have a zero then just hard clamp, otherwise fail + var digitsString = digits.join(''); + if (digitsString.match(/^0+$/)) { + exponent = EXPONENT_MAX; + break; + } else { + return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)); + } + } + + exponent = exponent - 1; + } + + while (exponent < EXPONENT_MIN || nDigitsStored < nDigits) { + // Shift last digit + if (lastDigit === 0) { + exponent = EXPONENT_MIN; + significantDigits = 0; + break; + } + + if (nDigitsStored < nDigits) { + // adjust to match digits not stored + nDigits = nDigits - 1; + } else { + // adjust to round + lastDigit = lastDigit - 1; + } + + if (exponent < EXPONENT_MAX) { + exponent = exponent + 1; + } else { + // Check if we have a zero then just hard clamp, otherwise fail + digitsString = digits.join(''); + if (digitsString.match(/^0+$/)) { + exponent = EXPONENT_MAX; + break; + } else { + return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)); + } + } + } + + // Round + // We've normalized the exponent, but might still need to round. + if (lastDigit - firstDigit + 1 < significantDigits && string[significantDigits] !== '0') { + var endOfString = nDigitsRead; + + // If we have seen a radix point, 'string' is 1 longer than we have + // documented with ndigits_read, so inc the position of the first nonzero + // digit and the position that digits are read to. + if (sawRadix && exponent === EXPONENT_MIN) { + firstNonZero = firstNonZero + 1; + endOfString = endOfString + 1; + } + + var roundDigit = parseInt(string[firstNonZero + lastDigit + 1], 10); + var roundBit = 0; + + if (roundDigit >= 5) { + roundBit = 1; + + if (roundDigit === 5) { + roundBit = digits[lastDigit] % 2 === 1; + + for (i = firstNonZero + lastDigit + 2; i < endOfString; i++) { + if (parseInt(string[i], 10)) { + roundBit = 1; + break; + } + } + } + } + + if (roundBit) { + var dIdx = lastDigit; + + for (; dIdx >= 0; dIdx--) { + if (++digits[dIdx] > 9) { + digits[dIdx] = 0; + + // overflowed most significant digit + if (dIdx === 0) { + if (exponent < EXPONENT_MAX) { + exponent = exponent + 1; + digits[dIdx] = 1; + } else { + return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)); + } + } + } else { + break; + } + } + } + } + + // Encode significand + // The high 17 digits of the significand + significandHigh = Long.fromNumber(0); + // The low 17 digits of the significand + significandLow = Long.fromNumber(0); + + // read a zero + if (significantDigits === 0) { + significandHigh = Long.fromNumber(0); + significandLow = Long.fromNumber(0); + } else if (lastDigit - firstDigit < 17) { + dIdx = firstDigit; + significandLow = Long.fromNumber(digits[dIdx++]); + significandHigh = new Long(0, 0); + + for (; dIdx <= lastDigit; dIdx++) { + significandLow = significandLow.multiply(Long.fromNumber(10)); + significandLow = significandLow.add(Long.fromNumber(digits[dIdx])); + } + } else { + dIdx = firstDigit; + significandHigh = Long.fromNumber(digits[dIdx++]); + + for (; dIdx <= lastDigit - 17; dIdx++) { + significandHigh = significandHigh.multiply(Long.fromNumber(10)); + significandHigh = significandHigh.add(Long.fromNumber(digits[dIdx])); + } + + significandLow = Long.fromNumber(digits[dIdx++]); + + for (; dIdx <= lastDigit; dIdx++) { + significandLow = significandLow.multiply(Long.fromNumber(10)); + significandLow = significandLow.add(Long.fromNumber(digits[dIdx])); + } + } + + var significand = multiply64x2(significandHigh, Long.fromString('100000000000000000')); + + significand.low = significand.low.add(significandLow); + + if (lessThan(significand.low, significandLow)) { + significand.high = significand.high.add(Long.fromNumber(1)); + } + + // Biased exponent + biasedExponent = exponent + EXPONENT_BIAS; + var dec = { low: Long.fromNumber(0), high: Long.fromNumber(0) }; + + // Encode combination, exponent, and significand. + if (significand.high.shiftRightUnsigned(49).and(Long.fromNumber(1)).equals(Long.fromNumber)) { + // Encode '11' into bits 1 to 3 + dec.high = dec.high.or(Long.fromNumber(0x3).shiftLeft(61)); + dec.high = dec.high.or(Long.fromNumber(biasedExponent).and(Long.fromNumber(0x3fff).shiftLeft(47))); + dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x7fffffffffff))); + } else { + dec.high = dec.high.or(Long.fromNumber(biasedExponent & 0x3fff).shiftLeft(49)); + dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x1ffffffffffff))); + } + + dec.low = significand.low; + + // Encode sign + if (isNegative) { + dec.high = dec.high.or(Long.fromString('9223372036854775808')); + } + + // Encode into a buffer + var buffer = utils.allocBuffer(16); + index = 0; + + // Encode the low 64 bits of the decimal + // Encode low bits + buffer[index++] = dec.low.low_ & 0xff; + buffer[index++] = dec.low.low_ >> 8 & 0xff; + buffer[index++] = dec.low.low_ >> 16 & 0xff; + buffer[index++] = dec.low.low_ >> 24 & 0xff; + // Encode high bits + buffer[index++] = dec.low.high_ & 0xff; + buffer[index++] = dec.low.high_ >> 8 & 0xff; + buffer[index++] = dec.low.high_ >> 16 & 0xff; + buffer[index++] = dec.low.high_ >> 24 & 0xff; + + // Encode the high 64 bits of the decimal + // Encode low bits + buffer[index++] = dec.high.low_ & 0xff; + buffer[index++] = dec.high.low_ >> 8 & 0xff; + buffer[index++] = dec.high.low_ >> 16 & 0xff; + buffer[index++] = dec.high.low_ >> 24 & 0xff; + // Encode high bits + buffer[index++] = dec.high.high_ & 0xff; + buffer[index++] = dec.high.high_ >> 8 & 0xff; + buffer[index++] = dec.high.high_ >> 16 & 0xff; + buffer[index++] = dec.high.high_ >> 24 & 0xff; + + // Return the new Decimal128 + return new Decimal128(buffer); + }; + + // Extract least significant 5 bits + var COMBINATION_MASK = 0x1f; + // Extract least significant 14 bits + var EXPONENT_MASK = 0x3fff; + // Value of combination field for Inf + var COMBINATION_INFINITY = 30; + // Value of combination field for NaN + var COMBINATION_NAN = 31; + // Value of combination field for NaN + // var COMBINATION_SNAN = 32; + // decimal128 exponent bias + EXPONENT_BIAS = 6176; + + /** + * Create a string representation of the raw Decimal128 value + * + * @method + * @return {string} returns a Decimal128 string representation. + */ + Decimal128.prototype.toString = function () { + // Note: bits in this routine are referred to starting at 0, + // from the sign bit, towards the coefficient. + + // bits 0 - 31 + var high; + // bits 32 - 63 + var midh; + // bits 64 - 95 + var midl; + // bits 96 - 127 + var low; + // bits 1 - 5 + var combination; + // decoded biased exponent (14 bits) + var biased_exponent; + // the number of significand digits + var significand_digits = 0; + // the base-10 digits in the significand + var significand = new Array(36); + for (var i = 0; i < significand.length; i++) significand[i] = 0; + // read pointer into significand + var index = 0; + + // unbiased exponent + var exponent; + // the exponent if scientific notation is used + var scientific_exponent; + + // true if the number is zero + var is_zero = false; + + // the most signifcant significand bits (50-46) + var significand_msb; + // temporary storage for significand decoding + var significand128 = { parts: new Array(4) }; + // indexing variables + i; + var j, k; + + // Output string + var string = []; + + // Unpack index + index = 0; + + // Buffer reference + var buffer = this.bytes; + + // Unpack the low 64bits into a long + low = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + midl = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + + // Unpack the high 64bits into a long + midh = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + high = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + + // Unpack index + index = 0; + + // Create the state of the decimal + var dec = { + low: new Long(low, midl), + high: new Long(midh, high) + }; + + if (dec.high.lessThan(Long.ZERO)) { + string.push('-'); + } + + // Decode combination field and exponent + combination = high >> 26 & COMBINATION_MASK; + + if (combination >> 3 === 3) { + // Check for 'special' values + if (combination === COMBINATION_INFINITY) { + return string.join('') + 'Infinity'; + } else if (combination === COMBINATION_NAN) { + return 'NaN'; + } else { + biased_exponent = high >> 15 & EXPONENT_MASK; + significand_msb = 0x08 + (high >> 14 & 0x01); + } + } else { + significand_msb = high >> 14 & 0x07; + biased_exponent = high >> 17 & EXPONENT_MASK; + } + + exponent = biased_exponent - EXPONENT_BIAS; + + // Create string of significand digits + + // Convert the 114-bit binary number represented by + // (significand_high, significand_low) to at most 34 decimal + // digits through modulo and division. + significand128.parts[0] = (high & 0x3fff) + ((significand_msb & 0xf) << 14); + significand128.parts[1] = midh; + significand128.parts[2] = midl; + significand128.parts[3] = low; + + if (significand128.parts[0] === 0 && significand128.parts[1] === 0 && significand128.parts[2] === 0 && significand128.parts[3] === 0) { + is_zero = true; + } else { + for (k = 3; k >= 0; k--) { + var least_digits = 0; + // Peform the divide + var result = divideu128(significand128); + significand128 = result.quotient; + least_digits = result.rem.low_; + + // We now have the 9 least significant digits (in base 2). + // Convert and output to string. + if (!least_digits) continue; + + for (j = 8; j >= 0; j--) { + // significand[k * 9 + j] = Math.round(least_digits % 10); + significand[k * 9 + j] = least_digits % 10; + // least_digits = Math.round(least_digits / 10); + least_digits = Math.floor(least_digits / 10); + } + } + } + + // Output format options: + // Scientific - [-]d.dddE(+/-)dd or [-]dE(+/-)dd + // Regular - ddd.ddd + + if (is_zero) { + significand_digits = 1; + significand[index] = 0; + } else { + significand_digits = 36; + i = 0; + + while (!significand[index]) { + i++; + significand_digits = significand_digits - 1; + index = index + 1; + } + } + + scientific_exponent = significand_digits - 1 + exponent; + + // The scientific exponent checks are dictated by the string conversion + // specification and are somewhat arbitrary cutoffs. + // + // We must check exponent > 0, because if this is the case, the number + // has trailing zeros. However, we *cannot* output these trailing zeros, + // because doing so would change the precision of the value, and would + // change stored data if the string converted number is round tripped. + + if (scientific_exponent >= 34 || scientific_exponent <= -7 || exponent > 0) { + // Scientific format + string.push(significand[index++]); + significand_digits = significand_digits - 1; + + if (significand_digits) { + string.push('.'); + } + + for (i = 0; i < significand_digits; i++) { + string.push(significand[index++]); + } + + // Exponent + string.push('E'); + if (scientific_exponent > 0) { + string.push('+' + scientific_exponent); + } else { + string.push(scientific_exponent); + } + } else { + // Regular format with no decimal place + if (exponent >= 0) { + for (i = 0; i < significand_digits; i++) { + string.push(significand[index++]); + } + } else { + var radix_position = significand_digits + exponent; + + // non-zero digits before radix + if (radix_position > 0) { + for (i = 0; i < radix_position; i++) { + string.push(significand[index++]); + } + } else { + string.push('0'); + } + + string.push('.'); + // add leading zeros after radix + while (radix_position++ < 0) { + string.push('0'); + } + + for (i = 0; i < significand_digits - Math.max(radix_position - 1, 0); i++) { + string.push(significand[index++]); + } + } + } + + return string.join(''); + }; + + Decimal128.prototype.toJSON = function () { + return { $numberDecimal: this.toString() }; + }; + + module.exports = Decimal128; + module.exports.Decimal128 = Decimal128; + +/***/ }), +/* 353 */ +/***/ (function(module, exports) { + + /** + * A class representation of the BSON MinKey type. + * + * @class + * @return {MinKey} A MinKey instance + */ + function MinKey() { + if (!(this instanceof MinKey)) return new MinKey(); + + this._bsontype = 'MinKey'; + } + + module.exports = MinKey; + module.exports.MinKey = MinKey; + +/***/ }), +/* 354 */ +/***/ (function(module, exports) { + + /** + * A class representation of the BSON MaxKey type. + * + * @class + * @return {MaxKey} A MaxKey instance + */ + function MaxKey() { + if (!(this instanceof MaxKey)) return new MaxKey(); + + this._bsontype = 'MaxKey'; + } + + module.exports = MaxKey; + module.exports.MaxKey = MaxKey; + +/***/ }), +/* 355 */ +/***/ (function(module, exports) { + + /** + * A class representation of the BSON DBRef type. + * + * @class + * @param {string} namespace the collection name. + * @param {ObjectID} oid the reference ObjectID. + * @param {string} [db] optional db name, if omitted the reference is local to the current db. + * @return {DBRef} + */ + function DBRef(namespace, oid, db) { + if (!(this instanceof DBRef)) return new DBRef(namespace, oid, db); + + this._bsontype = 'DBRef'; + this.namespace = namespace; + this.oid = oid; + this.db = db; + } + + /** + * @ignore + * @api private + */ + DBRef.prototype.toJSON = function () { + return { + $ref: this.namespace, + $id: this.oid, + $db: this.db == null ? '' : this.db + }; + }; + + module.exports = DBRef; + module.exports.DBRef = DBRef; + +/***/ }), +/* 356 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(global) {/** + * Module dependencies. + * @ignore + */ + + // Test if we're in Node via presence of "global" not absence of "window" + // to support hybrid environments like Electron + if (typeof global !== 'undefined') { + var Buffer = __webpack_require__(339).Buffer; // TODO just use global Buffer + } + + var utils = __webpack_require__(344); + + /** + * A class representation of the BSON Binary type. + * + * Sub types + * - **BSON.BSON_BINARY_SUBTYPE_DEFAULT**, default BSON type. + * - **BSON.BSON_BINARY_SUBTYPE_FUNCTION**, BSON function type. + * - **BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY**, BSON byte array type. + * - **BSON.BSON_BINARY_SUBTYPE_UUID**, BSON uuid type. + * - **BSON.BSON_BINARY_SUBTYPE_MD5**, BSON md5 type. + * - **BSON.BSON_BINARY_SUBTYPE_USER_DEFINED**, BSON user defined type. + * + * @class + * @param {Buffer} buffer a buffer object containing the binary data. + * @param {Number} [subType] the option binary type. + * @return {Binary} + */ + function Binary(buffer, subType) { + if (!(this instanceof Binary)) return new Binary(buffer, subType); + + if (buffer != null && !(typeof buffer === 'string') && !Buffer.isBuffer(buffer) && !(buffer instanceof Uint8Array) && !Array.isArray(buffer)) { + throw new Error('only String, Buffer, Uint8Array or Array accepted'); + } + + this._bsontype = 'Binary'; + + if (buffer instanceof Number) { + this.sub_type = buffer; + this.position = 0; + } else { + this.sub_type = subType == null ? BSON_BINARY_SUBTYPE_DEFAULT : subType; + this.position = 0; + } + + if (buffer != null && !(buffer instanceof Number)) { + // Only accept Buffer, Uint8Array or Arrays + if (typeof buffer === 'string') { + // Different ways of writing the length of the string for the different types + if (typeof Buffer !== 'undefined') { + this.buffer = utils.toBuffer(buffer); + } else if (typeof Uint8Array !== 'undefined' || Object.prototype.toString.call(buffer) === '[object Array]') { + this.buffer = writeStringToArray(buffer); + } else { + throw new Error('only String, Buffer, Uint8Array or Array accepted'); + } + } else { + this.buffer = buffer; + } + this.position = buffer.length; + } else { + if (typeof Buffer !== 'undefined') { + this.buffer = utils.allocBuffer(Binary.BUFFER_SIZE); + } else if (typeof Uint8Array !== 'undefined') { + this.buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE)); + } else { + this.buffer = new Array(Binary.BUFFER_SIZE); + } + // Set position to start of buffer + this.position = 0; + } + } + + /** + * Updates this binary with byte_value. + * + * @method + * @param {string} byte_value a single byte we wish to write. + */ + Binary.prototype.put = function put(byte_value) { + // If it's a string and a has more than one character throw an error + if (byte_value['length'] != null && typeof byte_value !== 'number' && byte_value.length !== 1) throw new Error('only accepts single character String, Uint8Array or Array'); + if (typeof byte_value !== 'number' && byte_value < 0 || byte_value > 255) throw new Error('only accepts number in a valid unsigned byte range 0-255'); + + // Decode the byte value once + var decoded_byte = null; + if (typeof byte_value === 'string') { + decoded_byte = byte_value.charCodeAt(0); + } else if (byte_value['length'] != null) { + decoded_byte = byte_value[0]; + } else { + decoded_byte = byte_value; + } + + if (this.buffer.length > this.position) { + this.buffer[this.position++] = decoded_byte; + } else { + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) { + // Create additional overflow buffer + var buffer = utils.allocBuffer(Binary.BUFFER_SIZE + this.buffer.length); + // Combine the two buffers together + this.buffer.copy(buffer, 0, 0, this.buffer.length); + this.buffer = buffer; + this.buffer[this.position++] = decoded_byte; + } else { + buffer = null; + // Create a new buffer (typed or normal array) + if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') { + buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE + this.buffer.length)); + } else { + buffer = new Array(Binary.BUFFER_SIZE + this.buffer.length); + } + + // We need to copy all the content to the new array + for (var i = 0; i < this.buffer.length; i++) { + buffer[i] = this.buffer[i]; + } + + // Reassign the buffer + this.buffer = buffer; + // Write the byte + this.buffer[this.position++] = decoded_byte; + } + } + }; + + /** + * Writes a buffer or string to the binary. + * + * @method + * @param {(Buffer|string)} string a string or buffer to be written to the Binary BSON object. + * @param {number} offset specify the binary of where to write the content. + * @return {null} + */ + Binary.prototype.write = function write(string, offset) { + offset = typeof offset === 'number' ? offset : this.position; + + // If the buffer is to small let's extend the buffer + if (this.buffer.length < offset + string.length) { + var buffer = null; + // If we are in node.js + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) { + buffer = utils.allocBuffer(this.buffer.length + string.length); + this.buffer.copy(buffer, 0, 0, this.buffer.length); + } else if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') { + // Create a new buffer + buffer = new Uint8Array(new ArrayBuffer(this.buffer.length + string.length)); + // Copy the content + for (var i = 0; i < this.position; i++) { + buffer[i] = this.buffer[i]; + } + } + + // Assign the new buffer + this.buffer = buffer; + } + + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(string) && Buffer.isBuffer(this.buffer)) { + string.copy(this.buffer, offset, 0, string.length); + this.position = offset + string.length > this.position ? offset + string.length : this.position; + // offset = string.length + } else if (typeof Buffer !== 'undefined' && typeof string === 'string' && Buffer.isBuffer(this.buffer)) { + this.buffer.write(string, offset, 'binary'); + this.position = offset + string.length > this.position ? offset + string.length : this.position; + // offset = string.length; + } else if (Object.prototype.toString.call(string) === '[object Uint8Array]' || Object.prototype.toString.call(string) === '[object Array]' && typeof string !== 'string') { + for (i = 0; i < string.length; i++) { + this.buffer[offset++] = string[i]; + } + + this.position = offset > this.position ? offset : this.position; + } else if (typeof string === 'string') { + for (i = 0; i < string.length; i++) { + this.buffer[offset++] = string.charCodeAt(i); + } + + this.position = offset > this.position ? offset : this.position; + } + }; + + /** + * Reads **length** bytes starting at **position**. + * + * @method + * @param {number} position read from the given position in the Binary. + * @param {number} length the number of bytes to read. + * @return {Buffer} + */ + Binary.prototype.read = function read(position, length) { + length = length && length > 0 ? length : this.position; + + // Let's return the data based on the type we have + if (this.buffer['slice']) { + return this.buffer.slice(position, position + length); + } else { + // Create a buffer to keep the result + var buffer = typeof Uint8Array !== 'undefined' ? new Uint8Array(new ArrayBuffer(length)) : new Array(length); + for (var i = 0; i < length; i++) { + buffer[i] = this.buffer[position++]; + } + } + // Return the buffer + return buffer; + }; + + /** + * Returns the value of this binary as a string. + * + * @method + * @return {string} + */ + Binary.prototype.value = function value(asRaw) { + asRaw = asRaw == null ? false : asRaw; + + // Optimize to serialize for the situation where the data == size of buffer + if (asRaw && typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer) && this.buffer.length === this.position) return this.buffer; + + // If it's a node.js buffer object + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) { + return asRaw ? this.buffer.slice(0, this.position) : this.buffer.toString('binary', 0, this.position); + } else { + if (asRaw) { + // we support the slice command use it + if (this.buffer['slice'] != null) { + return this.buffer.slice(0, this.position); + } else { + // Create a new buffer to copy content to + var newBuffer = Object.prototype.toString.call(this.buffer) === '[object Uint8Array]' ? new Uint8Array(new ArrayBuffer(this.position)) : new Array(this.position); + // Copy content + for (var i = 0; i < this.position; i++) { + newBuffer[i] = this.buffer[i]; + } + // Return the buffer + return newBuffer; + } + } else { + return convertArraytoUtf8BinaryString(this.buffer, 0, this.position); + } + } + }; + + /** + * Length. + * + * @method + * @return {number} the length of the binary. + */ + Binary.prototype.length = function length() { + return this.position; + }; + + /** + * @ignore + */ + Binary.prototype.toJSON = function () { + return this.buffer != null ? this.buffer.toString('base64') : ''; + }; + + /** + * @ignore + */ + Binary.prototype.toString = function (format) { + return this.buffer != null ? this.buffer.slice(0, this.position).toString(format) : ''; + }; + + /** + * Binary default subtype + * @ignore + */ + var BSON_BINARY_SUBTYPE_DEFAULT = 0; + + /** + * @ignore + */ + var writeStringToArray = function (data) { + // Create a buffer + var buffer = typeof Uint8Array !== 'undefined' ? new Uint8Array(new ArrayBuffer(data.length)) : new Array(data.length); + // Write the content to the buffer + for (var i = 0; i < data.length; i++) { + buffer[i] = data.charCodeAt(i); + } + // Write the string to the buffer + return buffer; + }; + + /** + * Convert Array ot Uint8Array to Binary String + * + * @ignore + */ + var convertArraytoUtf8BinaryString = function (byteArray, startIndex, endIndex) { + var result = ''; + for (var i = startIndex; i < endIndex; i++) { + result = result + String.fromCharCode(byteArray[i]); + } + return result; + }; + + Binary.BUFFER_SIZE = 256; + + /** + * Default BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ + Binary.SUBTYPE_DEFAULT = 0; + /** + * Function BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ + Binary.SUBTYPE_FUNCTION = 1; + /** + * Byte Array BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ + Binary.SUBTYPE_BYTE_ARRAY = 2; + /** + * OLD UUID BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ + Binary.SUBTYPE_UUID_OLD = 3; + /** + * UUID BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ + Binary.SUBTYPE_UUID = 4; + /** + * MD5 BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ + Binary.SUBTYPE_MD5 = 5; + /** + * User BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ + Binary.SUBTYPE_USER_DEFINED = 128; + + /** + * Expose. + */ + module.exports = Binary; + module.exports.Binary = Binary; + /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()))) + +/***/ }), +/* 357 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var Long = __webpack_require__(335).Long, + Double = __webpack_require__(336).Double, + Timestamp = __webpack_require__(337).Timestamp, + ObjectID = __webpack_require__(338).ObjectID, + Symbol = __webpack_require__(349).Symbol, + Code = __webpack_require__(351).Code, + MinKey = __webpack_require__(353).MinKey, + MaxKey = __webpack_require__(354).MaxKey, + Decimal128 = __webpack_require__(352), + Int32 = __webpack_require__(350), + DBRef = __webpack_require__(355).DBRef, + BSONRegExp = __webpack_require__(348).BSONRegExp, + Binary = __webpack_require__(356).Binary; + + var utils = __webpack_require__(344); + + var deserialize = function (buffer, options, isArray) { + options = options == null ? {} : options; + var index = options && options.index ? options.index : 0; + // Read the document size + var size = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24; + + // Ensure buffer is valid size + if (size < 5 || buffer.length < size || size + index > buffer.length) { + throw new Error('corrupt bson message'); + } + + // Illegal end value + if (buffer[index + size - 1] !== 0) { + throw new Error("One object, sized correctly, with a spot for an EOO, but the EOO isn't 0x00"); + } + + // Start deserializtion + return deserializeObject(buffer, index, options, isArray); + }; + + var deserializeObject = function (buffer, index, options, isArray) { + var evalFunctions = options['evalFunctions'] == null ? false : options['evalFunctions']; + var cacheFunctions = options['cacheFunctions'] == null ? false : options['cacheFunctions']; + var cacheFunctionsCrc32 = options['cacheFunctionsCrc32'] == null ? false : options['cacheFunctionsCrc32']; + + if (!cacheFunctionsCrc32) var crc32 = null; + + var fieldsAsRaw = options['fieldsAsRaw'] == null ? null : options['fieldsAsRaw']; + + // Return raw bson buffer instead of parsing it + var raw = options['raw'] == null ? false : options['raw']; + + // Return BSONRegExp objects instead of native regular expressions + var bsonRegExp = typeof options['bsonRegExp'] === 'boolean' ? options['bsonRegExp'] : false; + + // Controls the promotion of values vs wrapper classes + var promoteBuffers = options['promoteBuffers'] == null ? false : options['promoteBuffers']; + var promoteLongs = options['promoteLongs'] == null ? true : options['promoteLongs']; + var promoteValues = options['promoteValues'] == null ? true : options['promoteValues']; + + // Set the start index + var startIndex = index; + + // Validate that we have at least 4 bytes of buffer + if (buffer.length < 5) throw new Error('corrupt bson message < 5 bytes long'); + + // Read the document size + var size = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + + // Ensure buffer is valid size + if (size < 5 || size > buffer.length) throw new Error('corrupt bson message'); + + // Create holding object + var object = isArray ? [] : {}; + // Used for arrays to skip having to perform utf8 decoding + var arrayIndex = 0; + + var done = false; + + // While we have more left data left keep parsing + // while (buffer[index + 1] !== 0) { + while (!done) { + // Read the type + var elementType = buffer[index++]; + // If we get a zero it's the last byte, exit + if (elementType === 0) break; + + // Get the start search index + var i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + var name = isArray ? arrayIndex++ : buffer.toString('utf8', index, i); + + index = i + 1; + + if (elementType === BSON.BSON_DATA_STRING) { + var stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson'); + object[name] = buffer.toString('utf8', index, index + stringSize - 1); + index = index + stringSize; + } else if (elementType === BSON.BSON_DATA_OID) { + var oid = utils.allocBuffer(12); + buffer.copy(oid, 0, index, index + 12); + object[name] = new ObjectID(oid); + index = index + 12; + } else if (elementType === BSON.BSON_DATA_INT && promoteValues === false) { + object[name] = new Int32(buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24); + } else if (elementType === BSON.BSON_DATA_INT) { + object[name] = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + } else if (elementType === BSON.BSON_DATA_NUMBER && promoteValues === false) { + object[name] = new Double(buffer.readDoubleLE(index)); + index = index + 8; + } else if (elementType === BSON.BSON_DATA_NUMBER) { + object[name] = buffer.readDoubleLE(index); + index = index + 8; + } else if (elementType === BSON.BSON_DATA_DATE) { + var lowBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + var highBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + object[name] = new Date(new Long(lowBits, highBits).toNumber()); + } else if (elementType === BSON.BSON_DATA_BOOLEAN) { + if (buffer[index] !== 0 && buffer[index] !== 1) throw new Error('illegal boolean type value'); + object[name] = buffer[index++] === 1; + } else if (elementType === BSON.BSON_DATA_OBJECT) { + var _index = index; + var objectSize = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24; + if (objectSize <= 0 || objectSize > buffer.length - index) throw new Error('bad embedded document length in bson'); + + // We have a raw value + if (raw) { + object[name] = buffer.slice(index, index + objectSize); + } else { + object[name] = deserializeObject(buffer, _index, options, false); + } + + index = index + objectSize; + } else if (elementType === BSON.BSON_DATA_ARRAY) { + _index = index; + objectSize = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24; + var arrayOptions = options; + + // Stop index + var stopIndex = index + objectSize; + + // All elements of array to be returned as raw bson + if (fieldsAsRaw && fieldsAsRaw[name]) { + arrayOptions = {}; + for (var n in options) arrayOptions[n] = options[n]; + arrayOptions['raw'] = true; + } + + object[name] = deserializeObject(buffer, _index, arrayOptions, true); + index = index + objectSize; + + if (buffer[index - 1] !== 0) throw new Error('invalid array terminator byte'); + if (index !== stopIndex) throw new Error('corrupted array bson'); + } else if (elementType === BSON.BSON_DATA_UNDEFINED) { + object[name] = undefined; + } else if (elementType === BSON.BSON_DATA_NULL) { + object[name] = null; + } else if (elementType === BSON.BSON_DATA_LONG) { + // Unpack the low and high bits + lowBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + highBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + var long = new Long(lowBits, highBits); + // Promote the long if possible + if (promoteLongs && promoteValues === true) { + object[name] = long.lessThanOrEqual(JS_INT_MAX_LONG) && long.greaterThanOrEqual(JS_INT_MIN_LONG) ? long.toNumber() : long; + } else { + object[name] = long; + } + } else if (elementType === BSON.BSON_DATA_DECIMAL128) { + // Buffer to contain the decimal bytes + var bytes = utils.allocBuffer(16); + // Copy the next 16 bytes into the bytes buffer + buffer.copy(bytes, 0, index, index + 16); + // Update index + index = index + 16; + // Assign the new Decimal128 value + var decimal128 = new Decimal128(bytes); + // If we have an alternative mapper use that + object[name] = decimal128.toObject ? decimal128.toObject() : decimal128; + } else if (elementType === BSON.BSON_DATA_BINARY) { + var binarySize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + var totalBinarySize = binarySize; + var subType = buffer[index++]; + + // Did we have a negative binary size, throw + if (binarySize < 0) throw new Error('Negative binary type element size found'); + + // Is the length longer than the document + if (binarySize > buffer.length) throw new Error('Binary type size larger than document size'); + + // Decode as raw Buffer object if options specifies it + if (buffer['slice'] != null) { + // If we have subtype 2 skip the 4 bytes for the size + if (subType === Binary.SUBTYPE_BYTE_ARRAY) { + binarySize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + if (binarySize < 0) throw new Error('Negative binary type element size found for subtype 0x02'); + if (binarySize > totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to long binary size'); + if (binarySize < totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to short binary size'); + } + + if (promoteBuffers && promoteValues) { + object[name] = buffer.slice(index, index + binarySize); + } else { + object[name] = new Binary(buffer.slice(index, index + binarySize), subType); + } + } else { + var _buffer = typeof Uint8Array !== 'undefined' ? new Uint8Array(new ArrayBuffer(binarySize)) : new Array(binarySize); + // If we have subtype 2 skip the 4 bytes for the size + if (subType === Binary.SUBTYPE_BYTE_ARRAY) { + binarySize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + if (binarySize < 0) throw new Error('Negative binary type element size found for subtype 0x02'); + if (binarySize > totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to long binary size'); + if (binarySize < totalBinarySize - 4) throw new Error('Binary type with subtype 0x02 contains to short binary size'); + } + + // Copy the data + for (i = 0; i < binarySize; i++) { + _buffer[i] = buffer[index + i]; + } + + if (promoteBuffers && promoteValues) { + object[name] = _buffer; + } else { + object[name] = new Binary(_buffer, subType); + } + } + + // Update the index + index = index + binarySize; + } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === false) { + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + var source = buffer.toString('utf8', index, i); + // Create the regexp + index = i + 1; + + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + var regExpOptions = buffer.toString('utf8', index, i); + index = i + 1; + + // For each option add the corresponding one for javascript + var optionsArray = new Array(regExpOptions.length); + + // Parse options + for (i = 0; i < regExpOptions.length; i++) { + switch (regExpOptions[i]) { + case 'm': + optionsArray[i] = 'm'; + break; + case 's': + optionsArray[i] = 'g'; + break; + case 'i': + optionsArray[i] = 'i'; + break; + } + } + + object[name] = new RegExp(source, optionsArray.join('')); + } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === true) { + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + source = buffer.toString('utf8', index, i); + index = i + 1; + + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + regExpOptions = buffer.toString('utf8', index, i); + index = i + 1; + + // Set the object + object[name] = new BSONRegExp(source, regExpOptions); + } else if (elementType === BSON.BSON_DATA_SYMBOL) { + stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson'); + object[name] = new Symbol(buffer.toString('utf8', index, index + stringSize - 1)); + index = index + stringSize; + } else if (elementType === BSON.BSON_DATA_TIMESTAMP) { + lowBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + highBits = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + object[name] = new Timestamp(lowBits, highBits); + } else if (elementType === BSON.BSON_DATA_MIN_KEY) { + object[name] = new MinKey(); + } else if (elementType === BSON.BSON_DATA_MAX_KEY) { + object[name] = new MaxKey(); + } else if (elementType === BSON.BSON_DATA_CODE) { + stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson'); + var functionString = buffer.toString('utf8', index, index + stringSize - 1); + + // If we are evaluating the functions + if (evalFunctions) { + // If we have cache enabled let's look for the md5 of the function in the cache + if (cacheFunctions) { + var hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString; + // Got to do this to avoid V8 deoptimizing the call due to finding eval + object[name] = isolateEvalWithHash(functionCache, hash, functionString, object); + } else { + object[name] = isolateEval(functionString); + } + } else { + object[name] = new Code(functionString); + } + + // Update parse index position + index = index + stringSize; + } else if (elementType === BSON.BSON_DATA_CODE_W_SCOPE) { + var totalSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + + // Element cannot be shorter than totalSize + stringSize + documentSize + terminator + if (totalSize < 4 + 4 + 4 + 1) { + throw new Error('code_w_scope total size shorter minimum expected length'); + } + + // Get the code string size + stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + // Check if we have a valid string + if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson'); + + // Javascript function + functionString = buffer.toString('utf8', index, index + stringSize - 1); + // Update parse index position + index = index + stringSize; + // Parse the element + _index = index; + // Decode the size of the object document + objectSize = buffer[index] | buffer[index + 1] << 8 | buffer[index + 2] << 16 | buffer[index + 3] << 24; + // Decode the scope object + var scopeObject = deserializeObject(buffer, _index, options, false); + // Adjust the index + index = index + objectSize; + + // Check if field length is to short + if (totalSize < 4 + 4 + objectSize + stringSize) { + throw new Error('code_w_scope total size is to short, truncating scope'); + } + + // Check if totalSize field is to long + if (totalSize > 4 + 4 + objectSize + stringSize) { + throw new Error('code_w_scope total size is to long, clips outer document'); + } + + // If we are evaluating the functions + if (evalFunctions) { + // If we have cache enabled let's look for the md5 of the function in the cache + if (cacheFunctions) { + hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString; + // Got to do this to avoid V8 deoptimizing the call due to finding eval + object[name] = isolateEvalWithHash(functionCache, hash, functionString, object); + } else { + object[name] = isolateEval(functionString); + } + + object[name].scope = scopeObject; + } else { + object[name] = new Code(functionString, scopeObject); + } + } else if (elementType === BSON.BSON_DATA_DBPOINTER) { + // Get the code string size + stringSize = buffer[index++] | buffer[index++] << 8 | buffer[index++] << 16 | buffer[index++] << 24; + // Check if we have a valid string + if (stringSize <= 0 || stringSize > buffer.length - index || buffer[index + stringSize - 1] !== 0) throw new Error('bad string length in bson'); + // Namespace + var namespace = buffer.toString('utf8', index, index + stringSize - 1); + // Update parse index position + index = index + stringSize; + + // Read the oid + var oidBuffer = utils.allocBuffer(12); + buffer.copy(oidBuffer, 0, index, index + 12); + oid = new ObjectID(oidBuffer); + + // Update the index + index = index + 12; + + // Split the namespace + var parts = namespace.split('.'); + var db = parts.shift(); + var collection = parts.join('.'); + // Upgrade to DBRef type + object[name] = new DBRef(collection, oid, db); + } else { + throw new Error('Detected unknown BSON type ' + elementType.toString(16) + ' for fieldname "' + name + '", are you using the latest BSON parser'); + } + } + + // Check if the deserialization was against a valid array/object + if (size !== index - startIndex) { + if (isArray) throw new Error('corrupt array bson'); + throw new Error('corrupt object bson'); + } + + // Check if we have a db ref object + if (object['$id'] != null) object = new DBRef(object['$ref'], object['$id'], object['$db']); + return object; + }; + + /** + * Ensure eval is isolated. + * + * @ignore + * @api private + */ + var isolateEvalWithHash = function (functionCache, hash, functionString, object) { + // Contains the value we are going to set + var value = null; + + // Check for cache hit, eval if missing and return cached function + if (functionCache[hash] == null) { + eval('value = ' + functionString); + functionCache[hash] = value; + } + // Set the object + return functionCache[hash].bind(object); + }; + + /** + * Ensure eval is isolated. + * + * @ignore + * @api private + */ + var isolateEval = function (functionString) { + // Contains the value we are going to set + var value = null; + // Eval the function + eval('value = ' + functionString); + return value; + }; + + var BSON = {}; + + /** + * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5 + * + * @ignore + * @api private + */ + var functionCache = BSON.functionCache = {}; + + /** + * Number BSON Type + * + * @classconstant BSON_DATA_NUMBER + **/ + BSON.BSON_DATA_NUMBER = 1; + /** + * String BSON Type + * + * @classconstant BSON_DATA_STRING + **/ + BSON.BSON_DATA_STRING = 2; + /** + * Object BSON Type + * + * @classconstant BSON_DATA_OBJECT + **/ + BSON.BSON_DATA_OBJECT = 3; + /** + * Array BSON Type + * + * @classconstant BSON_DATA_ARRAY + **/ + BSON.BSON_DATA_ARRAY = 4; + /** + * Binary BSON Type + * + * @classconstant BSON_DATA_BINARY + **/ + BSON.BSON_DATA_BINARY = 5; + /** + * Binary BSON Type + * + * @classconstant BSON_DATA_UNDEFINED + **/ + BSON.BSON_DATA_UNDEFINED = 6; + /** + * ObjectID BSON Type + * + * @classconstant BSON_DATA_OID + **/ + BSON.BSON_DATA_OID = 7; + /** + * Boolean BSON Type + * + * @classconstant BSON_DATA_BOOLEAN + **/ + BSON.BSON_DATA_BOOLEAN = 8; + /** + * Date BSON Type + * + * @classconstant BSON_DATA_DATE + **/ + BSON.BSON_DATA_DATE = 9; + /** + * null BSON Type + * + * @classconstant BSON_DATA_NULL + **/ + BSON.BSON_DATA_NULL = 10; + /** + * RegExp BSON Type + * + * @classconstant BSON_DATA_REGEXP + **/ + BSON.BSON_DATA_REGEXP = 11; + /** + * Code BSON Type + * + * @classconstant BSON_DATA_DBPOINTER + **/ + BSON.BSON_DATA_DBPOINTER = 12; + /** + * Code BSON Type + * + * @classconstant BSON_DATA_CODE + **/ + BSON.BSON_DATA_CODE = 13; + /** + * Symbol BSON Type + * + * @classconstant BSON_DATA_SYMBOL + **/ + BSON.BSON_DATA_SYMBOL = 14; + /** + * Code with Scope BSON Type + * + * @classconstant BSON_DATA_CODE_W_SCOPE + **/ + BSON.BSON_DATA_CODE_W_SCOPE = 15; + /** + * 32 bit Integer BSON Type + * + * @classconstant BSON_DATA_INT + **/ + BSON.BSON_DATA_INT = 16; + /** + * Timestamp BSON Type + * + * @classconstant BSON_DATA_TIMESTAMP + **/ + BSON.BSON_DATA_TIMESTAMP = 17; + /** + * Long BSON Type + * + * @classconstant BSON_DATA_LONG + **/ + BSON.BSON_DATA_LONG = 18; + /** + * Long BSON Type + * + * @classconstant BSON_DATA_DECIMAL128 + **/ + BSON.BSON_DATA_DECIMAL128 = 19; + /** + * MinKey BSON Type + * + * @classconstant BSON_DATA_MIN_KEY + **/ + BSON.BSON_DATA_MIN_KEY = 0xff; + /** + * MaxKey BSON Type + * + * @classconstant BSON_DATA_MAX_KEY + **/ + BSON.BSON_DATA_MAX_KEY = 0x7f; + + /** + * Binary Default Type + * + * @classconstant BSON_BINARY_SUBTYPE_DEFAULT + **/ + BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0; + /** + * Binary Function Type + * + * @classconstant BSON_BINARY_SUBTYPE_FUNCTION + **/ + BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1; + /** + * Binary Byte Array Type + * + * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY + **/ + BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2; + /** + * Binary UUID Type + * + * @classconstant BSON_BINARY_SUBTYPE_UUID + **/ + BSON.BSON_BINARY_SUBTYPE_UUID = 3; + /** + * Binary MD5 Type + * + * @classconstant BSON_BINARY_SUBTYPE_MD5 + **/ + BSON.BSON_BINARY_SUBTYPE_MD5 = 4; + /** + * Binary User Defined Type + * + * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED + **/ + BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128; + + // BSON MAX VALUES + BSON.BSON_INT32_MAX = 0x7fffffff; + BSON.BSON_INT32_MIN = -0x80000000; + + BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; + BSON.BSON_INT64_MIN = -Math.pow(2, 63); + + // JS MAX PRECISE VALUES + BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. + BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + + // Internal long versions + var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double. + var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double. + + module.exports = deserialize; + +/***/ }), +/* 358 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer) {'use strict'; + + var writeIEEE754 = __webpack_require__(359).writeIEEE754, + Long = __webpack_require__(335).Long, + Map = __webpack_require__(334), + Binary = __webpack_require__(356).Binary; + + var normalizedFunctionString = __webpack_require__(344).normalizedFunctionString; + + // try { + // var _Buffer = Uint8Array; + // } catch (e) { + // _Buffer = Buffer; + // } + + var regexp = /\x00/; // eslint-disable-line no-control-regex + var ignoreKeys = ['$db', '$ref', '$id', '$clusterTime']; + + // To ensure that 0.4 of node works correctly + var isDate = function isDate(d) { + return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]'; + }; + + var isRegExp = function isRegExp(d) { + return Object.prototype.toString.call(d) === '[object RegExp]'; + }; + + var serializeString = function (buffer, key, value, index, isArray) { + // Encode String type + buffer[index++] = BSON.BSON_DATA_STRING; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes + 1; + buffer[index - 1] = 0; + // Write the string + var size = buffer.write(value, index + 4, 'utf8'); + // Write the size of the string to buffer + buffer[index + 3] = size + 1 >> 24 & 0xff; + buffer[index + 2] = size + 1 >> 16 & 0xff; + buffer[index + 1] = size + 1 >> 8 & 0xff; + buffer[index] = size + 1 & 0xff; + // Update index + index = index + 4 + size; + // Write zero + buffer[index++] = 0; + return index; + }; + + var serializeNumber = function (buffer, key, value, index, isArray) { + // We have an integer value + if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) { + // If the value fits in 32 bits encode as int, if it fits in a double + // encode it as a double, otherwise long + if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) { + // Set int type 32 bits or less + buffer[index++] = BSON.BSON_DATA_INT; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the int value + buffer[index++] = value & 0xff; + buffer[index++] = value >> 8 & 0xff; + buffer[index++] = value >> 16 & 0xff; + buffer[index++] = value >> 24 & 0xff; + } else if (value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) { + // Encode as double + buffer[index++] = BSON.BSON_DATA_NUMBER; + // Number of written bytes + numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write float + writeIEEE754(buffer, value, index, 'little', 52, 8); + // Ajust index + index = index + 8; + } else { + // Set long type + buffer[index++] = BSON.BSON_DATA_LONG; + // Number of written bytes + numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + var longVal = Long.fromNumber(value); + var lowBits = longVal.getLowBits(); + var highBits = longVal.getHighBits(); + // Encode low bits + buffer[index++] = lowBits & 0xff; + buffer[index++] = lowBits >> 8 & 0xff; + buffer[index++] = lowBits >> 16 & 0xff; + buffer[index++] = lowBits >> 24 & 0xff; + // Encode high bits + buffer[index++] = highBits & 0xff; + buffer[index++] = highBits >> 8 & 0xff; + buffer[index++] = highBits >> 16 & 0xff; + buffer[index++] = highBits >> 24 & 0xff; + } + } else { + // Encode as double + buffer[index++] = BSON.BSON_DATA_NUMBER; + // Number of written bytes + numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write float + writeIEEE754(buffer, value, index, 'little', 52, 8); + // Ajust index + index = index + 8; + } + + return index; + }; + + var serializeNull = function (buffer, key, value, index, isArray) { + // Set long type + buffer[index++] = BSON.BSON_DATA_NULL; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + return index; + }; + + var serializeBoolean = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_BOOLEAN; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Encode the boolean value + buffer[index++] = value ? 1 : 0; + return index; + }; + + var serializeDate = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_DATE; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Write the date + var dateInMilis = Long.fromNumber(value.getTime()); + var lowBits = dateInMilis.getLowBits(); + var highBits = dateInMilis.getHighBits(); + // Encode low bits + buffer[index++] = lowBits & 0xff; + buffer[index++] = lowBits >> 8 & 0xff; + buffer[index++] = lowBits >> 16 & 0xff; + buffer[index++] = lowBits >> 24 & 0xff; + // Encode high bits + buffer[index++] = highBits & 0xff; + buffer[index++] = highBits >> 8 & 0xff; + buffer[index++] = highBits >> 16 & 0xff; + buffer[index++] = highBits >> 24 & 0xff; + return index; + }; + + var serializeRegExp = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_REGEXP; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + if (value.source && value.source.match(regexp) != null) { + throw Error('value ' + value.source + ' must not contain null bytes'); + } + // Adjust the index + index = index + buffer.write(value.source, index, 'utf8'); + // Write zero + buffer[index++] = 0x00; + // Write the parameters + if (value.global) buffer[index++] = 0x73; // s + if (value.ignoreCase) buffer[index++] = 0x69; // i + if (value.multiline) buffer[index++] = 0x6d; // m + // Add ending zero + buffer[index++] = 0x00; + return index; + }; + + var serializeBSONRegExp = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_REGEXP; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Check the pattern for 0 bytes + if (value.pattern.match(regexp) != null) { + // The BSON spec doesn't allow keys with null bytes because keys are + // null-terminated. + throw Error('pattern ' + value.pattern + ' must not contain null bytes'); + } + + // Adjust the index + index = index + buffer.write(value.pattern, index, 'utf8'); + // Write zero + buffer[index++] = 0x00; + // Write the options + index = index + buffer.write(value.options.split('').sort().join(''), index, 'utf8'); + // Add ending zero + buffer[index++] = 0x00; + return index; + }; + + var serializeMinMax = function (buffer, key, value, index, isArray) { + // Write the type of either min or max key + if (value === null) { + buffer[index++] = BSON.BSON_DATA_NULL; + } else if (value._bsontype === 'MinKey') { + buffer[index++] = BSON.BSON_DATA_MIN_KEY; + } else { + buffer[index++] = BSON.BSON_DATA_MAX_KEY; + } + + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + return index; + }; + + var serializeObjectId = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_OID; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Write the objectId into the shared buffer + if (typeof value.id === 'string') { + buffer.write(value.id, index, 'binary'); + } else if (value.id && value.id.copy) { + value.id.copy(buffer, index, 0, 12); + } else { + throw new Error('object [' + JSON.stringify(value) + '] is not a valid ObjectId'); + } + + // Ajust index + return index + 12; + }; + + var serializeBuffer = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_BINARY; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Get size of the buffer (current write point) + var size = value.length; + // Write the size of the string to buffer + buffer[index++] = size & 0xff; + buffer[index++] = size >> 8 & 0xff; + buffer[index++] = size >> 16 & 0xff; + buffer[index++] = size >> 24 & 0xff; + // Write the default subtype + buffer[index++] = BSON.BSON_BINARY_SUBTYPE_DEFAULT; + // Copy the content form the binary field to the buffer + value.copy(buffer, index, 0, size); + // Adjust the index + index = index + size; + return index; + }; + + var serializeObject = function (buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, isArray, path) { + for (var i = 0; i < path.length; i++) { + if (path[i] === value) throw new Error('cyclic dependency detected'); + } + + // Push value to stack + path.push(value); + // Write the type + buffer[index++] = Array.isArray(value) ? BSON.BSON_DATA_ARRAY : BSON.BSON_DATA_OBJECT; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + var endIndex = serializeInto(buffer, value, checkKeys, index, depth + 1, serializeFunctions, ignoreUndefined, path); + // Pop stack + path.pop(); + // Write size + return endIndex; + }; + + var serializeDecimal128 = function (buffer, key, value, index, isArray) { + buffer[index++] = BSON.BSON_DATA_DECIMAL128; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the data from the value + value.bytes.copy(buffer, index, 0, 16); + return index + 16; + }; + + var serializeLong = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = value._bsontype === 'Long' ? BSON.BSON_DATA_LONG : BSON.BSON_DATA_TIMESTAMP; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the date + var lowBits = value.getLowBits(); + var highBits = value.getHighBits(); + // Encode low bits + buffer[index++] = lowBits & 0xff; + buffer[index++] = lowBits >> 8 & 0xff; + buffer[index++] = lowBits >> 16 & 0xff; + buffer[index++] = lowBits >> 24 & 0xff; + // Encode high bits + buffer[index++] = highBits & 0xff; + buffer[index++] = highBits >> 8 & 0xff; + buffer[index++] = highBits >> 16 & 0xff; + buffer[index++] = highBits >> 24 & 0xff; + return index; + }; + + var serializeInt32 = function (buffer, key, value, index, isArray) { + // Set int type 32 bits or less + buffer[index++] = BSON.BSON_DATA_INT; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the int value + buffer[index++] = value & 0xff; + buffer[index++] = value >> 8 & 0xff; + buffer[index++] = value >> 16 & 0xff; + buffer[index++] = value >> 24 & 0xff; + return index; + }; + + var serializeDouble = function (buffer, key, value, index, isArray) { + // Encode as double + buffer[index++] = BSON.BSON_DATA_NUMBER; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write float + writeIEEE754(buffer, value, index, 'little', 52, 8); + // Ajust index + index = index + 8; + return index; + }; + + var serializeFunction = function (buffer, key, value, index, checkKeys, depth, isArray) { + buffer[index++] = BSON.BSON_DATA_CODE; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Function string + var functionString = normalizedFunctionString(value); + + // Write the string + var size = buffer.write(functionString, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = size & 0xff; + buffer[index + 1] = size >> 8 & 0xff; + buffer[index + 2] = size >> 16 & 0xff; + buffer[index + 3] = size >> 24 & 0xff; + // Update index + index = index + 4 + size - 1; + // Write zero + buffer[index++] = 0; + return index; + }; + + var serializeCode = function (buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, isArray) { + if (value.scope && typeof value.scope === 'object') { + // Write the type + buffer[index++] = BSON.BSON_DATA_CODE_W_SCOPE; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Starting index + var startIndex = index; + + // Serialize the function + // Get the function string + var functionString = typeof value.code === 'string' ? value.code : value.code.toString(); + // Index adjustment + index = index + 4; + // Write string into buffer + var codeSize = buffer.write(functionString, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = codeSize & 0xff; + buffer[index + 1] = codeSize >> 8 & 0xff; + buffer[index + 2] = codeSize >> 16 & 0xff; + buffer[index + 3] = codeSize >> 24 & 0xff; + // Write end 0 + buffer[index + 4 + codeSize - 1] = 0; + // Write the + index = index + codeSize + 4; + + // + // Serialize the scope value + var endIndex = serializeInto(buffer, value.scope, checkKeys, index, depth + 1, serializeFunctions, ignoreUndefined); + index = endIndex - 1; + + // Writ the total + var totalSize = endIndex - startIndex; + + // Write the total size of the object + buffer[startIndex++] = totalSize & 0xff; + buffer[startIndex++] = totalSize >> 8 & 0xff; + buffer[startIndex++] = totalSize >> 16 & 0xff; + buffer[startIndex++] = totalSize >> 24 & 0xff; + // Write trailing zero + buffer[index++] = 0; + } else { + buffer[index++] = BSON.BSON_DATA_CODE; + // Number of written bytes + numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Function string + functionString = value.code.toString(); + // Write the string + var size = buffer.write(functionString, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = size & 0xff; + buffer[index + 1] = size >> 8 & 0xff; + buffer[index + 2] = size >> 16 & 0xff; + buffer[index + 3] = size >> 24 & 0xff; + // Update index + index = index + 4 + size - 1; + // Write zero + buffer[index++] = 0; + } + + return index; + }; + + var serializeBinary = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_BINARY; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Extract the buffer + var data = value.value(true); + // Calculate size + var size = value.position; + // Add the deprecated 02 type 4 bytes of size to total + if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) size = size + 4; + // Write the size of the string to buffer + buffer[index++] = size & 0xff; + buffer[index++] = size >> 8 & 0xff; + buffer[index++] = size >> 16 & 0xff; + buffer[index++] = size >> 24 & 0xff; + // Write the subtype to the buffer + buffer[index++] = value.sub_type; + + // If we have binary type 2 the 4 first bytes are the size + if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) { + size = size - 4; + buffer[index++] = size & 0xff; + buffer[index++] = size >> 8 & 0xff; + buffer[index++] = size >> 16 & 0xff; + buffer[index++] = size >> 24 & 0xff; + } + + // Write the data to the object + data.copy(buffer, index, 0, value.position); + // Adjust the index + index = index + value.position; + return index; + }; + + var serializeSymbol = function (buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_SYMBOL; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the string + var size = buffer.write(value.value, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = size & 0xff; + buffer[index + 1] = size >> 8 & 0xff; + buffer[index + 2] = size >> 16 & 0xff; + buffer[index + 3] = size >> 24 & 0xff; + // Update index + index = index + 4 + size - 1; + // Write zero + buffer[index++] = 0x00; + return index; + }; + + var serializeDBRef = function (buffer, key, value, index, depth, serializeFunctions, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_OBJECT; + // Number of written bytes + var numberOfWrittenBytes = !isArray ? buffer.write(key, index, 'utf8') : buffer.write(key, index, 'ascii'); + + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + var startIndex = index; + var endIndex; + + // Serialize object + if (null != value.db) { + endIndex = serializeInto(buffer, { + $ref: value.namespace, + $id: value.oid, + $db: value.db + }, false, index, depth + 1, serializeFunctions); + } else { + endIndex = serializeInto(buffer, { + $ref: value.namespace, + $id: value.oid + }, false, index, depth + 1, serializeFunctions); + } + + // Calculate object size + var size = endIndex - startIndex; + // Write the size + buffer[startIndex++] = size & 0xff; + buffer[startIndex++] = size >> 8 & 0xff; + buffer[startIndex++] = size >> 16 & 0xff; + buffer[startIndex++] = size >> 24 & 0xff; + // Set index + return endIndex; + }; + + var serializeInto = function serializeInto(buffer, object, checkKeys, startingIndex, depth, serializeFunctions, ignoreUndefined, path) { + startingIndex = startingIndex || 0; + path = path || []; + + // Push the object to the path + path.push(object); + + // Start place to serialize into + var index = startingIndex + 4; + // var self = this; + + // Special case isArray + if (Array.isArray(object)) { + // Get object keys + for (var i = 0; i < object.length; i++) { + var key = '' + i; + var value = object[i]; + + // Is there an override value + if (value && value.toBSON) { + if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function'); + value = value.toBSON(); + } + + var type = typeof value; + if (type === 'string') { + index = serializeString(buffer, key, value, index, true); + } else if (type === 'number') { + index = serializeNumber(buffer, key, value, index, true); + } else if (type === 'boolean') { + index = serializeBoolean(buffer, key, value, index, true); + } else if (value instanceof Date || isDate(value)) { + index = serializeDate(buffer, key, value, index, true); + } else if (value === undefined) { + index = serializeNull(buffer, key, value, index, true); + } else if (value === null) { + index = serializeNull(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + index = serializeObjectId(buffer, key, value, index, true); + } else if (Buffer.isBuffer(value)) { + index = serializeBuffer(buffer, key, value, index, true); + } else if (value instanceof RegExp || isRegExp(value)) { + index = serializeRegExp(buffer, key, value, index, true); + } else if (type === 'object' && value['_bsontype'] == null) { + index = serializeObject(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, true, path); + } else if (type === 'object' && value['_bsontype'] === 'Decimal128') { + index = serializeDecimal128(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') { + index = serializeLong(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Double') { + index = serializeDouble(buffer, key, value, index, true); + } else if (typeof value === 'function' && serializeFunctions) { + index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions, true); + } else if (value['_bsontype'] === 'Code') { + index = serializeCode(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, true); + } else if (value['_bsontype'] === 'Binary') { + index = serializeBinary(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Symbol') { + index = serializeSymbol(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'DBRef') { + index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions, true); + } else if (value['_bsontype'] === 'BSONRegExp') { + index = serializeBSONRegExp(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Int32') { + index = serializeInt32(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') { + index = serializeMinMax(buffer, key, value, index, true); + } else if (typeof value['_bsontype'] !== 'undefined') { + throw new TypeError('Unrecognized or invalid _bsontype: ' + value['_bsontype']); + } + } + } else if (object instanceof Map) { + var iterator = object.entries(); + var done = false; + + while (!done) { + // Unpack the next entry + var entry = iterator.next(); + done = entry.done; + // Are we done, then skip and terminate + if (done) continue; + + // Get the entry values + key = entry.value[0]; + value = entry.value[1]; + + // Check the type of the value + type = typeof value; + + // Check the key and throw error if it's illegal + if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) { + if (key.match(regexp) != null) { + // The BSON spec doesn't allow keys with null bytes because keys are + // null-terminated. + throw Error('key ' + key + ' must not contain null bytes'); + } + + if (checkKeys) { + if ('$' === key[0]) { + throw Error('key ' + key + " must not start with '$'"); + } else if (~key.indexOf('.')) { + throw Error('key ' + key + " must not contain '.'"); + } + } + } + + if (type === 'string') { + index = serializeString(buffer, key, value, index); + } else if (type === 'number') { + index = serializeNumber(buffer, key, value, index); + } else if (type === 'boolean') { + index = serializeBoolean(buffer, key, value, index); + } else if (value instanceof Date || isDate(value)) { + index = serializeDate(buffer, key, value, index); + // } else if (value === undefined && ignoreUndefined === true) { + } else if (value === null || value === undefined && ignoreUndefined === false) { + index = serializeNull(buffer, key, value, index); + } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + index = serializeObjectId(buffer, key, value, index); + } else if (Buffer.isBuffer(value)) { + index = serializeBuffer(buffer, key, value, index); + } else if (value instanceof RegExp || isRegExp(value)) { + index = serializeRegExp(buffer, key, value, index); + } else if (type === 'object' && value['_bsontype'] == null) { + index = serializeObject(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, false, path); + } else if (type === 'object' && value['_bsontype'] === 'Decimal128') { + index = serializeDecimal128(buffer, key, value, index); + } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') { + index = serializeLong(buffer, key, value, index); + } else if (value['_bsontype'] === 'Double') { + index = serializeDouble(buffer, key, value, index); + } else if (value['_bsontype'] === 'Code') { + index = serializeCode(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined); + } else if (typeof value === 'function' && serializeFunctions) { + index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions); + } else if (value['_bsontype'] === 'Binary') { + index = serializeBinary(buffer, key, value, index); + } else if (value['_bsontype'] === 'Symbol') { + index = serializeSymbol(buffer, key, value, index); + } else if (value['_bsontype'] === 'DBRef') { + index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions); + } else if (value['_bsontype'] === 'BSONRegExp') { + index = serializeBSONRegExp(buffer, key, value, index); + } else if (value['_bsontype'] === 'Int32') { + index = serializeInt32(buffer, key, value, index); + } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') { + index = serializeMinMax(buffer, key, value, index); + } else if (typeof value['_bsontype'] !== 'undefined') { + throw new TypeError('Unrecognized or invalid _bsontype: ' + value['_bsontype']); + } + } + } else { + // Did we provide a custom serialization method + if (object.toBSON) { + if (typeof object.toBSON !== 'function') throw new Error('toBSON is not a function'); + object = object.toBSON(); + if (object != null && typeof object !== 'object') throw new Error('toBSON function did not return an object'); + } + + // Iterate over all the keys + for (key in object) { + value = object[key]; + // Is there an override value + if (value && value.toBSON) { + if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function'); + value = value.toBSON(); + } + + // Check the type of the value + type = typeof value; + + // Check the key and throw error if it's illegal + if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) { + if (key.match(regexp) != null) { + // The BSON spec doesn't allow keys with null bytes because keys are + // null-terminated. + throw Error('key ' + key + ' must not contain null bytes'); + } + + if (checkKeys) { + if ('$' === key[0]) { + throw Error('key ' + key + " must not start with '$'"); + } else if (~key.indexOf('.')) { + throw Error('key ' + key + " must not contain '.'"); + } + } + } + + if (type === 'string') { + index = serializeString(buffer, key, value, index); + } else if (type === 'number') { + index = serializeNumber(buffer, key, value, index); + } else if (type === 'boolean') { + index = serializeBoolean(buffer, key, value, index); + } else if (value instanceof Date || isDate(value)) { + index = serializeDate(buffer, key, value, index); + } else if (value === undefined) { + if (ignoreUndefined === false) index = serializeNull(buffer, key, value, index); + } else if (value === null) { + index = serializeNull(buffer, key, value, index); + } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + index = serializeObjectId(buffer, key, value, index); + } else if (Buffer.isBuffer(value)) { + index = serializeBuffer(buffer, key, value, index); + } else if (value instanceof RegExp || isRegExp(value)) { + index = serializeRegExp(buffer, key, value, index); + } else if (type === 'object' && value['_bsontype'] == null) { + index = serializeObject(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined, false, path); + } else if (type === 'object' && value['_bsontype'] === 'Decimal128') { + index = serializeDecimal128(buffer, key, value, index); + } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') { + index = serializeLong(buffer, key, value, index); + } else if (value['_bsontype'] === 'Double') { + index = serializeDouble(buffer, key, value, index); + } else if (value['_bsontype'] === 'Code') { + index = serializeCode(buffer, key, value, index, checkKeys, depth, serializeFunctions, ignoreUndefined); + } else if (typeof value === 'function' && serializeFunctions) { + index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions); + } else if (value['_bsontype'] === 'Binary') { + index = serializeBinary(buffer, key, value, index); + } else if (value['_bsontype'] === 'Symbol') { + index = serializeSymbol(buffer, key, value, index); + } else if (value['_bsontype'] === 'DBRef') { + index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions); + } else if (value['_bsontype'] === 'BSONRegExp') { + index = serializeBSONRegExp(buffer, key, value, index); + } else if (value['_bsontype'] === 'Int32') { + index = serializeInt32(buffer, key, value, index); + } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') { + index = serializeMinMax(buffer, key, value, index); + } else if (typeof value['_bsontype'] !== 'undefined') { + throw new TypeError('Unrecognized or invalid _bsontype: ' + value['_bsontype']); + } + } + } + + // Remove the path + path.pop(); + + // Final padding byte for object + buffer[index++] = 0x00; + + // Final size + var size = index - startingIndex; + // Write the size of the object + buffer[startingIndex++] = size & 0xff; + buffer[startingIndex++] = size >> 8 & 0xff; + buffer[startingIndex++] = size >> 16 & 0xff; + buffer[startingIndex++] = size >> 24 & 0xff; + return index; + }; + + var BSON = {}; + + /** + * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5 + * + * @ignore + * @api private + */ + // var functionCache = (BSON.functionCache = {}); + + /** + * Number BSON Type + * + * @classconstant BSON_DATA_NUMBER + **/ + BSON.BSON_DATA_NUMBER = 1; + /** + * String BSON Type + * + * @classconstant BSON_DATA_STRING + **/ + BSON.BSON_DATA_STRING = 2; + /** + * Object BSON Type + * + * @classconstant BSON_DATA_OBJECT + **/ + BSON.BSON_DATA_OBJECT = 3; + /** + * Array BSON Type + * + * @classconstant BSON_DATA_ARRAY + **/ + BSON.BSON_DATA_ARRAY = 4; + /** + * Binary BSON Type + * + * @classconstant BSON_DATA_BINARY + **/ + BSON.BSON_DATA_BINARY = 5; + /** + * ObjectID BSON Type, deprecated + * + * @classconstant BSON_DATA_UNDEFINED + **/ + BSON.BSON_DATA_UNDEFINED = 6; + /** + * ObjectID BSON Type + * + * @classconstant BSON_DATA_OID + **/ + BSON.BSON_DATA_OID = 7; + /** + * Boolean BSON Type + * + * @classconstant BSON_DATA_BOOLEAN + **/ + BSON.BSON_DATA_BOOLEAN = 8; + /** + * Date BSON Type + * + * @classconstant BSON_DATA_DATE + **/ + BSON.BSON_DATA_DATE = 9; + /** + * null BSON Type + * + * @classconstant BSON_DATA_NULL + **/ + BSON.BSON_DATA_NULL = 10; + /** + * RegExp BSON Type + * + * @classconstant BSON_DATA_REGEXP + **/ + BSON.BSON_DATA_REGEXP = 11; + /** + * Code BSON Type + * + * @classconstant BSON_DATA_CODE + **/ + BSON.BSON_DATA_CODE = 13; + /** + * Symbol BSON Type + * + * @classconstant BSON_DATA_SYMBOL + **/ + BSON.BSON_DATA_SYMBOL = 14; + /** + * Code with Scope BSON Type + * + * @classconstant BSON_DATA_CODE_W_SCOPE + **/ + BSON.BSON_DATA_CODE_W_SCOPE = 15; + /** + * 32 bit Integer BSON Type + * + * @classconstant BSON_DATA_INT + **/ + BSON.BSON_DATA_INT = 16; + /** + * Timestamp BSON Type + * + * @classconstant BSON_DATA_TIMESTAMP + **/ + BSON.BSON_DATA_TIMESTAMP = 17; + /** + * Long BSON Type + * + * @classconstant BSON_DATA_LONG + **/ + BSON.BSON_DATA_LONG = 18; + /** + * Long BSON Type + * + * @classconstant BSON_DATA_DECIMAL128 + **/ + BSON.BSON_DATA_DECIMAL128 = 19; + /** + * MinKey BSON Type + * + * @classconstant BSON_DATA_MIN_KEY + **/ + BSON.BSON_DATA_MIN_KEY = 0xff; + /** + * MaxKey BSON Type + * + * @classconstant BSON_DATA_MAX_KEY + **/ + BSON.BSON_DATA_MAX_KEY = 0x7f; + /** + * Binary Default Type + * + * @classconstant BSON_BINARY_SUBTYPE_DEFAULT + **/ + BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0; + /** + * Binary Function Type + * + * @classconstant BSON_BINARY_SUBTYPE_FUNCTION + **/ + BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1; + /** + * Binary Byte Array Type + * + * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY + **/ + BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2; + /** + * Binary UUID Type + * + * @classconstant BSON_BINARY_SUBTYPE_UUID + **/ + BSON.BSON_BINARY_SUBTYPE_UUID = 3; + /** + * Binary MD5 Type + * + * @classconstant BSON_BINARY_SUBTYPE_MD5 + **/ + BSON.BSON_BINARY_SUBTYPE_MD5 = 4; + /** + * Binary User Defined Type + * + * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED + **/ + BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128; + + // BSON MAX VALUES + BSON.BSON_INT32_MAX = 0x7fffffff; + BSON.BSON_INT32_MIN = -0x80000000; + + BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; + BSON.BSON_INT64_MIN = -Math.pow(2, 63); + + // JS MAX PRECISE VALUES + BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. + BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + + // Internal long versions + // var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double. + // var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double. + + module.exports = serializeInto; + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer)) + +/***/ }), +/* 359 */ +/***/ (function(module, exports) { + + // Copyright (c) 2008, Fair Oaks Labs, Inc. + // All rights reserved. + // + // Redistribution and use in source and binary forms, with or without + // modification, are permitted provided that the following conditions are met: + // + // * Redistributions of source code must retain the above copyright notice, + // this list of conditions and the following disclaimer. + // + // * Redistributions in binary form must reproduce the above copyright notice, + // this list of conditions and the following disclaimer in the documentation + // and/or other materials provided with the distribution. + // + // * Neither the name of Fair Oaks Labs, Inc. nor the names of its contributors + // may be used to endorse or promote products derived from this software + // without specific prior written permission. + // + // THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + // AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + // IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + // ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + // LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + // CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + // SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + // INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + // CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + // ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + // POSSIBILITY OF SUCH DAMAGE. + // + // + // Modifications to writeIEEE754 to support negative zeroes made by Brian White + + var readIEEE754 = function (buffer, offset, endian, mLen, nBytes) { + var e, + m, + bBE = endian === 'big', + eLen = nBytes * 8 - mLen - 1, + eMax = (1 << eLen) - 1, + eBias = eMax >> 1, + nBits = -7, + i = bBE ? 0 : nBytes - 1, + d = bBE ? 1 : -1, + s = buffer[offset + i]; + + i += d; + + e = s & (1 << -nBits) - 1; + s >>= -nBits; + nBits += eLen; + for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8); + + m = e & (1 << -nBits) - 1; + e >>= -nBits; + nBits += mLen; + for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8); + + if (e === 0) { + e = 1 - eBias; + } else if (e === eMax) { + return m ? NaN : (s ? -1 : 1) * Infinity; + } else { + m = m + Math.pow(2, mLen); + e = e - eBias; + } + return (s ? -1 : 1) * m * Math.pow(2, e - mLen); + }; + + var writeIEEE754 = function (buffer, value, offset, endian, mLen, nBytes) { + var e, + m, + c, + bBE = endian === 'big', + eLen = nBytes * 8 - mLen - 1, + eMax = (1 << eLen) - 1, + eBias = eMax >> 1, + rt = mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0, + i = bBE ? nBytes - 1 : 0, + d = bBE ? -1 : 1, + s = value < 0 || value === 0 && 1 / value < 0 ? 1 : 0; + + value = Math.abs(value); + + if (isNaN(value) || value === Infinity) { + m = isNaN(value) ? 1 : 0; + e = eMax; + } else { + e = Math.floor(Math.log(value) / Math.LN2); + if (value * (c = Math.pow(2, -e)) < 1) { + e--; + c *= 2; + } + if (e + eBias >= 1) { + value += rt / c; + } else { + value += rt * Math.pow(2, 1 - eBias); + } + if (value * c >= 2) { + e++; + c /= 2; + } + + if (e + eBias >= eMax) { + m = 0; + e = eMax; + } else if (e + eBias >= 1) { + m = (value * c - 1) * Math.pow(2, mLen); + e = e + eBias; + } else { + m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen); + e = 0; + } + } + + for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8); + + e = e << mLen | m; + eLen += mLen; + for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8); + + buffer[offset + i - d] |= s * 128; + }; + + exports.readIEEE754 = readIEEE754; + exports.writeIEEE754 = writeIEEE754; + +/***/ }), +/* 360 */ +/***/ (function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer) {'use strict'; + + var Long = __webpack_require__(335).Long, + Double = __webpack_require__(336).Double, + Timestamp = __webpack_require__(337).Timestamp, + ObjectID = __webpack_require__(338).ObjectID, + Symbol = __webpack_require__(349).Symbol, + BSONRegExp = __webpack_require__(348).BSONRegExp, + Code = __webpack_require__(351).Code, + Decimal128 = __webpack_require__(352), + MinKey = __webpack_require__(353).MinKey, + MaxKey = __webpack_require__(354).MaxKey, + DBRef = __webpack_require__(355).DBRef, + Binary = __webpack_require__(356).Binary; + + var normalizedFunctionString = __webpack_require__(344).normalizedFunctionString; + + // To ensure that 0.4 of node works correctly + var isDate = function isDate(d) { + return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]'; + }; + + var calculateObjectSize = function calculateObjectSize(object, serializeFunctions, ignoreUndefined) { + var totalLength = 4 + 1; + + if (Array.isArray(object)) { + for (var i = 0; i < object.length; i++) { + totalLength += calculateElement(i.toString(), object[i], serializeFunctions, true, ignoreUndefined); + } + } else { + // If we have toBSON defined, override the current object + if (object.toBSON) { + object = object.toBSON(); + } + + // Calculate size + for (var key in object) { + totalLength += calculateElement(key, object[key], serializeFunctions, false, ignoreUndefined); + } + } + + return totalLength; + }; + + /** + * @ignore + * @api private + */ + function calculateElement(name, value, serializeFunctions, isArray, ignoreUndefined) { + // If we have toBSON defined, override the current object + if (value && value.toBSON) { + value = value.toBSON(); + } + + switch (typeof value) { + case 'string': + return 1 + Buffer.byteLength(name, 'utf8') + 1 + 4 + Buffer.byteLength(value, 'utf8') + 1; + case 'number': + if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) { + if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) { + // 32 bit + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (4 + 1); + } else { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } + } else { + // 64 bit + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } + case 'undefined': + if (isArray || !ignoreUndefined) return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1; + return 0; + case 'boolean': + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 1); + case 'object': + if (value == null || value instanceof MinKey || value instanceof MaxKey || value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1; + } else if (value instanceof ObjectID || value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (12 + 1); + } else if (value instanceof Date || isDate(value)) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } else if (typeof Buffer !== 'undefined' && Buffer.isBuffer(value)) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 4 + 1) + value.length; + } else if (value instanceof Long || value instanceof Double || value instanceof Timestamp || value['_bsontype'] === 'Long' || value['_bsontype'] === 'Double' || value['_bsontype'] === 'Timestamp') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } else if (value instanceof Decimal128 || value['_bsontype'] === 'Decimal128') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (16 + 1); + } else if (value instanceof Code || value['_bsontype'] === 'Code') { + // Calculate size depending on the availability of a scope + if (value.scope != null && Object.keys(value.scope).length > 0) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + 4 + Buffer.byteLength(value.code.toString(), 'utf8') + 1 + calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined); + } else { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + Buffer.byteLength(value.code.toString(), 'utf8') + 1; + } + } else if (value instanceof Binary || value['_bsontype'] === 'Binary') { + // Check what kind of subtype we have + if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (value.position + 1 + 4 + 1 + 4); + } else { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (value.position + 1 + 4 + 1); + } + } else if (value instanceof Symbol || value['_bsontype'] === 'Symbol') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + Buffer.byteLength(value.value, 'utf8') + 4 + 1 + 1; + } else if (value instanceof DBRef || value['_bsontype'] === 'DBRef') { + // Set up correct object for serialization + var ordered_values = { + $ref: value.namespace, + $id: value.oid + }; + + // Add db reference if it exists + if (null != value.db) { + ordered_values['$db'] = value.db; + } + + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + calculateObjectSize(ordered_values, serializeFunctions, ignoreUndefined); + } else if (value instanceof RegExp || Object.prototype.toString.call(value) === '[object RegExp]') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + Buffer.byteLength(value.source, 'utf8') + 1 + (value.global ? 1 : 0) + (value.ignoreCase ? 1 : 0) + (value.multiline ? 1 : 0) + 1; + } else if (value instanceof BSONRegExp || value['_bsontype'] === 'BSONRegExp') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + Buffer.byteLength(value.pattern, 'utf8') + 1 + Buffer.byteLength(value.options, 'utf8') + 1; + } else { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + calculateObjectSize(value, serializeFunctions, ignoreUndefined) + 1; + } + case 'function': + // WTF for 0.4.X where typeof /someregexp/ === 'function' + if (value instanceof RegExp || Object.prototype.toString.call(value) === '[object RegExp]' || String.call(value) === '[object RegExp]') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + Buffer.byteLength(value.source, 'utf8') + 1 + (value.global ? 1 : 0) + (value.ignoreCase ? 1 : 0) + (value.multiline ? 1 : 0) + 1; + } else { + if (serializeFunctions && value.scope != null && Object.keys(value.scope).length > 0) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + 4 + Buffer.byteLength(normalizedFunctionString(value), 'utf8') + 1 + calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined); + } else if (serializeFunctions) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1 + 4 + Buffer.byteLength(normalizedFunctionString(value), 'utf8') + 1; + } + } + } + + return 0; + } + + var BSON = {}; + + // BSON MAX VALUES + BSON.BSON_INT32_MAX = 0x7fffffff; + BSON.BSON_INT32_MIN = -0x80000000; + + // JS MAX PRECISE VALUES + BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. + BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + + module.exports = calculateObjectSize; + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(339).Buffer)) + +/***/ }) +/******/ ]) +}); +; \ No newline at end of file diff --git a/node_modules/bson/browser_build/package.json b/node_modules/bson/browser_build/package.json new file mode 100644 index 00000000..980db7f9 --- /dev/null +++ b/node_modules/bson/browser_build/package.json @@ -0,0 +1,8 @@ +{ "name" : "bson" +, "description" : "A bson parser for node.js and the browser" +, "main": "../" +, "directories" : { "lib" : "../lib/bson" } +, "engines" : { "node" : ">=0.6.0" } +, "licenses" : [ { "type" : "Apache License, Version 2.0" + , "url" : "http://www.apache.org/licenses/LICENSE-2.0" } ] +} diff --git a/node_modules/bson/index.js b/node_modules/bson/index.js new file mode 100644 index 00000000..6502552d --- /dev/null +++ b/node_modules/bson/index.js @@ -0,0 +1,46 @@ +var BSON = require('./lib/bson/bson'), + Binary = require('./lib/bson/binary'), + Code = require('./lib/bson/code'), + DBRef = require('./lib/bson/db_ref'), + Decimal128 = require('./lib/bson/decimal128'), + Double = require('./lib/bson/double'), + Int32 = require('./lib/bson/int_32'), + Long = require('./lib/bson/long'), + Map = require('./lib/bson/map'), + MaxKey = require('./lib/bson/max_key'), + MinKey = require('./lib/bson/min_key'), + ObjectId = require('./lib/bson/objectid'), + BSONRegExp = require('./lib/bson/regexp'), + Symbol = require('./lib/bson/symbol'), + Timestamp = require('./lib/bson/timestamp'); + +// BSON MAX VALUES +BSON.BSON_INT32_MAX = 0x7fffffff; +BSON.BSON_INT32_MIN = -0x80000000; + +BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; +BSON.BSON_INT64_MIN = -Math.pow(2, 63); + +// JS MAX PRECISE VALUES +BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. +BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + +// Add BSON types to function creation +BSON.Binary = Binary; +BSON.Code = Code; +BSON.DBRef = DBRef; +BSON.Decimal128 = Decimal128; +BSON.Double = Double; +BSON.Int32 = Int32; +BSON.Long = Long; +BSON.Map = Map; +BSON.MaxKey = MaxKey; +BSON.MinKey = MinKey; +BSON.ObjectId = ObjectId; +BSON.ObjectID = ObjectId; +BSON.BSONRegExp = BSONRegExp; +BSON.Symbol = Symbol; +BSON.Timestamp = Timestamp; + +// Return the BSON +module.exports = BSON; diff --git a/node_modules/bson/lib/bson/binary.js b/node_modules/bson/lib/bson/binary.js new file mode 100644 index 00000000..6d190bca --- /dev/null +++ b/node_modules/bson/lib/bson/binary.js @@ -0,0 +1,384 @@ +/** + * Module dependencies. + * @ignore + */ + +// Test if we're in Node via presence of "global" not absence of "window" +// to support hybrid environments like Electron +if (typeof global !== 'undefined') { + var Buffer = require('buffer').Buffer; // TODO just use global Buffer +} + +var utils = require('./parser/utils'); + +/** + * A class representation of the BSON Binary type. + * + * Sub types + * - **BSON.BSON_BINARY_SUBTYPE_DEFAULT**, default BSON type. + * - **BSON.BSON_BINARY_SUBTYPE_FUNCTION**, BSON function type. + * - **BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY**, BSON byte array type. + * - **BSON.BSON_BINARY_SUBTYPE_UUID**, BSON uuid type. + * - **BSON.BSON_BINARY_SUBTYPE_MD5**, BSON md5 type. + * - **BSON.BSON_BINARY_SUBTYPE_USER_DEFINED**, BSON user defined type. + * + * @class + * @param {Buffer} buffer a buffer object containing the binary data. + * @param {Number} [subType] the option binary type. + * @return {Binary} + */ +function Binary(buffer, subType) { + if (!(this instanceof Binary)) return new Binary(buffer, subType); + + if ( + buffer != null && + !(typeof buffer === 'string') && + !Buffer.isBuffer(buffer) && + !(buffer instanceof Uint8Array) && + !Array.isArray(buffer) + ) { + throw new Error('only String, Buffer, Uint8Array or Array accepted'); + } + + this._bsontype = 'Binary'; + + if (buffer instanceof Number) { + this.sub_type = buffer; + this.position = 0; + } else { + this.sub_type = subType == null ? BSON_BINARY_SUBTYPE_DEFAULT : subType; + this.position = 0; + } + + if (buffer != null && !(buffer instanceof Number)) { + // Only accept Buffer, Uint8Array or Arrays + if (typeof buffer === 'string') { + // Different ways of writing the length of the string for the different types + if (typeof Buffer !== 'undefined') { + this.buffer = utils.toBuffer(buffer); + } else if ( + typeof Uint8Array !== 'undefined' || + Object.prototype.toString.call(buffer) === '[object Array]' + ) { + this.buffer = writeStringToArray(buffer); + } else { + throw new Error('only String, Buffer, Uint8Array or Array accepted'); + } + } else { + this.buffer = buffer; + } + this.position = buffer.length; + } else { + if (typeof Buffer !== 'undefined') { + this.buffer = utils.allocBuffer(Binary.BUFFER_SIZE); + } else if (typeof Uint8Array !== 'undefined') { + this.buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE)); + } else { + this.buffer = new Array(Binary.BUFFER_SIZE); + } + // Set position to start of buffer + this.position = 0; + } +} + +/** + * Updates this binary with byte_value. + * + * @method + * @param {string} byte_value a single byte we wish to write. + */ +Binary.prototype.put = function put(byte_value) { + // If it's a string and a has more than one character throw an error + if (byte_value['length'] != null && typeof byte_value !== 'number' && byte_value.length !== 1) + throw new Error('only accepts single character String, Uint8Array or Array'); + if ((typeof byte_value !== 'number' && byte_value < 0) || byte_value > 255) + throw new Error('only accepts number in a valid unsigned byte range 0-255'); + + // Decode the byte value once + var decoded_byte = null; + if (typeof byte_value === 'string') { + decoded_byte = byte_value.charCodeAt(0); + } else if (byte_value['length'] != null) { + decoded_byte = byte_value[0]; + } else { + decoded_byte = byte_value; + } + + if (this.buffer.length > this.position) { + this.buffer[this.position++] = decoded_byte; + } else { + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) { + // Create additional overflow buffer + var buffer = utils.allocBuffer(Binary.BUFFER_SIZE + this.buffer.length); + // Combine the two buffers together + this.buffer.copy(buffer, 0, 0, this.buffer.length); + this.buffer = buffer; + this.buffer[this.position++] = decoded_byte; + } else { + buffer = null; + // Create a new buffer (typed or normal array) + if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') { + buffer = new Uint8Array(new ArrayBuffer(Binary.BUFFER_SIZE + this.buffer.length)); + } else { + buffer = new Array(Binary.BUFFER_SIZE + this.buffer.length); + } + + // We need to copy all the content to the new array + for (var i = 0; i < this.buffer.length; i++) { + buffer[i] = this.buffer[i]; + } + + // Reassign the buffer + this.buffer = buffer; + // Write the byte + this.buffer[this.position++] = decoded_byte; + } + } +}; + +/** + * Writes a buffer or string to the binary. + * + * @method + * @param {(Buffer|string)} string a string or buffer to be written to the Binary BSON object. + * @param {number} offset specify the binary of where to write the content. + * @return {null} + */ +Binary.prototype.write = function write(string, offset) { + offset = typeof offset === 'number' ? offset : this.position; + + // If the buffer is to small let's extend the buffer + if (this.buffer.length < offset + string.length) { + var buffer = null; + // If we are in node.js + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) { + buffer = utils.allocBuffer(this.buffer.length + string.length); + this.buffer.copy(buffer, 0, 0, this.buffer.length); + } else if (Object.prototype.toString.call(this.buffer) === '[object Uint8Array]') { + // Create a new buffer + buffer = new Uint8Array(new ArrayBuffer(this.buffer.length + string.length)); + // Copy the content + for (var i = 0; i < this.position; i++) { + buffer[i] = this.buffer[i]; + } + } + + // Assign the new buffer + this.buffer = buffer; + } + + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(string) && Buffer.isBuffer(this.buffer)) { + string.copy(this.buffer, offset, 0, string.length); + this.position = offset + string.length > this.position ? offset + string.length : this.position; + // offset = string.length + } else if ( + typeof Buffer !== 'undefined' && + typeof string === 'string' && + Buffer.isBuffer(this.buffer) + ) { + this.buffer.write(string, offset, 'binary'); + this.position = offset + string.length > this.position ? offset + string.length : this.position; + // offset = string.length; + } else if ( + Object.prototype.toString.call(string) === '[object Uint8Array]' || + (Object.prototype.toString.call(string) === '[object Array]' && typeof string !== 'string') + ) { + for (i = 0; i < string.length; i++) { + this.buffer[offset++] = string[i]; + } + + this.position = offset > this.position ? offset : this.position; + } else if (typeof string === 'string') { + for (i = 0; i < string.length; i++) { + this.buffer[offset++] = string.charCodeAt(i); + } + + this.position = offset > this.position ? offset : this.position; + } +}; + +/** + * Reads **length** bytes starting at **position**. + * + * @method + * @param {number} position read from the given position in the Binary. + * @param {number} length the number of bytes to read. + * @return {Buffer} + */ +Binary.prototype.read = function read(position, length) { + length = length && length > 0 ? length : this.position; + + // Let's return the data based on the type we have + if (this.buffer['slice']) { + return this.buffer.slice(position, position + length); + } else { + // Create a buffer to keep the result + var buffer = + typeof Uint8Array !== 'undefined' + ? new Uint8Array(new ArrayBuffer(length)) + : new Array(length); + for (var i = 0; i < length; i++) { + buffer[i] = this.buffer[position++]; + } + } + // Return the buffer + return buffer; +}; + +/** + * Returns the value of this binary as a string. + * + * @method + * @return {string} + */ +Binary.prototype.value = function value(asRaw) { + asRaw = asRaw == null ? false : asRaw; + + // Optimize to serialize for the situation where the data == size of buffer + if ( + asRaw && + typeof Buffer !== 'undefined' && + Buffer.isBuffer(this.buffer) && + this.buffer.length === this.position + ) + return this.buffer; + + // If it's a node.js buffer object + if (typeof Buffer !== 'undefined' && Buffer.isBuffer(this.buffer)) { + return asRaw + ? this.buffer.slice(0, this.position) + : this.buffer.toString('binary', 0, this.position); + } else { + if (asRaw) { + // we support the slice command use it + if (this.buffer['slice'] != null) { + return this.buffer.slice(0, this.position); + } else { + // Create a new buffer to copy content to + var newBuffer = + Object.prototype.toString.call(this.buffer) === '[object Uint8Array]' + ? new Uint8Array(new ArrayBuffer(this.position)) + : new Array(this.position); + // Copy content + for (var i = 0; i < this.position; i++) { + newBuffer[i] = this.buffer[i]; + } + // Return the buffer + return newBuffer; + } + } else { + return convertArraytoUtf8BinaryString(this.buffer, 0, this.position); + } + } +}; + +/** + * Length. + * + * @method + * @return {number} the length of the binary. + */ +Binary.prototype.length = function length() { + return this.position; +}; + +/** + * @ignore + */ +Binary.prototype.toJSON = function() { + return this.buffer != null ? this.buffer.toString('base64') : ''; +}; + +/** + * @ignore + */ +Binary.prototype.toString = function(format) { + return this.buffer != null ? this.buffer.slice(0, this.position).toString(format) : ''; +}; + +/** + * Binary default subtype + * @ignore + */ +var BSON_BINARY_SUBTYPE_DEFAULT = 0; + +/** + * @ignore + */ +var writeStringToArray = function(data) { + // Create a buffer + var buffer = + typeof Uint8Array !== 'undefined' + ? new Uint8Array(new ArrayBuffer(data.length)) + : new Array(data.length); + // Write the content to the buffer + for (var i = 0; i < data.length; i++) { + buffer[i] = data.charCodeAt(i); + } + // Write the string to the buffer + return buffer; +}; + +/** + * Convert Array ot Uint8Array to Binary String + * + * @ignore + */ +var convertArraytoUtf8BinaryString = function(byteArray, startIndex, endIndex) { + var result = ''; + for (var i = startIndex; i < endIndex; i++) { + result = result + String.fromCharCode(byteArray[i]); + } + return result; +}; + +Binary.BUFFER_SIZE = 256; + +/** + * Default BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ +Binary.SUBTYPE_DEFAULT = 0; +/** + * Function BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ +Binary.SUBTYPE_FUNCTION = 1; +/** + * Byte Array BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ +Binary.SUBTYPE_BYTE_ARRAY = 2; +/** + * OLD UUID BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ +Binary.SUBTYPE_UUID_OLD = 3; +/** + * UUID BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ +Binary.SUBTYPE_UUID = 4; +/** + * MD5 BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ +Binary.SUBTYPE_MD5 = 5; +/** + * User BSON type + * + * @classconstant SUBTYPE_DEFAULT + **/ +Binary.SUBTYPE_USER_DEFINED = 128; + +/** + * Expose. + */ +module.exports = Binary; +module.exports.Binary = Binary; diff --git a/node_modules/bson/lib/bson/bson.js b/node_modules/bson/lib/bson/bson.js new file mode 100644 index 00000000..912c5b92 --- /dev/null +++ b/node_modules/bson/lib/bson/bson.js @@ -0,0 +1,386 @@ +'use strict'; + +var Map = require('./map'), + Long = require('./long'), + Double = require('./double'), + Timestamp = require('./timestamp'), + ObjectID = require('./objectid'), + BSONRegExp = require('./regexp'), + Symbol = require('./symbol'), + Int32 = require('./int_32'), + Code = require('./code'), + Decimal128 = require('./decimal128'), + MinKey = require('./min_key'), + MaxKey = require('./max_key'), + DBRef = require('./db_ref'), + Binary = require('./binary'); + +// Parts of the parser +var deserialize = require('./parser/deserializer'), + serializer = require('./parser/serializer'), + calculateObjectSize = require('./parser/calculate_size'), + utils = require('./parser/utils'); + +/** + * @ignore + * @api private + */ +// Default Max Size +var MAXSIZE = 1024 * 1024 * 17; + +// Current Internal Temporary Serialization Buffer +var buffer = utils.allocBuffer(MAXSIZE); + +var BSON = function() {}; + +/** + * Serialize a Javascript object. + * + * @param {Object} object the Javascript object to serialize. + * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid. + * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**. + * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**. + * @param {Number} [options.minInternalBufferSize=1024*1024*17] minimum size of the internal temporary serialization buffer **(default:1024*1024*17)**. + * @return {Buffer} returns the Buffer object containing the serialized object. + * @api public + */ +BSON.prototype.serialize = function serialize(object, options) { + options = options || {}; + // Unpack the options + var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false; + var serializeFunctions = + typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false; + var ignoreUndefined = + typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true; + var minInternalBufferSize = + typeof options.minInternalBufferSize === 'number' ? options.minInternalBufferSize : MAXSIZE; + + // Resize the internal serialization buffer if needed + if (buffer.length < minInternalBufferSize) { + buffer = utils.allocBuffer(minInternalBufferSize); + } + + // Attempt to serialize + var serializationIndex = serializer( + buffer, + object, + checkKeys, + 0, + 0, + serializeFunctions, + ignoreUndefined, + [] + ); + // Create the final buffer + var finishedBuffer = utils.allocBuffer(serializationIndex); + // Copy into the finished buffer + buffer.copy(finishedBuffer, 0, 0, finishedBuffer.length); + // Return the buffer + return finishedBuffer; +}; + +/** + * Serialize a Javascript object using a predefined Buffer and index into the buffer, useful when pre-allocating the space for serialization. + * + * @param {Object} object the Javascript object to serialize. + * @param {Buffer} buffer the Buffer you pre-allocated to store the serialized BSON object. + * @param {Boolean} [options.checkKeys] the serializer will check if keys are valid. + * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**. + * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**. + * @param {Number} [options.index] the index in the buffer where we wish to start serializing into. + * @return {Number} returns the index pointing to the last written byte in the buffer. + * @api public + */ +BSON.prototype.serializeWithBufferAndIndex = function(object, finalBuffer, options) { + options = options || {}; + // Unpack the options + var checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false; + var serializeFunctions = + typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false; + var ignoreUndefined = + typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true; + var startIndex = typeof options.index === 'number' ? options.index : 0; + + // Attempt to serialize + var serializationIndex = serializer( + finalBuffer, + object, + checkKeys, + startIndex || 0, + 0, + serializeFunctions, + ignoreUndefined + ); + + // Return the index + return serializationIndex - 1; +}; + +/** + * Deserialize data as BSON. + * + * @param {Buffer} buffer the buffer containing the serialized set of BSON documents. + * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized. + * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse. + * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function. + * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits + * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance. + * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types. + * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer. + * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances. + * @return {Object} returns the deserialized Javascript Object. + * @api public + */ +BSON.prototype.deserialize = function(buffer, options) { + return deserialize(buffer, options); +}; + +/** + * Calculate the bson size for a passed in Javascript object. + * + * @param {Object} object the Javascript object to calculate the BSON byte size for. + * @param {Boolean} [options.serializeFunctions=false] serialize the javascript functions **(default:false)**. + * @param {Boolean} [options.ignoreUndefined=true] ignore undefined fields **(default:true)**. + * @return {Number} returns the number of bytes the BSON object will take up. + * @api public + */ +BSON.prototype.calculateObjectSize = function(object, options) { + options = options || {}; + + var serializeFunctions = + typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false; + var ignoreUndefined = + typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : true; + + return calculateObjectSize(object, serializeFunctions, ignoreUndefined); +}; + +/** + * Deserialize stream data as BSON documents. + * + * @param {Buffer} data the buffer containing the serialized set of BSON documents. + * @param {Number} startIndex the start index in the data Buffer where the deserialization is to start. + * @param {Number} numberOfDocuments number of documents to deserialize. + * @param {Array} documents an array where to store the deserialized documents. + * @param {Number} docStartIndex the index in the documents array from where to start inserting documents. + * @param {Object} [options] additional options used for the deserialization. + * @param {Object} [options.evalFunctions=false] evaluate functions in the BSON document scoped to the object deserialized. + * @param {Object} [options.cacheFunctions=false] cache evaluated functions for reuse. + * @param {Object} [options.cacheFunctionsCrc32=false] use a crc32 code for caching, otherwise use the string of the function. + * @param {Object} [options.promoteLongs=true] when deserializing a Long will fit it into a Number if it's smaller than 53 bits + * @param {Object} [options.promoteBuffers=false] when deserializing a Binary will return it as a node.js Buffer instance. + * @param {Object} [options.promoteValues=false] when deserializing will promote BSON values to their Node.js closest equivalent types. + * @param {Object} [options.fieldsAsRaw=null] allow to specify if there what fields we wish to return as unserialized raw buffer. + * @param {Object} [options.bsonRegExp=false] return BSON regular expressions as BSONRegExp instances. + * @return {Number} returns the next index in the buffer after deserialization **x** numbers of documents. + * @api public + */ +BSON.prototype.deserializeStream = function( + data, + startIndex, + numberOfDocuments, + documents, + docStartIndex, + options +) { + options = options != null ? options : {}; + var index = startIndex; + // Loop over all documents + for (var i = 0; i < numberOfDocuments; i++) { + // Find size of the document + var size = + data[index] | (data[index + 1] << 8) | (data[index + 2] << 16) | (data[index + 3] << 24); + // Update options with index + options['index'] = index; + // Parse the document at this point + documents[docStartIndex + i] = this.deserialize(data, options); + // Adjust index by the document size + index = index + size; + } + + // Return object containing end index of parsing and list of documents + return index; +}; + +/** + * @ignore + * @api private + */ +// BSON MAX VALUES +BSON.BSON_INT32_MAX = 0x7fffffff; +BSON.BSON_INT32_MIN = -0x80000000; + +BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; +BSON.BSON_INT64_MIN = -Math.pow(2, 63); + +// JS MAX PRECISE VALUES +BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. +BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + +// Internal long versions +// var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double. +// var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double. + +/** + * Number BSON Type + * + * @classconstant BSON_DATA_NUMBER + **/ +BSON.BSON_DATA_NUMBER = 1; +/** + * String BSON Type + * + * @classconstant BSON_DATA_STRING + **/ +BSON.BSON_DATA_STRING = 2; +/** + * Object BSON Type + * + * @classconstant BSON_DATA_OBJECT + **/ +BSON.BSON_DATA_OBJECT = 3; +/** + * Array BSON Type + * + * @classconstant BSON_DATA_ARRAY + **/ +BSON.BSON_DATA_ARRAY = 4; +/** + * Binary BSON Type + * + * @classconstant BSON_DATA_BINARY + **/ +BSON.BSON_DATA_BINARY = 5; +/** + * ObjectID BSON Type + * + * @classconstant BSON_DATA_OID + **/ +BSON.BSON_DATA_OID = 7; +/** + * Boolean BSON Type + * + * @classconstant BSON_DATA_BOOLEAN + **/ +BSON.BSON_DATA_BOOLEAN = 8; +/** + * Date BSON Type + * + * @classconstant BSON_DATA_DATE + **/ +BSON.BSON_DATA_DATE = 9; +/** + * null BSON Type + * + * @classconstant BSON_DATA_NULL + **/ +BSON.BSON_DATA_NULL = 10; +/** + * RegExp BSON Type + * + * @classconstant BSON_DATA_REGEXP + **/ +BSON.BSON_DATA_REGEXP = 11; +/** + * Code BSON Type + * + * @classconstant BSON_DATA_CODE + **/ +BSON.BSON_DATA_CODE = 13; +/** + * Symbol BSON Type + * + * @classconstant BSON_DATA_SYMBOL + **/ +BSON.BSON_DATA_SYMBOL = 14; +/** + * Code with Scope BSON Type + * + * @classconstant BSON_DATA_CODE_W_SCOPE + **/ +BSON.BSON_DATA_CODE_W_SCOPE = 15; +/** + * 32 bit Integer BSON Type + * + * @classconstant BSON_DATA_INT + **/ +BSON.BSON_DATA_INT = 16; +/** + * Timestamp BSON Type + * + * @classconstant BSON_DATA_TIMESTAMP + **/ +BSON.BSON_DATA_TIMESTAMP = 17; +/** + * Long BSON Type + * + * @classconstant BSON_DATA_LONG + **/ +BSON.BSON_DATA_LONG = 18; +/** + * MinKey BSON Type + * + * @classconstant BSON_DATA_MIN_KEY + **/ +BSON.BSON_DATA_MIN_KEY = 0xff; +/** + * MaxKey BSON Type + * + * @classconstant BSON_DATA_MAX_KEY + **/ +BSON.BSON_DATA_MAX_KEY = 0x7f; + +/** + * Binary Default Type + * + * @classconstant BSON_BINARY_SUBTYPE_DEFAULT + **/ +BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0; +/** + * Binary Function Type + * + * @classconstant BSON_BINARY_SUBTYPE_FUNCTION + **/ +BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1; +/** + * Binary Byte Array Type + * + * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY + **/ +BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2; +/** + * Binary UUID Type + * + * @classconstant BSON_BINARY_SUBTYPE_UUID + **/ +BSON.BSON_BINARY_SUBTYPE_UUID = 3; +/** + * Binary MD5 Type + * + * @classconstant BSON_BINARY_SUBTYPE_MD5 + **/ +BSON.BSON_BINARY_SUBTYPE_MD5 = 4; +/** + * Binary User Defined Type + * + * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED + **/ +BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128; + +// Return BSON +module.exports = BSON; +module.exports.Code = Code; +module.exports.Map = Map; +module.exports.Symbol = Symbol; +module.exports.BSON = BSON; +module.exports.DBRef = DBRef; +module.exports.Binary = Binary; +module.exports.ObjectID = ObjectID; +module.exports.Long = Long; +module.exports.Timestamp = Timestamp; +module.exports.Double = Double; +module.exports.Int32 = Int32; +module.exports.MinKey = MinKey; +module.exports.MaxKey = MaxKey; +module.exports.BSONRegExp = BSONRegExp; +module.exports.Decimal128 = Decimal128; diff --git a/node_modules/bson/lib/bson/code.js b/node_modules/bson/lib/bson/code.js new file mode 100644 index 00000000..c2984cd5 --- /dev/null +++ b/node_modules/bson/lib/bson/code.js @@ -0,0 +1,24 @@ +/** + * A class representation of the BSON Code type. + * + * @class + * @param {(string|function)} code a string or function. + * @param {Object} [scope] an optional scope for the function. + * @return {Code} + */ +var Code = function Code(code, scope) { + if (!(this instanceof Code)) return new Code(code, scope); + this._bsontype = 'Code'; + this.code = code; + this.scope = scope; +}; + +/** + * @ignore + */ +Code.prototype.toJSON = function() { + return { scope: this.scope, code: this.code }; +}; + +module.exports = Code; +module.exports.Code = Code; diff --git a/node_modules/bson/lib/bson/db_ref.js b/node_modules/bson/lib/bson/db_ref.js new file mode 100644 index 00000000..f95795b1 --- /dev/null +++ b/node_modules/bson/lib/bson/db_ref.js @@ -0,0 +1,32 @@ +/** + * A class representation of the BSON DBRef type. + * + * @class + * @param {string} namespace the collection name. + * @param {ObjectID} oid the reference ObjectID. + * @param {string} [db] optional db name, if omitted the reference is local to the current db. + * @return {DBRef} + */ +function DBRef(namespace, oid, db) { + if (!(this instanceof DBRef)) return new DBRef(namespace, oid, db); + + this._bsontype = 'DBRef'; + this.namespace = namespace; + this.oid = oid; + this.db = db; +} + +/** + * @ignore + * @api private + */ +DBRef.prototype.toJSON = function() { + return { + $ref: this.namespace, + $id: this.oid, + $db: this.db == null ? '' : this.db + }; +}; + +module.exports = DBRef; +module.exports.DBRef = DBRef; diff --git a/node_modules/bson/lib/bson/decimal128.js b/node_modules/bson/lib/bson/decimal128.js new file mode 100644 index 00000000..924513f4 --- /dev/null +++ b/node_modules/bson/lib/bson/decimal128.js @@ -0,0 +1,820 @@ +'use strict'; + +var Long = require('./long'); + +var PARSE_STRING_REGEXP = /^(\+|-)?(\d+|(\d*\.\d*))?(E|e)?([-+])?(\d+)?$/; +var PARSE_INF_REGEXP = /^(\+|-)?(Infinity|inf)$/i; +var PARSE_NAN_REGEXP = /^(\+|-)?NaN$/i; + +var EXPONENT_MAX = 6111; +var EXPONENT_MIN = -6176; +var EXPONENT_BIAS = 6176; +var MAX_DIGITS = 34; + +// Nan value bits as 32 bit values (due to lack of longs) +var NAN_BUFFER = [ + 0x7c, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00 +].reverse(); +// Infinity value bits 32 bit values (due to lack of longs) +var INF_NEGATIVE_BUFFER = [ + 0xf8, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00 +].reverse(); +var INF_POSITIVE_BUFFER = [ + 0x78, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00, + 0x00 +].reverse(); + +var EXPONENT_REGEX = /^([-+])?(\d+)?$/; + +var utils = require('./parser/utils'); + +// Detect if the value is a digit +var isDigit = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +// Divide two uint128 values +var divideu128 = function(value) { + var DIVISOR = Long.fromNumber(1000 * 1000 * 1000); + var _rem = Long.fromNumber(0); + var i = 0; + + if (!value.parts[0] && !value.parts[1] && !value.parts[2] && !value.parts[3]) { + return { quotient: value, rem: _rem }; + } + + for (i = 0; i <= 3; i++) { + // Adjust remainder to match value of next dividend + _rem = _rem.shiftLeft(32); + // Add the divided to _rem + _rem = _rem.add(new Long(value.parts[i], 0)); + value.parts[i] = _rem.div(DIVISOR).low_; + _rem = _rem.modulo(DIVISOR); + } + + return { quotient: value, rem: _rem }; +}; + +// Multiply two Long values and return the 128 bit value +var multiply64x2 = function(left, right) { + if (!left && !right) { + return { high: Long.fromNumber(0), low: Long.fromNumber(0) }; + } + + var leftHigh = left.shiftRightUnsigned(32); + var leftLow = new Long(left.getLowBits(), 0); + var rightHigh = right.shiftRightUnsigned(32); + var rightLow = new Long(right.getLowBits(), 0); + + var productHigh = leftHigh.multiply(rightHigh); + var productMid = leftHigh.multiply(rightLow); + var productMid2 = leftLow.multiply(rightHigh); + var productLow = leftLow.multiply(rightLow); + + productHigh = productHigh.add(productMid.shiftRightUnsigned(32)); + productMid = new Long(productMid.getLowBits(), 0) + .add(productMid2) + .add(productLow.shiftRightUnsigned(32)); + + productHigh = productHigh.add(productMid.shiftRightUnsigned(32)); + productLow = productMid.shiftLeft(32).add(new Long(productLow.getLowBits(), 0)); + + // Return the 128 bit result + return { high: productHigh, low: productLow }; +}; + +var lessThan = function(left, right) { + // Make values unsigned + var uhleft = left.high_ >>> 0; + var uhright = right.high_ >>> 0; + + // Compare high bits first + if (uhleft < uhright) { + return true; + } else if (uhleft === uhright) { + var ulleft = left.low_ >>> 0; + var ulright = right.low_ >>> 0; + if (ulleft < ulright) return true; + } + + return false; +}; + +// var longtoHex = function(value) { +// var buffer = utils.allocBuffer(8); +// var index = 0; +// // Encode the low 64 bits of the decimal +// // Encode low bits +// buffer[index++] = value.low_ & 0xff; +// buffer[index++] = (value.low_ >> 8) & 0xff; +// buffer[index++] = (value.low_ >> 16) & 0xff; +// buffer[index++] = (value.low_ >> 24) & 0xff; +// // Encode high bits +// buffer[index++] = value.high_ & 0xff; +// buffer[index++] = (value.high_ >> 8) & 0xff; +// buffer[index++] = (value.high_ >> 16) & 0xff; +// buffer[index++] = (value.high_ >> 24) & 0xff; +// return buffer.reverse().toString('hex'); +// }; + +// var int32toHex = function(value) { +// var buffer = utils.allocBuffer(4); +// var index = 0; +// // Encode the low 64 bits of the decimal +// // Encode low bits +// buffer[index++] = value & 0xff; +// buffer[index++] = (value >> 8) & 0xff; +// buffer[index++] = (value >> 16) & 0xff; +// buffer[index++] = (value >> 24) & 0xff; +// return buffer.reverse().toString('hex'); +// }; + +/** + * A class representation of the BSON Decimal128 type. + * + * @class + * @param {Buffer} bytes a buffer containing the raw Decimal128 bytes. + * @return {Double} + */ +var Decimal128 = function(bytes) { + this._bsontype = 'Decimal128'; + this.bytes = bytes; +}; + +/** + * Create a Decimal128 instance from a string representation + * + * @method + * @param {string} string a numeric string representation. + * @return {Decimal128} returns a Decimal128 instance. + */ +Decimal128.fromString = function(string) { + // Parse state tracking + var isNegative = false; + var sawRadix = false; + var foundNonZero = false; + + // Total number of significant digits (no leading or trailing zero) + var significantDigits = 0; + // Total number of significand digits read + var nDigitsRead = 0; + // Total number of digits (no leading zeros) + var nDigits = 0; + // The number of the digits after radix + var radixPosition = 0; + // The index of the first non-zero in *str* + var firstNonZero = 0; + + // Digits Array + var digits = [0]; + // The number of digits in digits + var nDigitsStored = 0; + // Insertion pointer for digits + var digitsInsert = 0; + // The index of the first non-zero digit + var firstDigit = 0; + // The index of the last digit + var lastDigit = 0; + + // Exponent + var exponent = 0; + // loop index over array + var i = 0; + // The high 17 digits of the significand + var significandHigh = [0, 0]; + // The low 17 digits of the significand + var significandLow = [0, 0]; + // The biased exponent + var biasedExponent = 0; + + // Read index + var index = 0; + + // Trim the string + string = string.trim(); + + // Naively prevent against REDOS attacks. + // TODO: implementing a custom parsing for this, or refactoring the regex would yield + // further gains. + if (string.length >= 7000) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Results + var stringMatch = string.match(PARSE_STRING_REGEXP); + var infMatch = string.match(PARSE_INF_REGEXP); + var nanMatch = string.match(PARSE_NAN_REGEXP); + + // Validate the string + if ((!stringMatch && !infMatch && !nanMatch) || string.length === 0) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Check if we have an illegal exponent format + if (stringMatch && stringMatch[4] && stringMatch[2] === undefined) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Get the negative or positive sign + if (string[index] === '+' || string[index] === '-') { + isNegative = string[index++] === '-'; + } + + // Check if user passed Infinity or NaN + if (!isDigit(string[index]) && string[index] !== '.') { + if (string[index] === 'i' || string[index] === 'I') { + return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)); + } else if (string[index] === 'N') { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + } + + // Read all the digits + while (isDigit(string[index]) || string[index] === '.') { + if (string[index] === '.') { + if (sawRadix) { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + + sawRadix = true; + index = index + 1; + continue; + } + + if (nDigitsStored < 34) { + if (string[index] !== '0' || foundNonZero) { + if (!foundNonZero) { + firstNonZero = nDigitsRead; + } + + foundNonZero = true; + + // Only store 34 digits + digits[digitsInsert++] = parseInt(string[index], 10); + nDigitsStored = nDigitsStored + 1; + } + } + + if (foundNonZero) { + nDigits = nDigits + 1; + } + + if (sawRadix) { + radixPosition = radixPosition + 1; + } + + nDigitsRead = nDigitsRead + 1; + index = index + 1; + } + + if (sawRadix && !nDigitsRead) { + throw new Error('' + string + ' not a valid Decimal128 string'); + } + + // Read exponent if exists + if (string[index] === 'e' || string[index] === 'E') { + // Read exponent digits + var match = string.substr(++index).match(EXPONENT_REGEX); + + // No digits read + if (!match || !match[2]) { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + + // Get exponent + exponent = parseInt(match[0], 10); + + // Adjust the index + index = index + match[0].length; + } + + // Return not a number + if (string[index]) { + return new Decimal128(utils.toBuffer(NAN_BUFFER)); + } + + // Done reading input + // Find first non-zero digit in digits + firstDigit = 0; + + if (!nDigitsStored) { + firstDigit = 0; + lastDigit = 0; + digits[0] = 0; + nDigits = 1; + nDigitsStored = 1; + significantDigits = 0; + } else { + lastDigit = nDigitsStored - 1; + significantDigits = nDigits; + + if (exponent !== 0 && significantDigits !== 1) { + while (string[firstNonZero + significantDigits - 1] === '0') { + significantDigits = significantDigits - 1; + } + } + } + + // Normalization of exponent + // Correct exponent based on radix position, and shift significand as needed + // to represent user input + + // Overflow prevention + if (exponent <= radixPosition && radixPosition - exponent > 1 << 14) { + exponent = EXPONENT_MIN; + } else { + exponent = exponent - radixPosition; + } + + // Attempt to normalize the exponent + while (exponent > EXPONENT_MAX) { + // Shift exponent to significand and decrease + lastDigit = lastDigit + 1; + + if (lastDigit - firstDigit > MAX_DIGITS) { + // Check if we have a zero then just hard clamp, otherwise fail + var digitsString = digits.join(''); + if (digitsString.match(/^0+$/)) { + exponent = EXPONENT_MAX; + break; + } else { + return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)); + } + } + + exponent = exponent - 1; + } + + while (exponent < EXPONENT_MIN || nDigitsStored < nDigits) { + // Shift last digit + if (lastDigit === 0) { + exponent = EXPONENT_MIN; + significantDigits = 0; + break; + } + + if (nDigitsStored < nDigits) { + // adjust to match digits not stored + nDigits = nDigits - 1; + } else { + // adjust to round + lastDigit = lastDigit - 1; + } + + if (exponent < EXPONENT_MAX) { + exponent = exponent + 1; + } else { + // Check if we have a zero then just hard clamp, otherwise fail + digitsString = digits.join(''); + if (digitsString.match(/^0+$/)) { + exponent = EXPONENT_MAX; + break; + } else { + return new Decimal128(utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER)); + } + } + } + + // Round + // We've normalized the exponent, but might still need to round. + if (lastDigit - firstDigit + 1 < significantDigits && string[significantDigits] !== '0') { + var endOfString = nDigitsRead; + + // If we have seen a radix point, 'string' is 1 longer than we have + // documented with ndigits_read, so inc the position of the first nonzero + // digit and the position that digits are read to. + if (sawRadix && exponent === EXPONENT_MIN) { + firstNonZero = firstNonZero + 1; + endOfString = endOfString + 1; + } + + var roundDigit = parseInt(string[firstNonZero + lastDigit + 1], 10); + var roundBit = 0; + + if (roundDigit >= 5) { + roundBit = 1; + + if (roundDigit === 5) { + roundBit = digits[lastDigit] % 2 === 1; + + for (i = firstNonZero + lastDigit + 2; i < endOfString; i++) { + if (parseInt(string[i], 10)) { + roundBit = 1; + break; + } + } + } + } + + if (roundBit) { + var dIdx = lastDigit; + + for (; dIdx >= 0; dIdx--) { + if (++digits[dIdx] > 9) { + digits[dIdx] = 0; + + // overflowed most significant digit + if (dIdx === 0) { + if (exponent < EXPONENT_MAX) { + exponent = exponent + 1; + digits[dIdx] = 1; + } else { + return new Decimal128( + utils.toBuffer(isNegative ? INF_NEGATIVE_BUFFER : INF_POSITIVE_BUFFER) + ); + } + } + } else { + break; + } + } + } + } + + // Encode significand + // The high 17 digits of the significand + significandHigh = Long.fromNumber(0); + // The low 17 digits of the significand + significandLow = Long.fromNumber(0); + + // read a zero + if (significantDigits === 0) { + significandHigh = Long.fromNumber(0); + significandLow = Long.fromNumber(0); + } else if (lastDigit - firstDigit < 17) { + dIdx = firstDigit; + significandLow = Long.fromNumber(digits[dIdx++]); + significandHigh = new Long(0, 0); + + for (; dIdx <= lastDigit; dIdx++) { + significandLow = significandLow.multiply(Long.fromNumber(10)); + significandLow = significandLow.add(Long.fromNumber(digits[dIdx])); + } + } else { + dIdx = firstDigit; + significandHigh = Long.fromNumber(digits[dIdx++]); + + for (; dIdx <= lastDigit - 17; dIdx++) { + significandHigh = significandHigh.multiply(Long.fromNumber(10)); + significandHigh = significandHigh.add(Long.fromNumber(digits[dIdx])); + } + + significandLow = Long.fromNumber(digits[dIdx++]); + + for (; dIdx <= lastDigit; dIdx++) { + significandLow = significandLow.multiply(Long.fromNumber(10)); + significandLow = significandLow.add(Long.fromNumber(digits[dIdx])); + } + } + + var significand = multiply64x2(significandHigh, Long.fromString('100000000000000000')); + + significand.low = significand.low.add(significandLow); + + if (lessThan(significand.low, significandLow)) { + significand.high = significand.high.add(Long.fromNumber(1)); + } + + // Biased exponent + biasedExponent = exponent + EXPONENT_BIAS; + var dec = { low: Long.fromNumber(0), high: Long.fromNumber(0) }; + + // Encode combination, exponent, and significand. + if ( + significand.high + .shiftRightUnsigned(49) + .and(Long.fromNumber(1)) + .equals(Long.fromNumber) + ) { + // Encode '11' into bits 1 to 3 + dec.high = dec.high.or(Long.fromNumber(0x3).shiftLeft(61)); + dec.high = dec.high.or( + Long.fromNumber(biasedExponent).and(Long.fromNumber(0x3fff).shiftLeft(47)) + ); + dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x7fffffffffff))); + } else { + dec.high = dec.high.or(Long.fromNumber(biasedExponent & 0x3fff).shiftLeft(49)); + dec.high = dec.high.or(significand.high.and(Long.fromNumber(0x1ffffffffffff))); + } + + dec.low = significand.low; + + // Encode sign + if (isNegative) { + dec.high = dec.high.or(Long.fromString('9223372036854775808')); + } + + // Encode into a buffer + var buffer = utils.allocBuffer(16); + index = 0; + + // Encode the low 64 bits of the decimal + // Encode low bits + buffer[index++] = dec.low.low_ & 0xff; + buffer[index++] = (dec.low.low_ >> 8) & 0xff; + buffer[index++] = (dec.low.low_ >> 16) & 0xff; + buffer[index++] = (dec.low.low_ >> 24) & 0xff; + // Encode high bits + buffer[index++] = dec.low.high_ & 0xff; + buffer[index++] = (dec.low.high_ >> 8) & 0xff; + buffer[index++] = (dec.low.high_ >> 16) & 0xff; + buffer[index++] = (dec.low.high_ >> 24) & 0xff; + + // Encode the high 64 bits of the decimal + // Encode low bits + buffer[index++] = dec.high.low_ & 0xff; + buffer[index++] = (dec.high.low_ >> 8) & 0xff; + buffer[index++] = (dec.high.low_ >> 16) & 0xff; + buffer[index++] = (dec.high.low_ >> 24) & 0xff; + // Encode high bits + buffer[index++] = dec.high.high_ & 0xff; + buffer[index++] = (dec.high.high_ >> 8) & 0xff; + buffer[index++] = (dec.high.high_ >> 16) & 0xff; + buffer[index++] = (dec.high.high_ >> 24) & 0xff; + + // Return the new Decimal128 + return new Decimal128(buffer); +}; + +// Extract least significant 5 bits +var COMBINATION_MASK = 0x1f; +// Extract least significant 14 bits +var EXPONENT_MASK = 0x3fff; +// Value of combination field for Inf +var COMBINATION_INFINITY = 30; +// Value of combination field for NaN +var COMBINATION_NAN = 31; +// Value of combination field for NaN +// var COMBINATION_SNAN = 32; +// decimal128 exponent bias +EXPONENT_BIAS = 6176; + +/** + * Create a string representation of the raw Decimal128 value + * + * @method + * @return {string} returns a Decimal128 string representation. + */ +Decimal128.prototype.toString = function() { + // Note: bits in this routine are referred to starting at 0, + // from the sign bit, towards the coefficient. + + // bits 0 - 31 + var high; + // bits 32 - 63 + var midh; + // bits 64 - 95 + var midl; + // bits 96 - 127 + var low; + // bits 1 - 5 + var combination; + // decoded biased exponent (14 bits) + var biased_exponent; + // the number of significand digits + var significand_digits = 0; + // the base-10 digits in the significand + var significand = new Array(36); + for (var i = 0; i < significand.length; i++) significand[i] = 0; + // read pointer into significand + var index = 0; + + // unbiased exponent + var exponent; + // the exponent if scientific notation is used + var scientific_exponent; + + // true if the number is zero + var is_zero = false; + + // the most signifcant significand bits (50-46) + var significand_msb; + // temporary storage for significand decoding + var significand128 = { parts: new Array(4) }; + // indexing variables + i; + var j, k; + + // Output string + var string = []; + + // Unpack index + index = 0; + + // Buffer reference + var buffer = this.bytes; + + // Unpack the low 64bits into a long + low = + buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24); + midl = + buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24); + + // Unpack the high 64bits into a long + midh = + buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24); + high = + buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24); + + // Unpack index + index = 0; + + // Create the state of the decimal + var dec = { + low: new Long(low, midl), + high: new Long(midh, high) + }; + + if (dec.high.lessThan(Long.ZERO)) { + string.push('-'); + } + + // Decode combination field and exponent + combination = (high >> 26) & COMBINATION_MASK; + + if (combination >> 3 === 3) { + // Check for 'special' values + if (combination === COMBINATION_INFINITY) { + return string.join('') + 'Infinity'; + } else if (combination === COMBINATION_NAN) { + return 'NaN'; + } else { + biased_exponent = (high >> 15) & EXPONENT_MASK; + significand_msb = 0x08 + ((high >> 14) & 0x01); + } + } else { + significand_msb = (high >> 14) & 0x07; + biased_exponent = (high >> 17) & EXPONENT_MASK; + } + + exponent = biased_exponent - EXPONENT_BIAS; + + // Create string of significand digits + + // Convert the 114-bit binary number represented by + // (significand_high, significand_low) to at most 34 decimal + // digits through modulo and division. + significand128.parts[0] = (high & 0x3fff) + ((significand_msb & 0xf) << 14); + significand128.parts[1] = midh; + significand128.parts[2] = midl; + significand128.parts[3] = low; + + if ( + significand128.parts[0] === 0 && + significand128.parts[1] === 0 && + significand128.parts[2] === 0 && + significand128.parts[3] === 0 + ) { + is_zero = true; + } else { + for (k = 3; k >= 0; k--) { + var least_digits = 0; + // Peform the divide + var result = divideu128(significand128); + significand128 = result.quotient; + least_digits = result.rem.low_; + + // We now have the 9 least significant digits (in base 2). + // Convert and output to string. + if (!least_digits) continue; + + for (j = 8; j >= 0; j--) { + // significand[k * 9 + j] = Math.round(least_digits % 10); + significand[k * 9 + j] = least_digits % 10; + // least_digits = Math.round(least_digits / 10); + least_digits = Math.floor(least_digits / 10); + } + } + } + + // Output format options: + // Scientific - [-]d.dddE(+/-)dd or [-]dE(+/-)dd + // Regular - ddd.ddd + + if (is_zero) { + significand_digits = 1; + significand[index] = 0; + } else { + significand_digits = 36; + i = 0; + + while (!significand[index]) { + i++; + significand_digits = significand_digits - 1; + index = index + 1; + } + } + + scientific_exponent = significand_digits - 1 + exponent; + + // The scientific exponent checks are dictated by the string conversion + // specification and are somewhat arbitrary cutoffs. + // + // We must check exponent > 0, because if this is the case, the number + // has trailing zeros. However, we *cannot* output these trailing zeros, + // because doing so would change the precision of the value, and would + // change stored data if the string converted number is round tripped. + + if (scientific_exponent >= 34 || scientific_exponent <= -7 || exponent > 0) { + // Scientific format + string.push(significand[index++]); + significand_digits = significand_digits - 1; + + if (significand_digits) { + string.push('.'); + } + + for (i = 0; i < significand_digits; i++) { + string.push(significand[index++]); + } + + // Exponent + string.push('E'); + if (scientific_exponent > 0) { + string.push('+' + scientific_exponent); + } else { + string.push(scientific_exponent); + } + } else { + // Regular format with no decimal place + if (exponent >= 0) { + for (i = 0; i < significand_digits; i++) { + string.push(significand[index++]); + } + } else { + var radix_position = significand_digits + exponent; + + // non-zero digits before radix + if (radix_position > 0) { + for (i = 0; i < radix_position; i++) { + string.push(significand[index++]); + } + } else { + string.push('0'); + } + + string.push('.'); + // add leading zeros after radix + while (radix_position++ < 0) { + string.push('0'); + } + + for (i = 0; i < significand_digits - Math.max(radix_position - 1, 0); i++) { + string.push(significand[index++]); + } + } + } + + return string.join(''); +}; + +Decimal128.prototype.toJSON = function() { + return { $numberDecimal: this.toString() }; +}; + +module.exports = Decimal128; +module.exports.Decimal128 = Decimal128; diff --git a/node_modules/bson/lib/bson/double.js b/node_modules/bson/lib/bson/double.js new file mode 100644 index 00000000..523c21f8 --- /dev/null +++ b/node_modules/bson/lib/bson/double.js @@ -0,0 +1,33 @@ +/** + * A class representation of the BSON Double type. + * + * @class + * @param {number} value the number we want to represent as a double. + * @return {Double} + */ +function Double(value) { + if (!(this instanceof Double)) return new Double(value); + + this._bsontype = 'Double'; + this.value = value; +} + +/** + * Access the number value. + * + * @method + * @return {number} returns the wrapped double number. + */ +Double.prototype.valueOf = function() { + return this.value; +}; + +/** + * @ignore + */ +Double.prototype.toJSON = function() { + return this.value; +}; + +module.exports = Double; +module.exports.Double = Double; diff --git a/node_modules/bson/lib/bson/float_parser.js b/node_modules/bson/lib/bson/float_parser.js new file mode 100644 index 00000000..0054a2f6 --- /dev/null +++ b/node_modules/bson/lib/bson/float_parser.js @@ -0,0 +1,124 @@ +// Copyright (c) 2008, Fair Oaks Labs, Inc. +// All rights reserved. +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are met: +// +// * Redistributions of source code must retain the above copyright notice, +// this list of conditions and the following disclaimer. +// +// * Redistributions in binary form must reproduce the above copyright notice, +// this list of conditions and the following disclaimer in the documentation +// and/or other materials provided with the distribution. +// +// * Neither the name of Fair Oaks Labs, Inc. nor the names of its contributors +// may be used to endorse or promote products derived from this software +// without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +// AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +// IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +// ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +// LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +// CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +// SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +// INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +// CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +// ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +// POSSIBILITY OF SUCH DAMAGE. +// +// +// Modifications to writeIEEE754 to support negative zeroes made by Brian White + +var readIEEE754 = function(buffer, offset, endian, mLen, nBytes) { + var e, + m, + bBE = endian === 'big', + eLen = nBytes * 8 - mLen - 1, + eMax = (1 << eLen) - 1, + eBias = eMax >> 1, + nBits = -7, + i = bBE ? 0 : nBytes - 1, + d = bBE ? 1 : -1, + s = buffer[offset + i]; + + i += d; + + e = s & ((1 << -nBits) - 1); + s >>= -nBits; + nBits += eLen; + for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8); + + m = e & ((1 << -nBits) - 1); + e >>= -nBits; + nBits += mLen; + for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8); + + if (e === 0) { + e = 1 - eBias; + } else if (e === eMax) { + return m ? NaN : (s ? -1 : 1) * Infinity; + } else { + m = m + Math.pow(2, mLen); + e = e - eBias; + } + return (s ? -1 : 1) * m * Math.pow(2, e - mLen); +}; + +var writeIEEE754 = function(buffer, value, offset, endian, mLen, nBytes) { + var e, + m, + c, + bBE = endian === 'big', + eLen = nBytes * 8 - mLen - 1, + eMax = (1 << eLen) - 1, + eBias = eMax >> 1, + rt = mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0, + i = bBE ? nBytes - 1 : 0, + d = bBE ? -1 : 1, + s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0; + + value = Math.abs(value); + + if (isNaN(value) || value === Infinity) { + m = isNaN(value) ? 1 : 0; + e = eMax; + } else { + e = Math.floor(Math.log(value) / Math.LN2); + if (value * (c = Math.pow(2, -e)) < 1) { + e--; + c *= 2; + } + if (e + eBias >= 1) { + value += rt / c; + } else { + value += rt * Math.pow(2, 1 - eBias); + } + if (value * c >= 2) { + e++; + c /= 2; + } + + if (e + eBias >= eMax) { + m = 0; + e = eMax; + } else if (e + eBias >= 1) { + m = (value * c - 1) * Math.pow(2, mLen); + e = e + eBias; + } else { + m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen); + e = 0; + } + } + + for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8); + + e = (e << mLen) | m; + eLen += mLen; + for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8); + + buffer[offset + i - d] |= s * 128; +}; + +exports.readIEEE754 = readIEEE754; +exports.writeIEEE754 = writeIEEE754; diff --git a/node_modules/bson/lib/bson/int_32.js b/node_modules/bson/lib/bson/int_32.js new file mode 100644 index 00000000..85dbdec6 --- /dev/null +++ b/node_modules/bson/lib/bson/int_32.js @@ -0,0 +1,33 @@ +/** + * A class representation of a BSON Int32 type. + * + * @class + * @param {number} value the number we want to represent as an int32. + * @return {Int32} + */ +var Int32 = function(value) { + if (!(this instanceof Int32)) return new Int32(value); + + this._bsontype = 'Int32'; + this.value = value; +}; + +/** + * Access the number value. + * + * @method + * @return {number} returns the wrapped int32 number. + */ +Int32.prototype.valueOf = function() { + return this.value; +}; + +/** + * @ignore + */ +Int32.prototype.toJSON = function() { + return this.value; +}; + +module.exports = Int32; +module.exports.Int32 = Int32; diff --git a/node_modules/bson/lib/bson/long.js b/node_modules/bson/lib/bson/long.js new file mode 100644 index 00000000..551d1a60 --- /dev/null +++ b/node_modules/bson/lib/bson/long.js @@ -0,0 +1,865 @@ +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// Copyright 2009 Google Inc. All Rights Reserved + +/** + * Defines a Long class for representing a 64-bit two's-complement + * integer value, which faithfully simulates the behavior of a Java "Long". This + * implementation is derived from LongLib in GWT. + * + * Constructs a 64-bit two's-complement integer, given its low and high 32-bit + * values as *signed* integers. See the from* functions below for more + * convenient ways of constructing Longs. + * + * The internal representation of a Long is the two given signed, 32-bit values. + * We use 32-bit pieces because these are the size of integers on which + * Javascript performs bit-operations. For operations like addition and + * multiplication, we split each number into 16-bit pieces, which can easily be + * multiplied within Javascript's floating-point representation without overflow + * or change in sign. + * + * In the algorithms below, we frequently reduce the negative case to the + * positive case by negating the input(s) and then post-processing the result. + * Note that we must ALWAYS check specially whether those values are MIN_VALUE + * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as + * a positive number, it overflows back into a negative). Not handling this + * case would often result in infinite recursion. + * + * @class + * @param {number} low the low (signed) 32 bits of the Long. + * @param {number} high the high (signed) 32 bits of the Long. + * @return {Long} + */ +function Long(low, high) { + if (!(this instanceof Long)) return new Long(low, high); + + this._bsontype = 'Long'; + /** + * @type {number} + * @ignore + */ + this.low_ = low | 0; // force into 32 signed bits. + + /** + * @type {number} + * @ignore + */ + this.high_ = high | 0; // force into 32 signed bits. +} + +/** + * Return the int value. + * + * @method + * @return {number} the value, assuming it is a 32-bit integer. + */ +Long.prototype.toInt = function() { + return this.low_; +}; + +/** + * Return the Number value. + * + * @method + * @return {number} the closest floating-point representation to this value. + */ +Long.prototype.toNumber = function() { + return this.high_ * Long.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned(); +}; + +/** Converts the Long to a BigInt (arbitrary precision). */ +Long.prototype.toBigInt = function () { + return BigInt(this.toString()); +} + +/** + * Return the JSON value. + * + * @method + * @return {string} the JSON representation. + */ +Long.prototype.toJSON = function() { + return this.toString(); +}; + +/** + * Return the String value. + * + * @method + * @param {number} [opt_radix] the radix in which the text should be written. + * @return {string} the textual representation of this value. + */ +Long.prototype.toString = function(opt_radix) { + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (this.isZero()) { + return '0'; + } + + if (this.isNegative()) { + if (this.equals(Long.MIN_VALUE)) { + // We need to change the Long value before it can be negated, so we remove + // the bottom-most digit in this base and then recurse to do the rest. + var radixLong = Long.fromNumber(radix); + var div = this.div(radixLong); + var rem = div.multiply(radixLong).subtract(this); + return div.toString(radix) + rem.toInt().toString(radix); + } else { + return '-' + this.negate().toString(radix); + } + } + + // Do several (6) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Long.fromNumber(Math.pow(radix, 6)); + + rem = this; + var result = ''; + + while (!rem.isZero()) { + var remDiv = rem.div(radixToPower); + var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt(); + var digits = intval.toString(radix); + + rem = remDiv; + if (rem.isZero()) { + return digits + result; + } else { + while (digits.length < 6) { + digits = '0' + digits; + } + result = '' + digits + result; + } + } +}; + +/** + * Return the high 32-bits value. + * + * @method + * @return {number} the high 32-bits as a signed value. + */ +Long.prototype.getHighBits = function() { + return this.high_; +}; + +/** + * Return the low 32-bits value. + * + * @method + * @return {number} the low 32-bits as a signed value. + */ +Long.prototype.getLowBits = function() { + return this.low_; +}; + +/** + * Return the low unsigned 32-bits value. + * + * @method + * @return {number} the low 32-bits as an unsigned value. + */ +Long.prototype.getLowBitsUnsigned = function() { + return this.low_ >= 0 ? this.low_ : Long.TWO_PWR_32_DBL_ + this.low_; +}; + +/** + * Returns the number of bits needed to represent the absolute value of this Long. + * + * @method + * @return {number} Returns the number of bits needed to represent the absolute value of this Long. + */ +Long.prototype.getNumBitsAbs = function() { + if (this.isNegative()) { + if (this.equals(Long.MIN_VALUE)) { + return 64; + } else { + return this.negate().getNumBitsAbs(); + } + } else { + var val = this.high_ !== 0 ? this.high_ : this.low_; + for (var bit = 31; bit > 0; bit--) { + if ((val & (1 << bit)) !== 0) { + break; + } + } + return this.high_ !== 0 ? bit + 33 : bit + 1; + } +}; + +/** + * Return whether this value is zero. + * + * @method + * @return {boolean} whether this value is zero. + */ +Long.prototype.isZero = function() { + return this.high_ === 0 && this.low_ === 0; +}; + +/** + * Return whether this value is negative. + * + * @method + * @return {boolean} whether this value is negative. + */ +Long.prototype.isNegative = function() { + return this.high_ < 0; +}; + +/** + * Return whether this value is odd. + * + * @method + * @return {boolean} whether this value is odd. + */ +Long.prototype.isOdd = function() { + return (this.low_ & 1) === 1; +}; + +/** + * Return whether this Long equals the other + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long equals the other + */ +Long.prototype.equals = function(other) { + return this.high_ === other.high_ && this.low_ === other.low_; +}; + +/** + * Return whether this Long does not equal the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long does not equal the other. + */ +Long.prototype.notEquals = function(other) { + return this.high_ !== other.high_ || this.low_ !== other.low_; +}; + +/** + * Return whether this Long is less than the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is less than the other. + */ +Long.prototype.lessThan = function(other) { + return this.compare(other) < 0; +}; + +/** + * Return whether this Long is less than or equal to the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is less than or equal to the other. + */ +Long.prototype.lessThanOrEqual = function(other) { + return this.compare(other) <= 0; +}; + +/** + * Return whether this Long is greater than the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is greater than the other. + */ +Long.prototype.greaterThan = function(other) { + return this.compare(other) > 0; +}; + +/** + * Return whether this Long is greater than or equal to the other. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} whether this Long is greater than or equal to the other. + */ +Long.prototype.greaterThanOrEqual = function(other) { + return this.compare(other) >= 0; +}; + +/** + * Compares this Long with the given one. + * + * @method + * @param {Long} other Long to compare against. + * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater. + */ +Long.prototype.compare = function(other) { + if (this.equals(other)) { + return 0; + } + + var thisNeg = this.isNegative(); + var otherNeg = other.isNegative(); + if (thisNeg && !otherNeg) { + return -1; + } + if (!thisNeg && otherNeg) { + return 1; + } + + // at this point, the signs are the same, so subtraction will not overflow + if (this.subtract(other).isNegative()) { + return -1; + } else { + return 1; + } +}; + +/** + * The negation of this value. + * + * @method + * @return {Long} the negation of this value. + */ +Long.prototype.negate = function() { + if (this.equals(Long.MIN_VALUE)) { + return Long.MIN_VALUE; + } else { + return this.not().add(Long.ONE); + } +}; + +/** + * Returns the sum of this and the given Long. + * + * @method + * @param {Long} other Long to add to this one. + * @return {Long} the sum of this and the given Long. + */ +Long.prototype.add = function(other) { + // Divide each number into 4 chunks of 16 bits, and then sum the chunks. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 + b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 + b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 + b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 + b48; + c48 &= 0xffff; + return Long.fromBits((c16 << 16) | c00, (c48 << 16) | c32); +}; + +/** + * Returns the difference of this and the given Long. + * + * @method + * @param {Long} other Long to subtract from this. + * @return {Long} the difference of this and the given Long. + */ +Long.prototype.subtract = function(other) { + return this.add(other.negate()); +}; + +/** + * Returns the product of this and the given Long. + * + * @method + * @param {Long} other Long to multiply with this. + * @return {Long} the product of this and the other. + */ +Long.prototype.multiply = function(other) { + if (this.isZero()) { + return Long.ZERO; + } else if (other.isZero()) { + return Long.ZERO; + } + + if (this.equals(Long.MIN_VALUE)) { + return other.isOdd() ? Long.MIN_VALUE : Long.ZERO; + } else if (other.equals(Long.MIN_VALUE)) { + return this.isOdd() ? Long.MIN_VALUE : Long.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().multiply(other.negate()); + } else { + return this.negate() + .multiply(other) + .negate(); + } + } else if (other.isNegative()) { + return this.multiply(other.negate()).negate(); + } + + // If both Longs are small, use float multiplication + if (this.lessThan(Long.TWO_PWR_24_) && other.lessThan(Long.TWO_PWR_24_)) { + return Long.fromNumber(this.toNumber() * other.toNumber()); + } + + // Divide each Long into 4 chunks of 16 bits, and then add up 4x4 products. + // We can skip products that would overflow. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 * b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 * b00; + c32 += c16 >>> 16; + c16 &= 0xffff; + c16 += a00 * b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 * b00; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a16 * b16; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a00 * b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48; + c48 &= 0xffff; + return Long.fromBits((c16 << 16) | c00, (c48 << 16) | c32); +}; + +/** + * Returns this Long divided by the given one. + * + * @method + * @param {Long} other Long by which to divide. + * @return {Long} this Long divided by the given one. + */ +Long.prototype.div = function(other) { + if (other.isZero()) { + throw Error('division by zero'); + } else if (this.isZero()) { + return Long.ZERO; + } + + if (this.equals(Long.MIN_VALUE)) { + if (other.equals(Long.ONE) || other.equals(Long.NEG_ONE)) { + return Long.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE + } else if (other.equals(Long.MIN_VALUE)) { + return Long.ONE; + } else { + // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|. + var halfThis = this.shiftRight(1); + var approx = halfThis.div(other).shiftLeft(1); + if (approx.equals(Long.ZERO)) { + return other.isNegative() ? Long.ONE : Long.NEG_ONE; + } else { + var rem = this.subtract(other.multiply(approx)); + var result = approx.add(rem.div(other)); + return result; + } + } + } else if (other.equals(Long.MIN_VALUE)) { + return Long.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().div(other.negate()); + } else { + return this.negate() + .div(other) + .negate(); + } + } else if (other.isNegative()) { + return this.div(other.negate()).negate(); + } + + // Repeat the following until the remainder is less than other: find a + // floating-point that approximates remainder / other *from below*, add this + // into the result, and subtract it from the remainder. It is critical that + // the approximate value is less than or equal to the real value so that the + // remainder never becomes negative. + var res = Long.ZERO; + rem = this; + while (rem.greaterThanOrEqual(other)) { + // Approximate the result of division. This may be a little greater or + // smaller than the actual value. + approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber())); + + // We will tweak the approximate result by changing it in the 48-th digit or + // the smallest non-fractional digit, whichever is larger. + var log2 = Math.ceil(Math.log(approx) / Math.LN2); + var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48); + + // Decrease the approximation until it is smaller than the remainder. Note + // that if it is too large, the product overflows and is negative. + var approxRes = Long.fromNumber(approx); + var approxRem = approxRes.multiply(other); + while (approxRem.isNegative() || approxRem.greaterThan(rem)) { + approx -= delta; + approxRes = Long.fromNumber(approx); + approxRem = approxRes.multiply(other); + } + + // We know the answer can't be zero... and actually, zero would cause + // infinite recursion since we would make no progress. + if (approxRes.isZero()) { + approxRes = Long.ONE; + } + + res = res.add(approxRes); + rem = rem.subtract(approxRem); + } + return res; +}; + +/** + * Returns this Long modulo the given one. + * + * @method + * @param {Long} other Long by which to mod. + * @return {Long} this Long modulo the given one. + */ +Long.prototype.modulo = function(other) { + return this.subtract(this.div(other).multiply(other)); +}; + +/** + * The bitwise-NOT of this value. + * + * @method + * @return {Long} the bitwise-NOT of this value. + */ +Long.prototype.not = function() { + return Long.fromBits(~this.low_, ~this.high_); +}; + +/** + * Returns the bitwise-AND of this Long and the given one. + * + * @method + * @param {Long} other the Long with which to AND. + * @return {Long} the bitwise-AND of this and the other. + */ +Long.prototype.and = function(other) { + return Long.fromBits(this.low_ & other.low_, this.high_ & other.high_); +}; + +/** + * Returns the bitwise-OR of this Long and the given one. + * + * @method + * @param {Long} other the Long with which to OR. + * @return {Long} the bitwise-OR of this and the other. + */ +Long.prototype.or = function(other) { + return Long.fromBits(this.low_ | other.low_, this.high_ | other.high_); +}; + +/** + * Returns the bitwise-XOR of this Long and the given one. + * + * @method + * @param {Long} other the Long with which to XOR. + * @return {Long} the bitwise-XOR of this and the other. + */ +Long.prototype.xor = function(other) { + return Long.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_); +}; + +/** + * Returns this Long with bits shifted to the left by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Long} this shifted to the left by the given amount. + */ +Long.prototype.shiftLeft = function(numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var low = this.low_; + if (numBits < 32) { + var high = this.high_; + return Long.fromBits(low << numBits, (high << numBits) | (low >>> (32 - numBits))); + } else { + return Long.fromBits(0, low << (numBits - 32)); + } + } +}; + +/** + * Returns this Long with bits shifted to the right by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Long} this shifted to the right by the given amount. + */ +Long.prototype.shiftRight = function(numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Long.fromBits((low >>> numBits) | (high << (32 - numBits)), high >> numBits); + } else { + return Long.fromBits(high >> (numBits - 32), high >= 0 ? 0 : -1); + } + } +}; + +/** + * Returns this Long with bits shifted to the right by the given amount, with the new top bits matching the current sign bit. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Long} this shifted to the right by the given amount, with zeros placed into the new leading bits. + */ +Long.prototype.shiftRightUnsigned = function(numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Long.fromBits((low >>> numBits) | (high << (32 - numBits)), high >>> numBits); + } else if (numBits === 32) { + return Long.fromBits(high, 0); + } else { + return Long.fromBits(high >>> (numBits - 32), 0); + } + } +}; + +/** + * Returns a Long representing the given (32-bit) integer value. + * + * @method + * @param {number} value the 32-bit integer in question. + * @return {Long} the corresponding Long value. + */ +Long.fromInt = function(value) { + if (-128 <= value && value < 128) { + var cachedObj = Long.INT_CACHE_[value]; + if (cachedObj) { + return cachedObj; + } + } + + var obj = new Long(value | 0, value < 0 ? -1 : 0); + if (-128 <= value && value < 128) { + Long.INT_CACHE_[value] = obj; + } + return obj; +}; + +/** + * Returns a Long representing the given value, provided that it is a finite number. Otherwise, zero is returned. + * + * @method + * @param {number} value the number in question. + * @return {Long} the corresponding Long value. + */ +Long.fromNumber = function(value) { + if (isNaN(value) || !isFinite(value)) { + return Long.ZERO; + } else if (value <= -Long.TWO_PWR_63_DBL_) { + return Long.MIN_VALUE; + } else if (value + 1 >= Long.TWO_PWR_63_DBL_) { + return Long.MAX_VALUE; + } else if (value < 0) { + return Long.fromNumber(-value).negate(); + } else { + return new Long((value % Long.TWO_PWR_32_DBL_) | 0, (value / Long.TWO_PWR_32_DBL_) | 0); + } +}; + +/** + * Returns a Long representing the given value, provided that it is a finite number. Otherwise, zero is returned. + * @param {bigint} value - The number in question + * @returns {Long} The corresponding Long value + */ +Long.fromBigInt = function(value) { + return Long.fromString(value.toString(10), 10); +} + +/** + * Returns a Long representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits. + * + * @method + * @param {number} lowBits the low 32-bits. + * @param {number} highBits the high 32-bits. + * @return {Long} the corresponding Long value. + */ +Long.fromBits = function(lowBits, highBits) { + return new Long(lowBits, highBits); +}; + +/** + * Returns a Long representation of the given string, written using the given radix. + * + * @method + * @param {string} str the textual representation of the Long. + * @param {number} opt_radix the radix in which the text is written. + * @return {Long} the corresponding Long value. + */ +Long.fromString = function(str, opt_radix) { + if (str.length === 0) { + throw Error('number format error: empty string'); + } + + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (str.charAt(0) === '-') { + return Long.fromString(str.substring(1), radix).negate(); + } else if (str.indexOf('-') >= 0) { + throw Error('number format error: interior "-" character: ' + str); + } + + // Do several (8) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Long.fromNumber(Math.pow(radix, 8)); + + var result = Long.ZERO; + for (var i = 0; i < str.length; i += 8) { + var size = Math.min(8, str.length - i); + var value = parseInt(str.substring(i, i + size), radix); + if (size < 8) { + var power = Long.fromNumber(Math.pow(radix, size)); + result = result.multiply(power).add(Long.fromNumber(value)); + } else { + result = result.multiply(radixToPower); + result = result.add(Long.fromNumber(value)); + } + } + return result; +}; + +// NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the +// from* methods on which they depend. + +/** + * A cache of the Long representations of small integer values. + * @type {Object} + * @ignore + */ +Long.INT_CACHE_ = {}; + +// NOTE: the compiler should inline these constant values below and then remove +// these variables, so there should be no runtime penalty for these. + +/** + * Number used repeated below in calculations. This must appear before the + * first call to any from* function below. + * @type {number} + * @ignore + */ +Long.TWO_PWR_16_DBL_ = 1 << 16; + +/** + * @type {number} + * @ignore + */ +Long.TWO_PWR_24_DBL_ = 1 << 24; + +/** + * @type {number} + * @ignore + */ +Long.TWO_PWR_32_DBL_ = Long.TWO_PWR_16_DBL_ * Long.TWO_PWR_16_DBL_; + +/** + * @type {number} + * @ignore + */ +Long.TWO_PWR_31_DBL_ = Long.TWO_PWR_32_DBL_ / 2; + +/** + * @type {number} + * @ignore + */ +Long.TWO_PWR_48_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_16_DBL_; + +/** + * @type {number} + * @ignore + */ +Long.TWO_PWR_64_DBL_ = Long.TWO_PWR_32_DBL_ * Long.TWO_PWR_32_DBL_; + +/** + * @type {number} + * @ignore + */ +Long.TWO_PWR_63_DBL_ = Long.TWO_PWR_64_DBL_ / 2; + +/** @type {Long} */ +Long.ZERO = Long.fromInt(0); + +/** @type {Long} */ +Long.ONE = Long.fromInt(1); + +/** @type {Long} */ +Long.NEG_ONE = Long.fromInt(-1); + +/** @type {Long} */ +Long.MAX_VALUE = Long.fromBits(0xffffffff | 0, 0x7fffffff | 0); + +/** @type {Long} */ +Long.MIN_VALUE = Long.fromBits(0, 0x80000000 | 0); + +/** + * @type {Long} + * @ignore + */ +Long.TWO_PWR_24_ = Long.fromInt(1 << 24); + +/** + * Expose. + */ +module.exports = Long; +module.exports.Long = Long; diff --git a/node_modules/bson/lib/bson/map.js b/node_modules/bson/lib/bson/map.js new file mode 100644 index 00000000..7edb4f2a --- /dev/null +++ b/node_modules/bson/lib/bson/map.js @@ -0,0 +1,128 @@ +'use strict'; + +// We have an ES6 Map available, return the native instance +if (typeof global.Map !== 'undefined') { + module.exports = global.Map; + module.exports.Map = global.Map; +} else { + // We will return a polyfill + var Map = function(array) { + this._keys = []; + this._values = {}; + + for (var i = 0; i < array.length; i++) { + if (array[i] == null) continue; // skip null and undefined + var entry = array[i]; + var key = entry[0]; + var value = entry[1]; + // Add the key to the list of keys in order + this._keys.push(key); + // Add the key and value to the values dictionary with a point + // to the location in the ordered keys list + this._values[key] = { v: value, i: this._keys.length - 1 }; + } + }; + + Map.prototype.clear = function() { + this._keys = []; + this._values = {}; + }; + + Map.prototype.delete = function(key) { + var value = this._values[key]; + if (value == null) return false; + // Delete entry + delete this._values[key]; + // Remove the key from the ordered keys list + this._keys.splice(value.i, 1); + return true; + }; + + Map.prototype.entries = function() { + var self = this; + var index = 0; + + return { + next: function() { + var key = self._keys[index++]; + return { + value: key !== undefined ? [key, self._values[key].v] : undefined, + done: key !== undefined ? false : true + }; + } + }; + }; + + Map.prototype.forEach = function(callback, self) { + self = self || this; + + for (var i = 0; i < this._keys.length; i++) { + var key = this._keys[i]; + // Call the forEach callback + callback.call(self, this._values[key].v, key, self); + } + }; + + Map.prototype.get = function(key) { + return this._values[key] ? this._values[key].v : undefined; + }; + + Map.prototype.has = function(key) { + return this._values[key] != null; + }; + + Map.prototype.keys = function() { + var self = this; + var index = 0; + + return { + next: function() { + var key = self._keys[index++]; + return { + value: key !== undefined ? key : undefined, + done: key !== undefined ? false : true + }; + } + }; + }; + + Map.prototype.set = function(key, value) { + if (this._values[key]) { + this._values[key].v = value; + return this; + } + + // Add the key to the list of keys in order + this._keys.push(key); + // Add the key and value to the values dictionary with a point + // to the location in the ordered keys list + this._values[key] = { v: value, i: this._keys.length - 1 }; + return this; + }; + + Map.prototype.values = function() { + var self = this; + var index = 0; + + return { + next: function() { + var key = self._keys[index++]; + return { + value: key !== undefined ? self._values[key].v : undefined, + done: key !== undefined ? false : true + }; + } + }; + }; + + // Last ismaster + Object.defineProperty(Map.prototype, 'size', { + enumerable: true, + get: function() { + return this._keys.length; + } + }); + + module.exports = Map; + module.exports.Map = Map; +} diff --git a/node_modules/bson/lib/bson/max_key.js b/node_modules/bson/lib/bson/max_key.js new file mode 100644 index 00000000..eebca7bc --- /dev/null +++ b/node_modules/bson/lib/bson/max_key.js @@ -0,0 +1,14 @@ +/** + * A class representation of the BSON MaxKey type. + * + * @class + * @return {MaxKey} A MaxKey instance + */ +function MaxKey() { + if (!(this instanceof MaxKey)) return new MaxKey(); + + this._bsontype = 'MaxKey'; +} + +module.exports = MaxKey; +module.exports.MaxKey = MaxKey; diff --git a/node_modules/bson/lib/bson/min_key.js b/node_modules/bson/lib/bson/min_key.js new file mode 100644 index 00000000..15f45228 --- /dev/null +++ b/node_modules/bson/lib/bson/min_key.js @@ -0,0 +1,14 @@ +/** + * A class representation of the BSON MinKey type. + * + * @class + * @return {MinKey} A MinKey instance + */ +function MinKey() { + if (!(this instanceof MinKey)) return new MinKey(); + + this._bsontype = 'MinKey'; +} + +module.exports = MinKey; +module.exports.MinKey = MinKey; diff --git a/node_modules/bson/lib/bson/objectid.js b/node_modules/bson/lib/bson/objectid.js new file mode 100644 index 00000000..0ebcc034 --- /dev/null +++ b/node_modules/bson/lib/bson/objectid.js @@ -0,0 +1,392 @@ +// Custom inspect property name / symbol. +var inspect = 'inspect'; + +var utils = require('./parser/utils'); + +/** + * Machine id. + * + * Create a random 3-byte value (i.e. unique for this + * process). Other drivers use a md5 of the machine id here, but + * that would mean an asyc call to gethostname, so we don't bother. + * @ignore + */ +var MACHINE_ID = parseInt(Math.random() * 0xffffff, 10); + +// Regular expression that checks for hex value +var checkForHexRegExp = new RegExp('^[0-9a-fA-F]{24}$'); + +// Check if buffer exists +try { + if (Buffer && Buffer.from) { + var hasBufferType = true; + inspect = require('util').inspect.custom || 'inspect'; + } +} catch (err) { + hasBufferType = false; +} + +/** +* Create a new ObjectID instance +* +* @class +* @param {(string|number)} id Can be a 24 byte hex string, 12 byte binary string or a Number. +* @property {number} generationTime The generation time of this ObjectId instance +* @return {ObjectID} instance of ObjectID. +*/ +var ObjectID = function ObjectID(id) { + // Duck-typing to support ObjectId from different npm packages + if (id instanceof ObjectID) return id; + if (!(this instanceof ObjectID)) return new ObjectID(id); + + this._bsontype = 'ObjectID'; + + // The most common usecase (blank id, new objectId instance) + if (id == null || typeof id === 'number') { + // Generate a new id + this.id = this.generate(id); + // If we are caching the hex string + if (ObjectID.cacheHexString) this.__id = this.toString('hex'); + // Return the object + return; + } + + // Check if the passed in id is valid + var valid = ObjectID.isValid(id); + + // Throw an error if it's not a valid setup + if (!valid && id != null) { + throw new Error( + 'Argument passed in must be a single String of 12 bytes or a string of 24 hex characters' + ); + } else if (valid && typeof id === 'string' && id.length === 24 && hasBufferType) { + return new ObjectID(utils.toBuffer(id, 'hex')); + } else if (valid && typeof id === 'string' && id.length === 24) { + return ObjectID.createFromHexString(id); + } else if (id != null && id.length === 12) { + // assume 12 byte string + this.id = id; + } else if (id != null && typeof id.toHexString === 'function') { + // Duck-typing to support ObjectId from different npm packages + return id; + } else { + throw new Error( + 'Argument passed in must be a single String of 12 bytes or a string of 24 hex characters' + ); + } + + if (ObjectID.cacheHexString) this.__id = this.toString('hex'); +}; + +// Allow usage of ObjectId as well as ObjectID +// var ObjectId = ObjectID; + +// Precomputed hex table enables speedy hex string conversion +var hexTable = []; +for (var i = 0; i < 256; i++) { + hexTable[i] = (i <= 15 ? '0' : '') + i.toString(16); +} + +/** +* Return the ObjectID id as a 24 byte hex string representation +* +* @method +* @return {string} return the 24 byte hex string representation. +*/ +ObjectID.prototype.toHexString = function() { + if (ObjectID.cacheHexString && this.__id) return this.__id; + + var hexString = ''; + if (!this.id || !this.id.length) { + throw new Error( + 'invalid ObjectId, ObjectId.id must be either a string or a Buffer, but is [' + + JSON.stringify(this.id) + + ']' + ); + } + + if (this.id instanceof _Buffer) { + hexString = convertToHex(this.id); + if (ObjectID.cacheHexString) this.__id = hexString; + return hexString; + } + + for (var i = 0; i < this.id.length; i++) { + hexString += hexTable[this.id.charCodeAt(i)]; + } + + if (ObjectID.cacheHexString) this.__id = hexString; + return hexString; +}; + +/** +* Update the ObjectID index used in generating new ObjectID's on the driver +* +* @method +* @return {number} returns next index value. +* @ignore +*/ +ObjectID.prototype.get_inc = function() { + return (ObjectID.index = (ObjectID.index + 1) % 0xffffff); +}; + +/** +* Update the ObjectID index used in generating new ObjectID's on the driver +* +* @method +* @return {number} returns next index value. +* @ignore +*/ +ObjectID.prototype.getInc = function() { + return this.get_inc(); +}; + +/** +* Generate a 12 byte id buffer used in ObjectID's +* +* @method +* @param {number} [time] optional parameter allowing to pass in a second based timestamp. +* @return {Buffer} return the 12 byte id buffer string. +*/ +ObjectID.prototype.generate = function(time) { + if ('number' !== typeof time) { + time = ~~(Date.now() / 1000); + } + + // Use pid + var pid = + (typeof process === 'undefined' || process.pid === 1 + ? Math.floor(Math.random() * 100000) + : process.pid) % 0xffff; + var inc = this.get_inc(); + // Buffer used + var buffer = utils.allocBuffer(12); + // Encode time + buffer[3] = time & 0xff; + buffer[2] = (time >> 8) & 0xff; + buffer[1] = (time >> 16) & 0xff; + buffer[0] = (time >> 24) & 0xff; + // Encode machine + buffer[6] = MACHINE_ID & 0xff; + buffer[5] = (MACHINE_ID >> 8) & 0xff; + buffer[4] = (MACHINE_ID >> 16) & 0xff; + // Encode pid + buffer[8] = pid & 0xff; + buffer[7] = (pid >> 8) & 0xff; + // Encode index + buffer[11] = inc & 0xff; + buffer[10] = (inc >> 8) & 0xff; + buffer[9] = (inc >> 16) & 0xff; + // Return the buffer + return buffer; +}; + +/** +* Converts the id into a 24 byte hex string for printing +* +* @param {String} format The Buffer toString format parameter. +* @return {String} return the 24 byte hex string representation. +* @ignore +*/ +ObjectID.prototype.toString = function(format) { + // Is the id a buffer then use the buffer toString method to return the format + if (this.id && this.id.copy) { + return this.id.toString(typeof format === 'string' ? format : 'hex'); + } + + // if(this.buffer ) + return this.toHexString(); +}; + +/** +* Converts to a string representation of this Id. +* +* @return {String} return the 24 byte hex string representation. +* @ignore +*/ +ObjectID.prototype[inspect] = ObjectID.prototype.toString; + +/** +* Converts to its JSON representation. +* +* @return {String} return the 24 byte hex string representation. +* @ignore +*/ +ObjectID.prototype.toJSON = function() { + return this.toHexString(); +}; + +/** +* Compares the equality of this ObjectID with `otherID`. +* +* @method +* @param {object} otherID ObjectID instance to compare against. +* @return {boolean} the result of comparing two ObjectID's +*/ +ObjectID.prototype.equals = function equals(otherId) { + // var id; + + if (otherId instanceof ObjectID) { + return this.toString() === otherId.toString(); + } else if ( + typeof otherId === 'string' && + ObjectID.isValid(otherId) && + otherId.length === 12 && + this.id instanceof _Buffer + ) { + return otherId === this.id.toString('binary'); + } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 24) { + return otherId.toLowerCase() === this.toHexString(); + } else if (typeof otherId === 'string' && ObjectID.isValid(otherId) && otherId.length === 12) { + return otherId === this.id; + } else if (otherId != null && (otherId instanceof ObjectID || otherId.toHexString)) { + return otherId.toHexString() === this.toHexString(); + } else { + return false; + } +}; + +/** +* Returns the generation date (accurate up to the second) that this ID was generated. +* +* @method +* @return {date} the generation date +*/ +ObjectID.prototype.getTimestamp = function() { + var timestamp = new Date(); + var time = this.id[3] | (this.id[2] << 8) | (this.id[1] << 16) | (this.id[0] << 24); + timestamp.setTime(Math.floor(time) * 1000); + return timestamp; +}; + +/** +* @ignore +*/ +ObjectID.index = ~~(Math.random() * 0xffffff); + +/** +* @ignore +*/ +ObjectID.createPk = function createPk() { + return new ObjectID(); +}; + +/** +* Creates an ObjectID from a second based number, with the rest of the ObjectID zeroed out. Used for comparisons or sorting the ObjectID. +* +* @method +* @param {number} time an integer number representing a number of seconds. +* @return {ObjectID} return the created ObjectID +*/ +ObjectID.createFromTime = function createFromTime(time) { + var buffer = utils.toBuffer([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]); + // Encode time into first 4 bytes + buffer[3] = time & 0xff; + buffer[2] = (time >> 8) & 0xff; + buffer[1] = (time >> 16) & 0xff; + buffer[0] = (time >> 24) & 0xff; + // Return the new objectId + return new ObjectID(buffer); +}; + +// Lookup tables +//var encodeLookup = '0123456789abcdef'.split(''); +var decodeLookup = []; +i = 0; +while (i < 10) decodeLookup[0x30 + i] = i++; +while (i < 16) decodeLookup[0x41 - 10 + i] = decodeLookup[0x61 - 10 + i] = i++; + +var _Buffer = Buffer; +var convertToHex = function(bytes) { + return bytes.toString('hex'); +}; + +/** +* Creates an ObjectID from a hex string representation of an ObjectID. +* +* @method +* @param {string} hexString create a ObjectID from a passed in 24 byte hexstring. +* @return {ObjectID} return the created ObjectID +*/ +ObjectID.createFromHexString = function createFromHexString(string) { + // Throw an error if it's not a valid setup + if (typeof string === 'undefined' || (string != null && string.length !== 24)) { + throw new Error( + 'Argument passed in must be a single String of 12 bytes or a string of 24 hex characters' + ); + } + + // Use Buffer.from method if available + if (hasBufferType) return new ObjectID(utils.toBuffer(string, 'hex')); + + // Calculate lengths + var array = new _Buffer(12); + var n = 0; + var i = 0; + + while (i < 24) { + array[n++] = (decodeLookup[string.charCodeAt(i++)] << 4) | decodeLookup[string.charCodeAt(i++)]; + } + + return new ObjectID(array); +}; + +/** +* Checks if a value is a valid bson ObjectId +* +* @method +* @return {boolean} return true if the value is a valid bson ObjectId, return false otherwise. +*/ +ObjectID.isValid = function isValid(id) { + if (id == null) return false; + + if (typeof id === 'number') { + return true; + } + + if (typeof id === 'string') { + return id.length === 12 || (id.length === 24 && checkForHexRegExp.test(id)); + } + + if (id instanceof ObjectID) { + return true; + } + + if (id instanceof _Buffer) { + return true; + } + + // Duck-Typing detection of ObjectId like objects + if ( + typeof id.toHexString === 'function' && + (id.id instanceof _Buffer || typeof id.id === 'string') + ) { + return id.id.length === 12 || (id.id.length === 24 && checkForHexRegExp.test(id.id)); + } + + return false; +}; + +/** +* @ignore +*/ +Object.defineProperty(ObjectID.prototype, 'generationTime', { + enumerable: true, + get: function() { + return this.id[3] | (this.id[2] << 8) | (this.id[1] << 16) | (this.id[0] << 24); + }, + set: function(value) { + // Encode time into first 4 bytes + this.id[3] = value & 0xff; + this.id[2] = (value >> 8) & 0xff; + this.id[1] = (value >> 16) & 0xff; + this.id[0] = (value >> 24) & 0xff; + } +}); + +/** + * Expose. + */ +module.exports = ObjectID; +module.exports.ObjectID = ObjectID; +module.exports.ObjectId = ObjectID; diff --git a/node_modules/bson/lib/bson/parser/calculate_size.js b/node_modules/bson/lib/bson/parser/calculate_size.js new file mode 100644 index 00000000..7e0026ca --- /dev/null +++ b/node_modules/bson/lib/bson/parser/calculate_size.js @@ -0,0 +1,255 @@ +'use strict'; + +var Long = require('../long').Long, + Double = require('../double').Double, + Timestamp = require('../timestamp').Timestamp, + ObjectID = require('../objectid').ObjectID, + Symbol = require('../symbol').Symbol, + BSONRegExp = require('../regexp').BSONRegExp, + Code = require('../code').Code, + Decimal128 = require('../decimal128'), + MinKey = require('../min_key').MinKey, + MaxKey = require('../max_key').MaxKey, + DBRef = require('../db_ref').DBRef, + Binary = require('../binary').Binary; + +var normalizedFunctionString = require('./utils').normalizedFunctionString; + +// To ensure that 0.4 of node works correctly +var isDate = function isDate(d) { + return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]'; +}; + +var calculateObjectSize = function calculateObjectSize( + object, + serializeFunctions, + ignoreUndefined +) { + var totalLength = 4 + 1; + + if (Array.isArray(object)) { + for (var i = 0; i < object.length; i++) { + totalLength += calculateElement( + i.toString(), + object[i], + serializeFunctions, + true, + ignoreUndefined + ); + } + } else { + // If we have toBSON defined, override the current object + if (object.toBSON) { + object = object.toBSON(); + } + + // Calculate size + for (var key in object) { + totalLength += calculateElement(key, object[key], serializeFunctions, false, ignoreUndefined); + } + } + + return totalLength; +}; + +/** + * @ignore + * @api private + */ +function calculateElement(name, value, serializeFunctions, isArray, ignoreUndefined) { + // If we have toBSON defined, override the current object + if (value && value.toBSON) { + value = value.toBSON(); + } + + switch (typeof value) { + case 'string': + return 1 + Buffer.byteLength(name, 'utf8') + 1 + 4 + Buffer.byteLength(value, 'utf8') + 1; + case 'number': + if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) { + if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) { + // 32 bit + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (4 + 1); + } else { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } + } else { + // 64 bit + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } + case 'undefined': + if (isArray || !ignoreUndefined) + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1; + return 0; + case 'boolean': + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 1); + case 'object': + if ( + value == null || + value instanceof MinKey || + value instanceof MaxKey || + value['_bsontype'] === 'MinKey' || + value['_bsontype'] === 'MaxKey' + ) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + 1; + } else if (value instanceof ObjectID || value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (12 + 1); + } else if (value instanceof Date || isDate(value)) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } else if (typeof Buffer !== 'undefined' && Buffer.isBuffer(value)) { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (1 + 4 + 1) + value.length + ); + } else if ( + value instanceof Long || + value instanceof Double || + value instanceof Timestamp || + value['_bsontype'] === 'Long' || + value['_bsontype'] === 'Double' || + value['_bsontype'] === 'Timestamp' + ) { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (8 + 1); + } else if (value instanceof Decimal128 || value['_bsontype'] === 'Decimal128') { + return (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (16 + 1); + } else if (value instanceof Code || value['_bsontype'] === 'Code') { + // Calculate size depending on the availability of a scope + if (value.scope != null && Object.keys(value.scope).length > 0) { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + 4 + + 4 + + Buffer.byteLength(value.code.toString(), 'utf8') + + 1 + + calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined) + ); + } else { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + 4 + + Buffer.byteLength(value.code.toString(), 'utf8') + + 1 + ); + } + } else if (value instanceof Binary || value['_bsontype'] === 'Binary') { + // Check what kind of subtype we have + if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + (value.position + 1 + 4 + 1 + 4) + ); + } else { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + (value.position + 1 + 4 + 1) + ); + } + } else if (value instanceof Symbol || value['_bsontype'] === 'Symbol') { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + Buffer.byteLength(value.value, 'utf8') + + 4 + + 1 + + 1 + ); + } else if (value instanceof DBRef || value['_bsontype'] === 'DBRef') { + // Set up correct object for serialization + var ordered_values = { + $ref: value.namespace, + $id: value.oid + }; + + // Add db reference if it exists + if (null != value.db) { + ordered_values['$db'] = value.db; + } + + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + calculateObjectSize(ordered_values, serializeFunctions, ignoreUndefined) + ); + } else if ( + value instanceof RegExp || + Object.prototype.toString.call(value) === '[object RegExp]' + ) { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + Buffer.byteLength(value.source, 'utf8') + + 1 + + (value.global ? 1 : 0) + + (value.ignoreCase ? 1 : 0) + + (value.multiline ? 1 : 0) + + 1 + ); + } else if (value instanceof BSONRegExp || value['_bsontype'] === 'BSONRegExp') { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + Buffer.byteLength(value.pattern, 'utf8') + + 1 + + Buffer.byteLength(value.options, 'utf8') + + 1 + ); + } else { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + calculateObjectSize(value, serializeFunctions, ignoreUndefined) + + 1 + ); + } + case 'function': + // WTF for 0.4.X where typeof /someregexp/ === 'function' + if ( + value instanceof RegExp || + Object.prototype.toString.call(value) === '[object RegExp]' || + String.call(value) === '[object RegExp]' + ) { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + Buffer.byteLength(value.source, 'utf8') + + 1 + + (value.global ? 1 : 0) + + (value.ignoreCase ? 1 : 0) + + (value.multiline ? 1 : 0) + + 1 + ); + } else { + if (serializeFunctions && value.scope != null && Object.keys(value.scope).length > 0) { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + 4 + + 4 + + Buffer.byteLength(normalizedFunctionString(value), 'utf8') + + 1 + + calculateObjectSize(value.scope, serializeFunctions, ignoreUndefined) + ); + } else if (serializeFunctions) { + return ( + (name != null ? Buffer.byteLength(name, 'utf8') + 1 : 0) + + 1 + + 4 + + Buffer.byteLength(normalizedFunctionString(value), 'utf8') + + 1 + ); + } + } + } + + return 0; +} + +var BSON = {}; + +// BSON MAX VALUES +BSON.BSON_INT32_MAX = 0x7fffffff; +BSON.BSON_INT32_MIN = -0x80000000; + +// JS MAX PRECISE VALUES +BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. +BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + +module.exports = calculateObjectSize; diff --git a/node_modules/bson/lib/bson/parser/deserializer.js b/node_modules/bson/lib/bson/parser/deserializer.js new file mode 100644 index 00000000..be3c8654 --- /dev/null +++ b/node_modules/bson/lib/bson/parser/deserializer.js @@ -0,0 +1,782 @@ +'use strict'; + +var Long = require('../long').Long, + Double = require('../double').Double, + Timestamp = require('../timestamp').Timestamp, + ObjectID = require('../objectid').ObjectID, + Symbol = require('../symbol').Symbol, + Code = require('../code').Code, + MinKey = require('../min_key').MinKey, + MaxKey = require('../max_key').MaxKey, + Decimal128 = require('../decimal128'), + Int32 = require('../int_32'), + DBRef = require('../db_ref').DBRef, + BSONRegExp = require('../regexp').BSONRegExp, + Binary = require('../binary').Binary; + +var utils = require('./utils'); + +var deserialize = function(buffer, options, isArray) { + options = options == null ? {} : options; + var index = options && options.index ? options.index : 0; + // Read the document size + var size = + buffer[index] | + (buffer[index + 1] << 8) | + (buffer[index + 2] << 16) | + (buffer[index + 3] << 24); + + // Ensure buffer is valid size + if (size < 5 || buffer.length < size || size + index > buffer.length) { + throw new Error('corrupt bson message'); + } + + // Illegal end value + if (buffer[index + size - 1] !== 0) { + throw new Error("One object, sized correctly, with a spot for an EOO, but the EOO isn't 0x00"); + } + + // Start deserializtion + return deserializeObject(buffer, index, options, isArray); +}; + +var deserializeObject = function(buffer, index, options, isArray) { + var evalFunctions = options['evalFunctions'] == null ? false : options['evalFunctions']; + var cacheFunctions = options['cacheFunctions'] == null ? false : options['cacheFunctions']; + var cacheFunctionsCrc32 = + options['cacheFunctionsCrc32'] == null ? false : options['cacheFunctionsCrc32']; + + if (!cacheFunctionsCrc32) var crc32 = null; + + var fieldsAsRaw = options['fieldsAsRaw'] == null ? null : options['fieldsAsRaw']; + + // Return raw bson buffer instead of parsing it + var raw = options['raw'] == null ? false : options['raw']; + + // Return BSONRegExp objects instead of native regular expressions + var bsonRegExp = typeof options['bsonRegExp'] === 'boolean' ? options['bsonRegExp'] : false; + + // Controls the promotion of values vs wrapper classes + var promoteBuffers = options['promoteBuffers'] == null ? false : options['promoteBuffers']; + var promoteLongs = options['promoteLongs'] == null ? true : options['promoteLongs']; + var promoteValues = options['promoteValues'] == null ? true : options['promoteValues']; + + // Set the start index + var startIndex = index; + + // Validate that we have at least 4 bytes of buffer + if (buffer.length < 5) throw new Error('corrupt bson message < 5 bytes long'); + + // Read the document size + var size = + buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24); + + // Ensure buffer is valid size + if (size < 5 || size > buffer.length) throw new Error('corrupt bson message'); + + // Create holding object + var object = isArray ? [] : {}; + // Used for arrays to skip having to perform utf8 decoding + var arrayIndex = 0; + + var done = false; + + // While we have more left data left keep parsing + // while (buffer[index + 1] !== 0) { + while (!done) { + // Read the type + var elementType = buffer[index++]; + // If we get a zero it's the last byte, exit + if (elementType === 0) break; + + // Get the start search index + var i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + var name = isArray ? arrayIndex++ : buffer.toString('utf8', index, i); + + index = i + 1; + + if (elementType === BSON.BSON_DATA_STRING) { + var stringSize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + if ( + stringSize <= 0 || + stringSize > buffer.length - index || + buffer[index + stringSize - 1] !== 0 + ) + throw new Error('bad string length in bson'); + object[name] = buffer.toString('utf8', index, index + stringSize - 1); + index = index + stringSize; + } else if (elementType === BSON.BSON_DATA_OID) { + var oid = utils.allocBuffer(12); + buffer.copy(oid, 0, index, index + 12); + object[name] = new ObjectID(oid); + index = index + 12; + } else if (elementType === BSON.BSON_DATA_INT && promoteValues === false) { + object[name] = new Int32( + buffer[index++] | (buffer[index++] << 8) | (buffer[index++] << 16) | (buffer[index++] << 24) + ); + } else if (elementType === BSON.BSON_DATA_INT) { + object[name] = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + } else if (elementType === BSON.BSON_DATA_NUMBER && promoteValues === false) { + object[name] = new Double(buffer.readDoubleLE(index)); + index = index + 8; + } else if (elementType === BSON.BSON_DATA_NUMBER) { + object[name] = buffer.readDoubleLE(index); + index = index + 8; + } else if (elementType === BSON.BSON_DATA_DATE) { + var lowBits = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + var highBits = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + object[name] = new Date(new Long(lowBits, highBits).toNumber()); + } else if (elementType === BSON.BSON_DATA_BOOLEAN) { + if (buffer[index] !== 0 && buffer[index] !== 1) throw new Error('illegal boolean type value'); + object[name] = buffer[index++] === 1; + } else if (elementType === BSON.BSON_DATA_OBJECT) { + var _index = index; + var objectSize = + buffer[index] | + (buffer[index + 1] << 8) | + (buffer[index + 2] << 16) | + (buffer[index + 3] << 24); + if (objectSize <= 0 || objectSize > buffer.length - index) + throw new Error('bad embedded document length in bson'); + + // We have a raw value + if (raw) { + object[name] = buffer.slice(index, index + objectSize); + } else { + object[name] = deserializeObject(buffer, _index, options, false); + } + + index = index + objectSize; + } else if (elementType === BSON.BSON_DATA_ARRAY) { + _index = index; + objectSize = + buffer[index] | + (buffer[index + 1] << 8) | + (buffer[index + 2] << 16) | + (buffer[index + 3] << 24); + var arrayOptions = options; + + // Stop index + var stopIndex = index + objectSize; + + // All elements of array to be returned as raw bson + if (fieldsAsRaw && fieldsAsRaw[name]) { + arrayOptions = {}; + for (var n in options) arrayOptions[n] = options[n]; + arrayOptions['raw'] = true; + } + + object[name] = deserializeObject(buffer, _index, arrayOptions, true); + index = index + objectSize; + + if (buffer[index - 1] !== 0) throw new Error('invalid array terminator byte'); + if (index !== stopIndex) throw new Error('corrupted array bson'); + } else if (elementType === BSON.BSON_DATA_UNDEFINED) { + object[name] = undefined; + } else if (elementType === BSON.BSON_DATA_NULL) { + object[name] = null; + } else if (elementType === BSON.BSON_DATA_LONG) { + // Unpack the low and high bits + lowBits = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + highBits = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + var long = new Long(lowBits, highBits); + // Promote the long if possible + if (promoteLongs && promoteValues === true) { + object[name] = + long.lessThanOrEqual(JS_INT_MAX_LONG) && long.greaterThanOrEqual(JS_INT_MIN_LONG) + ? long.toNumber() + : long; + } else { + object[name] = long; + } + } else if (elementType === BSON.BSON_DATA_DECIMAL128) { + // Buffer to contain the decimal bytes + var bytes = utils.allocBuffer(16); + // Copy the next 16 bytes into the bytes buffer + buffer.copy(bytes, 0, index, index + 16); + // Update index + index = index + 16; + // Assign the new Decimal128 value + var decimal128 = new Decimal128(bytes); + // If we have an alternative mapper use that + object[name] = decimal128.toObject ? decimal128.toObject() : decimal128; + } else if (elementType === BSON.BSON_DATA_BINARY) { + var binarySize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + var totalBinarySize = binarySize; + var subType = buffer[index++]; + + // Did we have a negative binary size, throw + if (binarySize < 0) throw new Error('Negative binary type element size found'); + + // Is the length longer than the document + if (binarySize > buffer.length) throw new Error('Binary type size larger than document size'); + + // Decode as raw Buffer object if options specifies it + if (buffer['slice'] != null) { + // If we have subtype 2 skip the 4 bytes for the size + if (subType === Binary.SUBTYPE_BYTE_ARRAY) { + binarySize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + if (binarySize < 0) + throw new Error('Negative binary type element size found for subtype 0x02'); + if (binarySize > totalBinarySize - 4) + throw new Error('Binary type with subtype 0x02 contains to long binary size'); + if (binarySize < totalBinarySize - 4) + throw new Error('Binary type with subtype 0x02 contains to short binary size'); + } + + if (promoteBuffers && promoteValues) { + object[name] = buffer.slice(index, index + binarySize); + } else { + object[name] = new Binary(buffer.slice(index, index + binarySize), subType); + } + } else { + var _buffer = + typeof Uint8Array !== 'undefined' + ? new Uint8Array(new ArrayBuffer(binarySize)) + : new Array(binarySize); + // If we have subtype 2 skip the 4 bytes for the size + if (subType === Binary.SUBTYPE_BYTE_ARRAY) { + binarySize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + if (binarySize < 0) + throw new Error('Negative binary type element size found for subtype 0x02'); + if (binarySize > totalBinarySize - 4) + throw new Error('Binary type with subtype 0x02 contains to long binary size'); + if (binarySize < totalBinarySize - 4) + throw new Error('Binary type with subtype 0x02 contains to short binary size'); + } + + // Copy the data + for (i = 0; i < binarySize; i++) { + _buffer[i] = buffer[index + i]; + } + + if (promoteBuffers && promoteValues) { + object[name] = _buffer; + } else { + object[name] = new Binary(_buffer, subType); + } + } + + // Update the index + index = index + binarySize; + } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === false) { + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + var source = buffer.toString('utf8', index, i); + // Create the regexp + index = i + 1; + + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + var regExpOptions = buffer.toString('utf8', index, i); + index = i + 1; + + // For each option add the corresponding one for javascript + var optionsArray = new Array(regExpOptions.length); + + // Parse options + for (i = 0; i < regExpOptions.length; i++) { + switch (regExpOptions[i]) { + case 'm': + optionsArray[i] = 'm'; + break; + case 's': + optionsArray[i] = 'g'; + break; + case 'i': + optionsArray[i] = 'i'; + break; + } + } + + object[name] = new RegExp(source, optionsArray.join('')); + } else if (elementType === BSON.BSON_DATA_REGEXP && bsonRegExp === true) { + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + source = buffer.toString('utf8', index, i); + index = i + 1; + + // Get the start search index + i = index; + // Locate the end of the c string + while (buffer[i] !== 0x00 && i < buffer.length) { + i++; + } + // If are at the end of the buffer there is a problem with the document + if (i >= buffer.length) throw new Error('Bad BSON Document: illegal CString'); + // Return the C string + regExpOptions = buffer.toString('utf8', index, i); + index = i + 1; + + // Set the object + object[name] = new BSONRegExp(source, regExpOptions); + } else if (elementType === BSON.BSON_DATA_SYMBOL) { + stringSize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + if ( + stringSize <= 0 || + stringSize > buffer.length - index || + buffer[index + stringSize - 1] !== 0 + ) + throw new Error('bad string length in bson'); + object[name] = new Symbol(buffer.toString('utf8', index, index + stringSize - 1)); + index = index + stringSize; + } else if (elementType === BSON.BSON_DATA_TIMESTAMP) { + lowBits = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + highBits = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + object[name] = new Timestamp(lowBits, highBits); + } else if (elementType === BSON.BSON_DATA_MIN_KEY) { + object[name] = new MinKey(); + } else if (elementType === BSON.BSON_DATA_MAX_KEY) { + object[name] = new MaxKey(); + } else if (elementType === BSON.BSON_DATA_CODE) { + stringSize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + if ( + stringSize <= 0 || + stringSize > buffer.length - index || + buffer[index + stringSize - 1] !== 0 + ) + throw new Error('bad string length in bson'); + var functionString = buffer.toString('utf8', index, index + stringSize - 1); + + // If we are evaluating the functions + if (evalFunctions) { + // If we have cache enabled let's look for the md5 of the function in the cache + if (cacheFunctions) { + var hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString; + // Got to do this to avoid V8 deoptimizing the call due to finding eval + object[name] = isolateEvalWithHash(functionCache, hash, functionString, object); + } else { + object[name] = isolateEval(functionString); + } + } else { + object[name] = new Code(functionString); + } + + // Update parse index position + index = index + stringSize; + } else if (elementType === BSON.BSON_DATA_CODE_W_SCOPE) { + var totalSize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + + // Element cannot be shorter than totalSize + stringSize + documentSize + terminator + if (totalSize < 4 + 4 + 4 + 1) { + throw new Error('code_w_scope total size shorter minimum expected length'); + } + + // Get the code string size + stringSize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + // Check if we have a valid string + if ( + stringSize <= 0 || + stringSize > buffer.length - index || + buffer[index + stringSize - 1] !== 0 + ) + throw new Error('bad string length in bson'); + + // Javascript function + functionString = buffer.toString('utf8', index, index + stringSize - 1); + // Update parse index position + index = index + stringSize; + // Parse the element + _index = index; + // Decode the size of the object document + objectSize = + buffer[index] | + (buffer[index + 1] << 8) | + (buffer[index + 2] << 16) | + (buffer[index + 3] << 24); + // Decode the scope object + var scopeObject = deserializeObject(buffer, _index, options, false); + // Adjust the index + index = index + objectSize; + + // Check if field length is to short + if (totalSize < 4 + 4 + objectSize + stringSize) { + throw new Error('code_w_scope total size is to short, truncating scope'); + } + + // Check if totalSize field is to long + if (totalSize > 4 + 4 + objectSize + stringSize) { + throw new Error('code_w_scope total size is to long, clips outer document'); + } + + // If we are evaluating the functions + if (evalFunctions) { + // If we have cache enabled let's look for the md5 of the function in the cache + if (cacheFunctions) { + hash = cacheFunctionsCrc32 ? crc32(functionString) : functionString; + // Got to do this to avoid V8 deoptimizing the call due to finding eval + object[name] = isolateEvalWithHash(functionCache, hash, functionString, object); + } else { + object[name] = isolateEval(functionString); + } + + object[name].scope = scopeObject; + } else { + object[name] = new Code(functionString, scopeObject); + } + } else if (elementType === BSON.BSON_DATA_DBPOINTER) { + // Get the code string size + stringSize = + buffer[index++] | + (buffer[index++] << 8) | + (buffer[index++] << 16) | + (buffer[index++] << 24); + // Check if we have a valid string + if ( + stringSize <= 0 || + stringSize > buffer.length - index || + buffer[index + stringSize - 1] !== 0 + ) + throw new Error('bad string length in bson'); + // Namespace + var namespace = buffer.toString('utf8', index, index + stringSize - 1); + // Update parse index position + index = index + stringSize; + + // Read the oid + var oidBuffer = utils.allocBuffer(12); + buffer.copy(oidBuffer, 0, index, index + 12); + oid = new ObjectID(oidBuffer); + + // Update the index + index = index + 12; + + // Split the namespace + var parts = namespace.split('.'); + var db = parts.shift(); + var collection = parts.join('.'); + // Upgrade to DBRef type + object[name] = new DBRef(collection, oid, db); + } else { + throw new Error( + 'Detected unknown BSON type ' + + elementType.toString(16) + + ' for fieldname "' + + name + + '", are you using the latest BSON parser' + ); + } + } + + // Check if the deserialization was against a valid array/object + if (size !== index - startIndex) { + if (isArray) throw new Error('corrupt array bson'); + throw new Error('corrupt object bson'); + } + + // Check if we have a db ref object + if (object['$id'] != null) object = new DBRef(object['$ref'], object['$id'], object['$db']); + return object; +}; + +/** + * Ensure eval is isolated. + * + * @ignore + * @api private + */ +var isolateEvalWithHash = function(functionCache, hash, functionString, object) { + // Contains the value we are going to set + var value = null; + + // Check for cache hit, eval if missing and return cached function + if (functionCache[hash] == null) { + eval('value = ' + functionString); + functionCache[hash] = value; + } + // Set the object + return functionCache[hash].bind(object); +}; + +/** + * Ensure eval is isolated. + * + * @ignore + * @api private + */ +var isolateEval = function(functionString) { + // Contains the value we are going to set + var value = null; + // Eval the function + eval('value = ' + functionString); + return value; +}; + +var BSON = {}; + +/** + * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5 + * + * @ignore + * @api private + */ +var functionCache = (BSON.functionCache = {}); + +/** + * Number BSON Type + * + * @classconstant BSON_DATA_NUMBER + **/ +BSON.BSON_DATA_NUMBER = 1; +/** + * String BSON Type + * + * @classconstant BSON_DATA_STRING + **/ +BSON.BSON_DATA_STRING = 2; +/** + * Object BSON Type + * + * @classconstant BSON_DATA_OBJECT + **/ +BSON.BSON_DATA_OBJECT = 3; +/** + * Array BSON Type + * + * @classconstant BSON_DATA_ARRAY + **/ +BSON.BSON_DATA_ARRAY = 4; +/** + * Binary BSON Type + * + * @classconstant BSON_DATA_BINARY + **/ +BSON.BSON_DATA_BINARY = 5; +/** + * Binary BSON Type + * + * @classconstant BSON_DATA_UNDEFINED + **/ +BSON.BSON_DATA_UNDEFINED = 6; +/** + * ObjectID BSON Type + * + * @classconstant BSON_DATA_OID + **/ +BSON.BSON_DATA_OID = 7; +/** + * Boolean BSON Type + * + * @classconstant BSON_DATA_BOOLEAN + **/ +BSON.BSON_DATA_BOOLEAN = 8; +/** + * Date BSON Type + * + * @classconstant BSON_DATA_DATE + **/ +BSON.BSON_DATA_DATE = 9; +/** + * null BSON Type + * + * @classconstant BSON_DATA_NULL + **/ +BSON.BSON_DATA_NULL = 10; +/** + * RegExp BSON Type + * + * @classconstant BSON_DATA_REGEXP + **/ +BSON.BSON_DATA_REGEXP = 11; +/** + * Code BSON Type + * + * @classconstant BSON_DATA_DBPOINTER + **/ +BSON.BSON_DATA_DBPOINTER = 12; +/** + * Code BSON Type + * + * @classconstant BSON_DATA_CODE + **/ +BSON.BSON_DATA_CODE = 13; +/** + * Symbol BSON Type + * + * @classconstant BSON_DATA_SYMBOL + **/ +BSON.BSON_DATA_SYMBOL = 14; +/** + * Code with Scope BSON Type + * + * @classconstant BSON_DATA_CODE_W_SCOPE + **/ +BSON.BSON_DATA_CODE_W_SCOPE = 15; +/** + * 32 bit Integer BSON Type + * + * @classconstant BSON_DATA_INT + **/ +BSON.BSON_DATA_INT = 16; +/** + * Timestamp BSON Type + * + * @classconstant BSON_DATA_TIMESTAMP + **/ +BSON.BSON_DATA_TIMESTAMP = 17; +/** + * Long BSON Type + * + * @classconstant BSON_DATA_LONG + **/ +BSON.BSON_DATA_LONG = 18; +/** + * Long BSON Type + * + * @classconstant BSON_DATA_DECIMAL128 + **/ +BSON.BSON_DATA_DECIMAL128 = 19; +/** + * MinKey BSON Type + * + * @classconstant BSON_DATA_MIN_KEY + **/ +BSON.BSON_DATA_MIN_KEY = 0xff; +/** + * MaxKey BSON Type + * + * @classconstant BSON_DATA_MAX_KEY + **/ +BSON.BSON_DATA_MAX_KEY = 0x7f; + +/** + * Binary Default Type + * + * @classconstant BSON_BINARY_SUBTYPE_DEFAULT + **/ +BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0; +/** + * Binary Function Type + * + * @classconstant BSON_BINARY_SUBTYPE_FUNCTION + **/ +BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1; +/** + * Binary Byte Array Type + * + * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY + **/ +BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2; +/** + * Binary UUID Type + * + * @classconstant BSON_BINARY_SUBTYPE_UUID + **/ +BSON.BSON_BINARY_SUBTYPE_UUID = 3; +/** + * Binary MD5 Type + * + * @classconstant BSON_BINARY_SUBTYPE_MD5 + **/ +BSON.BSON_BINARY_SUBTYPE_MD5 = 4; +/** + * Binary User Defined Type + * + * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED + **/ +BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128; + +// BSON MAX VALUES +BSON.BSON_INT32_MAX = 0x7fffffff; +BSON.BSON_INT32_MIN = -0x80000000; + +BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; +BSON.BSON_INT64_MIN = -Math.pow(2, 63); + +// JS MAX PRECISE VALUES +BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. +BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + +// Internal long versions +var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double. +var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double. + +module.exports = deserialize; diff --git a/node_modules/bson/lib/bson/parser/serializer.js b/node_modules/bson/lib/bson/parser/serializer.js new file mode 100644 index 00000000..fab9b6f3 --- /dev/null +++ b/node_modules/bson/lib/bson/parser/serializer.js @@ -0,0 +1,1194 @@ +'use strict'; + +var writeIEEE754 = require('../float_parser').writeIEEE754, + Long = require('../long').Long, + Map = require('../map'), + Binary = require('../binary').Binary; + +var normalizedFunctionString = require('./utils').normalizedFunctionString; + +// try { +// var _Buffer = Uint8Array; +// } catch (e) { +// _Buffer = Buffer; +// } + +var regexp = /\x00/; // eslint-disable-line no-control-regex +var ignoreKeys = ['$db', '$ref', '$id', '$clusterTime']; + +// To ensure that 0.4 of node works correctly +var isDate = function isDate(d) { + return typeof d === 'object' && Object.prototype.toString.call(d) === '[object Date]'; +}; + +var isRegExp = function isRegExp(d) { + return Object.prototype.toString.call(d) === '[object RegExp]'; +}; + +var serializeString = function(buffer, key, value, index, isArray) { + // Encode String type + buffer[index++] = BSON.BSON_DATA_STRING; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes + 1; + buffer[index - 1] = 0; + // Write the string + var size = buffer.write(value, index + 4, 'utf8'); + // Write the size of the string to buffer + buffer[index + 3] = ((size + 1) >> 24) & 0xff; + buffer[index + 2] = ((size + 1) >> 16) & 0xff; + buffer[index + 1] = ((size + 1) >> 8) & 0xff; + buffer[index] = (size + 1) & 0xff; + // Update index + index = index + 4 + size; + // Write zero + buffer[index++] = 0; + return index; +}; + +var serializeNumber = function(buffer, key, value, index, isArray) { + // We have an integer value + if (Math.floor(value) === value && value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) { + // If the value fits in 32 bits encode as int, if it fits in a double + // encode it as a double, otherwise long + if (value >= BSON.BSON_INT32_MIN && value <= BSON.BSON_INT32_MAX) { + // Set int type 32 bits or less + buffer[index++] = BSON.BSON_DATA_INT; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the int value + buffer[index++] = value & 0xff; + buffer[index++] = (value >> 8) & 0xff; + buffer[index++] = (value >> 16) & 0xff; + buffer[index++] = (value >> 24) & 0xff; + } else if (value >= BSON.JS_INT_MIN && value <= BSON.JS_INT_MAX) { + // Encode as double + buffer[index++] = BSON.BSON_DATA_NUMBER; + // Number of written bytes + numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write float + writeIEEE754(buffer, value, index, 'little', 52, 8); + // Ajust index + index = index + 8; + } else { + // Set long type + buffer[index++] = BSON.BSON_DATA_LONG; + // Number of written bytes + numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + var longVal = Long.fromNumber(value); + var lowBits = longVal.getLowBits(); + var highBits = longVal.getHighBits(); + // Encode low bits + buffer[index++] = lowBits & 0xff; + buffer[index++] = (lowBits >> 8) & 0xff; + buffer[index++] = (lowBits >> 16) & 0xff; + buffer[index++] = (lowBits >> 24) & 0xff; + // Encode high bits + buffer[index++] = highBits & 0xff; + buffer[index++] = (highBits >> 8) & 0xff; + buffer[index++] = (highBits >> 16) & 0xff; + buffer[index++] = (highBits >> 24) & 0xff; + } + } else { + // Encode as double + buffer[index++] = BSON.BSON_DATA_NUMBER; + // Number of written bytes + numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write float + writeIEEE754(buffer, value, index, 'little', 52, 8); + // Ajust index + index = index + 8; + } + + return index; +}; + +var serializeNull = function(buffer, key, value, index, isArray) { + // Set long type + buffer[index++] = BSON.BSON_DATA_NULL; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + return index; +}; + +var serializeBoolean = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_BOOLEAN; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Encode the boolean value + buffer[index++] = value ? 1 : 0; + return index; +}; + +var serializeDate = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_DATE; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Write the date + var dateInMilis = Long.fromNumber(value.getTime()); + var lowBits = dateInMilis.getLowBits(); + var highBits = dateInMilis.getHighBits(); + // Encode low bits + buffer[index++] = lowBits & 0xff; + buffer[index++] = (lowBits >> 8) & 0xff; + buffer[index++] = (lowBits >> 16) & 0xff; + buffer[index++] = (lowBits >> 24) & 0xff; + // Encode high bits + buffer[index++] = highBits & 0xff; + buffer[index++] = (highBits >> 8) & 0xff; + buffer[index++] = (highBits >> 16) & 0xff; + buffer[index++] = (highBits >> 24) & 0xff; + return index; +}; + +var serializeRegExp = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_REGEXP; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + if (value.source && value.source.match(regexp) != null) { + throw Error('value ' + value.source + ' must not contain null bytes'); + } + // Adjust the index + index = index + buffer.write(value.source, index, 'utf8'); + // Write zero + buffer[index++] = 0x00; + // Write the parameters + if (value.global) buffer[index++] = 0x73; // s + if (value.ignoreCase) buffer[index++] = 0x69; // i + if (value.multiline) buffer[index++] = 0x6d; // m + // Add ending zero + buffer[index++] = 0x00; + return index; +}; + +var serializeBSONRegExp = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_REGEXP; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Check the pattern for 0 bytes + if (value.pattern.match(regexp) != null) { + // The BSON spec doesn't allow keys with null bytes because keys are + // null-terminated. + throw Error('pattern ' + value.pattern + ' must not contain null bytes'); + } + + // Adjust the index + index = index + buffer.write(value.pattern, index, 'utf8'); + // Write zero + buffer[index++] = 0x00; + // Write the options + index = + index + + buffer.write( + value.options + .split('') + .sort() + .join(''), + index, + 'utf8' + ); + // Add ending zero + buffer[index++] = 0x00; + return index; +}; + +var serializeMinMax = function(buffer, key, value, index, isArray) { + // Write the type of either min or max key + if (value === null) { + buffer[index++] = BSON.BSON_DATA_NULL; + } else if (value._bsontype === 'MinKey') { + buffer[index++] = BSON.BSON_DATA_MIN_KEY; + } else { + buffer[index++] = BSON.BSON_DATA_MAX_KEY; + } + + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + return index; +}; + +var serializeObjectId = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_OID; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Write the objectId into the shared buffer + if (typeof value.id === 'string') { + buffer.write(value.id, index, 'binary'); + } else if (value.id && value.id.copy) { + value.id.copy(buffer, index, 0, 12); + } else { + throw new Error('object [' + JSON.stringify(value) + '] is not a valid ObjectId'); + } + + // Ajust index + return index + 12; +}; + +var serializeBuffer = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_BINARY; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Get size of the buffer (current write point) + var size = value.length; + // Write the size of the string to buffer + buffer[index++] = size & 0xff; + buffer[index++] = (size >> 8) & 0xff; + buffer[index++] = (size >> 16) & 0xff; + buffer[index++] = (size >> 24) & 0xff; + // Write the default subtype + buffer[index++] = BSON.BSON_BINARY_SUBTYPE_DEFAULT; + // Copy the content form the binary field to the buffer + value.copy(buffer, index, 0, size); + // Adjust the index + index = index + size; + return index; +}; + +var serializeObject = function( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined, + isArray, + path +) { + for (var i = 0; i < path.length; i++) { + if (path[i] === value) throw new Error('cyclic dependency detected'); + } + + // Push value to stack + path.push(value); + // Write the type + buffer[index++] = Array.isArray(value) ? BSON.BSON_DATA_ARRAY : BSON.BSON_DATA_OBJECT; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + var endIndex = serializeInto( + buffer, + value, + checkKeys, + index, + depth + 1, + serializeFunctions, + ignoreUndefined, + path + ); + // Pop stack + path.pop(); + // Write size + return endIndex; +}; + +var serializeDecimal128 = function(buffer, key, value, index, isArray) { + buffer[index++] = BSON.BSON_DATA_DECIMAL128; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the data from the value + value.bytes.copy(buffer, index, 0, 16); + return index + 16; +}; + +var serializeLong = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = value._bsontype === 'Long' ? BSON.BSON_DATA_LONG : BSON.BSON_DATA_TIMESTAMP; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the date + var lowBits = value.getLowBits(); + var highBits = value.getHighBits(); + // Encode low bits + buffer[index++] = lowBits & 0xff; + buffer[index++] = (lowBits >> 8) & 0xff; + buffer[index++] = (lowBits >> 16) & 0xff; + buffer[index++] = (lowBits >> 24) & 0xff; + // Encode high bits + buffer[index++] = highBits & 0xff; + buffer[index++] = (highBits >> 8) & 0xff; + buffer[index++] = (highBits >> 16) & 0xff; + buffer[index++] = (highBits >> 24) & 0xff; + return index; +}; + +var serializeInt32 = function(buffer, key, value, index, isArray) { + // Set int type 32 bits or less + buffer[index++] = BSON.BSON_DATA_INT; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the int value + buffer[index++] = value & 0xff; + buffer[index++] = (value >> 8) & 0xff; + buffer[index++] = (value >> 16) & 0xff; + buffer[index++] = (value >> 24) & 0xff; + return index; +}; + +var serializeDouble = function(buffer, key, value, index, isArray) { + // Encode as double + buffer[index++] = BSON.BSON_DATA_NUMBER; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write float + writeIEEE754(buffer, value, index, 'little', 52, 8); + // Ajust index + index = index + 8; + return index; +}; + +var serializeFunction = function(buffer, key, value, index, checkKeys, depth, isArray) { + buffer[index++] = BSON.BSON_DATA_CODE; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Function string + var functionString = normalizedFunctionString(value); + + // Write the string + var size = buffer.write(functionString, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = size & 0xff; + buffer[index + 1] = (size >> 8) & 0xff; + buffer[index + 2] = (size >> 16) & 0xff; + buffer[index + 3] = (size >> 24) & 0xff; + // Update index + index = index + 4 + size - 1; + // Write zero + buffer[index++] = 0; + return index; +}; + +var serializeCode = function( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined, + isArray +) { + if (value.scope && typeof value.scope === 'object') { + // Write the type + buffer[index++] = BSON.BSON_DATA_CODE_W_SCOPE; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + // Starting index + var startIndex = index; + + // Serialize the function + // Get the function string + var functionString = typeof value.code === 'string' ? value.code : value.code.toString(); + // Index adjustment + index = index + 4; + // Write string into buffer + var codeSize = buffer.write(functionString, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = codeSize & 0xff; + buffer[index + 1] = (codeSize >> 8) & 0xff; + buffer[index + 2] = (codeSize >> 16) & 0xff; + buffer[index + 3] = (codeSize >> 24) & 0xff; + // Write end 0 + buffer[index + 4 + codeSize - 1] = 0; + // Write the + index = index + codeSize + 4; + + // + // Serialize the scope value + var endIndex = serializeInto( + buffer, + value.scope, + checkKeys, + index, + depth + 1, + serializeFunctions, + ignoreUndefined + ); + index = endIndex - 1; + + // Writ the total + var totalSize = endIndex - startIndex; + + // Write the total size of the object + buffer[startIndex++] = totalSize & 0xff; + buffer[startIndex++] = (totalSize >> 8) & 0xff; + buffer[startIndex++] = (totalSize >> 16) & 0xff; + buffer[startIndex++] = (totalSize >> 24) & 0xff; + // Write trailing zero + buffer[index++] = 0; + } else { + buffer[index++] = BSON.BSON_DATA_CODE; + // Number of written bytes + numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Function string + functionString = value.code.toString(); + // Write the string + var size = buffer.write(functionString, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = size & 0xff; + buffer[index + 1] = (size >> 8) & 0xff; + buffer[index + 2] = (size >> 16) & 0xff; + buffer[index + 3] = (size >> 24) & 0xff; + // Update index + index = index + 4 + size - 1; + // Write zero + buffer[index++] = 0; + } + + return index; +}; + +var serializeBinary = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_BINARY; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Extract the buffer + var data = value.value(true); + // Calculate size + var size = value.position; + // Add the deprecated 02 type 4 bytes of size to total + if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) size = size + 4; + // Write the size of the string to buffer + buffer[index++] = size & 0xff; + buffer[index++] = (size >> 8) & 0xff; + buffer[index++] = (size >> 16) & 0xff; + buffer[index++] = (size >> 24) & 0xff; + // Write the subtype to the buffer + buffer[index++] = value.sub_type; + + // If we have binary type 2 the 4 first bytes are the size + if (value.sub_type === Binary.SUBTYPE_BYTE_ARRAY) { + size = size - 4; + buffer[index++] = size & 0xff; + buffer[index++] = (size >> 8) & 0xff; + buffer[index++] = (size >> 16) & 0xff; + buffer[index++] = (size >> 24) & 0xff; + } + + // Write the data to the object + data.copy(buffer, index, 0, value.position); + // Adjust the index + index = index + value.position; + return index; +}; + +var serializeSymbol = function(buffer, key, value, index, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_SYMBOL; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + // Write the string + var size = buffer.write(value.value, index + 4, 'utf8') + 1; + // Write the size of the string to buffer + buffer[index] = size & 0xff; + buffer[index + 1] = (size >> 8) & 0xff; + buffer[index + 2] = (size >> 16) & 0xff; + buffer[index + 3] = (size >> 24) & 0xff; + // Update index + index = index + 4 + size - 1; + // Write zero + buffer[index++] = 0x00; + return index; +}; + +var serializeDBRef = function(buffer, key, value, index, depth, serializeFunctions, isArray) { + // Write the type + buffer[index++] = BSON.BSON_DATA_OBJECT; + // Number of written bytes + var numberOfWrittenBytes = !isArray + ? buffer.write(key, index, 'utf8') + : buffer.write(key, index, 'ascii'); + + // Encode the name + index = index + numberOfWrittenBytes; + buffer[index++] = 0; + + var startIndex = index; + var endIndex; + + // Serialize object + if (null != value.db) { + endIndex = serializeInto( + buffer, + { + $ref: value.namespace, + $id: value.oid, + $db: value.db + }, + false, + index, + depth + 1, + serializeFunctions + ); + } else { + endIndex = serializeInto( + buffer, + { + $ref: value.namespace, + $id: value.oid + }, + false, + index, + depth + 1, + serializeFunctions + ); + } + + // Calculate object size + var size = endIndex - startIndex; + // Write the size + buffer[startIndex++] = size & 0xff; + buffer[startIndex++] = (size >> 8) & 0xff; + buffer[startIndex++] = (size >> 16) & 0xff; + buffer[startIndex++] = (size >> 24) & 0xff; + // Set index + return endIndex; +}; + +var serializeInto = function serializeInto( + buffer, + object, + checkKeys, + startingIndex, + depth, + serializeFunctions, + ignoreUndefined, + path +) { + startingIndex = startingIndex || 0; + path = path || []; + + // Push the object to the path + path.push(object); + + // Start place to serialize into + var index = startingIndex + 4; + // var self = this; + + // Special case isArray + if (Array.isArray(object)) { + // Get object keys + for (var i = 0; i < object.length; i++) { + var key = '' + i; + var value = object[i]; + + // Is there an override value + if (value && value.toBSON) { + if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function'); + value = value.toBSON(); + } + + var type = typeof value; + if (type === 'string') { + index = serializeString(buffer, key, value, index, true); + } else if (type === 'number') { + index = serializeNumber(buffer, key, value, index, true); + } else if(type === 'bigint') { + throw new TypeError('Unsupported type BigInt, please use Decimal128'); + } else if (type === 'boolean') { + index = serializeBoolean(buffer, key, value, index, true); + } else if (value instanceof Date || isDate(value)) { + index = serializeDate(buffer, key, value, index, true); + } else if (value === undefined) { + index = serializeNull(buffer, key, value, index, true); + } else if (value === null) { + index = serializeNull(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + index = serializeObjectId(buffer, key, value, index, true); + } else if (Buffer.isBuffer(value)) { + index = serializeBuffer(buffer, key, value, index, true); + } else if (value instanceof RegExp || isRegExp(value)) { + index = serializeRegExp(buffer, key, value, index, true); + } else if (type === 'object' && value['_bsontype'] == null) { + index = serializeObject( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined, + true, + path + ); + } else if (type === 'object' && value['_bsontype'] === 'Decimal128') { + index = serializeDecimal128(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') { + index = serializeLong(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Double') { + index = serializeDouble(buffer, key, value, index, true); + } else if (typeof value === 'function' && serializeFunctions) { + index = serializeFunction( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + true + ); + } else if (value['_bsontype'] === 'Code') { + index = serializeCode( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined, + true + ); + } else if (value['_bsontype'] === 'Binary') { + index = serializeBinary(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Symbol') { + index = serializeSymbol(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'DBRef') { + index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions, true); + } else if (value['_bsontype'] === 'BSONRegExp') { + index = serializeBSONRegExp(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'Int32') { + index = serializeInt32(buffer, key, value, index, true); + } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') { + index = serializeMinMax(buffer, key, value, index, true); + } else if (typeof value['_bsontype'] !== 'undefined') { + throw new TypeError('Unrecognized or invalid _bsontype: ' + value['_bsontype']); + } + } + } else if (object instanceof Map) { + var iterator = object.entries(); + var done = false; + + while (!done) { + // Unpack the next entry + var entry = iterator.next(); + done = entry.done; + // Are we done, then skip and terminate + if (done) continue; + + // Get the entry values + key = entry.value[0]; + value = entry.value[1]; + + // Check the type of the value + type = typeof value; + + // Check the key and throw error if it's illegal + if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) { + if (key.match(regexp) != null) { + // The BSON spec doesn't allow keys with null bytes because keys are + // null-terminated. + throw Error('key ' + key + ' must not contain null bytes'); + } + + if (checkKeys) { + if ('$' === key[0]) { + throw Error('key ' + key + " must not start with '$'"); + } else if (~key.indexOf('.')) { + throw Error('key ' + key + " must not contain '.'"); + } + } + } + + if (type === 'string') { + index = serializeString(buffer, key, value, index); + } else if (type === 'number') { + index = serializeNumber(buffer, key, value, index); + } else if(type === 'bigint') { + throw new TypeError('Unsupported type BigInt, please use Decimal128'); + } else if (type === 'boolean') { + index = serializeBoolean(buffer, key, value, index); + } else if (value instanceof Date || isDate(value)) { + index = serializeDate(buffer, key, value, index); + // } else if (value === undefined && ignoreUndefined === true) { + } else if (value === null || (value === undefined && ignoreUndefined === false)) { + index = serializeNull(buffer, key, value, index); + } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + index = serializeObjectId(buffer, key, value, index); + } else if (Buffer.isBuffer(value)) { + index = serializeBuffer(buffer, key, value, index); + } else if (value instanceof RegExp || isRegExp(value)) { + index = serializeRegExp(buffer, key, value, index); + } else if (type === 'object' && value['_bsontype'] == null) { + index = serializeObject( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined, + false, + path + ); + } else if (type === 'object' && value['_bsontype'] === 'Decimal128') { + index = serializeDecimal128(buffer, key, value, index); + } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') { + index = serializeLong(buffer, key, value, index); + } else if (value['_bsontype'] === 'Double') { + index = serializeDouble(buffer, key, value, index); + } else if (value['_bsontype'] === 'Code') { + index = serializeCode( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined + ); + } else if (typeof value === 'function' && serializeFunctions) { + index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions); + } else if (value['_bsontype'] === 'Binary') { + index = serializeBinary(buffer, key, value, index); + } else if (value['_bsontype'] === 'Symbol') { + index = serializeSymbol(buffer, key, value, index); + } else if (value['_bsontype'] === 'DBRef') { + index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions); + } else if (value['_bsontype'] === 'BSONRegExp') { + index = serializeBSONRegExp(buffer, key, value, index); + } else if (value['_bsontype'] === 'Int32') { + index = serializeInt32(buffer, key, value, index); + } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') { + index = serializeMinMax(buffer, key, value, index); + } else if (typeof value['_bsontype'] !== 'undefined') { + throw new TypeError('Unrecognized or invalid _bsontype: ' + value['_bsontype']); + } + } + } else { + // Did we provide a custom serialization method + if (object.toBSON) { + if (typeof object.toBSON !== 'function') throw new Error('toBSON is not a function'); + object = object.toBSON(); + if (object != null && typeof object !== 'object') + throw new Error('toBSON function did not return an object'); + } + + // Iterate over all the keys + for (key in object) { + value = object[key]; + // Is there an override value + if (value && value.toBSON) { + if (typeof value.toBSON !== 'function') throw new Error('toBSON is not a function'); + value = value.toBSON(); + } + + // Check the type of the value + type = typeof value; + + // Check the key and throw error if it's illegal + if (typeof key === 'string' && ignoreKeys.indexOf(key) === -1) { + if (key.match(regexp) != null) { + // The BSON spec doesn't allow keys with null bytes because keys are + // null-terminated. + throw Error('key ' + key + ' must not contain null bytes'); + } + + if (checkKeys) { + if ('$' === key[0]) { + throw Error('key ' + key + " must not start with '$'"); + } else if (~key.indexOf('.')) { + throw Error('key ' + key + " must not contain '.'"); + } + } + } + + if (type === 'string') { + index = serializeString(buffer, key, value, index); + } else if (type === 'number') { + index = serializeNumber(buffer, key, value, index); + } else if(type === 'bigint') { + throw new TypeError('Unsupported type BigInt, please use Decimal128'); + } else if (type === 'boolean') { + index = serializeBoolean(buffer, key, value, index); + } else if (value instanceof Date || isDate(value)) { + index = serializeDate(buffer, key, value, index); + } else if (value === undefined) { + if (ignoreUndefined === false) index = serializeNull(buffer, key, value, index); + } else if (value === null) { + index = serializeNull(buffer, key, value, index); + } else if (value['_bsontype'] === 'ObjectID' || value['_bsontype'] === 'ObjectId') { + index = serializeObjectId(buffer, key, value, index); + } else if (Buffer.isBuffer(value)) { + index = serializeBuffer(buffer, key, value, index); + } else if (value instanceof RegExp || isRegExp(value)) { + index = serializeRegExp(buffer, key, value, index); + } else if (type === 'object' && value['_bsontype'] == null) { + index = serializeObject( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined, + false, + path + ); + } else if (type === 'object' && value['_bsontype'] === 'Decimal128') { + index = serializeDecimal128(buffer, key, value, index); + } else if (value['_bsontype'] === 'Long' || value['_bsontype'] === 'Timestamp') { + index = serializeLong(buffer, key, value, index); + } else if (value['_bsontype'] === 'Double') { + index = serializeDouble(buffer, key, value, index); + } else if (value['_bsontype'] === 'Code') { + index = serializeCode( + buffer, + key, + value, + index, + checkKeys, + depth, + serializeFunctions, + ignoreUndefined + ); + } else if (typeof value === 'function' && serializeFunctions) { + index = serializeFunction(buffer, key, value, index, checkKeys, depth, serializeFunctions); + } else if (value['_bsontype'] === 'Binary') { + index = serializeBinary(buffer, key, value, index); + } else if (value['_bsontype'] === 'Symbol') { + index = serializeSymbol(buffer, key, value, index); + } else if (value['_bsontype'] === 'DBRef') { + index = serializeDBRef(buffer, key, value, index, depth, serializeFunctions); + } else if (value['_bsontype'] === 'BSONRegExp') { + index = serializeBSONRegExp(buffer, key, value, index); + } else if (value['_bsontype'] === 'Int32') { + index = serializeInt32(buffer, key, value, index); + } else if (value['_bsontype'] === 'MinKey' || value['_bsontype'] === 'MaxKey') { + index = serializeMinMax(buffer, key, value, index); + } else if (typeof value['_bsontype'] !== 'undefined') { + throw new TypeError('Unrecognized or invalid _bsontype: ' + value['_bsontype']); + } + } + } + + // Remove the path + path.pop(); + + // Final padding byte for object + buffer[index++] = 0x00; + + // Final size + var size = index - startingIndex; + // Write the size of the object + buffer[startingIndex++] = size & 0xff; + buffer[startingIndex++] = (size >> 8) & 0xff; + buffer[startingIndex++] = (size >> 16) & 0xff; + buffer[startingIndex++] = (size >> 24) & 0xff; + return index; +}; + +var BSON = {}; + +/** + * Contains the function cache if we have that enable to allow for avoiding the eval step on each deserialization, comparison is by md5 + * + * @ignore + * @api private + */ +// var functionCache = (BSON.functionCache = {}); + +/** + * Number BSON Type + * + * @classconstant BSON_DATA_NUMBER + **/ +BSON.BSON_DATA_NUMBER = 1; +/** + * String BSON Type + * + * @classconstant BSON_DATA_STRING + **/ +BSON.BSON_DATA_STRING = 2; +/** + * Object BSON Type + * + * @classconstant BSON_DATA_OBJECT + **/ +BSON.BSON_DATA_OBJECT = 3; +/** + * Array BSON Type + * + * @classconstant BSON_DATA_ARRAY + **/ +BSON.BSON_DATA_ARRAY = 4; +/** + * Binary BSON Type + * + * @classconstant BSON_DATA_BINARY + **/ +BSON.BSON_DATA_BINARY = 5; +/** + * ObjectID BSON Type, deprecated + * + * @classconstant BSON_DATA_UNDEFINED + **/ +BSON.BSON_DATA_UNDEFINED = 6; +/** + * ObjectID BSON Type + * + * @classconstant BSON_DATA_OID + **/ +BSON.BSON_DATA_OID = 7; +/** + * Boolean BSON Type + * + * @classconstant BSON_DATA_BOOLEAN + **/ +BSON.BSON_DATA_BOOLEAN = 8; +/** + * Date BSON Type + * + * @classconstant BSON_DATA_DATE + **/ +BSON.BSON_DATA_DATE = 9; +/** + * null BSON Type + * + * @classconstant BSON_DATA_NULL + **/ +BSON.BSON_DATA_NULL = 10; +/** + * RegExp BSON Type + * + * @classconstant BSON_DATA_REGEXP + **/ +BSON.BSON_DATA_REGEXP = 11; +/** + * Code BSON Type + * + * @classconstant BSON_DATA_CODE + **/ +BSON.BSON_DATA_CODE = 13; +/** + * Symbol BSON Type + * + * @classconstant BSON_DATA_SYMBOL + **/ +BSON.BSON_DATA_SYMBOL = 14; +/** + * Code with Scope BSON Type + * + * @classconstant BSON_DATA_CODE_W_SCOPE + **/ +BSON.BSON_DATA_CODE_W_SCOPE = 15; +/** + * 32 bit Integer BSON Type + * + * @classconstant BSON_DATA_INT + **/ +BSON.BSON_DATA_INT = 16; +/** + * Timestamp BSON Type + * + * @classconstant BSON_DATA_TIMESTAMP + **/ +BSON.BSON_DATA_TIMESTAMP = 17; +/** + * Long BSON Type + * + * @classconstant BSON_DATA_LONG + **/ +BSON.BSON_DATA_LONG = 18; +/** + * Long BSON Type + * + * @classconstant BSON_DATA_DECIMAL128 + **/ +BSON.BSON_DATA_DECIMAL128 = 19; +/** + * MinKey BSON Type + * + * @classconstant BSON_DATA_MIN_KEY + **/ +BSON.BSON_DATA_MIN_KEY = 0xff; +/** + * MaxKey BSON Type + * + * @classconstant BSON_DATA_MAX_KEY + **/ +BSON.BSON_DATA_MAX_KEY = 0x7f; +/** + * Binary Default Type + * + * @classconstant BSON_BINARY_SUBTYPE_DEFAULT + **/ +BSON.BSON_BINARY_SUBTYPE_DEFAULT = 0; +/** + * Binary Function Type + * + * @classconstant BSON_BINARY_SUBTYPE_FUNCTION + **/ +BSON.BSON_BINARY_SUBTYPE_FUNCTION = 1; +/** + * Binary Byte Array Type + * + * @classconstant BSON_BINARY_SUBTYPE_BYTE_ARRAY + **/ +BSON.BSON_BINARY_SUBTYPE_BYTE_ARRAY = 2; +/** + * Binary UUID Type + * + * @classconstant BSON_BINARY_SUBTYPE_UUID + **/ +BSON.BSON_BINARY_SUBTYPE_UUID = 3; +/** + * Binary MD5 Type + * + * @classconstant BSON_BINARY_SUBTYPE_MD5 + **/ +BSON.BSON_BINARY_SUBTYPE_MD5 = 4; +/** + * Binary User Defined Type + * + * @classconstant BSON_BINARY_SUBTYPE_USER_DEFINED + **/ +BSON.BSON_BINARY_SUBTYPE_USER_DEFINED = 128; + +// BSON MAX VALUES +BSON.BSON_INT32_MAX = 0x7fffffff; +BSON.BSON_INT32_MIN = -0x80000000; + +BSON.BSON_INT64_MAX = Math.pow(2, 63) - 1; +BSON.BSON_INT64_MIN = -Math.pow(2, 63); + +// JS MAX PRECISE VALUES +BSON.JS_INT_MAX = 0x20000000000000; // Any integer up to 2^53 can be precisely represented by a double. +BSON.JS_INT_MIN = -0x20000000000000; // Any integer down to -2^53 can be precisely represented by a double. + +// Internal long versions +// var JS_INT_MAX_LONG = Long.fromNumber(0x20000000000000); // Any integer up to 2^53 can be precisely represented by a double. +// var JS_INT_MIN_LONG = Long.fromNumber(-0x20000000000000); // Any integer down to -2^53 can be precisely represented by a double. + +module.exports = serializeInto; diff --git a/node_modules/bson/lib/bson/parser/utils.js b/node_modules/bson/lib/bson/parser/utils.js new file mode 100644 index 00000000..6faa4396 --- /dev/null +++ b/node_modules/bson/lib/bson/parser/utils.js @@ -0,0 +1,28 @@ +'use strict'; + +/** + * Normalizes our expected stringified form of a function across versions of node + * @param {Function} fn The function to stringify + */ +function normalizedFunctionString(fn) { + return fn.toString().replace(/function *\(/, 'function ('); +} + +function newBuffer(item, encoding) { + return new Buffer(item, encoding); +} + +function allocBuffer() { + return Buffer.alloc.apply(Buffer, arguments); +} + +function toBuffer() { + return Buffer.from.apply(Buffer, arguments); +} + +module.exports = { + normalizedFunctionString: normalizedFunctionString, + allocBuffer: typeof Buffer.alloc === 'function' ? allocBuffer : newBuffer, + toBuffer: typeof Buffer.from === 'function' ? toBuffer : newBuffer +}; + diff --git a/node_modules/bson/lib/bson/regexp.js b/node_modules/bson/lib/bson/regexp.js new file mode 100644 index 00000000..108f0166 --- /dev/null +++ b/node_modules/bson/lib/bson/regexp.js @@ -0,0 +1,33 @@ +/** + * A class representation of the BSON RegExp type. + * + * @class + * @return {BSONRegExp} A MinKey instance + */ +function BSONRegExp(pattern, options) { + if (!(this instanceof BSONRegExp)) return new BSONRegExp(); + + // Execute + this._bsontype = 'BSONRegExp'; + this.pattern = pattern || ''; + this.options = options || ''; + + // Validate options + for (var i = 0; i < this.options.length; i++) { + if ( + !( + this.options[i] === 'i' || + this.options[i] === 'm' || + this.options[i] === 'x' || + this.options[i] === 'l' || + this.options[i] === 's' || + this.options[i] === 'u' + ) + ) { + throw new Error('the regular expression options [' + this.options[i] + '] is not supported'); + } + } +} + +module.exports = BSONRegExp; +module.exports.BSONRegExp = BSONRegExp; diff --git a/node_modules/bson/lib/bson/symbol.js b/node_modules/bson/lib/bson/symbol.js new file mode 100644 index 00000000..ba20cabe --- /dev/null +++ b/node_modules/bson/lib/bson/symbol.js @@ -0,0 +1,50 @@ +// Custom inspect property name / symbol. +var inspect = Buffer ? require('util').inspect.custom || 'inspect' : 'inspect'; + +/** + * A class representation of the BSON Symbol type. + * + * @class + * @deprecated + * @param {string} value the string representing the symbol. + * @return {Symbol} + */ +function Symbol(value) { + if (!(this instanceof Symbol)) return new Symbol(value); + this._bsontype = 'Symbol'; + this.value = value; +} + +/** + * Access the wrapped string value. + * + * @method + * @return {String} returns the wrapped string. + */ +Symbol.prototype.valueOf = function() { + return this.value; +}; + +/** + * @ignore + */ +Symbol.prototype.toString = function() { + return this.value; +}; + +/** + * @ignore + */ +Symbol.prototype[inspect] = function() { + return this.value; +}; + +/** + * @ignore + */ +Symbol.prototype.toJSON = function() { + return this.value; +}; + +module.exports = Symbol; +module.exports.Symbol = Symbol; diff --git a/node_modules/bson/lib/bson/timestamp.js b/node_modules/bson/lib/bson/timestamp.js new file mode 100644 index 00000000..dc61a6cc --- /dev/null +++ b/node_modules/bson/lib/bson/timestamp.js @@ -0,0 +1,854 @@ +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// Copyright 2009 Google Inc. All Rights Reserved + +/** + * This type is for INTERNAL use in MongoDB only and should not be used in applications. + * The appropriate corresponding type is the JavaScript Date type. + * + * Defines a Timestamp class for representing a 64-bit two's-complement + * integer value, which faithfully simulates the behavior of a Java "Timestamp". This + * implementation is derived from TimestampLib in GWT. + * + * Constructs a 64-bit two's-complement integer, given its low and high 32-bit + * values as *signed* integers. See the from* functions below for more + * convenient ways of constructing Timestamps. + * + * The internal representation of a Timestamp is the two given signed, 32-bit values. + * We use 32-bit pieces because these are the size of integers on which + * Javascript performs bit-operations. For operations like addition and + * multiplication, we split each number into 16-bit pieces, which can easily be + * multiplied within Javascript's floating-point representation without overflow + * or change in sign. + * + * In the algorithms below, we frequently reduce the negative case to the + * positive case by negating the input(s) and then post-processing the result. + * Note that we must ALWAYS check specially whether those values are MIN_VALUE + * (-2^63) because -MIN_VALUE == MIN_VALUE (since 2^63 cannot be represented as + * a positive number, it overflows back into a negative). Not handling this + * case would often result in infinite recursion. + * + * @class + * @param {number} low the low (signed) 32 bits of the Timestamp. + * @param {number} high the high (signed) 32 bits of the Timestamp. + */ +function Timestamp(low, high) { + if (!(this instanceof Timestamp)) return new Timestamp(low, high); + this._bsontype = 'Timestamp'; + /** + * @type {number} + * @ignore + */ + this.low_ = low | 0; // force into 32 signed bits. + + /** + * @type {number} + * @ignore + */ + this.high_ = high | 0; // force into 32 signed bits. +} + +/** + * Return the int value. + * + * @return {number} the value, assuming it is a 32-bit integer. + */ +Timestamp.prototype.toInt = function() { + return this.low_; +}; + +/** + * Return the Number value. + * + * @method + * @return {number} the closest floating-point representation to this value. + */ +Timestamp.prototype.toNumber = function() { + return this.high_ * Timestamp.TWO_PWR_32_DBL_ + this.getLowBitsUnsigned(); +}; + +/** + * Return the JSON value. + * + * @method + * @return {string} the JSON representation. + */ +Timestamp.prototype.toJSON = function() { + return this.toString(); +}; + +/** + * Return the String value. + * + * @method + * @param {number} [opt_radix] the radix in which the text should be written. + * @return {string} the textual representation of this value. + */ +Timestamp.prototype.toString = function(opt_radix) { + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (this.isZero()) { + return '0'; + } + + if (this.isNegative()) { + if (this.equals(Timestamp.MIN_VALUE)) { + // We need to change the Timestamp value before it can be negated, so we remove + // the bottom-most digit in this base and then recurse to do the rest. + var radixTimestamp = Timestamp.fromNumber(radix); + var div = this.div(radixTimestamp); + var rem = div.multiply(radixTimestamp).subtract(this); + return div.toString(radix) + rem.toInt().toString(radix); + } else { + return '-' + this.negate().toString(radix); + } + } + + // Do several (6) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Timestamp.fromNumber(Math.pow(radix, 6)); + + rem = this; + var result = ''; + + while (!rem.isZero()) { + var remDiv = rem.div(radixToPower); + var intval = rem.subtract(remDiv.multiply(radixToPower)).toInt(); + var digits = intval.toString(radix); + + rem = remDiv; + if (rem.isZero()) { + return digits + result; + } else { + while (digits.length < 6) { + digits = '0' + digits; + } + result = '' + digits + result; + } + } +}; + +/** + * Return the high 32-bits value. + * + * @method + * @return {number} the high 32-bits as a signed value. + */ +Timestamp.prototype.getHighBits = function() { + return this.high_; +}; + +/** + * Return the low 32-bits value. + * + * @method + * @return {number} the low 32-bits as a signed value. + */ +Timestamp.prototype.getLowBits = function() { + return this.low_; +}; + +/** + * Return the low unsigned 32-bits value. + * + * @method + * @return {number} the low 32-bits as an unsigned value. + */ +Timestamp.prototype.getLowBitsUnsigned = function() { + return this.low_ >= 0 ? this.low_ : Timestamp.TWO_PWR_32_DBL_ + this.low_; +}; + +/** + * Returns the number of bits needed to represent the absolute value of this Timestamp. + * + * @method + * @return {number} Returns the number of bits needed to represent the absolute value of this Timestamp. + */ +Timestamp.prototype.getNumBitsAbs = function() { + if (this.isNegative()) { + if (this.equals(Timestamp.MIN_VALUE)) { + return 64; + } else { + return this.negate().getNumBitsAbs(); + } + } else { + var val = this.high_ !== 0 ? this.high_ : this.low_; + for (var bit = 31; bit > 0; bit--) { + if ((val & (1 << bit)) !== 0) { + break; + } + } + return this.high_ !== 0 ? bit + 33 : bit + 1; + } +}; + +/** + * Return whether this value is zero. + * + * @method + * @return {boolean} whether this value is zero. + */ +Timestamp.prototype.isZero = function() { + return this.high_ === 0 && this.low_ === 0; +}; + +/** + * Return whether this value is negative. + * + * @method + * @return {boolean} whether this value is negative. + */ +Timestamp.prototype.isNegative = function() { + return this.high_ < 0; +}; + +/** + * Return whether this value is odd. + * + * @method + * @return {boolean} whether this value is odd. + */ +Timestamp.prototype.isOdd = function() { + return (this.low_ & 1) === 1; +}; + +/** + * Return whether this Timestamp equals the other + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp equals the other + */ +Timestamp.prototype.equals = function(other) { + return this.high_ === other.high_ && this.low_ === other.low_; +}; + +/** + * Return whether this Timestamp does not equal the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp does not equal the other. + */ +Timestamp.prototype.notEquals = function(other) { + return this.high_ !== other.high_ || this.low_ !== other.low_; +}; + +/** + * Return whether this Timestamp is less than the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is less than the other. + */ +Timestamp.prototype.lessThan = function(other) { + return this.compare(other) < 0; +}; + +/** + * Return whether this Timestamp is less than or equal to the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is less than or equal to the other. + */ +Timestamp.prototype.lessThanOrEqual = function(other) { + return this.compare(other) <= 0; +}; + +/** + * Return whether this Timestamp is greater than the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is greater than the other. + */ +Timestamp.prototype.greaterThan = function(other) { + return this.compare(other) > 0; +}; + +/** + * Return whether this Timestamp is greater than or equal to the other. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} whether this Timestamp is greater than or equal to the other. + */ +Timestamp.prototype.greaterThanOrEqual = function(other) { + return this.compare(other) >= 0; +}; + +/** + * Compares this Timestamp with the given one. + * + * @method + * @param {Timestamp} other Timestamp to compare against. + * @return {boolean} 0 if they are the same, 1 if the this is greater, and -1 if the given one is greater. + */ +Timestamp.prototype.compare = function(other) { + if (this.equals(other)) { + return 0; + } + + var thisNeg = this.isNegative(); + var otherNeg = other.isNegative(); + if (thisNeg && !otherNeg) { + return -1; + } + if (!thisNeg && otherNeg) { + return 1; + } + + // at this point, the signs are the same, so subtraction will not overflow + if (this.subtract(other).isNegative()) { + return -1; + } else { + return 1; + } +}; + +/** + * The negation of this value. + * + * @method + * @return {Timestamp} the negation of this value. + */ +Timestamp.prototype.negate = function() { + if (this.equals(Timestamp.MIN_VALUE)) { + return Timestamp.MIN_VALUE; + } else { + return this.not().add(Timestamp.ONE); + } +}; + +/** + * Returns the sum of this and the given Timestamp. + * + * @method + * @param {Timestamp} other Timestamp to add to this one. + * @return {Timestamp} the sum of this and the given Timestamp. + */ +Timestamp.prototype.add = function(other) { + // Divide each number into 4 chunks of 16 bits, and then sum the chunks. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 + b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 + b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 + b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 + b48; + c48 &= 0xffff; + return Timestamp.fromBits((c16 << 16) | c00, (c48 << 16) | c32); +}; + +/** + * Returns the difference of this and the given Timestamp. + * + * @method + * @param {Timestamp} other Timestamp to subtract from this. + * @return {Timestamp} the difference of this and the given Timestamp. + */ +Timestamp.prototype.subtract = function(other) { + return this.add(other.negate()); +}; + +/** + * Returns the product of this and the given Timestamp. + * + * @method + * @param {Timestamp} other Timestamp to multiply with this. + * @return {Timestamp} the product of this and the other. + */ +Timestamp.prototype.multiply = function(other) { + if (this.isZero()) { + return Timestamp.ZERO; + } else if (other.isZero()) { + return Timestamp.ZERO; + } + + if (this.equals(Timestamp.MIN_VALUE)) { + return other.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO; + } else if (other.equals(Timestamp.MIN_VALUE)) { + return this.isOdd() ? Timestamp.MIN_VALUE : Timestamp.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().multiply(other.negate()); + } else { + return this.negate() + .multiply(other) + .negate(); + } + } else if (other.isNegative()) { + return this.multiply(other.negate()).negate(); + } + + // If both Timestamps are small, use float multiplication + if (this.lessThan(Timestamp.TWO_PWR_24_) && other.lessThan(Timestamp.TWO_PWR_24_)) { + return Timestamp.fromNumber(this.toNumber() * other.toNumber()); + } + + // Divide each Timestamp into 4 chunks of 16 bits, and then add up 4x4 products. + // We can skip products that would overflow. + + var a48 = this.high_ >>> 16; + var a32 = this.high_ & 0xffff; + var a16 = this.low_ >>> 16; + var a00 = this.low_ & 0xffff; + + var b48 = other.high_ >>> 16; + var b32 = other.high_ & 0xffff; + var b16 = other.low_ >>> 16; + var b00 = other.low_ & 0xffff; + + var c48 = 0, + c32 = 0, + c16 = 0, + c00 = 0; + c00 += a00 * b00; + c16 += c00 >>> 16; + c00 &= 0xffff; + c16 += a16 * b00; + c32 += c16 >>> 16; + c16 &= 0xffff; + c16 += a00 * b16; + c32 += c16 >>> 16; + c16 &= 0xffff; + c32 += a32 * b00; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a16 * b16; + c48 += c32 >>> 16; + c32 &= 0xffff; + c32 += a00 * b32; + c48 += c32 >>> 16; + c32 &= 0xffff; + c48 += a48 * b00 + a32 * b16 + a16 * b32 + a00 * b48; + c48 &= 0xffff; + return Timestamp.fromBits((c16 << 16) | c00, (c48 << 16) | c32); +}; + +/** + * Returns this Timestamp divided by the given one. + * + * @method + * @param {Timestamp} other Timestamp by which to divide. + * @return {Timestamp} this Timestamp divided by the given one. + */ +Timestamp.prototype.div = function(other) { + if (other.isZero()) { + throw Error('division by zero'); + } else if (this.isZero()) { + return Timestamp.ZERO; + } + + if (this.equals(Timestamp.MIN_VALUE)) { + if (other.equals(Timestamp.ONE) || other.equals(Timestamp.NEG_ONE)) { + return Timestamp.MIN_VALUE; // recall that -MIN_VALUE == MIN_VALUE + } else if (other.equals(Timestamp.MIN_VALUE)) { + return Timestamp.ONE; + } else { + // At this point, we have |other| >= 2, so |this/other| < |MIN_VALUE|. + var halfThis = this.shiftRight(1); + var approx = halfThis.div(other).shiftLeft(1); + if (approx.equals(Timestamp.ZERO)) { + return other.isNegative() ? Timestamp.ONE : Timestamp.NEG_ONE; + } else { + var rem = this.subtract(other.multiply(approx)); + var result = approx.add(rem.div(other)); + return result; + } + } + } else if (other.equals(Timestamp.MIN_VALUE)) { + return Timestamp.ZERO; + } + + if (this.isNegative()) { + if (other.isNegative()) { + return this.negate().div(other.negate()); + } else { + return this.negate() + .div(other) + .negate(); + } + } else if (other.isNegative()) { + return this.div(other.negate()).negate(); + } + + // Repeat the following until the remainder is less than other: find a + // floating-point that approximates remainder / other *from below*, add this + // into the result, and subtract it from the remainder. It is critical that + // the approximate value is less than or equal to the real value so that the + // remainder never becomes negative. + var res = Timestamp.ZERO; + rem = this; + while (rem.greaterThanOrEqual(other)) { + // Approximate the result of division. This may be a little greater or + // smaller than the actual value. + approx = Math.max(1, Math.floor(rem.toNumber() / other.toNumber())); + + // We will tweak the approximate result by changing it in the 48-th digit or + // the smallest non-fractional digit, whichever is larger. + var log2 = Math.ceil(Math.log(approx) / Math.LN2); + var delta = log2 <= 48 ? 1 : Math.pow(2, log2 - 48); + + // Decrease the approximation until it is smaller than the remainder. Note + // that if it is too large, the product overflows and is negative. + var approxRes = Timestamp.fromNumber(approx); + var approxRem = approxRes.multiply(other); + while (approxRem.isNegative() || approxRem.greaterThan(rem)) { + approx -= delta; + approxRes = Timestamp.fromNumber(approx); + approxRem = approxRes.multiply(other); + } + + // We know the answer can't be zero... and actually, zero would cause + // infinite recursion since we would make no progress. + if (approxRes.isZero()) { + approxRes = Timestamp.ONE; + } + + res = res.add(approxRes); + rem = rem.subtract(approxRem); + } + return res; +}; + +/** + * Returns this Timestamp modulo the given one. + * + * @method + * @param {Timestamp} other Timestamp by which to mod. + * @return {Timestamp} this Timestamp modulo the given one. + */ +Timestamp.prototype.modulo = function(other) { + return this.subtract(this.div(other).multiply(other)); +}; + +/** + * The bitwise-NOT of this value. + * + * @method + * @return {Timestamp} the bitwise-NOT of this value. + */ +Timestamp.prototype.not = function() { + return Timestamp.fromBits(~this.low_, ~this.high_); +}; + +/** + * Returns the bitwise-AND of this Timestamp and the given one. + * + * @method + * @param {Timestamp} other the Timestamp with which to AND. + * @return {Timestamp} the bitwise-AND of this and the other. + */ +Timestamp.prototype.and = function(other) { + return Timestamp.fromBits(this.low_ & other.low_, this.high_ & other.high_); +}; + +/** + * Returns the bitwise-OR of this Timestamp and the given one. + * + * @method + * @param {Timestamp} other the Timestamp with which to OR. + * @return {Timestamp} the bitwise-OR of this and the other. + */ +Timestamp.prototype.or = function(other) { + return Timestamp.fromBits(this.low_ | other.low_, this.high_ | other.high_); +}; + +/** + * Returns the bitwise-XOR of this Timestamp and the given one. + * + * @method + * @param {Timestamp} other the Timestamp with which to XOR. + * @return {Timestamp} the bitwise-XOR of this and the other. + */ +Timestamp.prototype.xor = function(other) { + return Timestamp.fromBits(this.low_ ^ other.low_, this.high_ ^ other.high_); +}; + +/** + * Returns this Timestamp with bits shifted to the left by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Timestamp} this shifted to the left by the given amount. + */ +Timestamp.prototype.shiftLeft = function(numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var low = this.low_; + if (numBits < 32) { + var high = this.high_; + return Timestamp.fromBits(low << numBits, (high << numBits) | (low >>> (32 - numBits))); + } else { + return Timestamp.fromBits(0, low << (numBits - 32)); + } + } +}; + +/** + * Returns this Timestamp with bits shifted to the right by the given amount. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Timestamp} this shifted to the right by the given amount. + */ +Timestamp.prototype.shiftRight = function(numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Timestamp.fromBits((low >>> numBits) | (high << (32 - numBits)), high >> numBits); + } else { + return Timestamp.fromBits(high >> (numBits - 32), high >= 0 ? 0 : -1); + } + } +}; + +/** + * Returns this Timestamp with bits shifted to the right by the given amount, with the new top bits matching the current sign bit. + * + * @method + * @param {number} numBits the number of bits by which to shift. + * @return {Timestamp} this shifted to the right by the given amount, with zeros placed into the new leading bits. + */ +Timestamp.prototype.shiftRightUnsigned = function(numBits) { + numBits &= 63; + if (numBits === 0) { + return this; + } else { + var high = this.high_; + if (numBits < 32) { + var low = this.low_; + return Timestamp.fromBits((low >>> numBits) | (high << (32 - numBits)), high >>> numBits); + } else if (numBits === 32) { + return Timestamp.fromBits(high, 0); + } else { + return Timestamp.fromBits(high >>> (numBits - 32), 0); + } + } +}; + +/** + * Returns a Timestamp representing the given (32-bit) integer value. + * + * @method + * @param {number} value the 32-bit integer in question. + * @return {Timestamp} the corresponding Timestamp value. + */ +Timestamp.fromInt = function(value) { + if (-128 <= value && value < 128) { + var cachedObj = Timestamp.INT_CACHE_[value]; + if (cachedObj) { + return cachedObj; + } + } + + var obj = new Timestamp(value | 0, value < 0 ? -1 : 0); + if (-128 <= value && value < 128) { + Timestamp.INT_CACHE_[value] = obj; + } + return obj; +}; + +/** + * Returns a Timestamp representing the given value, provided that it is a finite number. Otherwise, zero is returned. + * + * @method + * @param {number} value the number in question. + * @return {Timestamp} the corresponding Timestamp value. + */ +Timestamp.fromNumber = function(value) { + if (isNaN(value) || !isFinite(value)) { + return Timestamp.ZERO; + } else if (value <= -Timestamp.TWO_PWR_63_DBL_) { + return Timestamp.MIN_VALUE; + } else if (value + 1 >= Timestamp.TWO_PWR_63_DBL_) { + return Timestamp.MAX_VALUE; + } else if (value < 0) { + return Timestamp.fromNumber(-value).negate(); + } else { + return new Timestamp( + (value % Timestamp.TWO_PWR_32_DBL_) | 0, + (value / Timestamp.TWO_PWR_32_DBL_) | 0 + ); + } +}; + +/** + * Returns a Timestamp representing the 64-bit integer that comes by concatenating the given high and low bits. Each is assumed to use 32 bits. + * + * @method + * @param {number} lowBits the low 32-bits. + * @param {number} highBits the high 32-bits. + * @return {Timestamp} the corresponding Timestamp value. + */ +Timestamp.fromBits = function(lowBits, highBits) { + return new Timestamp(lowBits, highBits); +}; + +/** + * Returns a Timestamp representation of the given string, written using the given radix. + * + * @method + * @param {string} str the textual representation of the Timestamp. + * @param {number} opt_radix the radix in which the text is written. + * @return {Timestamp} the corresponding Timestamp value. + */ +Timestamp.fromString = function(str, opt_radix) { + if (str.length === 0) { + throw Error('number format error: empty string'); + } + + var radix = opt_radix || 10; + if (radix < 2 || 36 < radix) { + throw Error('radix out of range: ' + radix); + } + + if (str.charAt(0) === '-') { + return Timestamp.fromString(str.substring(1), radix).negate(); + } else if (str.indexOf('-') >= 0) { + throw Error('number format error: interior "-" character: ' + str); + } + + // Do several (8) digits each time through the loop, so as to + // minimize the calls to the very expensive emulated div. + var radixToPower = Timestamp.fromNumber(Math.pow(radix, 8)); + + var result = Timestamp.ZERO; + for (var i = 0; i < str.length; i += 8) { + var size = Math.min(8, str.length - i); + var value = parseInt(str.substring(i, i + size), radix); + if (size < 8) { + var power = Timestamp.fromNumber(Math.pow(radix, size)); + result = result.multiply(power).add(Timestamp.fromNumber(value)); + } else { + result = result.multiply(radixToPower); + result = result.add(Timestamp.fromNumber(value)); + } + } + return result; +}; + +// NOTE: Common constant values ZERO, ONE, NEG_ONE, etc. are defined below the +// from* methods on which they depend. + +/** + * A cache of the Timestamp representations of small integer values. + * @type {Object} + * @ignore + */ +Timestamp.INT_CACHE_ = {}; + +// NOTE: the compiler should inline these constant values below and then remove +// these variables, so there should be no runtime penalty for these. + +/** + * Number used repeated below in calculations. This must appear before the + * first call to any from* function below. + * @type {number} + * @ignore + */ +Timestamp.TWO_PWR_16_DBL_ = 1 << 16; + +/** + * @type {number} + * @ignore + */ +Timestamp.TWO_PWR_24_DBL_ = 1 << 24; + +/** + * @type {number} + * @ignore + */ +Timestamp.TWO_PWR_32_DBL_ = Timestamp.TWO_PWR_16_DBL_ * Timestamp.TWO_PWR_16_DBL_; + +/** + * @type {number} + * @ignore + */ +Timestamp.TWO_PWR_31_DBL_ = Timestamp.TWO_PWR_32_DBL_ / 2; + +/** + * @type {number} + * @ignore + */ +Timestamp.TWO_PWR_48_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_16_DBL_; + +/** + * @type {number} + * @ignore + */ +Timestamp.TWO_PWR_64_DBL_ = Timestamp.TWO_PWR_32_DBL_ * Timestamp.TWO_PWR_32_DBL_; + +/** + * @type {number} + * @ignore + */ +Timestamp.TWO_PWR_63_DBL_ = Timestamp.TWO_PWR_64_DBL_ / 2; + +/** @type {Timestamp} */ +Timestamp.ZERO = Timestamp.fromInt(0); + +/** @type {Timestamp} */ +Timestamp.ONE = Timestamp.fromInt(1); + +/** @type {Timestamp} */ +Timestamp.NEG_ONE = Timestamp.fromInt(-1); + +/** @type {Timestamp} */ +Timestamp.MAX_VALUE = Timestamp.fromBits(0xffffffff | 0, 0x7fffffff | 0); + +/** @type {Timestamp} */ +Timestamp.MIN_VALUE = Timestamp.fromBits(0, 0x80000000 | 0); + +/** + * @type {Timestamp} + * @ignore + */ +Timestamp.TWO_PWR_24_ = Timestamp.fromInt(1 << 24); + +/** + * Expose. + */ +module.exports = Timestamp; +module.exports.Timestamp = Timestamp; diff --git a/node_modules/bson/package.json b/node_modules/bson/package.json new file mode 100644 index 00000000..5dc76e83 --- /dev/null +++ b/node_modules/bson/package.json @@ -0,0 +1,58 @@ +{ + "name": "bson", + "description": "A bson parser for node.js and the browser", + "keywords": [ + "mongodb", + "bson", + "parser" + ], + "files": [ + "lib", + "index.js", + "browser_build", + "bower.json" + ], + "version": "1.1.6", + "author": "Christian Amor Kvalheim ", + "contributors": [], + "repository": "mongodb/js-bson", + "bugs": { + "mail": "node-mongodb-native@googlegroups.com", + "url": "https://github.com/mongodb/js-bson/issues" + }, + "devDependencies": { + "benchmark": "1.0.0", + "colors": "1.1.0", + "nodeunit": "0.9.0", + "babel-core": "^6.14.0", + "babel-loader": "^6.2.5", + "babel-polyfill": "^6.13.0", + "babel-preset-es2015": "^6.14.0", + "babel-preset-stage-0": "^6.5.0", + "babel-register": "^6.14.0", + "conventional-changelog-cli": "^1.3.5", + "standard-version": "^9.1.1", + "webpack": "^1.13.2", + "webpack-polyfills-plugin": "0.0.9" + }, + "config": { + "native": false + }, + "main": "./index", + "directories": { + "lib": "./lib/bson" + }, + "engines": { + "node": ">=0.6.19" + }, + "scripts": { + "test": "nodeunit ./test/node", + "build": "webpack --config ./webpack.dist.config.js", + "changelog": "conventional-changelog -p angular -i HISTORY.md -s", + "lint": "eslint lib test", + "format": "prettier --print-width 100 --tab-width 2 --single-quote --write 'test/**/*.js' 'lib/**/*.js'", + "release": "standard-version -i HISTORY.md" + }, + "browser": "lib/bson/bson.js", + "license": "Apache-2.0" +} diff --git a/node_modules/bytes/History.md b/node_modules/bytes/History.md new file mode 100644 index 00000000..d60ce0e6 --- /dev/null +++ b/node_modules/bytes/History.md @@ -0,0 +1,97 @@ +3.1.2 / 2022-01-27 +================== + + * Fix return value for un-parsable strings + +3.1.1 / 2021-11-15 +================== + + * Fix "thousandsSeparator" incorrecting formatting fractional part + +3.1.0 / 2019-01-22 +================== + + * Add petabyte (`pb`) support + +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/node_modules/bytes/LICENSE b/node_modules/bytes/LICENSE new file mode 100644 index 00000000..63e95a96 --- /dev/null +++ b/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015 Jed Watson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/bytes/Readme.md b/node_modules/bytes/Readme.md new file mode 100644 index 00000000..5790e23e --- /dev/null +++ b/node_modules/bytes/Readme.md @@ -0,0 +1,152 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes(number｜string value, [options]): number｜string｜null + +Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number`｜`string` | Number value to format or string value to parse | +| options | `Object` | Conversion options for `format` | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`｜`number`｜`null` | Return null upon error. Numeric value in bytes, or string value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes('1KB'); +// output: 1024 +``` + +#### bytes.format(number value, [options]): string｜null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`｜`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`｜`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`｜`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. | +| unit | `string`｜`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`｜`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`｜`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes.format(1024); +// output: '1KB' + +bytes.format(1000); +// output: '1000B' + +bytes.format(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes.format(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes.format(1024, {unitSeparator: ' '}); +// output: '1 KB' +``` + +#### bytes.parse(string｜number value): number｜null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + * `pb` for petabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`｜`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`｜`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes.parse('1KB'); +// output: 1024 + +bytes.parse('1024'); +// output: 1024 + +bytes.parse(1024); +// output: 1024 +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci +[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master +[downloads-image]: https://badgen.net/npm/dm/bytes +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://badgen.net/npm/v/bytes +[npm-url]: https://npmjs.org/package/bytes diff --git a/node_modules/bytes/index.js b/node_modules/bytes/index.js new file mode 100644 index 00000000..6f2d0f89 --- /dev/null +++ b/node_modules/bytes/index.js @@ -0,0 +1,170 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: Math.pow(1024, 4), + pb: Math.pow(1024, 5), +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.pb) { + unit = 'PB'; + } else if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.split('.').map(function (s, i) { + return i === 0 + ? s.replace(formatThousandsRegExp, thousandsSeparator) + : s + }).join('.'); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + if (isNaN(floatValue)) { + return null; + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/node_modules/bytes/package.json b/node_modules/bytes/package.json new file mode 100644 index 00000000..f2b6a8b0 --- /dev/null +++ b/node_modules/bytes/package.json @@ -0,0 +1,42 @@ +{ + "name": "bytes", + "description": "Utility to parse a string bytes to bytes and vice-versa", + "version": "3.1.2", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "contributors": [ + "Jed Watson ", + "Théo FIDRY " + ], + "license": "MIT", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "repository": "visionmedia/bytes.js", + "devDependencies": { + "eslint": "7.32.0", + "eslint-plugin-markdown": "2.2.1", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/node_modules/call-bind/.eslintignore b/node_modules/call-bind/.eslintignore new file mode 100644 index 00000000..404abb22 --- /dev/null +++ b/node_modules/call-bind/.eslintignore @@ -0,0 +1 @@ +coverage/ diff --git a/node_modules/call-bind/.eslintrc b/node_modules/call-bind/.eslintrc new file mode 100644 index 00000000..dfa9a6cd --- /dev/null +++ b/node_modules/call-bind/.eslintrc @@ -0,0 +1,16 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "func-name-matching": 0, + "id-length": 0, + "new-cap": [2, { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + "no-magic-numbers": 0, + }, +} diff --git a/node_modules/call-bind/.github/FUNDING.yml b/node_modules/call-bind/.github/FUNDING.yml new file mode 100644 index 00000000..c70c2ecd --- /dev/null +++ b/node_modules/call-bind/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/call-bind +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/node_modules/call-bind/.nycrc b/node_modules/call-bind/.nycrc new file mode 100644 index 00000000..bdd626ce --- /dev/null +++ b/node_modules/call-bind/.nycrc @@ -0,0 +1,9 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "exclude": [ + "coverage", + "test" + ] +} diff --git a/node_modules/call-bind/CHANGELOG.md b/node_modules/call-bind/CHANGELOG.md new file mode 100644 index 00000000..c653f701 --- /dev/null +++ b/node_modules/call-bind/CHANGELOG.md @@ -0,0 +1,93 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.0.7](https://github.com/ljharb/call-bind/compare/v1.0.6...v1.0.7) - 2024-02-12 + +### Commits + +- [Refactor] use `es-define-property` [`09b76a0`](https://github.com/ljharb/call-bind/commit/09b76a01634440461d44a80c9924ec4b500f3b03) +- [Deps] update `get-intrinsic`, `set-function-length` [`ad5136d`](https://github.com/ljharb/call-bind/commit/ad5136ddda2a45c590959829ad3dce0c9f4e3590) + +## [v1.0.6](https://github.com/ljharb/call-bind/compare/v1.0.5...v1.0.6) - 2024-02-05 + +### Commits + +- [Dev Deps] update `aud`, `npmignore`, `tape` [`d564d5c`](https://github.com/ljharb/call-bind/commit/d564d5ce3e06a19df4d499c77f8d1a9da44e77aa) +- [Deps] update `get-intrinsic`, `set-function-length` [`cfc2bdc`](https://github.com/ljharb/call-bind/commit/cfc2bdca7b633df0e0e689e6b637f668f1c6792e) +- [Refactor] use `es-errors`, so things that only need those do not need `get-intrinsic` [`64cd289`](https://github.com/ljharb/call-bind/commit/64cd289ae5862c250a4ca80aa8d461047c166af5) +- [meta] add missing `engines.node` [`32a4038`](https://github.com/ljharb/call-bind/commit/32a4038857b62179f7f9b7b3df2c5260036be582) + +## [v1.0.5](https://github.com/ljharb/call-bind/compare/v1.0.4...v1.0.5) - 2023-10-19 + +### Commits + +- [Fix] throw an error on non-functions as early as possible [`f262408`](https://github.com/ljharb/call-bind/commit/f262408f822c840fbc268080f3ad7c429611066d) +- [Deps] update `set-function-length` [`3fff271`](https://github.com/ljharb/call-bind/commit/3fff27145a1e3a76a5b74f1d7c3c43d0fa3b9871) + +## [v1.0.4](https://github.com/ljharb/call-bind/compare/v1.0.3...v1.0.4) - 2023-10-19 + +## [v1.0.3](https://github.com/ljharb/call-bind/compare/v1.0.2...v1.0.3) - 2023-10-19 + +### Commits + +- [actions] reuse common workflows [`a994df6`](https://github.com/ljharb/call-bind/commit/a994df69f401f4bf735a4ccd77029b85d1549453) +- [meta] use `npmignore` to autogenerate an npmignore file [`eef3ef2`](https://github.com/ljharb/call-bind/commit/eef3ef21e1f002790837fedb8af2679c761fbdf5) +- [readme] flesh out content [`1845ccf`](https://github.com/ljharb/call-bind/commit/1845ccfd9976a607884cfc7157c93192cc16cf22) +- [actions] use `node/install` instead of `node/run`; use `codecov` action [`5b47d53`](https://github.com/ljharb/call-bind/commit/5b47d53d2fd74af5ea0a44f1d51e503cd42f7a90) +- [Refactor] use `set-function-length` [`a0e165c`](https://github.com/ljharb/call-bind/commit/a0e165c5dc61db781cbc919b586b1c2b8da0b150) +- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`9c50103`](https://github.com/ljharb/call-bind/commit/9c50103f44137279a817317cf6cc421a658f85b4) +- [meta] simplify "exports" [`019c6d0`](https://github.com/ljharb/call-bind/commit/019c6d06b0e1246ceed8e579f57e44441cbbf6d9) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `safe-publish-latest`, `tape` [`23bd718`](https://github.com/ljharb/call-bind/commit/23bd718a288d3b03042062b4ef5153b3cea83f11) +- [actions] update codecov uploader [`62552d7`](https://github.com/ljharb/call-bind/commit/62552d79cc79e05825e99aaba134ae5b37f33da5) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `tape` [`ec81665`](https://github.com/ljharb/call-bind/commit/ec81665b300f87eabff597afdc8b8092adfa7afd) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `safe-publish-latest`, `tape` [`35d67fc`](https://github.com/ljharb/call-bind/commit/35d67fcea883e686650f736f61da5ddca2592de8) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`0266d8d`](https://github.com/ljharb/call-bind/commit/0266d8d2a45086a922db366d0c2932fa463662ff) +- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`43a5b28`](https://github.com/ljharb/call-bind/commit/43a5b28a444e710e1bbf92adb8afb5cf7523a223) +- [Deps] update `define-data-property`, `function-bind`, `get-intrinsic` [`780eb36`](https://github.com/ljharb/call-bind/commit/780eb36552514f8cc99c70821ce698697c2726a5) +- [Dev Deps] update `aud`, `tape` [`90d50ad`](https://github.com/ljharb/call-bind/commit/90d50ad03b061e0268b3380b0065fcaec183dc05) +- [meta] use `prepublishOnly` script for npm 7+ [`44c5433`](https://github.com/ljharb/call-bind/commit/44c5433b7980e02b4870007046407cf6fc543329) +- [Deps] update `get-intrinsic` [`86bfbfc`](https://github.com/ljharb/call-bind/commit/86bfbfcf34afdc6eabc93ce3d408548d0e27d958) +- [Deps] update `get-intrinsic` [`5c53354`](https://github.com/ljharb/call-bind/commit/5c5335489be0294c18cd7a8bb6e08226ee019ff5) +- [actions] update checkout action [`4c393a8`](https://github.com/ljharb/call-bind/commit/4c393a8173b3c8e5b30d5b3297b3b94d48bf87f3) +- [Deps] update `get-intrinsic` [`4e70bde`](https://github.com/ljharb/call-bind/commit/4e70bdec0626acb11616d66250fc14565e716e91) +- [Deps] update `get-intrinsic` [`55ae803`](https://github.com/ljharb/call-bind/commit/55ae803a920bd93c369cd798c20de31f91e9fc60) + +## [v1.0.2](https://github.com/ljharb/call-bind/compare/v1.0.1...v1.0.2) - 2021-01-11 + +### Commits + +- [Fix] properly include the receiver in the bound length [`dbae7bc`](https://github.com/ljharb/call-bind/commit/dbae7bc676c079a0d33c0a43e9ef92cb7b01345d) + +## [v1.0.1](https://github.com/ljharb/call-bind/compare/v1.0.0...v1.0.1) - 2021-01-08 + +### Commits + +- [Tests] migrate tests to Github Actions [`b6db284`](https://github.com/ljharb/call-bind/commit/b6db284c36f8ccd195b88a6764fe84b7223a0da1) +- [meta] do not publish github action workflow files [`ec7fe46`](https://github.com/ljharb/call-bind/commit/ec7fe46e60cfa4764ee943d2755f5e5a366e578e) +- [Fix] preserve original function’s length when possible [`adbceaa`](https://github.com/ljharb/call-bind/commit/adbceaa3cac4b41ea78bb19d7ccdbaaf7e0bdadb) +- [Tests] gather coverage data on every job [`d69e23c`](https://github.com/ljharb/call-bind/commit/d69e23cc65f101ba1d4c19bb07fa8eb0ec624be8) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`2fd3586`](https://github.com/ljharb/call-bind/commit/2fd3586c5d47b335364c14293114c6b625ae1f71) +- [Deps] update `get-intrinsic` [`f23e931`](https://github.com/ljharb/call-bind/commit/f23e9318cc271c2add8bb38cfded85ee7baf8eee) +- [Deps] update `get-intrinsic` [`72d9f44`](https://github.com/ljharb/call-bind/commit/72d9f44e184465ba8dd3fb48260bbcff234985f2) +- [meta] fix FUNDING.yml [`e723573`](https://github.com/ljharb/call-bind/commit/e723573438c5a68dcec31fb5d96ea6b7e4a93be8) +- [eslint] ignore coverage output [`15e76d2`](https://github.com/ljharb/call-bind/commit/15e76d28a5f43e504696401e5b31ebb78ee1b532) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`8fa4dab`](https://github.com/ljharb/call-bind/commit/8fa4dabb23ba3dd7bb92c9571c1241c08b56e4b6) + +## v1.0.0 - 2020-10-30 + +### Commits + +- Initial commit [`306cf98`](https://github.com/ljharb/call-bind/commit/306cf98c7ec9e7ef66b653ec152277ac1381eb50) +- Tests [`e10d0bb`](https://github.com/ljharb/call-bind/commit/e10d0bbdadc7a10ecedc9a1c035112d3e368b8df) +- Implementation [`43852ed`](https://github.com/ljharb/call-bind/commit/43852eda0f187327b7fad2423ca972149a52bd65) +- npm init [`408f860`](https://github.com/ljharb/call-bind/commit/408f860b773a2f610805fd3613d0d71bac1b6249) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`fb349b2`](https://github.com/ljharb/call-bind/commit/fb349b2e48defbec8b5ec8a8395cc8f69f220b13) +- [meta] add `auto-changelog` [`c4001fc`](https://github.com/ljharb/call-bind/commit/c4001fc43031799ef908211c98d3b0fb2b60fde4) +- [meta] add "funding"; create `FUNDING.yml` [`d4d6d29`](https://github.com/ljharb/call-bind/commit/d4d6d2974a14bc2e98830468eda7fe6d6a776717) +- [Tests] add `npm run lint` [`dedfb98`](https://github.com/ljharb/call-bind/commit/dedfb98bd0ecefb08ddb9a94061bd10cde4332af) +- Only apps should have lockfiles [`54ac776`](https://github.com/ljharb/call-bind/commit/54ac77653db45a7361dc153d2f478e743f110650) +- [meta] add `safe-publish-latest` [`9ea8e43`](https://github.com/ljharb/call-bind/commit/9ea8e435b950ce9b705559cd651039f9bf40140f) diff --git a/node_modules/call-bind/LICENSE b/node_modules/call-bind/LICENSE new file mode 100644 index 00000000..48f05d01 --- /dev/null +++ b/node_modules/call-bind/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2020 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/call-bind/README.md b/node_modules/call-bind/README.md new file mode 100644 index 00000000..48e9047f --- /dev/null +++ b/node_modules/call-bind/README.md @@ -0,0 +1,64 @@ +# call-bind [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![dependency status][deps-svg]][deps-url] +[![dev dependency status][dev-deps-svg]][dev-deps-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Robustly `.call.bind()` a function. + +## Getting started + +```sh +npm install --save call-bind +``` + +## Usage/Examples + +```js +const assert = require('assert'); +const callBind = require('call-bind'); +const callBound = require('call-bind/callBound'); + +function f(a, b) { + assert.equal(this, 1); + assert.equal(a, 2); + assert.equal(b, 3); + assert.equal(arguments.length, 2); +} + +const fBound = callBind(f); + +const slice = callBound('Array.prototype.slice'); + +delete Function.prototype.call; +delete Function.prototype.bind; + +fBound(1, 2, 3); + +assert.deepEqual(slice([1, 2, 3, 4], 1, -1), [2, 3]); +``` + +## Tests + +Clone the repo, `npm install`, and run `npm test` + +[package-url]: https://npmjs.org/package/call-bind +[npm-version-svg]: https://versionbadg.es/ljharb/call-bind.svg +[deps-svg]: https://david-dm.org/ljharb/call-bind.svg +[deps-url]: https://david-dm.org/ljharb/call-bind +[dev-deps-svg]: https://david-dm.org/ljharb/call-bind/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/call-bind#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/call-bind.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/call-bind.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/call-bind.svg +[downloads-url]: https://npm-stat.com/charts.html?package=call-bind +[codecov-image]: https://codecov.io/gh/ljharb/call-bind/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/call-bind/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bind +[actions-url]: https://github.com/ljharb/call-bind/actions diff --git a/node_modules/call-bind/callBound.js b/node_modules/call-bind/callBound.js new file mode 100644 index 00000000..8374adfd --- /dev/null +++ b/node_modules/call-bind/callBound.js @@ -0,0 +1,15 @@ +'use strict'; + +var GetIntrinsic = require('get-intrinsic'); + +var callBind = require('./'); + +var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf')); + +module.exports = function callBoundIntrinsic(name, allowMissing) { + var intrinsic = GetIntrinsic(name, !!allowMissing); + if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) { + return callBind(intrinsic); + } + return intrinsic; +}; diff --git a/node_modules/call-bind/index.js b/node_modules/call-bind/index.js new file mode 100644 index 00000000..01c5b3d4 --- /dev/null +++ b/node_modules/call-bind/index.js @@ -0,0 +1,35 @@ +'use strict'; + +var bind = require('function-bind'); +var GetIntrinsic = require('get-intrinsic'); +var setFunctionLength = require('set-function-length'); + +var $TypeError = require('es-errors/type'); +var $apply = GetIntrinsic('%Function.prototype.apply%'); +var $call = GetIntrinsic('%Function.prototype.call%'); +var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply); + +var $defineProperty = require('es-define-property'); +var $max = GetIntrinsic('%Math.max%'); + +module.exports = function callBind(originalFunction) { + if (typeof originalFunction !== 'function') { + throw new $TypeError('a function is required'); + } + var func = $reflectApply(bind, $call, arguments); + return setFunctionLength( + func, + 1 + $max(0, originalFunction.length - (arguments.length - 1)), + true + ); +}; + +var applyBind = function applyBind() { + return $reflectApply(bind, $apply, arguments); +}; + +if ($defineProperty) { + $defineProperty(module.exports, 'apply', { value: applyBind }); +} else { + module.exports.apply = applyBind; +} diff --git a/node_modules/call-bind/package.json b/node_modules/call-bind/package.json new file mode 100644 index 00000000..5ba88ff8 --- /dev/null +++ b/node_modules/call-bind/package.json @@ -0,0 +1,95 @@ +{ + "name": "call-bind", + "version": "1.0.7", + "description": "Robustly `.call.bind()` a function", + "main": "index.js", + "exports": { + ".": "./index.js", + "./callBound": "./callBound.js", + "./package.json": "./package.json" + }, + "scripts": { + "prepack": "npmignore --auto --commentLines=auto", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "lint": "eslint --ext=.js,.mjs .", + "postlint": "evalmd README.md", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "aud --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/call-bind.git" + }, + "keywords": [ + "javascript", + "ecmascript", + "es", + "js", + "callbind", + "callbound", + "call", + "bind", + "bound", + "call-bind", + "call-bound", + "function", + "es-abstract" + ], + "author": "Jordan Harband ", + "funding": { + "url": "https://github.com/sponsors/ljharb" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/call-bind/issues" + }, + "homepage": "https://github.com/ljharb/call-bind#readme", + "devDependencies": { + "@ljharb/eslint-config": "^21.1.0", + "aud": "^2.0.4", + "auto-changelog": "^2.4.0", + "es-value-fixtures": "^1.4.2", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-strict-mode": "^1.0.1", + "in-publish": "^2.0.1", + "npmignore": "^0.3.1", + "nyc": "^10.3.2", + "object-inspect": "^1.13.1", + "safe-publish-latest": "^2.0.0", + "tape": "^5.7.4" + }, + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "set-function-length": "^1.2.1" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows" + ] + }, + "engines": { + "node": ">= 0.4" + } +} diff --git a/node_modules/call-bind/test/callBound.js b/node_modules/call-bind/test/callBound.js new file mode 100644 index 00000000..c32319d7 --- /dev/null +++ b/node_modules/call-bind/test/callBound.js @@ -0,0 +1,54 @@ +'use strict'; + +var test = require('tape'); + +var callBound = require('../callBound'); + +test('callBound', function (t) { + // static primitive + t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself'); + t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself'); + + // static non-function object + t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself'); + t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself'); + t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself'); + t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself'); + + // static function + t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself'); + t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself'); + + // prototype primitive + t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself'); + t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself'); + + // prototype function + t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself'); + t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself'); + t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original'); + t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original'); + + t['throws']( + function () { callBound('does not exist'); }, + SyntaxError, + 'nonexistent intrinsic throws' + ); + t['throws']( + function () { callBound('does not exist', true); }, + SyntaxError, + 'allowMissing arg still throws for unknown intrinsic' + ); + + t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) { + st['throws']( + function () { callBound('WeakRef'); }, + TypeError, + 'real but absent intrinsic throws' + ); + st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception'); + st.end(); + }); + + t.end(); +}); diff --git a/node_modules/call-bind/test/index.js b/node_modules/call-bind/test/index.js new file mode 100644 index 00000000..1fd46689 --- /dev/null +++ b/node_modules/call-bind/test/index.js @@ -0,0 +1,80 @@ +'use strict'; + +var callBind = require('../'); +var bind = require('function-bind'); +var gOPD = require('gopd'); +var hasStrictMode = require('has-strict-mode')(); +var forEach = require('for-each'); +var inspect = require('object-inspect'); +var v = require('es-value-fixtures'); + +var test = require('tape'); + +/* + * older engines have length nonconfigurable + * in io.js v3, it is configurable except on bound functions, hence the .bind() + */ +var functionsHaveConfigurableLengths = !!( + gOPD + && Object.getOwnPropertyDescriptor + && Object.getOwnPropertyDescriptor(bind.call(function () {}), 'length').configurable +); + +test('callBind', function (t) { + forEach(v.nonFunctions, function (nonFunction) { + t['throws']( + function () { callBind(nonFunction); }, + TypeError, + inspect(nonFunction) + ' is not a function' + ); + }); + + var sentinel = { sentinel: true }; + var func = function (a, b) { + // eslint-disable-next-line no-invalid-this + return [!hasStrictMode && this === global ? undefined : this, a, b]; + }; + t.equal(func.length, 2, 'original function length is 2'); + t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args'); + t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args'); + t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args'); + + var bound = callBind(func); + t.equal(bound.length, func.length + 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with too few args'); + t.deepEqual(bound(1, 2), [hasStrictMode ? 1 : Object(1), 2, undefined], 'bound func with right args'); + t.deepEqual(bound(1, 2, 3), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with too many args'); + + var boundR = callBind(func, sentinel); + t.equal(boundR.length, func.length, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args'); + t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args'); + t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args'); + + var boundArg = callBind(func, sentinel, 1); + t.equal(boundArg.length, func.length - 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args'); + t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg'); + t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args'); + + t.test('callBind.apply', function (st) { + var aBound = callBind.apply(func); + st.deepEqual(aBound(sentinel), [sentinel, undefined, undefined], 'apply-bound func with no args'); + st.deepEqual(aBound(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + st.deepEqual(aBound(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + + var aBoundArg = callBind.apply(func); + st.deepEqual(aBoundArg(sentinel, [1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with too many args'); + st.deepEqual(aBoundArg(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + st.deepEqual(aBoundArg(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + + var aBoundR = callBind.apply(func, sentinel); + st.deepEqual(aBoundR([1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with receiver and too many args'); + st.deepEqual(aBoundR([1, 2], 4), [sentinel, 1, 2], 'apply-bound func with receiver and right args'); + st.deepEqual(aBoundR([1], 4), [sentinel, 1, undefined], 'apply-bound func with receiver and too few args'); + + st.end(); + }); + + t.end(); +}); diff --git a/node_modules/content-disposition/HISTORY.md b/node_modules/content-disposition/HISTORY.md new file mode 100644 index 00000000..488effa0 --- /dev/null +++ b/node_modules/content-disposition/HISTORY.md @@ -0,0 +1,60 @@ +0.5.4 / 2021-12-10 +================== + + * deps: safe-buffer@5.2.1 + +0.5.3 / 2018-12-17 +================== + + * Use `safe-buffer` for improved Buffer API + +0.5.2 / 2016-12-08 +================== + + * Fix `parse` to accept any linear whitespace character + +0.5.1 / 2016-01-17 +================== + + * perf: enable strict mode + +0.5.0 / 2014-10-11 +================== + + * Add `parse` function + +0.4.0 / 2014-09-21 +================== + + * Expand non-Unicode `filename` to the full ISO-8859-1 charset + +0.3.0 / 2014-09-20 +================== + + * Add `fallback` option + * Add `type` option + +0.2.0 / 2014-09-19 +================== + + * Reduce ambiguity of file names with hex escape in buggy browsers + +0.1.2 / 2014-09-19 +================== + + * Fix periodic invalid Unicode filename header + +0.1.1 / 2014-09-19 +================== + + * Fix invalid characters appearing in `filename*` parameter + +0.1.0 / 2014-09-18 +================== + + * Make the `filename` argument optional + +0.0.0 / 2014-09-18 +================== + + * Initial release diff --git a/node_modules/content-disposition/LICENSE b/node_modules/content-disposition/LICENSE new file mode 100644 index 00000000..84441fbb --- /dev/null +++ b/node_modules/content-disposition/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/content-disposition/README.md b/node_modules/content-disposition/README.md new file mode 100644 index 00000000..3a0bb055 --- /dev/null +++ b/node_modules/content-disposition/README.md @@ -0,0 +1,142 @@ +# content-disposition + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP `Content-Disposition` header + +## Installation + +```sh +$ npm install content-disposition +``` + +## API + +```js +var contentDisposition = require('content-disposition') +``` + +### contentDisposition(filename, options) + +Create an attachment `Content-Disposition` header value using the given file name, +if supplied. The `filename` is optional and if no file name is desired, but you +want to specify `options`, set `filename` to `undefined`. + +```js +res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf')) +``` + +**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this +header through a means different from `setHeader` in Node.js, you'll want to specify +the `'binary'` encoding in Node.js. + +#### Options + +`contentDisposition` accepts these properties in the options object. + +##### fallback + +If the `filename` option is outside ISO-8859-1, then the file name is actually +stored in a supplemental field for clients that support Unicode file names and +a ISO-8859-1 version of the file name is automatically generated. + +This specifies the ISO-8859-1 file name to override the automatic generation or +disables the generation all together, defaults to `true`. + + - A string will specify the ISO-8859-1 file name to use in place of automatic + generation. + - `false` will disable including a ISO-8859-1 file name and only include the + Unicode version (unless the file name is already ISO-8859-1). + - `true` will enable automatic generation if the file name is outside ISO-8859-1. + +If the `filename` option is ISO-8859-1 and this option is specified and has a +different value, then the `filename` option is encoded in the extended field +and this set as the fallback field, even though they are both ISO-8859-1. + +##### type + +Specifies the disposition type, defaults to `"attachment"`. This can also be +`"inline"`, or any other value (all values except inline are treated like +`attachment`, but can convey additional information if both parties agree to +it). The type is normalized to lower-case. + +### contentDisposition.parse(string) + +```js +var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt') +``` + +Parse a `Content-Disposition` header string. This automatically handles extended +("Unicode") parameters by decoding them and providing them under the standard +parameter name. This will return an object with the following properties (examples +are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`): + + - `type`: The disposition type (always lower case). Example: `'attachment'` + + - `parameters`: An object of the parameters in the disposition (name of parameter + always lower case and extended versions replace non-extended versions). Example: + `{filename: "€ rates.txt"}` + +## Examples + +### Send a file for download + +```js +var contentDisposition = require('content-disposition') +var destroy = require('destroy') +var fs = require('fs') +var http = require('http') +var onFinished = require('on-finished') + +var filePath = '/path/to/public/plans.pdf' + +http.createServer(function onRequest (req, res) { + // set headers + res.setHeader('Content-Type', 'application/pdf') + res.setHeader('Content-Disposition', contentDisposition(filePath)) + + // send file + var stream = fs.createReadStream(filePath) + stream.pipe(res) + onFinished(res, function () { + destroy(stream) + }) +}) +``` + +## Testing + +```sh +$ npm test +``` + +## References + +- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616] +- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987] +- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266] +- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231] + +[rfc-2616]: https://tools.ietf.org/html/rfc2616 +[rfc-5987]: https://tools.ietf.org/html/rfc5987 +[rfc-6266]: https://tools.ietf.org/html/rfc6266 +[tc-2231]: http://greenbytes.de/tech/tc2231/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-disposition.svg +[npm-url]: https://npmjs.org/package/content-disposition +[node-version-image]: https://img.shields.io/node/v/content-disposition.svg +[node-version-url]: https://nodejs.org/en/download +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master +[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg +[downloads-url]: https://npmjs.org/package/content-disposition +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci diff --git a/node_modules/content-disposition/index.js b/node_modules/content-disposition/index.js new file mode 100644 index 00000000..ecec899a --- /dev/null +++ b/node_modules/content-disposition/index.js @@ -0,0 +1,458 @@ +/*! + * content-disposition + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = contentDisposition +module.exports.parse = parse + +/** + * Module dependencies. + * @private + */ + +var basename = require('path').basename +var Buffer = require('safe-buffer').Buffer + +/** + * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%") + * @private + */ + +var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex + +/** + * RegExp to match percent encoding escape. + * @private + */ + +var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/ +var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g + +/** + * RegExp to match non-latin1 characters. + * @private + */ + +var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + * @private + */ + +var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + * @private + */ + +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp for various RFC 2616 grammar + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * HT = + * CTL = + * OCTET = + * @private + */ + +var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/ + +/** + * RegExp for various RFC 5987 grammar + * + * ext-value = charset "'" [ language ] "'" value-chars + * charset = "UTF-8" / "ISO-8859-1" / mime-charset + * mime-charset = 1*mime-charsetc + * mime-charsetc = ALPHA / DIGIT + * / "!" / "#" / "$" / "%" / "&" + * / "+" / "-" / "^" / "_" / "`" + * / "{" / "}" / "~" + * language = ( 2*3ALPHA [ extlang ] ) + * / 4ALPHA + * / 5*8ALPHA + * extlang = *3( "-" 3ALPHA ) + * value-chars = *( pct-encoded / attr-char ) + * pct-encoded = "%" HEXDIG HEXDIG + * attr-char = ALPHA / DIGIT + * / "!" / "#" / "$" / "&" / "+" / "-" / "." + * / "^" / "_" / "`" / "|" / "~" + * @private + */ + +var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/ + +/** + * RegExp for various RFC 6266 grammar + * + * disposition-type = "inline" | "attachment" | disp-ext-type + * disp-ext-type = token + * disposition-parm = filename-parm | disp-ext-parm + * filename-parm = "filename" "=" value + * | "filename*" "=" ext-value + * disp-ext-parm = token "=" value + * | ext-token "=" ext-value + * ext-token = + * @private + */ + +var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex + +/** + * Create an attachment Content-Disposition header. + * + * @param {string} [filename] + * @param {object} [options] + * @param {string} [options.type=attachment] + * @param {string|boolean} [options.fallback=true] + * @return {string} + * @public + */ + +function contentDisposition (filename, options) { + var opts = options || {} + + // get type + var type = opts.type || 'attachment' + + // get parameters + var params = createparams(filename, opts.fallback) + + // format into string + return format(new ContentDisposition(type, params)) +} + +/** + * Create parameters object from filename and fallback. + * + * @param {string} [filename] + * @param {string|boolean} [fallback=true] + * @return {object} + * @private + */ + +function createparams (filename, fallback) { + if (filename === undefined) { + return + } + + var params = {} + + if (typeof filename !== 'string') { + throw new TypeError('filename must be a string') + } + + // fallback defaults to true + if (fallback === undefined) { + fallback = true + } + + if (typeof fallback !== 'string' && typeof fallback !== 'boolean') { + throw new TypeError('fallback must be a string or boolean') + } + + if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) { + throw new TypeError('fallback must be ISO-8859-1 string') + } + + // restrict to file base name + var name = basename(filename) + + // determine if name is suitable for quoted string + var isQuotedString = TEXT_REGEXP.test(name) + + // generate fallback name + var fallbackName = typeof fallback !== 'string' + ? fallback && getlatin1(name) + : basename(fallback) + var hasFallback = typeof fallbackName === 'string' && fallbackName !== name + + // set extended filename parameter + if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) { + params['filename*'] = name + } + + // set filename parameter + if (isQuotedString || hasFallback) { + params.filename = hasFallback + ? fallbackName + : name + } + + return params +} + +/** + * Format object to Content-Disposition header. + * + * @param {object} obj + * @param {string} obj.type + * @param {object} [obj.parameters] + * @return {string} + * @private + */ + +function format (obj) { + var parameters = obj.parameters + var type = obj.type + + if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + // start with normalized type + var string = String(type).toLowerCase() + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + var val = param.substr(-1) === '*' + ? ustring(parameters[param]) + : qstring(parameters[param]) + + string += '; ' + param + '=' + val + } + } + + return string +} + +/** + * Decode a RFC 5987 field value (gracefully). + * + * @param {string} str + * @return {string} + * @private + */ + +function decodefield (str) { + var match = EXT_VALUE_REGEXP.exec(str) + + if (!match) { + throw new TypeError('invalid extended field value') + } + + var charset = match[1].toLowerCase() + var encoded = match[2] + var value + + // to binary string + var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode) + + switch (charset) { + case 'iso-8859-1': + value = getlatin1(binary) + break + case 'utf-8': + value = Buffer.from(binary, 'binary').toString('utf8') + break + default: + throw new TypeError('unsupported charset in extended field') + } + + return value +} + +/** + * Get ISO-8859-1 version of string. + * + * @param {string} val + * @return {string} + * @private + */ + +function getlatin1 (val) { + // simple Unicode -> ISO-8859-1 transformation + return String(val).replace(NON_LATIN1_REGEXP, '?') +} + +/** + * Parse Content-Disposition header string. + * + * @param {string} string + * @return {object} + * @public + */ + +function parse (string) { + if (!string || typeof string !== 'string') { + throw new TypeError('argument string is required') + } + + var match = DISPOSITION_TYPE_REGEXP.exec(string) + + if (!match) { + throw new TypeError('invalid type format') + } + + // normalize type + var index = match[0].length + var type = match[1].toLowerCase() + + var key + var names = [] + var params = {} + var value + + // calculate index to start at + index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';' + ? index - 1 + : index + + // match parameters + while ((match = PARAM_REGEXP.exec(string))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (names.indexOf(key) !== -1) { + throw new TypeError('invalid duplicate parameter') + } + + names.push(key) + + if (key.indexOf('*') + 1 === key.length) { + // decode extended value + key = key.slice(0, -1) + value = decodefield(value) + + // overwrite existing value + params[key] = value + continue + } + + if (typeof params[key] === 'string') { + continue + } + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return new ContentDisposition(type, params) +} + +/** + * Percent decode a single character. + * + * @param {string} str + * @param {string} hex + * @return {string} + * @private + */ + +function pdecode (str, hex) { + return String.fromCharCode(parseInt(hex, 16)) +} + +/** + * Percent encode a single character. + * + * @param {string} char + * @return {string} + * @private + */ + +function pencode (char) { + return '%' + String(char) + .charCodeAt(0) + .toString(16) + .toUpperCase() +} + +/** + * Quote a string for HTTP. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Encode a Unicode string for HTTP (RFC 5987). + * + * @param {string} val + * @return {string} + * @private + */ + +function ustring (val) { + var str = String(val) + + // percent encode as UTF-8 + var encoded = encodeURIComponent(str) + .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode) + + return 'UTF-8\'\'' + encoded +} + +/** + * Class for parsed Content-Disposition header for v8 optimization + * + * @public + * @param {string} type + * @param {object} parameters + * @constructor + */ + +function ContentDisposition (type, parameters) { + this.type = type + this.parameters = parameters +} diff --git a/node_modules/content-disposition/package.json b/node_modules/content-disposition/package.json new file mode 100644 index 00000000..43c70ce2 --- /dev/null +++ b/node_modules/content-disposition/package.json @@ -0,0 +1,44 @@ +{ + "name": "content-disposition", + "description": "Create and parse Content-Disposition header", + "version": "0.5.4", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-disposition", + "http", + "rfc6266", + "res" + ], + "repository": "jshttp/content-disposition", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "13.0.1", + "eslint-plugin-import": "2.25.3", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "istanbul": "0.4.5", + "mocha": "9.1.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + } +} diff --git a/node_modules/content-type/HISTORY.md b/node_modules/content-type/HISTORY.md new file mode 100644 index 00000000..45836713 --- /dev/null +++ b/node_modules/content-type/HISTORY.md @@ -0,0 +1,29 @@ +1.0.5 / 2023-01-29 +================== + + * perf: skip value escaping when unnecessary + +1.0.4 / 2017-09-11 +================== + + * perf: skip parameter parsing when no parameters + +1.0.3 / 2017-09-10 +================== + + * perf: remove argument reassignment + +1.0.2 / 2016-05-09 +================== + + * perf: enable strict mode + +1.0.1 / 2015-02-13 +================== + + * Improve missing `Content-Type` header error message + +1.0.0 / 2015-02-01 +================== + + * Initial implementation, derived from `media-typer@0.3.0` diff --git a/node_modules/content-type/LICENSE b/node_modules/content-type/LICENSE new file mode 100644 index 00000000..34b1a2de --- /dev/null +++ b/node_modules/content-type/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/content-type/README.md b/node_modules/content-type/README.md new file mode 100644 index 00000000..c1a922a9 --- /dev/null +++ b/node_modules/content-type/README.md @@ -0,0 +1,94 @@ +# content-type + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Create and parse HTTP Content-Type header according to RFC 7231 + +## Installation + +```sh +$ npm install content-type +``` + +## API + +```js +var contentType = require('content-type') +``` + +### contentType.parse(string) + +```js +var obj = contentType.parse('image/svg+xml; charset=utf-8') +``` + +Parse a `Content-Type` header. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (the type and subtype, always lower case). + Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter + always lower case). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the string is missing or invalid. + +### contentType.parse(req) + +```js +var obj = contentType.parse(req) +``` + +Parse the `Content-Type` header from the given `req`. Short-cut for +`contentType.parse(req.headers['content-type'])`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.parse(res) + +```js +var obj = contentType.parse(res) +``` + +Parse the `Content-Type` header set on the given `res`. Short-cut for +`contentType.parse(res.getHeader('content-type'))`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.format(obj) + +```js +var str = contentType.format({ + type: 'image/svg+xml', + parameters: { charset: 'utf-8' } +}) +``` + +Format an object into a `Content-Type` header. This will return a string of the +content type for the given object with the following properties (examples are +shown that produce the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of the + parameter will be lower-cased). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the object contains an invalid type or parameter names. + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/content-type/master?label=ci +[ci-url]: https://github.com/jshttp/content-type/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/content-type/master +[coveralls-url]: https://coveralls.io/r/jshttp/content-type?branch=master +[node-image]: https://badgen.net/npm/node/content-type +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/content-type +[npm-url]: https://npmjs.org/package/content-type +[npm-version-image]: https://badgen.net/npm/v/content-type diff --git a/node_modules/content-type/index.js b/node_modules/content-type/index.js new file mode 100644 index 00000000..41840e7b --- /dev/null +++ b/node_modules/content-type/index.js @@ -0,0 +1,225 @@ +/*! + * content-type + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1 + * + * parameter = token "=" ( token / quoted-string ) + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE + * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text + * obs-text = %x80-FF + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + */ +var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ // eslint-disable-line no-control-regex +var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * RegExp to match quoted-pair in RFC 7230 sec 3.2.6 + * + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + * obs-text = %x80-FF + */ +var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6 + */ +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp to match type in RFC 7231 sec 3.1.1.1 + * + * media-type = type "/" subtype + * type = token + * subtype = token + */ +var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * Module exports. + * @public + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @public + */ + +function format (obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var type = obj.type + + if (!type || !TYPE_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + var string = type + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!TOKEN_REGEXP.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @public + */ + +function parse (string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + var header = typeof string === 'object' + ? getcontenttype(string) + : string + + if (typeof header !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = header.indexOf(';') + var type = index !== -1 + ? header.slice(0, index).trim() + : header.trim() + + if (!TYPE_REGEXP.test(type)) { + throw new TypeError('invalid media type') + } + + var obj = new ContentType(type.toLowerCase()) + + // parse parameters + if (index !== -1) { + var key + var match + var value + + PARAM_REGEXP.lastIndex = index + + while ((match = PARAM_REGEXP.exec(header))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value.charCodeAt(0) === 0x22 /* " */) { + // remove quotes + value = value.slice(1, -1) + + // remove escapes + if (value.indexOf('\\') !== -1) { + value = value.replace(QESC_REGEXP, '$1') + } + } + + obj.parameters[key] = value + } + + if (index !== header.length) { + throw new TypeError('invalid parameter format') + } + } + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @private + */ + +function getcontenttype (obj) { + var header + + if (typeof obj.getHeader === 'function') { + // res-like + header = obj.getHeader('content-type') + } else if (typeof obj.headers === 'object') { + // req-like + header = obj.headers && obj.headers['content-type'] + } + + if (typeof header !== 'string') { + throw new TypeError('content-type header is missing from object') + } + + return header +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + // no need to quote tokens + if (TOKEN_REGEXP.test(str)) { + return str + } + + if (str.length > 0 && !TEXT_REGEXP.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Class to represent a content type. + * @private + */ +function ContentType (type) { + this.parameters = Object.create(null) + this.type = type +} diff --git a/node_modules/content-type/package.json b/node_modules/content-type/package.json new file mode 100644 index 00000000..9db19f63 --- /dev/null +++ b/node_modules/content-type/package.json @@ -0,0 +1,42 @@ +{ + "name": "content-type", + "description": "Create and parse HTTP Content-Type header", + "version": "1.0.5", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-type", + "http", + "req", + "res", + "rfc7231" + ], + "repository": "jshttp/content-type", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "8.32.0", + "eslint-config-standard": "15.0.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "10.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/cookie-signature/.npmignore b/node_modules/cookie-signature/.npmignore new file mode 100644 index 00000000..f1250e58 --- /dev/null +++ b/node_modules/cookie-signature/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/node_modules/cookie-signature/History.md b/node_modules/cookie-signature/History.md new file mode 100644 index 00000000..78513cc3 --- /dev/null +++ b/node_modules/cookie-signature/History.md @@ -0,0 +1,38 @@ +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/cookie-signature/Readme.md b/node_modules/cookie-signature/Readme.md new file mode 100644 index 00000000..2559e841 --- /dev/null +++ b/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/cookie-signature/index.js b/node_modules/cookie-signature/index.js new file mode 100644 index 00000000..b8c9463a --- /dev/null +++ b/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/node_modules/cookie-signature/package.json b/node_modules/cookie-signature/package.json new file mode 100644 index 00000000..29c4498e --- /dev/null +++ b/node_modules/cookie-signature/package.json @@ -0,0 +1,18 @@ +{ + "name": "cookie-signature", + "version": "1.0.6", + "description": "Sign and unsign cookies", + "keywords": ["cookie", "sign", "unsign"], + "author": "TJ Holowaychuk ", + "license": "MIT", + "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"}, + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "main": "index" +} diff --git a/node_modules/cookie/HISTORY.md b/node_modules/cookie/HISTORY.md new file mode 100644 index 00000000..41ae4b01 --- /dev/null +++ b/node_modules/cookie/HISTORY.md @@ -0,0 +1,147 @@ +0.6.0 / 2023-11-06 +================== + + * Add `partitioned` option + +0.5.0 / 2022-04-11 +================== + + * Add `priority` option + * Fix `expires` option to reject invalid dates + * perf: improve default decode speed + * perf: remove slow string split in parse + +0.4.2 / 2022-02-02 +================== + + * perf: read value only when assigning in parse + * perf: remove unnecessary regexp in parse + +0.4.1 / 2020-04-21 +================== + + * Fix `maxAge` option to reject invalid values + +0.4.0 / 2019-05-15 +================== + + * Add `SameSite=None` support + +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatenation for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/node_modules/cookie/LICENSE b/node_modules/cookie/LICENSE new file mode 100644 index 00000000..058b6b4e --- /dev/null +++ b/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/cookie/README.md b/node_modules/cookie/README.md new file mode 100644 index 00000000..71fdac11 --- /dev/null +++ b/node_modules/cookie/README.md @@ -0,0 +1,317 @@ +# cookie + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `encodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### partitioned + +Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies) +attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not. By default, the +`Partitioned` attribute is not set. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +More information about can be found in [the proposal](https://github.com/privacycg/CHIPS). + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path +is considered the ["default path"][rfc-6265-5.1.4]. + +##### priority + +Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1]. + + - `'low'` will set the `Priority` attribute to `Low`. + - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set. + - `'high'` will set the `Priority` attribute to `High`. + +More information about the different priority levels can be found in +[the specification][rfc-west-cookie-priority-00-4.1]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-09-5.4.7]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end('
'); +} + +http.createServer(onRequest).listen(3000); +``` + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +``` +$ npm run bench + +> cookie@0.5.0 bench +> node benchmark/index.js + + node@18.18.2 + acorn@8.10.0 + ada@2.6.0 + ares@1.19.1 + brotli@1.0.9 + cldr@43.1 + icu@73.2 + llhttp@6.0.11 + modules@108 + napi@9 + nghttp2@1.57.0 + nghttp3@0.7.0 + ngtcp2@0.8.1 + openssl@3.0.10+quic + simdutf@3.2.14 + tz@2023c + undici@5.26.3 + unicode@15.0 + uv@1.44.2 + uvwasi@0.0.18 + v8@10.2.154.26-node.26 + zlib@1.2.13.1-motley + +> node benchmark/parse-top.js + + cookie.parse - top sites + + 14 tests completed. + + parse accounts.google.com x 2,588,913 ops/sec ±0.74% (186 runs sampled) + parse apple.com x 2,370,002 ops/sec ±0.69% (186 runs sampled) + parse cloudflare.com x 2,213,102 ops/sec ±0.88% (188 runs sampled) + parse docs.google.com x 2,194,157 ops/sec ±1.03% (184 runs sampled) + parse drive.google.com x 2,265,084 ops/sec ±0.79% (187 runs sampled) + parse en.wikipedia.org x 457,099 ops/sec ±0.81% (186 runs sampled) + parse linkedin.com x 504,407 ops/sec ±0.89% (186 runs sampled) + parse maps.google.com x 1,230,959 ops/sec ±0.98% (186 runs sampled) + parse microsoft.com x 926,294 ops/sec ±0.88% (184 runs sampled) + parse play.google.com x 2,311,338 ops/sec ±0.83% (185 runs sampled) + parse support.google.com x 1,508,850 ops/sec ±0.86% (186 runs sampled) + parse www.google.com x 1,022,582 ops/sec ±1.32% (182 runs sampled) + parse youtu.be x 332,136 ops/sec ±1.02% (185 runs sampled) + parse youtube.com x 323,833 ops/sec ±0.77% (183 runs sampled) + +> node benchmark/parse.js + + cookie.parse - generic + + 6 tests completed. + + simple x 3,214,032 ops/sec ±1.61% (183 runs sampled) + decode x 587,237 ops/sec ±1.16% (187 runs sampled) + unquote x 2,954,618 ops/sec ±1.35% (183 runs sampled) + duplicates x 857,008 ops/sec ±0.89% (187 runs sampled) + 10 cookies x 292,133 ops/sec ±0.89% (187 runs sampled) + 100 cookies x 22,610 ops/sec ±0.68% (187 runs sampled) +``` + +## References + +- [RFC 6265: HTTP State Management Mechanism][rfc-6265] +- [Same-site Cookies][rfc-6265bis-09-5.4.7] + +[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/ +[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1 +[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7 +[rfc-6265]: https://tools.ietf.org/html/rfc6265 +[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4 +[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1 +[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2 +[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3 +[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4 +[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5 +[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6 +[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3 + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/cookie/master?label=ci +[ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master +[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master +[node-image]: https://badgen.net/npm/node/cookie +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/cookie +[npm-url]: https://npmjs.org/package/cookie +[npm-version-image]: https://badgen.net/npm/v/cookie diff --git a/node_modules/cookie/SECURITY.md b/node_modules/cookie/SECURITY.md new file mode 100644 index 00000000..fd4a6c53 --- /dev/null +++ b/node_modules/cookie/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The `cookie` team and community take all security bugs seriously. Thank +you for improving the security of the project. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `cookie`. This +information can be found in the npm registry using the command +`npm owner ls cookie`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/jshttp/cookie/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/node_modules/cookie/index.js b/node_modules/cookie/index.js new file mode 100644 index 00000000..03d4c386 --- /dev/null +++ b/node_modules/cookie/index.js @@ -0,0 +1,274 @@ +/*! + * cookie + * Copyright(c) 2012-2014 Roman Shtylman + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +exports.parse = parse; +exports.serialize = serialize; + +/** + * Module variables. + * @private + */ + +var __toString = Object.prototype.toString + +/** + * RegExp to match field-content in RFC 7230 sec 3.2 + * + * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ] + * field-vchar = VCHAR / obs-text + * obs-text = %x80-FF + */ + +var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/; + +/** + * Parse a cookie header. + * + * Parse the given cookie header string into an object + * The object has the various cookies as keys(names) => values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var dec = opt.decode || decode; + + var index = 0 + while (index < str.length) { + var eqIdx = str.indexOf('=', index) + + // no more cookie pairs + if (eqIdx === -1) { + break + } + + var endIdx = str.indexOf(';', index) + + if (endIdx === -1) { + endIdx = str.length + } else if (endIdx < eqIdx) { + // backtrack on prior semicolon + index = str.lastIndexOf(';', eqIdx - 1) + 1 + continue + } + + var key = str.slice(index, eqIdx).trim() + + // only assign once + if (undefined === obj[key]) { + var val = str.slice(eqIdx + 1, endIdx).trim() + + // quoted values + if (val.charCodeAt(0) === 0x22) { + val = val.slice(1, -1) + } + + obj[key] = tryDecode(val, dec); + } + + index = endIdx + 1 + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + + if (isNaN(maxAge) || !isFinite(maxAge)) { + throw new TypeError('option maxAge is invalid') + } + + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + var expires = opt.expires + + if (!isDate(expires) || isNaN(expires.valueOf())) { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + expires.toUTCString() + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.partitioned) { + str += '; Partitioned' + } + + if (opt.priority) { + var priority = typeof opt.priority === 'string' + ? opt.priority.toLowerCase() + : opt.priority + + switch (priority) { + case 'low': + str += '; Priority=Low' + break + case 'medium': + str += '; Priority=Medium' + break + case 'high': + str += '; Priority=High' + break + default: + throw new TypeError('option priority is invalid') + } + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + case 'none': + str += '; SameSite=None'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * URL-decode string value. Optimized to skip native call when no %. + * + * @param {string} str + * @returns {string} + */ + +function decode (str) { + return str.indexOf('%') !== -1 + ? decodeURIComponent(str) + : str +} + +/** + * URL-encode value. + * + * @param {string} val + * @returns {string} + */ + +function encode (val) { + return encodeURIComponent(val) +} + +/** + * Determine if value is a Date. + * + * @param {*} val + * @private + */ + +function isDate (val) { + return __toString.call(val) === '[object Date]' || + val instanceof Date +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/node_modules/cookie/package.json b/node_modules/cookie/package.json new file mode 100644 index 00000000..0c3f0063 --- /dev/null +++ b/node_modules/cookie/package.json @@ -0,0 +1,44 @@ +{ + "name": "cookie", + "description": "HTTP server cookie parsing and serialization", + "version": "0.6.0", + "author": "Roman Shtylman ", + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "keywords": [ + "cookie", + "cookies" + ], + "repository": "jshttp/cookie", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "8.53.0", + "eslint-plugin-markdown": "3.0.1", + "mocha": "10.2.0", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "top-sites": "1.1.194" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "SECURITY.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "update-bench": "node scripts/update-benchmark.js", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/core-util-is/LICENSE b/node_modules/core-util-is/LICENSE new file mode 100644 index 00000000..d8d7f943 --- /dev/null +++ b/node_modules/core-util-is/LICENSE @@ -0,0 +1,19 @@ +Copyright Node.js contributors. All rights reserved. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to +deal in the Software without restriction, including without limitation the +rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. diff --git a/node_modules/core-util-is/README.md b/node_modules/core-util-is/README.md new file mode 100644 index 00000000..5a76b414 --- /dev/null +++ b/node_modules/core-util-is/README.md @@ -0,0 +1,3 @@ +# core-util-is + +The `util.is*` functions introduced in Node v0.12. diff --git a/node_modules/core-util-is/lib/util.js b/node_modules/core-util-is/lib/util.js new file mode 100644 index 00000000..6e5a20d7 --- /dev/null +++ b/node_modules/core-util-is/lib/util.js @@ -0,0 +1,107 @@ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. + +function isArray(arg) { + if (Array.isArray) { + return Array.isArray(arg); + } + return objectToString(arg) === '[object Array]'; +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +exports.isBuffer = require('buffer').Buffer.isBuffer; + +function objectToString(o) { + return Object.prototype.toString.call(o); +} diff --git a/node_modules/core-util-is/package.json b/node_modules/core-util-is/package.json new file mode 100644 index 00000000..b0c51f58 --- /dev/null +++ b/node_modules/core-util-is/package.json @@ -0,0 +1,38 @@ +{ + "name": "core-util-is", + "version": "1.0.3", + "description": "The `util.is*` functions introduced in Node v0.12.", + "main": "lib/util.js", + "files": [ + "lib" + ], + "repository": { + "type": "git", + "url": "git://github.com/isaacs/core-util-is" + }, + "keywords": [ + "util", + "isBuffer", + "isArray", + "isNumber", + "isString", + "isRegExp", + "isThis", + "isThat", + "polyfill" + ], + "author": "Isaac Z. Schlueter (http://blog.izs.me/)", + "license": "MIT", + "bugs": { + "url": "https://github.com/isaacs/core-util-is/issues" + }, + "scripts": { + "test": "tap test.js", + "preversion": "npm test", + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags" + }, + "devDependencies": { + "tap": "^15.0.9" + } +} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 00000000..20a70685 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 00000000..8a37ae2c --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 00000000..5f60eecc --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 00000000..6c6090c3 --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 00000000..eadaa189 --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,362 @@ + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 00000000..658c933d --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 00000000..584da8bf --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 00000000..f67be6b3 --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json new file mode 100644 index 00000000..9de26410 --- /dev/null +++ b/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 00000000..103a82d1 --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 00000000..7fc36fe6 --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 00000000..dc787ba7 --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,49 @@ +{ + "name": "debug", + "version": "2.6.9", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": "TJ Holowaychuk ", + "contributors": [ + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + }, + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + } +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 00000000..71069249 --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 00000000..6a5e3fc9 --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 00000000..e12cf4d5 --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/inspector-log.js b/node_modules/debug/src/inspector-log.js new file mode 100644 index 00000000..60ea6c04 --- /dev/null +++ b/node_modules/debug/src/inspector-log.js @@ -0,0 +1,15 @@ +module.exports = inspectorLog; + +// black hole +const nullStream = new (require('stream').Writable)(); +nullStream._write = () => {}; + +/** + * Outputs a `console.log()` to the Node.js Inspector console *only*. + */ +function inspectorLog() { + const stdout = console._stdout; + console._stdout = nullStream; + console.log.apply(console, arguments); + console._stdout = stdout; +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 00000000..b15109c9 --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,248 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/define-data-property/.eslintrc b/node_modules/define-data-property/.eslintrc new file mode 100644 index 00000000..75443e81 --- /dev/null +++ b/node_modules/define-data-property/.eslintrc @@ -0,0 +1,24 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "complexity": 0, + "id-length": 0, + "new-cap": ["error", { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + }, + + "overrides": [ + { + "files": "test/**", + "rules": { + "max-lines-per-function": "off", + }, + }, + ], +} diff --git a/node_modules/define-data-property/.github/FUNDING.yml b/node_modules/define-data-property/.github/FUNDING.yml new file mode 100644 index 00000000..3e17725d --- /dev/null +++ b/node_modules/define-data-property/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/define-data-property +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/node_modules/define-data-property/.nycrc b/node_modules/define-data-property/.nycrc new file mode 100644 index 00000000..1826526e --- /dev/null +++ b/node_modules/define-data-property/.nycrc @@ -0,0 +1,13 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "lines": 86, + "statements": 85.93, + "functions": 82.43, + "branches": 76.06, + "exclude": [ + "coverage", + "test" + ] +} diff --git a/node_modules/define-data-property/CHANGELOG.md b/node_modules/define-data-property/CHANGELOG.md new file mode 100644 index 00000000..4eed75ea --- /dev/null +++ b/node_modules/define-data-property/CHANGELOG.md @@ -0,0 +1,70 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.1.4](https://github.com/ljharb/define-data-property/compare/v1.1.3...v1.1.4) - 2024-02-13 + +### Commits + +- [Refactor] use `es-define-property` [`90f2f4c`](https://github.com/ljharb/define-data-property/commit/90f2f4cc20298401e71c28e1e08888db12021453) +- [Dev Deps] update `@types/object.getownpropertydescriptors` [`cd929d9`](https://github.com/ljharb/define-data-property/commit/cd929d9a04f5f2fdcfa9d5be140940b91a083153) + +## [v1.1.3](https://github.com/ljharb/define-data-property/compare/v1.1.2...v1.1.3) - 2024-02-12 + +### Commits + +- [types] hand-write d.ts instead of emitting it [`0cbc988`](https://github.com/ljharb/define-data-property/commit/0cbc988203c105f2d97948327c7167ebd33bd318) +- [meta] simplify `exports` [`690781e`](https://github.com/ljharb/define-data-property/commit/690781eed28bbf2d6766237efda0ba6dd591609e) +- [Dev Deps] update `hasown`; clean up DT packages [`6cdfd1c`](https://github.com/ljharb/define-data-property/commit/6cdfd1cb2d91d791bfd18cda5d5cab232fd5d8fc) +- [actions] cleanup [`3142bc6`](https://github.com/ljharb/define-data-property/commit/3142bc6a4bc406a51f5b04f31e98562a27f35ffd) +- [meta] add `funding` [`8474423`](https://github.com/ljharb/define-data-property/commit/847442391a79779af3e0f1bf0b5bb923552b7804) +- [Deps] update `get-intrinsic` [`3e9be00`](https://github.com/ljharb/define-data-property/commit/3e9be00e07784ba34e7c77d8bc0fdbc832ad61de) + +## [v1.1.2](https://github.com/ljharb/define-data-property/compare/v1.1.1...v1.1.2) - 2024-02-05 + +### Commits + +- [Dev Deps] update @types packages, `object-inspect`, `tape`, `typescript` [`df41bf8`](https://github.com/ljharb/define-data-property/commit/df41bf84ca3456be6226055caab44e38e3a7fd2f) +- [Dev Deps] update DT packages, `aud`, `npmignore`, `tape`, typescript` [`fab0e4e`](https://github.com/ljharb/define-data-property/commit/fab0e4ec709ee02b79f42d6db3ee5f26e0a34b8a) +- [Dev Deps] use `hasown` instead of `has` [`aa51ef9`](https://github.com/ljharb/define-data-property/commit/aa51ef93f6403d49d9bb72a807bcdb6e418978c0) +- [Refactor] use `es-errors`, so things that only need those do not need `get-intrinsic` [`d89be50`](https://github.com/ljharb/define-data-property/commit/d89be50571175888d391238605122679f7e65ffc) +- [Deps] update `has-property-descriptors` [`7af887c`](https://github.com/ljharb/define-data-property/commit/7af887c9083b59b195b0079e04815cfed9fcee2b) +- [Deps] update `get-intrinsic` [`bb8728e`](https://github.com/ljharb/define-data-property/commit/bb8728ec42cd998505a7157ae24853a560c20646) + +## [v1.1.1](https://github.com/ljharb/define-data-property/compare/v1.1.0...v1.1.1) - 2023-10-12 + +### Commits + +- [Tests] fix tests in ES3 engines [`5c6920e`](https://github.com/ljharb/define-data-property/commit/5c6920edd1f52f675b02f417e539c28135b43f94) +- [Dev Deps] update `@types/es-value-fixtures`, `@types/for-each`, `@types/gopd`, `@types/has-property-descriptors`, `tape`, `typescript` [`7d82dfc`](https://github.com/ljharb/define-data-property/commit/7d82dfc20f778b4465bba06335dd53f6f431aea3) +- [Fix] IE 8 has a broken `Object.defineProperty` [`0672e1a`](https://github.com/ljharb/define-data-property/commit/0672e1af2a9fcc787e7c23b96dea60d290df5548) +- [meta] emit types on prepack [`73acb1f`](https://github.com/ljharb/define-data-property/commit/73acb1f903c21b314ec7156bf10f73c7910530c0) +- [Dev Deps] update `tape`, `typescript` [`9489a77`](https://github.com/ljharb/define-data-property/commit/9489a7738bf2ecf0ac71d5b78ec4ca6ad7ba0142) + +## [v1.1.0](https://github.com/ljharb/define-data-property/compare/v1.0.1...v1.1.0) - 2023-09-13 + +### Commits + +- [New] add `loose` arg [`155235a`](https://github.com/ljharb/define-data-property/commit/155235a4c4d7741f6de01cd87c99599a56654b72) +- [New] allow `null` to be passed for the non* args [`7d2fa5f`](https://github.com/ljharb/define-data-property/commit/7d2fa5f06be0392736c13b126f7cd38979f34792) + +## [v1.0.1](https://github.com/ljharb/define-data-property/compare/v1.0.0...v1.0.1) - 2023-09-12 + +### Commits + +- [meta] add TS types [`43d763c`](https://github.com/ljharb/define-data-property/commit/43d763c6c883f652de1c9c02ef6216ee507ffa69) +- [Dev Deps] update `@types/tape`, `typescript` [`f444985`](https://github.com/ljharb/define-data-property/commit/f444985811c36f3e6448a03ad2f9b7898917f4c7) +- [meta] add `safe-publish-latest`, [`172bb10`](https://github.com/ljharb/define-data-property/commit/172bb10890896ebb160e64398f6ee55760107bee) + +## v1.0.0 - 2023-09-12 + +### Commits + +- Initial implementation, tests, readme [`5b43d6b`](https://github.com/ljharb/define-data-property/commit/5b43d6b44e675a904810467a7d4e0adb7efc3196) +- Initial commit [`35e577a`](https://github.com/ljharb/define-data-property/commit/35e577a6ba59a98befa97776d70d90f3bea9009d) +- npm init [`82a0a04`](https://github.com/ljharb/define-data-property/commit/82a0a04a321ca7de220af02d41e2745e8a9962ed) +- Only apps should have lockfiles [`96df244`](https://github.com/ljharb/define-data-property/commit/96df244a3c6f426f9a2437be825d1c6f5dd7158e) +- [meta] use `npmignore` to autogenerate an npmignore file [`a87ff18`](https://github.com/ljharb/define-data-property/commit/a87ff18cb79e14c2eb5720486c4759fd9a189375) diff --git a/node_modules/define-data-property/LICENSE b/node_modules/define-data-property/LICENSE new file mode 100644 index 00000000..b4213ac6 --- /dev/null +++ b/node_modules/define-data-property/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2023 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/define-data-property/README.md b/node_modules/define-data-property/README.md new file mode 100644 index 00000000..f2304dae --- /dev/null +++ b/node_modules/define-data-property/README.md @@ -0,0 +1,67 @@ +# define-data-property [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Define a data property on an object. Will fall back to assignment in an engine without descriptors. + +The three `non*` argument can also be passed `null`, which will use the existing state if available. + +The `loose` argument will mean that if you attempt to set a non-normal data property, in an environment without descriptor support, it will fall back to normal assignment. + +## Usage + +```javascript +var defineDataProperty = require('define-data-property'); +var assert = require('assert'); + +var obj = {}; +defineDataProperty(obj, 'key', 'value'); +defineDataProperty( + obj, + 'key2', + 'value', + true, // nonEnumerable, optional + false, // nonWritable, optional + true, // nonConfigurable, optional + false // loose, optional +); + +assert.deepEqual( + Object.getOwnPropertyDescriptors(obj), + { + key: { + configurable: true, + enumerable: true, + value: 'value', + writable: true, + }, + key2: { + configurable: false, + enumerable: false, + value: 'value', + writable: true, + }, + } +); +``` + +[package-url]: https://npmjs.org/package/define-data-property +[npm-version-svg]: https://versionbadg.es/ljharb/define-data-property.svg +[deps-svg]: https://david-dm.org/ljharb/define-data-property.svg +[deps-url]: https://david-dm.org/ljharb/define-data-property +[dev-deps-svg]: https://david-dm.org/ljharb/define-data-property/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/define-data-property#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/define-data-property.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/define-data-property.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/define-data-property.svg +[downloads-url]: https://npm-stat.com/charts.html?package=define-data-property +[codecov-image]: https://codecov.io/gh/ljharb/define-data-property/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/define-data-property/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/define-data-property +[actions-url]: https://github.com/ljharb/define-data-property/actions diff --git a/node_modules/define-data-property/index.d.ts b/node_modules/define-data-property/index.d.ts new file mode 100644 index 00000000..b56a77da --- /dev/null +++ b/node_modules/define-data-property/index.d.ts @@ -0,0 +1,12 @@ + +declare function defineDataProperty( + obj: Record, + property: keyof typeof obj, + value: typeof obj[typeof property], + nonEnumerable?: boolean | null, + nonWritable?: boolean | null, + nonConfigurable?: boolean | null, + loose?: boolean +): void; + +export = defineDataProperty; \ No newline at end of file diff --git a/node_modules/define-data-property/index.js b/node_modules/define-data-property/index.js new file mode 100644 index 00000000..e1a38c07 --- /dev/null +++ b/node_modules/define-data-property/index.js @@ -0,0 +1,56 @@ +'use strict'; + +var $defineProperty = require('es-define-property'); + +var $SyntaxError = require('es-errors/syntax'); +var $TypeError = require('es-errors/type'); + +var gopd = require('gopd'); + +/** @type {import('.')} */ +module.exports = function defineDataProperty( + obj, + property, + value +) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new $TypeError('`obj` must be an object or a function`'); + } + if (typeof property !== 'string' && typeof property !== 'symbol') { + throw new $TypeError('`property` must be a string or a symbol`'); + } + if (arguments.length > 3 && typeof arguments[3] !== 'boolean' && arguments[3] !== null) { + throw new $TypeError('`nonEnumerable`, if provided, must be a boolean or null'); + } + if (arguments.length > 4 && typeof arguments[4] !== 'boolean' && arguments[4] !== null) { + throw new $TypeError('`nonWritable`, if provided, must be a boolean or null'); + } + if (arguments.length > 5 && typeof arguments[5] !== 'boolean' && arguments[5] !== null) { + throw new $TypeError('`nonConfigurable`, if provided, must be a boolean or null'); + } + if (arguments.length > 6 && typeof arguments[6] !== 'boolean') { + throw new $TypeError('`loose`, if provided, must be a boolean'); + } + + var nonEnumerable = arguments.length > 3 ? arguments[3] : null; + var nonWritable = arguments.length > 4 ? arguments[4] : null; + var nonConfigurable = arguments.length > 5 ? arguments[5] : null; + var loose = arguments.length > 6 ? arguments[6] : false; + + /* @type {false | TypedPropertyDescriptor} */ + var desc = !!gopd && gopd(obj, property); + + if ($defineProperty) { + $defineProperty(obj, property, { + configurable: nonConfigurable === null && desc ? desc.configurable : !nonConfigurable, + enumerable: nonEnumerable === null && desc ? desc.enumerable : !nonEnumerable, + value: value, + writable: nonWritable === null && desc ? desc.writable : !nonWritable + }); + } else if (loose || (!nonEnumerable && !nonWritable && !nonConfigurable)) { + // must fall back to [[Set]], and was not explicitly asked to make non-enumerable, non-writable, or non-configurable + obj[property] = value; // eslint-disable-line no-param-reassign + } else { + throw new $SyntaxError('This environment does not support defining a property as non-configurable, non-writable, or non-enumerable.'); + } +}; diff --git a/node_modules/define-data-property/package.json b/node_modules/define-data-property/package.json new file mode 100644 index 00000000..eec40971 --- /dev/null +++ b/node_modules/define-data-property/package.json @@ -0,0 +1,106 @@ +{ + "name": "define-data-property", + "version": "1.1.4", + "description": "Define a data property on an object. Will fall back to assignment in an engine without descriptors.", + "main": "index.js", + "types": "./index.d.ts", + "exports": { + ".": "./index.js", + "./package.json": "./package.json" + }, + "sideEffects": false, + "scripts": { + "prepack": "npmignore --auto --commentLines=autogenerated", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "tsc": "tsc -p .", + "prelint": "evalmd README.md", + "lint": "eslint --ext=js,mjs .", + "postlint": "npm run tsc", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "aud --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/define-data-property.git" + }, + "keywords": [ + "define", + "data", + "property", + "object", + "accessor", + "javascript", + "ecmascript", + "enumerable", + "configurable", + "writable" + ], + "author": "Jordan Harband ", + "funding": { + "url": "https://github.com/sponsors/ljharb" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/define-data-property/issues" + }, + "homepage": "https://github.com/ljharb/define-data-property#readme", + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "gopd": "^1.0.1" + }, + "devDependencies": { + "@ljharb/eslint-config": "^21.1.0", + "@types/call-bind": "^1.0.5", + "@types/define-properties": "^1.1.5", + "@types/es-value-fixtures": "^1.4.4", + "@types/for-each": "^0.3.3", + "@types/get-intrinsic": "^1.2.2", + "@types/gopd": "^1.0.3", + "@types/has-property-descriptors": "^1.0.3", + "@types/object-inspect": "^1.8.4", + "@types/object.getownpropertydescriptors": "^2.1.4", + "@types/tape": "^5.6.4", + "aud": "^2.0.4", + "auto-changelog": "^2.4.0", + "es-value-fixtures": "^1.4.2", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.3", + "hasown": "^2.0.1", + "in-publish": "^2.0.1", + "npmignore": "^0.3.1", + "nyc": "^10.3.2", + "object-inspect": "^1.13.1", + "object.getownpropertydescriptors": "^2.1.7", + "reflect.ownkeys": "^1.1.4", + "safe-publish-latest": "^2.0.0", + "tape": "^5.7.4", + "typescript": "next" + }, + "engines": { + "node": ">= 0.4" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows", + "types/reflect.ownkeys" + ] + } +} diff --git a/node_modules/define-data-property/test/index.js b/node_modules/define-data-property/test/index.js new file mode 100644 index 00000000..68204c66 --- /dev/null +++ b/node_modules/define-data-property/test/index.js @@ -0,0 +1,392 @@ +'use strict'; + +var test = require('tape'); +var v = require('es-value-fixtures'); +var forEach = require('for-each'); +var inspect = require('object-inspect'); +var hasOwn = require('hasown'); +var hasPropertyDescriptors = require('has-property-descriptors')(); +var getOwnPropertyDescriptors = require('object.getownpropertydescriptors'); +var ownKeys = require('reflect.ownkeys'); + +var defineDataProperty = require('../'); + +test('defineDataProperty', function (t) { + t.test('argument validation', function (st) { + forEach(v.primitives, function (nonObject) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty(nonObject, 'key', 'value'); }, + TypeError, + 'throws on non-object input: ' + inspect(nonObject) + ); + }); + + forEach(v.nonPropertyKeys, function (nonPropertyKey) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, nonPropertyKey, 'value'); }, + TypeError, + 'throws on non-PropertyKey input: ' + inspect(nonPropertyKey) + ); + }); + + forEach(v.nonBooleans, function (nonBoolean) { + if (nonBoolean !== null) { + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', nonBoolean); }, + TypeError, + 'throws on non-boolean nonEnumerable: ' + inspect(nonBoolean) + ); + + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', false, nonBoolean); }, + TypeError, + 'throws on non-boolean nonWritable: ' + inspect(nonBoolean) + ); + + st['throws']( + // @ts-expect-error + function () { defineDataProperty({}, 'key', 'value', false, false, nonBoolean); }, + TypeError, + 'throws on non-boolean nonConfigurable: ' + inspect(nonBoolean) + ); + } + }); + + st.end(); + }); + + t.test('normal data property', function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + st.ok(hasOwn(obj, 'existing'), 'has initial own property'); + st.equal(obj.existing, 'existing property', 'has expected initial value'); + + var res = defineDataProperty(obj, 'added', 'added property'); + st.equal(res, void undefined, 'returns `undefined`'); + st.ok(hasOwn(obj, 'added'), 'has expected own property'); + st.equal(obj.added, 'added property', 'has expected value'); + + defineDataProperty(obj, 'existing', 'new value'); + st.ok(hasOwn(obj, 'existing'), 'still has expected own property'); + st.equal(obj.existing, 'new value', 'has new expected value'); + + defineDataProperty(obj, 'explicit1', 'new value', false); + st.ok(hasOwn(obj, 'explicit1'), 'has expected own property (explicit enumerable)'); + st.equal(obj.explicit1, 'new value', 'has new expected value (explicit enumerable)'); + + defineDataProperty(obj, 'explicit2', 'new value', false, false); + st.ok(hasOwn(obj, 'explicit2'), 'has expected own property (explicit writable)'); + st.equal(obj.explicit2, 'new value', 'has new expected value (explicit writable)'); + + defineDataProperty(obj, 'explicit3', 'new value', false, false, false); + st.ok(hasOwn(obj, 'explicit3'), 'has expected own property (explicit configurable)'); + st.equal(obj.explicit3, 'new value', 'has new expected value (explicit configurable)'); + + st.end(); + }); + + t.test('loose mode', { skip: !hasPropertyDescriptors }, function (st) { + var obj = { existing: 'existing property' }; + + defineDataProperty(obj, 'added', 'added value 1', true, null, null, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: true, + enumerable: !hasPropertyDescriptors, + value: 'added value 1', + writable: true + } + }, + 'in loose mode, obj still adds property 1' + ); + + defineDataProperty(obj, 'added', 'added value 2', false, true, null, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: true, + enumerable: true, + value: 'added value 2', + writable: !hasPropertyDescriptors + } + }, + 'in loose mode, obj still adds property 2' + ); + + defineDataProperty(obj, 'added', 'added value 3', false, false, true, true); + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + added: { + configurable: !hasPropertyDescriptors, + enumerable: true, + value: 'added value 3', + writable: true + } + }, + 'in loose mode, obj still adds property 3' + ); + + st.end(); + }); + + t.test('non-normal data property, ES3', { skip: hasPropertyDescriptors }, function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', true); }, + SyntaxError, + 'nonEnumerable throws a Syntax Error' + ); + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', false, true); }, + SyntaxError, + 'nonWritable throws a Syntax Error' + ); + + st['throws']( + function () { defineDataProperty(obj, 'added', 'added value', false, false, true); }, + SyntaxError, + 'nonWritable throws a Syntax Error' + ); + + st.deepEqual( + ownKeys(obj), + ['existing'], + 'obj still has expected keys' + ); + st.equal(obj.existing, 'existing property', 'obj still has expected values'); + + st.end(); + }); + + t.test('new non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + /** @type {Record} */ + var obj = { existing: 'existing property' }; + + defineDataProperty(obj, 'nonEnum', null, true); + defineDataProperty(obj, 'nonWrit', null, false, true); + defineDataProperty(obj, 'nonConf', null, false, false, true); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + existing: { + configurable: true, + enumerable: true, + value: 'existing property', + writable: true + }, + nonEnum: { + configurable: true, + enumerable: false, + value: null, + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: null, + writable: false + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj has expected property descriptors' + ); + + st.end(); + }); + + t.test('existing non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + // test case changing an existing non-normal property + + /** @type {Record} */ + var obj = {}; + Object.defineProperty(obj, 'nonEnum', { configurable: true, enumerable: false, value: null, writable: true }); + Object.defineProperty(obj, 'nonWrit', { configurable: true, enumerable: true, value: null, writable: false }); + Object.defineProperty(obj, 'nonConf', { configurable: false, enumerable: true, value: null, writable: true }); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + nonEnum: { + configurable: true, + enumerable: false, + value: null, + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: null, + writable: false + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj initially has expected property descriptors' + ); + + defineDataProperty(obj, 'nonEnum', 'new value', false); + defineDataProperty(obj, 'nonWrit', 'new value', false, false); + st['throws']( + function () { defineDataProperty(obj, 'nonConf', 'new value', false, false, false); }, + TypeError, + 'can not alter a nonconfigurable property' + ); + + st.deepEqual( + getOwnPropertyDescriptors(obj), + { + nonEnum: { + configurable: true, + enumerable: true, + value: 'new value', + writable: true + }, + nonWrit: { + configurable: true, + enumerable: true, + value: 'new value', + writable: true + }, + nonConf: { + configurable: false, + enumerable: true, + value: null, + writable: true + } + }, + 'obj ends up with expected property descriptors' + ); + + st.end(); + }); + + t.test('frozen object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var frozen = Object.freeze({ existing: true }); + + st['throws']( + function () { defineDataProperty(frozen, 'existing', 'new value'); }, + TypeError, + 'frozen object can not modify an existing property' + ); + + st['throws']( + function () { defineDataProperty(frozen, 'new', 'new property'); }, + TypeError, + 'frozen object can not add a new property' + ); + + st.end(); + }); + + t.test('sealed object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var sealed = Object.seal({ existing: true }); + st.deepEqual( + Object.getOwnPropertyDescriptor(sealed, 'existing'), + { + configurable: false, + enumerable: true, + value: true, + writable: true + }, + 'existing value on sealed object has expected descriptor' + ); + + defineDataProperty(sealed, 'existing', 'new value'); + + st.deepEqual( + Object.getOwnPropertyDescriptor(sealed, 'existing'), + { + configurable: false, + enumerable: true, + value: 'new value', + writable: true + }, + 'existing value on sealed object has changed descriptor' + ); + + st['throws']( + function () { defineDataProperty(sealed, 'new', 'new property'); }, + TypeError, + 'sealed object can not add a new property' + ); + + st.end(); + }); + + t.test('nonextensible object, ES5+', { skip: !hasPropertyDescriptors }, function (st) { + var nonExt = Object.preventExtensions({ existing: true }); + + st.deepEqual( + Object.getOwnPropertyDescriptor(nonExt, 'existing'), + { + configurable: true, + enumerable: true, + value: true, + writable: true + }, + 'existing value on non-extensible object has expected descriptor' + ); + + defineDataProperty(nonExt, 'existing', 'new value', true); + + st.deepEqual( + Object.getOwnPropertyDescriptor(nonExt, 'existing'), + { + configurable: true, + enumerable: false, + value: 'new value', + writable: true + }, + 'existing value on non-extensible object has changed descriptor' + ); + + st['throws']( + function () { defineDataProperty(nonExt, 'new', 'new property'); }, + TypeError, + 'non-extensible object can not add a new property' + ); + + st.end(); + }); + + t.end(); +}); diff --git a/node_modules/define-data-property/tsconfig.json b/node_modules/define-data-property/tsconfig.json new file mode 100644 index 00000000..69f060dc --- /dev/null +++ b/node_modules/define-data-property/tsconfig.json @@ -0,0 +1,59 @@ +{ + "compilerOptions": { + /* Visit https://aka.ms/tsconfig to read more about this file */ + + /* Projects */ + + /* Language and Environment */ + "target": "es2022", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */ + // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */ + // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */ + "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */ + // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */ + + /* Modules */ + "module": "commonjs", /* Specify what module code is generated. */ + // "rootDir": "./", /* Specify the root folder within your source files. */ + // "moduleResolution": "node10", /* Specify how TypeScript looks up a file from a given module specifier. */ + // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */ + // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */ + // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */ + "typeRoots": ["types"], /* Specify multiple folders that act like './node_modules/@types'. */ + "resolveJsonModule": true, /* Enable importing .json files. */ + + /* JavaScript Support */ + "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the 'checkJS' option to get errors from these files. */ + "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */ + "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from 'node_modules'. Only applicable with 'allowJs'. */ + + /* Emit */ + "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */ + "declarationMap": true, /* Create sourcemaps for d.ts files. */ + // "emitDeclarationOnly": true, /* Only output d.ts files and not JavaScript files. */ + "noEmit": true, /* Disable emitting files from a compilation. */ + + /* Interop Constraints */ + "allowSyntheticDefaultImports": true, /* Allow 'import x from y' when a module doesn't have a default export. */ + "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables 'allowSyntheticDefaultImports' for type compatibility. */ + "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */ + + /* Type Checking */ + "strict": true, /* Enable all strict type-checking options. */ + "noImplicitAny": true, /* Enable error reporting for expressions and declarations with an implied 'any' type. */ + "noImplicitThis": true, /* Enable error reporting when 'this' is given the type 'any'. */ + "useUnknownInCatchVariables": true, /* Default catch clause variables as 'unknown' instead of 'any'. */ + "noUnusedLocals": true, /* Enable error reporting when local variables aren't read. */ + "noUnusedParameters": true, /* Raise an error when a function parameter isn't read. */ + "noImplicitReturns": true, /* Enable error reporting for codepaths that do not explicitly return in a function. */ + "noFallthroughCasesInSwitch": true, /* Enable error reporting for fallthrough cases in switch statements. */ + "noUncheckedIndexedAccess": true, /* Add 'undefined' to a type when accessed using an index. */ + "noImplicitOverride": true, /* Ensure overriding members in derived classes are marked with an override modifier. */ + // "noPropertyAccessFromIndexSignature": true, /* Enforces using indexed accessors for keys declared using an indexed type. */ + + /* Completeness */ + // "skipLibCheck": true /* Skip type checking all .d.ts files. */ + }, + "exclude": [ + "coverage" + ] +} diff --git a/node_modules/denque/CHANGELOG.md b/node_modules/denque/CHANGELOG.md new file mode 100644 index 00000000..123d6ef9 --- /dev/null +++ b/node_modules/denque/CHANGELOG.md @@ -0,0 +1,8 @@ +## 1.5.1 + + - perf: minor performance tweak when growing queue size (#29) + +## 1.5.0 + + - feat: adds capacity option for circular buffers (#27) + diff --git a/node_modules/denque/LICENSE b/node_modules/denque/LICENSE new file mode 100644 index 00000000..fd22a2db --- /dev/null +++ b/node_modules/denque/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2018 Mike Diarmid (Salakar) + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this library except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. diff --git a/node_modules/denque/README.md b/node_modules/denque/README.md new file mode 100644 index 00000000..886d2dd4 --- /dev/null +++ b/node_modules/denque/README.md @@ -0,0 +1,77 @@ +

+

Denque

+

+ +

+ NPM downloads + NPM version + Tests status + Coverage + License + Follow on Twitter +

+ +Denque is a well tested, extremely fast and lightweight [double-ended queue](http://en.wikipedia.org/wiki/Double-ended_queue) +implementation with zero dependencies and includes TypeScript types. + +Double-ended queues can also be used as a: + +- [Stack](http://en.wikipedia.org/wiki/Stack_\(abstract_data_type\)) +- [Queue](http://en.wikipedia.org/wiki/Queue_\(data_structure\)) + +This implementation is currently the fastest available, even faster than `double-ended-queue`, see the [benchmarks](https://docs.page/invertase/denque/benchmarks). + +Every queue operation is done at a constant `O(1)` - including random access from `.peekAt(index)`. + +**Works on all node versions >= v0.10** + +## Quick Start + +Install the package: + +```bash +npm install denque +``` + +Create and consume a queue: + +```js +const Denque = require("denque"); + +const denque = new Denque([1,2,3,4]); +denque.shift(); // 1 +denque.pop(); // 4 +``` + + +See the [API reference documentation](https://docs.page/invertase/denque/api) for more examples. + +--- + +## Who's using it? + +- [Kafka Node.js client](https://www.npmjs.com/package/kafka-node) +- [MariaDB Node.js client](https://www.npmjs.com/package/mariadb) +- [MongoDB Node.js client](https://www.npmjs.com/package/mongodb) +- [MySQL Node.js client](https://www.npmjs.com/package/mysql2) +- [Redis Node.js clients](https://www.npmjs.com/package/redis) + +... and [many more](https://www.npmjs.com/browse/depended/denque). + + +--- + +## License + +- See [LICENSE](/LICENSE) + +--- + +

+ + + +

+ Built and maintained by Invertase. +

+

diff --git a/node_modules/denque/index.d.ts b/node_modules/denque/index.d.ts new file mode 100644 index 00000000..05d7123f --- /dev/null +++ b/node_modules/denque/index.d.ts @@ -0,0 +1,31 @@ +declare class Denque { + constructor(); + constructor(array: T[]); + constructor(array: T[], options: IDenqueOptions); + + push(item: T): number; + unshift(item: T): number; + pop(): T | undefined; + removeBack(): T | undefined; + shift(): T | undefined; + peekBack(): T | undefined; + peekFront(): T | undefined; + peekAt(index: number): T | undefined; + get(index: number): T | undefined; + remove(index: number, count: number): T[]; + removeOne(index: number): T | undefined; + splice(index: number, count: number, ...item: T[]): T[] | undefined; + isEmpty(): boolean; + clear(): void; + + toString(): string; + toArray(): T[]; + + length: number; +} + +interface IDenqueOptions { + capacity?: number +} + +export = Denque; diff --git a/node_modules/denque/index.js b/node_modules/denque/index.js new file mode 100644 index 00000000..c809f084 --- /dev/null +++ b/node_modules/denque/index.js @@ -0,0 +1,443 @@ +'use strict'; + +/** + * Custom implementation of a double ended queue. + */ +function Denque(array, options) { + var options = options || {}; + + this._head = 0; + this._tail = 0; + this._capacity = options.capacity; + this._capacityMask = 0x3; + this._list = new Array(4); + if (Array.isArray(array)) { + this._fromArray(array); + } +} + +/** + * ------------- + * PUBLIC API + * ------------- + */ + +/** + * Returns the item at the specified index from the list. + * 0 is the first element, 1 is the second, and so on... + * Elements at negative values are that many from the end: -1 is one before the end + * (the last element), -2 is two before the end (one before last), etc. + * @param index + * @returns {*} + */ +Denque.prototype.peekAt = function peekAt(index) { + var i = index; + // expect a number or return undefined + if ((i !== (i | 0))) { + return void 0; + } + var len = this.size(); + if (i >= len || i < -len) return undefined; + if (i < 0) i += len; + i = (this._head + i) & this._capacityMask; + return this._list[i]; +}; + +/** + * Alias for peekAt() + * @param i + * @returns {*} + */ +Denque.prototype.get = function get(i) { + return this.peekAt(i); +}; + +/** + * Returns the first item in the list without removing it. + * @returns {*} + */ +Denque.prototype.peek = function peek() { + if (this._head === this._tail) return undefined; + return this._list[this._head]; +}; + +/** + * Alias for peek() + * @returns {*} + */ +Denque.prototype.peekFront = function peekFront() { + return this.peek(); +}; + +/** + * Returns the item that is at the back of the queue without removing it. + * Uses peekAt(-1) + */ +Denque.prototype.peekBack = function peekBack() { + return this.peekAt(-1); +}; + +/** + * Returns the current length of the queue + * @return {Number} + */ +Object.defineProperty(Denque.prototype, 'length', { + get: function length() { + return this.size(); + } +}); + +/** + * Return the number of items on the list, or 0 if empty. + * @returns {number} + */ +Denque.prototype.size = function size() { + if (this._head === this._tail) return 0; + if (this._head < this._tail) return this._tail - this._head; + else return this._capacityMask + 1 - (this._head - this._tail); +}; + +/** + * Add an item at the beginning of the list. + * @param item + */ +Denque.prototype.unshift = function unshift(item) { + if (item === undefined) return this.size(); + var len = this._list.length; + this._head = (this._head - 1 + len) & this._capacityMask; + this._list[this._head] = item; + if (this._tail === this._head) this._growArray(); + if (this._capacity && this.size() > this._capacity) this.pop(); + if (this._head < this._tail) return this._tail - this._head; + else return this._capacityMask + 1 - (this._head - this._tail); +}; + +/** + * Remove and return the first item on the list, + * Returns undefined if the list is empty. + * @returns {*} + */ +Denque.prototype.shift = function shift() { + var head = this._head; + if (head === this._tail) return undefined; + var item = this._list[head]; + this._list[head] = undefined; + this._head = (head + 1) & this._capacityMask; + if (head < 2 && this._tail > 10000 && this._tail <= this._list.length >>> 2) this._shrinkArray(); + return item; +}; + +/** + * Add an item to the bottom of the list. + * @param item + */ +Denque.prototype.push = function push(item) { + if (item === undefined) return this.size(); + var tail = this._tail; + this._list[tail] = item; + this._tail = (tail + 1) & this._capacityMask; + if (this._tail === this._head) { + this._growArray(); + } + if (this._capacity && this.size() > this._capacity) { + this.shift(); + } + if (this._head < this._tail) return this._tail - this._head; + else return this._capacityMask + 1 - (this._head - this._tail); +}; + +/** + * Remove and return the last item on the list. + * Returns undefined if the list is empty. + * @returns {*} + */ +Denque.prototype.pop = function pop() { + var tail = this._tail; + if (tail === this._head) return undefined; + var len = this._list.length; + this._tail = (tail - 1 + len) & this._capacityMask; + var item = this._list[this._tail]; + this._list[this._tail] = undefined; + if (this._head < 2 && tail > 10000 && tail <= len >>> 2) this._shrinkArray(); + return item; +}; + +/** + * Remove and return the item at the specified index from the list. + * Returns undefined if the list is empty. + * @param index + * @returns {*} + */ +Denque.prototype.removeOne = function removeOne(index) { + var i = index; + // expect a number or return undefined + if ((i !== (i | 0))) { + return void 0; + } + if (this._head === this._tail) return void 0; + var size = this.size(); + var len = this._list.length; + if (i >= size || i < -size) return void 0; + if (i < 0) i += size; + i = (this._head + i) & this._capacityMask; + var item = this._list[i]; + var k; + if (index < size / 2) { + for (k = index; k > 0; k--) { + this._list[i] = this._list[i = (i - 1 + len) & this._capacityMask]; + } + this._list[i] = void 0; + this._head = (this._head + 1 + len) & this._capacityMask; + } else { + for (k = size - 1 - index; k > 0; k--) { + this._list[i] = this._list[i = ( i + 1 + len) & this._capacityMask]; + } + this._list[i] = void 0; + this._tail = (this._tail - 1 + len) & this._capacityMask; + } + return item; +}; + +/** + * Remove number of items from the specified index from the list. + * Returns array of removed items. + * Returns undefined if the list is empty. + * @param index + * @param count + * @returns {array} + */ +Denque.prototype.remove = function remove(index, count) { + var i = index; + var removed; + var del_count = count; + // expect a number or return undefined + if ((i !== (i | 0))) { + return void 0; + } + if (this._head === this._tail) return void 0; + var size = this.size(); + var len = this._list.length; + if (i >= size || i < -size || count < 1) return void 0; + if (i < 0) i += size; + if (count === 1 || !count) { + removed = new Array(1); + removed[0] = this.removeOne(i); + return removed; + } + if (i === 0 && i + count >= size) { + removed = this.toArray(); + this.clear(); + return removed; + } + if (i + count > size) count = size - i; + var k; + removed = new Array(count); + for (k = 0; k < count; k++) { + removed[k] = this._list[(this._head + i + k) & this._capacityMask]; + } + i = (this._head + i) & this._capacityMask; + if (index + count === size) { + this._tail = (this._tail - count + len) & this._capacityMask; + for (k = count; k > 0; k--) { + this._list[i = (i + 1 + len) & this._capacityMask] = void 0; + } + return removed; + } + if (index === 0) { + this._head = (this._head + count + len) & this._capacityMask; + for (k = count - 1; k > 0; k--) { + this._list[i = (i + 1 + len) & this._capacityMask] = void 0; + } + return removed; + } + if (i < size / 2) { + this._head = (this._head + index + count + len) & this._capacityMask; + for (k = index; k > 0; k--) { + this.unshift(this._list[i = (i - 1 + len) & this._capacityMask]); + } + i = (this._head - 1 + len) & this._capacityMask; + while (del_count > 0) { + this._list[i = (i - 1 + len) & this._capacityMask] = void 0; + del_count--; + } + if (index < 0) this._tail = i; + } else { + this._tail = i; + i = (i + count + len) & this._capacityMask; + for (k = size - (count + index); k > 0; k--) { + this.push(this._list[i++]); + } + i = this._tail; + while (del_count > 0) { + this._list[i = (i + 1 + len) & this._capacityMask] = void 0; + del_count--; + } + } + if (this._head < 2 && this._tail > 10000 && this._tail <= len >>> 2) this._shrinkArray(); + return removed; +}; + +/** + * Native splice implementation. + * Remove number of items from the specified index from the list and/or add new elements. + * Returns array of removed items or empty array if count == 0. + * Returns undefined if the list is empty. + * + * @param index + * @param count + * @param {...*} [elements] + * @returns {array} + */ +Denque.prototype.splice = function splice(index, count) { + var i = index; + // expect a number or return undefined + if ((i !== (i | 0))) { + return void 0; + } + var size = this.size(); + if (i < 0) i += size; + if (i > size) return void 0; + if (arguments.length > 2) { + var k; + var temp; + var removed; + var arg_len = arguments.length; + var len = this._list.length; + var arguments_index = 2; + if (!size || i < size / 2) { + temp = new Array(i); + for (k = 0; k < i; k++) { + temp[k] = this._list[(this._head + k) & this._capacityMask]; + } + if (count === 0) { + removed = []; + if (i > 0) { + this._head = (this._head + i + len) & this._capacityMask; + } + } else { + removed = this.remove(i, count); + this._head = (this._head + i + len) & this._capacityMask; + } + while (arg_len > arguments_index) { + this.unshift(arguments[--arg_len]); + } + for (k = i; k > 0; k--) { + this.unshift(temp[k - 1]); + } + } else { + temp = new Array(size - (i + count)); + var leng = temp.length; + for (k = 0; k < leng; k++) { + temp[k] = this._list[(this._head + i + count + k) & this._capacityMask]; + } + if (count === 0) { + removed = []; + if (i != size) { + this._tail = (this._head + i + len) & this._capacityMask; + } + } else { + removed = this.remove(i, count); + this._tail = (this._tail - leng + len) & this._capacityMask; + } + while (arguments_index < arg_len) { + this.push(arguments[arguments_index++]); + } + for (k = 0; k < leng; k++) { + this.push(temp[k]); + } + } + return removed; + } else { + return this.remove(i, count); + } +}; + +/** + * Soft clear - does not reset capacity. + */ +Denque.prototype.clear = function clear() { + this._head = 0; + this._tail = 0; +}; + +/** + * Returns true or false whether the list is empty. + * @returns {boolean} + */ +Denque.prototype.isEmpty = function isEmpty() { + return this._head === this._tail; +}; + +/** + * Returns an array of all queue items. + * @returns {Array} + */ +Denque.prototype.toArray = function toArray() { + return this._copyArray(false); +}; + +/** + * ------------- + * INTERNALS + * ------------- + */ + +/** + * Fills the queue with items from an array + * For use in the constructor + * @param array + * @private + */ +Denque.prototype._fromArray = function _fromArray(array) { + for (var i = 0; i < array.length; i++) this.push(array[i]); +}; + +/** + * + * @param fullCopy + * @returns {Array} + * @private + */ +Denque.prototype._copyArray = function _copyArray(fullCopy) { + var newArray = []; + var list = this._list; + var len = list.length; + var i; + if (fullCopy || this._head > this._tail) { + for (i = this._head; i < len; i++) newArray.push(list[i]); + for (i = 0; i < this._tail; i++) newArray.push(list[i]); + } else { + for (i = this._head; i < this._tail; i++) newArray.push(list[i]); + } + return newArray; +}; + +/** + * Grows the internal list array. + * @private + */ +Denque.prototype._growArray = function _growArray() { + if (this._head) { + // copy existing data, head to end, then beginning to tail. + this._list = this._copyArray(true); + this._head = 0; + } + + // head is at 0 and array is now full, safe to extend + this._tail = this._list.length; + + this._list.length <<= 1; + this._capacityMask = (this._capacityMask << 1) | 1; +}; + +/** + * Shrinks the internal list array. + * @private + */ +Denque.prototype._shrinkArray = function _shrinkArray() { + this._list.length >>>= 1; + this._capacityMask >>>= 1; +}; + + +module.exports = Denque; diff --git a/node_modules/denque/package.json b/node_modules/denque/package.json new file mode 100644 index 00000000..42534a63 --- /dev/null +++ b/node_modules/denque/package.json @@ -0,0 +1,55 @@ +{ + "name": "denque", + "version": "1.5.1", + "description": "The fastest javascript implementation of a double-ended queue. Used by the official Redis, MongoDB, MariaDB & MySQL libraries for Node.js and many other libraries. Maintains compatability with deque.", + "main": "index.js", + "engines": { + "node": ">=0.10" + }, + "keywords": [ + "data-structure", + "data-structures", + "queue", + "double", + "end", + "ended", + "deque", + "denque", + "double-ended-queue" + ], + "scripts": { + "test": "istanbul cover --report lcov _mocha && npm run typescript", + "coveralls": "cat ./coverage/lcov.info | coveralls", + "typescript": "tsc --project ./test/type/tsconfig.json", + "benchmark_thousand": "node benchmark/thousand", + "benchmark_2mil": "node benchmark/two_million", + "benchmark_splice": "node benchmark/splice", + "benchmark_remove": "node benchmark/remove", + "benchmark_removeOne": "node benchmark/removeOne" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/invertase/denque.git" + }, + "license": "Apache-2.0", + "author": { + "name": "Invertase", + "email": "oss@invertase.io", + "url": "http://github.com/invertase/" + }, + "contributors": [ + "Mike Diarmid (Salakar) " + ], + "bugs": { + "url": "https://github.com/invertase/denque/issues" + }, + "homepage": "https://docs.page/invertase/denque", + "devDependencies": { + "benchmark": "^2.1.4", + "codecov": "^3.8.3", + "double-ended-queue": "^2.1.0-0", + "istanbul": "^0.4.5", + "mocha": "^3.5.3", + "typescript": "^3.4.1" + } +} diff --git a/node_modules/depd/History.md b/node_modules/depd/History.md new file mode 100644 index 00000000..cd9ebaaa --- /dev/null +++ b/node_modules/depd/History.md @@ -0,0 +1,103 @@ +2.0.0 / 2018-10-26 +================== + + * Drop support for Node.js 0.6 + * Replace internal `eval` usage with `Function` constructor + * Use instance methods on `process` to check for listeners + +1.1.2 / 2018-01-11 +================== + + * perf: remove argument reassignment + * Support Node.js 0.6 to 9.x + +1.1.1 / 2017-07-27 +================== + + * Remove unnecessary `Buffer` loading + * Support Node.js 0.6 to 8.x + +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/node_modules/depd/LICENSE b/node_modules/depd/LICENSE new file mode 100644 index 00000000..248de7af --- /dev/null +++ b/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2018 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/depd/Readme.md b/node_modules/depd/Readme.md new file mode 100644 index 00000000..043d1ca2 --- /dev/null +++ b/node_modules/depd/Readme.md @@ -0,0 +1,280 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + + + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +▼ ▼ ▼ ▼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ ▲ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction () { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://badgen.net/npm/node/depd +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/depd +[npm-url]: https://npmjs.org/package/depd +[npm-version-image]: https://badgen.net/npm/v/depd +[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd diff --git a/node_modules/depd/index.js b/node_modules/depd/index.js new file mode 100644 index 00000000..1bf2fcfd --- /dev/null +++ b/node_modules/depd/index.js @@ -0,0 +1,538 @@ +/*! + * depd + * Copyright(c) 2014-2018 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace (str, namespace) { + var vals = str.split(/[ ,]+/) + var ns = String(namespace).toLowerCase() + + for (var i = 0; i < vals.length; i++) { + var val = vals[i] + + // namespace contained + if (val && (val === '*' || val.toLowerCase() === ns)) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor (obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter () { return value } + + if (descriptor.writable) { + descriptor.set = function setter (val) { return (value = val) } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString (arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString (stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + stack[i].toString() + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate (message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if event emitter has listeners of a given type. + * + * The way to do this check is done three different ways in Node.js >= 0.8 + * so this consolidates them into a minimal set using instance methods. + * + * @param {EventEmitter} emitter + * @param {string} type + * @returns {boolean} + * @private + */ + +function eehaslisteners (emitter, type) { + var count = typeof emitter.listenerCount !== 'function' + ? emitter.listeners(type).length + : emitter.listenerCount(type) + + return count > 0 +} + +/** + * Determine if namespace is ignored. + */ + +function isignored (namespace) { + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced (namespace) { + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log (message, site) { + var haslisteners = eehaslisteners(process, 'deprecation') + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var depSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + depSite = site + callSite = callSiteLocation(stack[1]) + callSite.name = depSite.name + file = callSite[0] + } else { + // get call site + i = 2 + depSite = callSiteLocation(stack[i]) + callSite = depSite + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? depSite.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + var msg = message + if (!msg) { + msg = callSite === depSite || !callSite.name + ? defaultMessage(depSite) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, msg, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var output = format.call(this, msg, caller, stack.slice(i)) + process.stderr.write(output + '\n', 'utf8') +} + +/** + * Get call site location as array. + */ + +function callSiteLocation (callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage (site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain (msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + stack[i].toString() + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor (msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan + ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation (callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace (obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + // eslint-disable-next-line no-new-func + var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site', + '"use strict"\n' + + 'return function (' + args + ') {' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '}')(fn, log, this, message, site) + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter () { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter () { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError (namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return (stackString = createStackString.call(this, stack)) + }, + set: function setter (val) { + stackString = val + } + }) + + return error +} diff --git a/node_modules/depd/lib/browser/index.js b/node_modules/depd/lib/browser/index.js new file mode 100644 index 00000000..6be45cc2 --- /dev/null +++ b/node_modules/depd/lib/browser/index.js @@ -0,0 +1,77 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate (message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } +} diff --git a/node_modules/depd/package.json b/node_modules/depd/package.json new file mode 100644 index 00000000..3857e199 --- /dev/null +++ b/node_modules/depd/package.json @@ -0,0 +1,45 @@ +{ + "name": "depd", + "description": "Deprecate all the things", + "version": "2.0.0", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "deprecate", + "deprecated" + ], + "repository": "dougwilson/nodejs-depd", + "browser": "lib/browser/index.js", + "devDependencies": { + "benchmark": "2.1.4", + "beautify-benchmark": "0.2.4", + "eslint": "5.7.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-markdown": "1.0.0-beta.7", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0", + "safe-buffer": "5.1.2", + "uid-safe": "2.1.5" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary", + "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary" + } +} diff --git a/node_modules/destroy/LICENSE b/node_modules/destroy/LICENSE new file mode 100644 index 00000000..0e2c35f0 --- /dev/null +++ b/node_modules/destroy/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2015-2022 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/destroy/README.md b/node_modules/destroy/README.md new file mode 100644 index 00000000..e7701aee --- /dev/null +++ b/node_modules/destroy/README.md @@ -0,0 +1,63 @@ +# destroy + +[![NPM version][npm-image]][npm-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +Destroy a stream. + +This module is meant to ensure a stream gets destroyed, handling different APIs +and Node.js bugs. + +## API + +```js +var destroy = require('destroy') +``` + +### destroy(stream [, suppress]) + +Destroy the given stream, and optionally suppress any future `error` events. + +In most cases, this is identical to a simple `stream.destroy()` call. The rules +are as follows for a given stream: + + 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()` + and add a listener to the `open` event to call `stream.close()` if it is + fired. This is for a Node.js bug that will leak a file descriptor if + `.destroy()` is called before `open`. + 2. If the `stream` is an instance of a zlib stream, then call `stream.destroy()` + and close the underlying zlib handle if open, otherwise call `stream.close()`. + This is for consistency across Node.js versions and a Node.js bug that will + leak a native zlib handle. + 3. If the `stream` is not an instance of `Stream`, then nothing happens. + 4. If the `stream` has a `.destroy()` method, then call it. + +The function returns the `stream` passed in as the argument. + +## Example + +```js +var destroy = require('destroy') + +var fs = require('fs') +var stream = fs.createReadStream('package.json') + +// ... and later +destroy(stream) +``` + +[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square +[npm-url]: https://npmjs.org/package/destroy +[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square +[github-url]: https://github.com/stream-utils/destroy/tags +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master +[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/destroy +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/stream-utils/destroy/ci/master?label=ci&style=flat-square +[github-actions-ci-url]: https://github.com/stream-utils/destroy/actions/workflows/ci.yml diff --git a/node_modules/destroy/index.js b/node_modules/destroy/index.js new file mode 100644 index 00000000..7fd5c093 --- /dev/null +++ b/node_modules/destroy/index.js @@ -0,0 +1,209 @@ +/*! + * destroy + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015-2022 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var EventEmitter = require('events').EventEmitter +var ReadStream = require('fs').ReadStream +var Stream = require('stream') +var Zlib = require('zlib') + +/** + * Module exports. + * @public + */ + +module.exports = destroy + +/** + * Destroy the given stream, and optionally suppress any future `error` events. + * + * @param {object} stream + * @param {boolean} suppress + * @public + */ + +function destroy (stream, suppress) { + if (isFsReadStream(stream)) { + destroyReadStream(stream) + } else if (isZlibStream(stream)) { + destroyZlibStream(stream) + } else if (hasDestroy(stream)) { + stream.destroy() + } + + if (isEventEmitter(stream) && suppress) { + stream.removeAllListeners('error') + stream.addListener('error', noop) + } + + return stream +} + +/** + * Destroy a ReadStream. + * + * @param {object} stream + * @private + */ + +function destroyReadStream (stream) { + stream.destroy() + + if (typeof stream.close === 'function') { + // node.js core bug work-around + stream.on('open', onOpenClose) + } +} + +/** + * Close a Zlib stream. + * + * Zlib streams below Node.js 4.5.5 have a buggy implementation + * of .close() when zlib encountered an error. + * + * @param {object} stream + * @private + */ + +function closeZlibStream (stream) { + if (stream._hadError === true) { + var prop = stream._binding === null + ? '_binding' + : '_handle' + + stream[prop] = { + close: function () { this[prop] = null } + } + } + + stream.close() +} + +/** + * Destroy a Zlib stream. + * + * Zlib streams don't have a destroy function in Node.js 6. On top of that + * simply calling destroy on a zlib stream in Node.js 8+ will result in a + * memory leak. So until that is fixed, we need to call both close AND destroy. + * + * PR to fix memory leak: https://github.com/nodejs/node/pull/23734 + * + * In Node.js 6+8, it's important that destroy is called before close as the + * stream would otherwise emit the error 'zlib binding closed'. + * + * @param {object} stream + * @private + */ + +function destroyZlibStream (stream) { + if (typeof stream.destroy === 'function') { + // node.js core bug work-around + // istanbul ignore if: node.js 0.8 + if (stream._binding) { + // node.js < 0.10.0 + stream.destroy() + if (stream._processing) { + stream._needDrain = true + stream.once('drain', onDrainClearBinding) + } else { + stream._binding.clear() + } + } else if (stream._destroy && stream._destroy !== Stream.Transform.prototype._destroy) { + // node.js >= 12, ^11.1.0, ^10.15.1 + stream.destroy() + } else if (stream._destroy && typeof stream.close === 'function') { + // node.js 7, 8 + stream.destroyed = true + stream.close() + } else { + // fallback + // istanbul ignore next + stream.destroy() + } + } else if (typeof stream.close === 'function') { + // node.js < 8 fallback + closeZlibStream(stream) + } +} + +/** + * Determine if stream has destroy. + * @private + */ + +function hasDestroy (stream) { + return stream instanceof Stream && + typeof stream.destroy === 'function' +} + +/** + * Determine if val is EventEmitter. + * @private + */ + +function isEventEmitter (val) { + return val instanceof EventEmitter +} + +/** + * Determine if stream is fs.ReadStream stream. + * @private + */ + +function isFsReadStream (stream) { + return stream instanceof ReadStream +} + +/** + * Determine if stream is Zlib stream. + * @private + */ + +function isZlibStream (stream) { + return stream instanceof Zlib.Gzip || + stream instanceof Zlib.Gunzip || + stream instanceof Zlib.Deflate || + stream instanceof Zlib.DeflateRaw || + stream instanceof Zlib.Inflate || + stream instanceof Zlib.InflateRaw || + stream instanceof Zlib.Unzip +} + +/** + * No-op function. + * @private + */ + +function noop () {} + +/** + * On drain handler to clear binding. + * @private + */ + +// istanbul ignore next: node.js 0.8 +function onDrainClearBinding () { + this._binding.clear() +} + +/** + * On open handler to close stream. + * @private + */ + +function onOpenClose () { + if (typeof this.fd === 'number') { + // actually close down the fd + this.close() + } +} diff --git a/node_modules/destroy/package.json b/node_modules/destroy/package.json new file mode 100644 index 00000000..c85e4383 --- /dev/null +++ b/node_modules/destroy/package.json @@ -0,0 +1,48 @@ +{ + "name": "destroy", + "description": "destroy a stream if possible", + "version": "1.2.0", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com", + "twitter": "https://twitter.com/jongleberry" + }, + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "repository": "stream-utils/destroy", + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.2", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "files": [ + "index.js", + "LICENSE" + ], + "keywords": [ + "stream", + "streams", + "destroy", + "cleanup", + "leak", + "fd" + ] +} diff --git a/node_modules/dotenv/CHANGELOG.md b/node_modules/dotenv/CHANGELOG.md new file mode 100644 index 00000000..e35152ae --- /dev/null +++ b/node_modules/dotenv/CHANGELOG.md @@ -0,0 +1,475 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +## [Unreleased](https://github.com/motdotla/dotenv/compare/v16.4.5...master) + +## [16.4.5](https://github.com/motdotla/dotenv/compare/v16.4.4...v16.4.5) (2024-02-19) + +### Changed + +- 🐞 fix recent regression when using `path` option. return to historical behavior: do not attempt to auto find `.env` if `path` set. (regression was introduced in `16.4.3`) [#814](https://github.com/motdotla/dotenv/pull/814) + +## [16.4.4](https://github.com/motdotla/dotenv/compare/v16.4.3...v16.4.4) (2024-02-13) + +### Changed + +- 🐞 Replaced chaining operator `?.` with old school `&&` (fixing node 12 failures) [#812](https://github.com/motdotla/dotenv/pull/812) + +## [16.4.3](https://github.com/motdotla/dotenv/compare/v16.4.2...v16.4.3) (2024-02-12) + +### Changed + +- Fixed processing of multiple files in `options.path` [#805](https://github.com/motdotla/dotenv/pull/805) + +## [16.4.2](https://github.com/motdotla/dotenv/compare/v16.4.1...v16.4.2) (2024-02-10) + +### Changed + +- Changed funding link in package.json to [`dotenvx.com`](https://dotenvx.com) + +## [16.4.1](https://github.com/motdotla/dotenv/compare/v16.4.0...v16.4.1) (2024-01-24) + +- Patch support for array as `path` option [#797](https://github.com/motdotla/dotenv/pull/797) + +## [16.4.0](https://github.com/motdotla/dotenv/compare/v16.3.2...v16.4.0) (2024-01-23) + +- Add `error.code` to error messages around `.env.vault` decryption handling [#795](https://github.com/motdotla/dotenv/pull/795) +- Add ability to find `.env.vault` file when filename(s) passed as an array [#784](https://github.com/motdotla/dotenv/pull/784) + +## [16.3.2](https://github.com/motdotla/dotenv/compare/v16.3.1...v16.3.2) (2024-01-18) + +### Added + +- Add debug message when no encoding set [#735](https://github.com/motdotla/dotenv/pull/735) + +### Changed + +- Fix output typing for `populate` [#792](https://github.com/motdotla/dotenv/pull/792) +- Use subarray instead of slice [#793](https://github.com/motdotla/dotenv/pull/793) + +## [16.3.1](https://github.com/motdotla/dotenv/compare/v16.3.0...v16.3.1) (2023-06-17) + +### Added + +- Add missing type definitions for `processEnv` and `DOTENV_KEY` options. [#756](https://github.com/motdotla/dotenv/pull/756) + +## [16.3.0](https://github.com/motdotla/dotenv/compare/v16.2.0...v16.3.0) (2023-06-16) + +### Added + +- Optionally pass `DOTENV_KEY` to options rather than relying on `process.env.DOTENV_KEY`. Defaults to `process.env.DOTENV_KEY` [#754](https://github.com/motdotla/dotenv/pull/754) + +## [16.2.0](https://github.com/motdotla/dotenv/compare/v16.1.4...v16.2.0) (2023-06-15) + +### Added + +- Optionally write to your own target object rather than `process.env`. Defaults to `process.env`. [#753](https://github.com/motdotla/dotenv/pull/753) +- Add import type URL to types file [#751](https://github.com/motdotla/dotenv/pull/751) + +## [16.1.4](https://github.com/motdotla/dotenv/compare/v16.1.3...v16.1.4) (2023-06-04) + +### Added + +- Added `.github/` to `.npmignore` [#747](https://github.com/motdotla/dotenv/pull/747) + +## [16.1.3](https://github.com/motdotla/dotenv/compare/v16.1.2...v16.1.3) (2023-05-31) + +### Removed + +- Removed `browser` keys for `path`, `os`, and `crypto` in package.json. These were set to false incorrectly as of 16.1. Instead, if using dotenv on the front-end make sure to include polyfills for `path`, `os`, and `crypto`. [node-polyfill-webpack-plugin](https://github.com/Richienb/node-polyfill-webpack-plugin) provides these. + +## [16.1.2](https://github.com/motdotla/dotenv/compare/v16.1.1...v16.1.2) (2023-05-31) + +### Changed + +- Exposed private function `_configDotenv` as `configDotenv`. [#744](https://github.com/motdotla/dotenv/pull/744) + +## [16.1.1](https://github.com/motdotla/dotenv/compare/v16.1.0...v16.1.1) (2023-05-30) + +### Added + +- Added type definition for `decrypt` function + +### Changed + +- Fixed `{crypto: false}` in `packageJson.browser` + +## [16.1.0](https://github.com/motdotla/dotenv/compare/v16.0.3...v16.1.0) (2023-05-30) + +### Added + +- Add `populate` convenience method [#733](https://github.com/motdotla/dotenv/pull/733) +- Accept URL as path option [#720](https://github.com/motdotla/dotenv/pull/720) +- Add dotenv to `npm fund` command +- Spanish language README [#698](https://github.com/motdotla/dotenv/pull/698) +- Add `.env.vault` support. 🎉 ([#730](https://github.com/motdotla/dotenv/pull/730)) + +ℹ️ `.env.vault` extends the `.env` file format standard with a localized encrypted vault file. Package it securely with your production code deploys. It's cloud agnostic so that you can deploy your secrets anywhere – without [risky third-party integrations](https://techcrunch.com/2023/01/05/circleci-breach/). [read more](https://github.com/motdotla/dotenv#-deploying) + +### Changed + +- Fixed "cannot resolve 'fs'" error on tools like Replit [#693](https://github.com/motdotla/dotenv/pull/693) + +## [16.0.3](https://github.com/motdotla/dotenv/compare/v16.0.2...v16.0.3) (2022-09-29) + +### Changed + +- Added library version to debug logs ([#682](https://github.com/motdotla/dotenv/pull/682)) + +## [16.0.2](https://github.com/motdotla/dotenv/compare/v16.0.1...v16.0.2) (2022-08-30) + +### Added + +- Export `env-options.js` and `cli-options.js` in package.json for use with downstream [dotenv-expand](https://github.com/motdotla/dotenv-expand) module + +## [16.0.1](https://github.com/motdotla/dotenv/compare/v16.0.0...v16.0.1) (2022-05-10) + +### Changed + +- Minor README clarifications +- Development ONLY: updated devDependencies as recommended for development only security risks ([#658](https://github.com/motdotla/dotenv/pull/658)) + +## [16.0.0](https://github.com/motdotla/dotenv/compare/v15.0.1...v16.0.0) (2022-02-02) + +### Added + +- _Breaking:_ Backtick support 🎉 ([#615](https://github.com/motdotla/dotenv/pull/615)) + +If you had values containing the backtick character, please quote those values with either single or double quotes. + +## [15.0.1](https://github.com/motdotla/dotenv/compare/v15.0.0...v15.0.1) (2022-02-02) + +### Changed + +- Properly parse empty single or double quoted values 🐞 ([#614](https://github.com/motdotla/dotenv/pull/614)) + +## [15.0.0](https://github.com/motdotla/dotenv/compare/v14.3.2...v15.0.0) (2022-01-31) + +`v15.0.0` is a major new release with some important breaking changes. + +### Added + +- _Breaking:_ Multiline parsing support (just works. no need for the flag.) + +### Changed + +- _Breaking:_ `#` marks the beginning of a comment (UNLESS the value is wrapped in quotes. Please update your `.env` files to wrap in quotes any values containing `#`. For example: `SECRET_HASH="something-with-a-#-hash"`). + +..Understandably, (as some teams have noted) this is tedious to do across the entire team. To make it less tedious, we recommend using [dotenv cli](https://github.com/dotenv-org/cli) going forward. It's an optional plugin that will keep your `.env` files in sync between machines, environments, or team members. + +### Removed + +- _Breaking:_ Remove multiline option (just works out of the box now. no need for the flag.) + +## [14.3.2](https://github.com/motdotla/dotenv/compare/v14.3.1...v14.3.2) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on values containing `#` 🐞 ([#603](https://github.com/motdotla/dotenv/pull/603)) + +## [14.3.1](https://github.com/motdotla/dotenv/compare/v14.3.0...v14.3.1) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on exports by re-introducing the prior in-place exports 🐞 ([#606](https://github.com/motdotla/dotenv/pull/606)) + +## [14.3.0](https://github.com/motdotla/dotenv/compare/v14.2.0...v14.3.0) (2022-01-24) + +### Added + +- Add `multiline` option 🎉 ([#486](https://github.com/motdotla/dotenv/pull/486)) + +## [14.2.0](https://github.com/motdotla/dotenv/compare/v14.1.1...v14.2.0) (2022-01-17) + +### Added + +- Add `dotenv_config_override` cli option +- Add `DOTENV_CONFIG_OVERRIDE` command line env option + +## [14.1.1](https://github.com/motdotla/dotenv/compare/v14.1.0...v14.1.1) (2022-01-17) + +### Added + +- Add React gotcha to FAQ on README + +## [14.1.0](https://github.com/motdotla/dotenv/compare/v14.0.1...v14.1.0) (2022-01-17) + +### Added + +- Add `override` option 🎉 ([#595](https://github.com/motdotla/dotenv/pull/595)) + +## [14.0.1](https://github.com/motdotla/dotenv/compare/v14.0.0...v14.0.1) (2022-01-16) + +### Added + +- Log error on failure to load `.env` file ([#594](https://github.com/motdotla/dotenv/pull/594)) + +## [14.0.0](https://github.com/motdotla/dotenv/compare/v13.0.1...v14.0.0) (2022-01-16) + +### Added + +- _Breaking:_ Support inline comments for the parser 🎉 ([#568](https://github.com/motdotla/dotenv/pull/568)) + +## [13.0.1](https://github.com/motdotla/dotenv/compare/v13.0.0...v13.0.1) (2022-01-16) + +### Changed + +* Hide comments and newlines from debug output ([#404](https://github.com/motdotla/dotenv/pull/404)) + +## [13.0.0](https://github.com/motdotla/dotenv/compare/v12.0.4...v13.0.0) (2022-01-16) + +### Added + +* _Breaking:_ Add type file for `config.js` ([#539](https://github.com/motdotla/dotenv/pull/539)) + +## [12.0.4](https://github.com/motdotla/dotenv/compare/v12.0.3...v12.0.4) (2022-01-16) + +### Changed + +* README updates +* Minor order adjustment to package json format + +## [12.0.3](https://github.com/motdotla/dotenv/compare/v12.0.2...v12.0.3) (2022-01-15) + +### Changed + +* Simplified jsdoc for consistency across editors + +## [12.0.2](https://github.com/motdotla/dotenv/compare/v12.0.1...v12.0.2) (2022-01-15) + +### Changed + +* Improve embedded jsdoc type documentation + +## [12.0.1](https://github.com/motdotla/dotenv/compare/v12.0.0...v12.0.1) (2022-01-15) + +### Changed + +* README updates and clarifications + +## [12.0.0](https://github.com/motdotla/dotenv/compare/v11.0.0...v12.0.0) (2022-01-15) + +### Removed + +- _Breaking:_ drop support for Flow static type checker ([#584](https://github.com/motdotla/dotenv/pull/584)) + +### Changed + +- Move types/index.d.ts to lib/main.d.ts ([#585](https://github.com/motdotla/dotenv/pull/585)) +- Typescript cleanup ([#587](https://github.com/motdotla/dotenv/pull/587)) +- Explicit typescript inclusion in package.json ([#566](https://github.com/motdotla/dotenv/pull/566)) + +## [11.0.0](https://github.com/motdotla/dotenv/compare/v10.0.0...v11.0.0) (2022-01-11) + +### Changed + +- _Breaking:_ drop support for Node v10 ([#558](https://github.com/motdotla/dotenv/pull/558)) +- Patch debug option ([#550](https://github.com/motdotla/dotenv/pull/550)) + +## [10.0.0](https://github.com/motdotla/dotenv/compare/v9.0.2...v10.0.0) (2021-05-20) + +### Added + +- Add generic support to parse function +- Allow for import "dotenv/config.js" +- Add support to resolve home directory in path via ~ + +## [9.0.2](https://github.com/motdotla/dotenv/compare/v9.0.1...v9.0.2) (2021-05-10) + +### Changed + +- Support windows newlines with debug mode + +## [9.0.1](https://github.com/motdotla/dotenv/compare/v9.0.0...v9.0.1) (2021-05-08) + +### Changed + +- Updates to README + +## [9.0.0](https://github.com/motdotla/dotenv/compare/v8.6.0...v9.0.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 + +## [8.6.0](https://github.com/motdotla/dotenv/compare/v8.5.1...v8.6.0) (2021-05-05) + +### Added + +- define package.json in exports + +## [8.5.1](https://github.com/motdotla/dotenv/compare/v8.5.0...v8.5.1) (2021-05-05) + +### Changed + +- updated dev dependencies via npm audit + +## [8.5.0](https://github.com/motdotla/dotenv/compare/v8.4.0...v8.5.0) (2021-05-05) + +### Added + +- allow for `import "dotenv/config"` + +## [8.4.0](https://github.com/motdotla/dotenv/compare/v8.3.0...v8.4.0) (2021-05-05) + +### Changed + +- point to exact types file to work with VS Code + +## [8.3.0](https://github.com/motdotla/dotenv/compare/v8.2.0...v8.3.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 (mistake to be released as minor bump. later bumped to 9.0.0. see above.) + +## [8.2.0](https://github.com/motdotla/dotenv/compare/v8.1.0...v8.2.0) (2019-10-16) + +### Added + +- TypeScript types + +## [8.1.0](https://github.com/motdotla/dotenv/compare/v8.0.0...v8.1.0) (2019-08-18) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#392](https://github.com/motdotla/dotenv/issues/392)) + +# [8.0.0](https://github.com/motdotla/dotenv/compare/v7.0.0...v8.0.0) (2019-05-02) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#302](https://github.com/motdotla/dotenv/issues/392)) + +## [7.0.0] - 2019-03-12 + +### Fixed + +- Fix removing unbalanced quotes ([#376](https://github.com/motdotla/dotenv/pull/376)) + +### Removed + +- Removed `load` alias for `config` for consistency throughout code and documentation. + +## [6.2.0] - 2018-12-03 + +### Added + +- Support preload configuration via environment variables ([#351](https://github.com/motdotla/dotenv/issues/351)) + +## [6.1.0] - 2018-10-08 + +### Added + +- `debug` option for `config` and `parse` methods will turn on logging + +## [6.0.0] - 2018-06-02 + +### Changed + +- _Breaking:_ drop support for Node v4 ([#304](https://github.com/motdotla/dotenv/pull/304)) + +## [5.0.0] - 2018-01-29 + +### Added + +- Testing against Node v8 and v9 +- Documentation on trim behavior of values +- Documentation on how to use with `import` + +### Changed + +- _Breaking_: default `path` is now `path.resolve(process.cwd(), '.env')` +- _Breaking_: does not write over keys already in `process.env` if the key has a falsy value +- using `const` and `let` instead of `var` + +### Removed + +- Testing against Node v7 + +## [4.0.0] - 2016-12-23 + +### Changed + +- Return Object with parsed content or error instead of false ([#165](https://github.com/motdotla/dotenv/pull/165)). + +### Removed + +- `verbose` option removed in favor of returning result. + +## [3.0.0] - 2016-12-20 + +### Added + +- `verbose` option will log any error messages. Off by default. +- parses email addresses correctly +- allow importing config method directly in ES6 + +### Changed + +- Suppress error messages by default ([#154](https://github.com/motdotla/dotenv/pull/154)) +- Ignoring more files for NPM to make package download smaller + +### Fixed + +- False positive test due to case-sensitive variable ([#124](https://github.com/motdotla/dotenv/pull/124)) + +### Removed + +- `silent` option removed in favor of `verbose` + +## [2.0.0] - 2016-01-20 + +### Added + +- CHANGELOG to ["make it easier for users and contributors to see precisely what notable changes have been made between each release"](http://keepachangelog.com/). Linked to from README +- LICENSE to be more explicit about what was defined in `package.json`. Linked to from README +- Testing nodejs v4 on travis-ci +- added examples of how to use dotenv in different ways +- return parsed object on success rather than boolean true + +### Changed + +- README has shorter description not referencing ruby gem since we don't have or want feature parity + +### Removed + +- Variable expansion and escaping so environment variables are encouraged to be fully orthogonal + +## [1.2.0] - 2015-06-20 + +### Added + +- Preload hook to require dotenv without including it in your code + +### Changed + +- clarified license to be "BSD-2-Clause" in `package.json` + +### Fixed + +- retain spaces in string vars + +## [1.1.0] - 2015-03-31 + +### Added + +- Silent option to silence `console.log` when `.env` missing + +## [1.0.0] - 2015-03-13 + +### Removed + +- support for multiple `.env` files. should always use one `.env` file for the current environment + +[7.0.0]: https://github.com/motdotla/dotenv/compare/v6.2.0...v7.0.0 +[6.2.0]: https://github.com/motdotla/dotenv/compare/v6.1.0...v6.2.0 +[6.1.0]: https://github.com/motdotla/dotenv/compare/v6.0.0...v6.1.0 +[6.0.0]: https://github.com/motdotla/dotenv/compare/v5.0.0...v6.0.0 +[5.0.0]: https://github.com/motdotla/dotenv/compare/v4.0.0...v5.0.0 +[4.0.0]: https://github.com/motdotla/dotenv/compare/v3.0.0...v4.0.0 +[3.0.0]: https://github.com/motdotla/dotenv/compare/v2.0.0...v3.0.0 +[2.0.0]: https://github.com/motdotla/dotenv/compare/v1.2.0...v2.0.0 +[1.2.0]: https://github.com/motdotla/dotenv/compare/v1.1.0...v1.2.0 +[1.1.0]: https://github.com/motdotla/dotenv/compare/v1.0.0...v1.1.0 +[1.0.0]: https://github.com/motdotla/dotenv/compare/v0.4.0...v1.0.0 diff --git a/node_modules/dotenv/LICENSE b/node_modules/dotenv/LICENSE new file mode 100644 index 00000000..c430ad8b --- /dev/null +++ b/node_modules/dotenv/LICENSE @@ -0,0 +1,23 @@ +Copyright (c) 2015, Scott Motte +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/dotenv/README-es.md b/node_modules/dotenv/README-es.md new file mode 100644 index 00000000..154c1390 --- /dev/null +++ b/node_modules/dotenv/README-es.md @@ -0,0 +1,448 @@ +
+🎉 announcing dotenvx. run anywhere, multi-environment, encrypted envs. +
+ +  + +
+ +

+ + Dotenv es apoyado por la comunidad. + +

+Gracias espaciales a: +
+
+ +
+ Warp +
+ Warp es una rápida e impresionante terminal basada en Rust, reinventado para funcionar como una aplicación moderna. +
+ Haga más en la CLI con edición de texto real, resultado básado en bloques, y busqueda de comandos de IA. +
+ +
+ +
+ Retool +
+ Retool ayuda a los desarrolladores a crear software interno personalizado, como aplicaciones CRUD y paneles de administración, realmente rápido. +
+ Construya Interfaces de Usuario de forma visual con componentes flexibles, conéctese a cualquier fuente de datos, y escriba lógica de negocio en JavaScript. +
+ +
+ +
+ WorkOS +
+ Su Apliación, Lista para la Empresa. +
+ Agrega Inicio de Sesión Único, Autenticación Multi-Factor, y mucho más, en minutos en lugar de meses. +
+ +
+
+
+
+
+ +
+ +# dotenv [![NPM version](https://img.shields.io/npm/v/dotenv.svg?style=flat-square)](https://www.npmjs.com/package/dotenv) + +dotenv + +Dotenv es un módulo de dependencia cero que carga las variables de entorno desde un archivo `.env` en [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). El almacenamiento de la configuración del entorno separado del código está basado en la metodología [The Twelve-Factor App](http://12factor.net/config). + +[![js-standard-style](https://img.shields.io/badge/code%20style-standard-brightgreen.svg?style=flat-square)](https://github.com/feross/standard) +[![LICENSE](https://img.shields.io/github/license/motdotla/dotenv.svg)](LICENSE) + +## Instalación + +```bash +# instalación local (recomendado) +npm install dotenv --save +``` + +O installación con yarn? `yarn add dotenv` + +## Uso + +Cree un archivo `.env` en la raíz de su proyecto: + +```dosini +S3_BUCKET="YOURS3BUCKET" +SECRET_KEY="YOURSECRETKEYGOESHERE" +``` + +Tan prónto como sea posible en su aplicación, importe y configure dotenv: + +```javascript +require('dotenv').config() +console.log(process.env) // elimine esto después que haya confirmado que esta funcionando +``` + +.. o usa ES6? + +```javascript +import * as dotenv from 'dotenv' // vea en https://github.com/motdotla/dotenv#como-uso-dotenv-con-import +// REVISAR LINK DE REFERENCIA DE IMPORTACIÓN +dotenv.config() +import express from 'express' +``` + +Eso es todo. `process.env` ahora tiene las claves y los valores que definiste en tu archivo `.env`: + +```javascript +require('dotenv').config() + +... + +s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {}) +``` + +### Valores multilínea + +Si necesita variables de varias líneas, por ejemplo, claves privadas, ahora se admiten en la versión (`>= v15.0.0`) con saltos de línea: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY----- +... +Kh9NV... +... +-----END RSA PRIVATE KEY-----" +``` + +Alternativamente, puede usar comillas dobles y usar el carácter `\n`: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n" +``` + +### Comentarios + +Los comentarios pueden ser agregados en tu archivo o en la misma línea: + +```dosini +# This is a comment +SECRET_KEY=YOURSECRETKEYGOESHERE # comment +SECRET_HASH="something-with-a-#-hash" +``` + +Los comentarios comienzan donde existe un `#`, entonces, si su valor contiene un `#`, enciérrelo entre comillas. Este es un cambio importante desde la versión `>= v15.0.0` en adelante. + +### Análisis + +El motor que analiza el contenido de su archivo que contiene variables de entorno está disponible para su uso. Este Acepta una Cadena o un Búfer y devolverá un Objeto con las claves y los valores analizados. + +```javascript +const dotenv = require('dotenv') +const buf = Buffer.from('BASICO=basico') +const config = dotenv.parse(buf) // devolverá un objeto +console.log(typeof config, config) // objeto { BASICO : 'basico' } +``` + +### Precarga + +Puede usar el `--require` (`-r`) [opción de línea de comando](https://nodejs.org/api/cli.html#-r---require-module) para precargar dotenv. Al hacer esto, no necesita requerir ni cargar dotnev en el código de su aplicación. + +```bash +$ node -r dotenv/config tu_script.js +``` + +Las opciones de configuración a continuación se admiten como argumentos de línea de comandos en el formato `dotenv_config_