diff --git a/.github/workflows/deploy.yml b/.github/workflows/deploy.yml
index cbc6f485..abce6688 100644
--- a/.github/workflows/deploy.yml
+++ b/.github/workflows/deploy.yml
@@ -8,7 +8,7 @@ on:
   workflow_dispatch:
 
 jobs:
-  build:
+  build-docs:
     runs-on: ubuntu-latest
     defaults:
       run:
@@ -35,14 +35,14 @@ jobs:
           SFTP_HOST: ${{ secrets.SFTP_HOST }}
           SFTP_USERNAME: ${{ secrets.SFTP_USERNAME }}
           SFTP_KEY: ${{ secrets.SFTP_KEY }}
-          SFTP_KNOWN_HOSTS: ${{secrets.SFTP_KNOWN_HOSTS}}
+          SFTP_KNOWN_HOSTS: ${{ secrets.SFTP_KNOWN_HOSTS }}
         run: |
           echo "$SFTP_KEY" > sftp_key
           chmod 600 sftp_key
           echo "$SFTP_KNOWN_HOSTS" > known_hosts
           chmod 600 known_hosts
           rsync -avz --delete -e "ssh -i sftp_key -o UserKnownHostsFile=known_hosts" dist/ $SFTP_USERNAME@$SFTP_HOST:/var/www/www.setonix
-  doc:
+  build-doc-api:
     runs-on: ubuntu-24.04
     defaults:
       run:
@@ -54,12 +54,10 @@ jobs:
         with:
           flutter-version-file: app/pubspec.yaml
       - name: Install dependencies
-        run: |
-          flutter pub get
+        run: flutter pub get
       - name: Generate documentation
-        run: |
-          dart doc
-      - name: Deploy to SFTP
+        run: dart doc
+      - name: Deploy API docs via SFTP
         if: github.ref == 'refs/heads/develop'
         env:
           SFTP_HOST: ${{ secrets.SFTP_HOST }}
@@ -72,7 +70,7 @@ jobs:
           echo "$SFTP_KNOWN_HOSTS" > known_hosts
           chmod 600 known_hosts
           rsync -avz --delete -e "ssh -i sftp_key -o UserKnownHostsFile=known_hosts" doc/api/ $SFTP_USERNAME@$SFTP_HOST:/var/www/api.setonix
-  web:
+  build-web:
     runs-on: ubuntu-24.04
     defaults:
       run:
@@ -84,9 +82,8 @@ jobs:
         with:
           flutter-version-file: app/pubspec.yaml
       - name: Install dependencies
-        run: |
-          flutter pub get
-      - name: Generate
+        run: flutter pub get
+      - name: Generate code
         run: |
           cd ../tools
           dart pub get
@@ -104,16 +101,60 @@ jobs:
           echo "WEB_DIR=web" >> $GITHUB_ENV
       - name: Build
         run: flutter build web --wasm --release --no-web-resources-cdn --dart-define=flavor=$SETONIX_FLAVOR
-      - name: Deploy to SFTP
+      - name: Deploy Flutter web via SFTP
         if: github.ref == 'refs/heads/develop' || github.ref == 'refs/heads/main'
         env:
           SFTP_HOST: ${{ secrets.SFTP_HOST }}
           SFTP_USERNAME: ${{ secrets.SFTP_USERNAME }}
           SFTP_KEY: ${{ secrets.SFTP_KEY }}
-          SFTP_KNOWN_HOSTS: ${{secrets.SFTP_KNOWN_HOSTS}}
+          SFTP_KNOWN_HOSTS: ${{ secrets.SFTP_KNOWN_HOSTS }}
         run: |
           echo "$SFTP_KEY" > sftp_key
           chmod 600 sftp_key
           echo "$SFTP_KNOWN_HOSTS" > known_hosts
           chmod 600 known_hosts
           rsync -avz --delete -e "ssh -i sftp_key -o UserKnownHostsFile=known_hosts" build/web/ $SFTP_USERNAME@$SFTP_HOST:/var/www/$WEB_DIR.setonix
+  build-servers:
+    runs-on: ubuntu-latest
+    defaults:
+      run:
+        working-directory: servers
+    steps:
+      - uses: actions/checkout@v4
+      - name: Install pnpm
+        uses: pnpm/action-setup@v4
+        with:
+          package_json_file: docs/package.json
+      - name: Use Node.js
+        uses: actions/setup-node@v4
+        with:
+          node-version: 24
+          cache: "pnpm"
+          cache-dependency-path: docs/pnpm-lock.yaml
+      - name: Install dependencies
+        run: pnpm install
+      - name: Build
+        run: pnpm build
+      - name: Setup SSH Agent
+        if: github.ref == 'refs/heads/develop'
+        uses: webfactory/ssh-agent@v0.9.1
+        with:
+          ssh-private-key: ${{ secrets.SSH_PRIVATE_KEY }}
+      - name: Add SSH Known Hosts
+        if: github.ref == 'refs/heads/develop'
+        run: |
+          mkdir -p ~/.ssh
+          echo "${{ secrets.SSH_KNOWN_HOSTS }}" > ~/.ssh/known_hosts
+
+      - name: Deploy SSR build via rsync
+        if: github.ref == 'refs/heads/develop'
+        run: |
+          rsync -avz --delete ./dist/ ${{ secrets.SERVER_USER }}@${{ secrets.SERVER_HOST }}:/var/www/servers.setonix
+
+      - name: Restart SSR application
+        if: github.ref == 'refs/heads/develop'
+        run: |
+          ssh ${{ secrets.SERVER_USER }}@${{ secrets.SERVER_HOST }} << 'EOF'
+            pm2 stop astro-servers || true
+            PORT=${{ secrets.SERVERS_PORT }} pm2 start dist/server/entry.mjs --name astro-servers --update-env
+          EOF
diff --git a/api/lib/helpers.dart b/api/lib/helpers.dart
new file mode 100644
index 00000000..165c8c85
--- /dev/null
+++ b/api/lib/helpers.dart
@@ -0,0 +1 @@
+export 'src/helpers/crypto.dart';
diff --git a/api/lib/services.dart b/api/lib/services.dart
index 6b73810f..469c9a86 100644
--- a/api/lib/services.dart
+++ b/api/lib/services.dart
@@ -1,2 +1,4 @@
 export 'src/services/asset.dart';
+export 'src/services/challenge.dart';
 export 'src/services/network.dart';
+export 'src/services/user.dart';
diff --git a/api/lib/setonix_api.dart b/api/lib/setonix_api.dart
index c4f2287c..9f87654b 100644
--- a/api/lib/setonix_api.dart
+++ b/api/lib/setonix_api.dart
@@ -1,6 +1,7 @@
 /// The Linwood Setonix API
 library;
 
+export 'helpers.dart';
 export 'models.dart';
 export 'event.dart';
 export 'services.dart';
diff --git a/api/lib/src/event/client.dart b/api/lib/src/event/client.dart
index 051c7171..94621919 100644
--- a/api/lib/src/event/client.dart
+++ b/api/lib/src/event/client.dart
@@ -157,3 +157,31 @@ final class ModeChangeRequest extends ClientWorldEvent
   ModeChangeRequest(this.location);
   ModeChangeRequest.plain() : location = null;
 }
+
+@MappableClass(includeCustomMappers: [Base64Uint8ListHook()])
+final class AuthenticateRequest extends ClientWorldEvent
+    with AuthenticateRequestMappable {
+  final Uint8List signature;
+  final Uint8List publicKey;
+
+  static final _generator = Ed25519();
+
+  AuthenticateRequest(this.signature, this.publicKey);
+
+  static Future<AuthenticateRequest> build(
+      AuthenticatedRequested request, SetonixAccount account) async {
+    final challenge = request.challenge;
+    final keyPair = account.keyPair;
+    final signature = await _generator.sign(challenge, keyPair: keyPair);
+    return AuthenticateRequest(
+      Uint8List.fromList(signature.bytes),
+      account.publicKey,
+    );
+  }
+
+  Future<bool> verify(Uint8List challenge) => _generator.verify(
+        challenge,
+        signature: Signature(signature,
+            publicKey: SimplePublicKey(publicKey, type: KeyPairType.ed25519)),
+      );
+}
diff --git a/api/lib/src/event/event.dart b/api/lib/src/event/event.dart
index fc9a45d5..fff4ce7a 100644
--- a/api/lib/src/event/event.dart
+++ b/api/lib/src/event/event.dart
@@ -1,5 +1,6 @@
 import 'dart:convert';
 
+import 'package:cryptography_plus/cryptography_plus.dart';
 import 'package:dart_mappable/dart_mappable.dart';
 import 'package:networker/networker.dart';
 import 'package:setonix_api/event.dart';
diff --git a/api/lib/src/event/event.mapper.dart b/api/lib/src/event/event.mapper.dart
index 75873eec..e1933ce9 100644
--- a/api/lib/src/event/event.mapper.dart
+++ b/api/lib/src/event/event.mapper.dart
@@ -135,6 +135,7 @@ class ServerWorldEventMapper extends SubClassMapperBase<ServerWorldEvent> {
       DialogsClosedMapper.ensureInitialized();
       ImagesUpdatedMapper.ensureInitialized();
       ServerStateUpdatedMapper.ensureInitialized();
+      AuthenticatedRequestedMapper.ensureInitialized();
       HybridWorldEventMapper.ensureInitialized();
     }
     return _instance!;
@@ -1774,6 +1775,139 @@ class _ServerStateUpdatedCopyWithImpl<$R, $Out>
       _ServerStateUpdatedCopyWithImpl<$R2, $Out2>($value, $cast, t);
 }
 
+class AuthenticatedRequestedMapper
+    extends SubClassMapperBase<AuthenticatedRequested> {
+  AuthenticatedRequestedMapper._();
+
+  static AuthenticatedRequestedMapper? _instance;
+  static AuthenticatedRequestedMapper ensureInitialized() {
+    if (_instance == null) {
+      MapperContainer.globals.use(_instance = AuthenticatedRequestedMapper._());
+      ServerWorldEventMapper.ensureInitialized().addSubMapper(_instance!);
+      MapperContainer.globals.useAll([Base64Uint8ListHook()]);
+    }
+    return _instance!;
+  }
+
+  @override
+  final String id = 'AuthenticatedRequested';
+
+  static Uint8List _$challenge(AuthenticatedRequested v) => v.challenge;
+  static const Field<AuthenticatedRequested, Uint8List> _f$challenge =
+      Field('challenge', _$challenge);
+  static bool _$isRequired(AuthenticatedRequested v) => v.isRequired;
+  static const Field<AuthenticatedRequested, bool> _f$isRequired =
+      Field('isRequired', _$isRequired, opt: true, def: true);
+
+  @override
+  final MappableFields<AuthenticatedRequested> fields = const {
+    #challenge: _f$challenge,
+    #isRequired: _f$isRequired,
+  };
+
+  @override
+  final String discriminatorKey = 'type';
+  @override
+  final dynamic discriminatorValue = 'AuthenticatedRequested';
+  @override
+  late final ClassMapperBase superMapper =
+      ServerWorldEventMapper.ensureInitialized();
+
+  static AuthenticatedRequested _instantiate(DecodingData data) {
+    return AuthenticatedRequested(data.dec(_f$challenge),
+        isRequired: data.dec(_f$isRequired));
+  }
+
+  @override
+  final Function instantiate = _instantiate;
+
+  static AuthenticatedRequested fromMap(Map<String, dynamic> map) {
+    return ensureInitialized().decodeMap<AuthenticatedRequested>(map);
+  }
+
+  static AuthenticatedRequested fromJson(String json) {
+    return ensureInitialized().decodeJson<AuthenticatedRequested>(json);
+  }
+}
+
+mixin AuthenticatedRequestedMappable {
+  String toJson() {
+    return AuthenticatedRequestedMapper.ensureInitialized()
+        .encodeJson<AuthenticatedRequested>(this as AuthenticatedRequested);
+  }
+
+  Map<String, dynamic> toMap() {
+    return AuthenticatedRequestedMapper.ensureInitialized()
+        .encodeMap<AuthenticatedRequested>(this as AuthenticatedRequested);
+  }
+
+  AuthenticatedRequestedCopyWith<AuthenticatedRequested, AuthenticatedRequested,
+          AuthenticatedRequested>
+      get copyWith => _AuthenticatedRequestedCopyWithImpl<
+              AuthenticatedRequested, AuthenticatedRequested>(
+          this as AuthenticatedRequested, $identity, $identity);
+  @override
+  String toString() {
+    return AuthenticatedRequestedMapper.ensureInitialized()
+        .stringifyValue(this as AuthenticatedRequested);
+  }
+
+  @override
+  bool operator ==(Object other) {
+    return AuthenticatedRequestedMapper.ensureInitialized()
+        .equalsValue(this as AuthenticatedRequested, other);
+  }
+
+  @override
+  int get hashCode {
+    return AuthenticatedRequestedMapper.ensureInitialized()
+        .hashValue(this as AuthenticatedRequested);
+  }
+}
+
+extension AuthenticatedRequestedValueCopy<$R, $Out>
+    on ObjectCopyWith<$R, AuthenticatedRequested, $Out> {
+  AuthenticatedRequestedCopyWith<$R, AuthenticatedRequested, $Out>
+      get $asAuthenticatedRequested => $base.as((v, t, t2) =>
+          _AuthenticatedRequestedCopyWithImpl<$R, $Out>(v, t, t2));
+}
+
+abstract class AuthenticatedRequestedCopyWith<
+    $R,
+    $In extends AuthenticatedRequested,
+    $Out> implements ServerWorldEventCopyWith<$R, $In, $Out> {
+  @override
+  $R call({Uint8List? challenge, bool? isRequired});
+  AuthenticatedRequestedCopyWith<$R2, $In, $Out2> $chain<$R2, $Out2>(
+      Then<$Out2, $R2> t);
+}
+
+class _AuthenticatedRequestedCopyWithImpl<$R, $Out>
+    extends ClassCopyWithBase<$R, AuthenticatedRequested, $Out>
+    implements
+        AuthenticatedRequestedCopyWith<$R, AuthenticatedRequested, $Out> {
+  _AuthenticatedRequestedCopyWithImpl(super.value, super.then, super.then2);
+
+  @override
+  late final ClassMapperBase<AuthenticatedRequested> $mapper =
+      AuthenticatedRequestedMapper.ensureInitialized();
+  @override
+  $R call({Uint8List? challenge, bool? isRequired}) =>
+      $apply(FieldCopyWithData({
+        if (challenge != null) #challenge: challenge,
+        if (isRequired != null) #isRequired: isRequired
+      }));
+  @override
+  AuthenticatedRequested $make(CopyWithData data) =>
+      AuthenticatedRequested(data.get(#challenge, or: $value.challenge),
+          isRequired: data.get(#isRequired, or: $value.isRequired));
+
+  @override
+  AuthenticatedRequestedCopyWith<$R2, AuthenticatedRequested, $Out2>
+      $chain<$R2, $Out2>(Then<$Out2, $R2> t) =>
+          _AuthenticatedRequestedCopyWithImpl<$R2, $Out2>($value, $cast, t);
+}
+
 class ClientWorldEventMapper extends SubClassMapperBase<ClientWorldEvent> {
   ClientWorldEventMapper._();
 
@@ -1794,6 +1928,7 @@ class ClientWorldEventMapper extends SubClassMapperBase<ClientWorldEvent> {
       DialogCloseRequestMapper.ensureInitialized();
       ImagesRequestMapper.ensureInitialized();
       ModeChangeRequestMapper.ensureInitialized();
+      AuthenticateRequestMapper.ensureInitialized();
       HybridWorldEventMapper.ensureInitialized();
     }
     return _instance!;
@@ -3368,6 +3503,134 @@ class _ModeChangeRequestCopyWithImpl<$R, $Out>
       _ModeChangeRequestCopyWithImpl<$R2, $Out2>($value, $cast, t);
 }
 
+class AuthenticateRequestMapper
+    extends SubClassMapperBase<AuthenticateRequest> {
+  AuthenticateRequestMapper._();
+
+  static AuthenticateRequestMapper? _instance;
+  static AuthenticateRequestMapper ensureInitialized() {
+    if (_instance == null) {
+      MapperContainer.globals.use(_instance = AuthenticateRequestMapper._());
+      ClientWorldEventMapper.ensureInitialized().addSubMapper(_instance!);
+      MapperContainer.globals.useAll([Base64Uint8ListHook()]);
+    }
+    return _instance!;
+  }
+
+  @override
+  final String id = 'AuthenticateRequest';
+
+  static Uint8List _$signature(AuthenticateRequest v) => v.signature;
+  static const Field<AuthenticateRequest, Uint8List> _f$signature =
+      Field('signature', _$signature);
+  static Uint8List _$publicKey(AuthenticateRequest v) => v.publicKey;
+  static const Field<AuthenticateRequest, Uint8List> _f$publicKey =
+      Field('publicKey', _$publicKey);
+
+  @override
+  final MappableFields<AuthenticateRequest> fields = const {
+    #signature: _f$signature,
+    #publicKey: _f$publicKey,
+  };
+
+  @override
+  final String discriminatorKey = 'type';
+  @override
+  final dynamic discriminatorValue = 'AuthenticateRequest';
+  @override
+  late final ClassMapperBase superMapper =
+      ClientWorldEventMapper.ensureInitialized();
+
+  static AuthenticateRequest _instantiate(DecodingData data) {
+    return AuthenticateRequest(data.dec(_f$signature), data.dec(_f$publicKey));
+  }
+
+  @override
+  final Function instantiate = _instantiate;
+
+  static AuthenticateRequest fromMap(Map<String, dynamic> map) {
+    return ensureInitialized().decodeMap<AuthenticateRequest>(map);
+  }
+
+  static AuthenticateRequest fromJson(String json) {
+    return ensureInitialized().decodeJson<AuthenticateRequest>(json);
+  }
+}
+
+mixin AuthenticateRequestMappable {
+  String toJson() {
+    return AuthenticateRequestMapper.ensureInitialized()
+        .encodeJson<AuthenticateRequest>(this as AuthenticateRequest);
+  }
+
+  Map<String, dynamic> toMap() {
+    return AuthenticateRequestMapper.ensureInitialized()
+        .encodeMap<AuthenticateRequest>(this as AuthenticateRequest);
+  }
+
+  AuthenticateRequestCopyWith<AuthenticateRequest, AuthenticateRequest,
+      AuthenticateRequest> get copyWith => _AuthenticateRequestCopyWithImpl<
+          AuthenticateRequest, AuthenticateRequest>(
+      this as AuthenticateRequest, $identity, $identity);
+  @override
+  String toString() {
+    return AuthenticateRequestMapper.ensureInitialized()
+        .stringifyValue(this as AuthenticateRequest);
+  }
+
+  @override
+  bool operator ==(Object other) {
+    return AuthenticateRequestMapper.ensureInitialized()
+        .equalsValue(this as AuthenticateRequest, other);
+  }
+
+  @override
+  int get hashCode {
+    return AuthenticateRequestMapper.ensureInitialized()
+        .hashValue(this as AuthenticateRequest);
+  }
+}
+
+extension AuthenticateRequestValueCopy<$R, $Out>
+    on ObjectCopyWith<$R, AuthenticateRequest, $Out> {
+  AuthenticateRequestCopyWith<$R, AuthenticateRequest, $Out>
+      get $asAuthenticateRequest => $base.as(
+          (v, t, t2) => _AuthenticateRequestCopyWithImpl<$R, $Out>(v, t, t2));
+}
+
+abstract class AuthenticateRequestCopyWith<$R, $In extends AuthenticateRequest,
+    $Out> implements ClientWorldEventCopyWith<$R, $In, $Out> {
+  @override
+  $R call({Uint8List? signature, Uint8List? publicKey});
+  AuthenticateRequestCopyWith<$R2, $In, $Out2> $chain<$R2, $Out2>(
+      Then<$Out2, $R2> t);
+}
+
+class _AuthenticateRequestCopyWithImpl<$R, $Out>
+    extends ClassCopyWithBase<$R, AuthenticateRequest, $Out>
+    implements AuthenticateRequestCopyWith<$R, AuthenticateRequest, $Out> {
+  _AuthenticateRequestCopyWithImpl(super.value, super.then, super.then2);
+
+  @override
+  late final ClassMapperBase<AuthenticateRequest> $mapper =
+      AuthenticateRequestMapper.ensureInitialized();
+  @override
+  $R call({Uint8List? signature, Uint8List? publicKey}) =>
+      $apply(FieldCopyWithData({
+        if (signature != null) #signature: signature,
+        if (publicKey != null) #publicKey: publicKey
+      }));
+  @override
+  AuthenticateRequest $make(CopyWithData data) => AuthenticateRequest(
+      data.get(#signature, or: $value.signature),
+      data.get(#publicKey, or: $value.publicKey));
+
+  @override
+  AuthenticateRequestCopyWith<$R2, AuthenticateRequest, $Out2>
+      $chain<$R2, $Out2>(Then<$Out2, $R2> t) =>
+          _AuthenticateRequestCopyWithImpl<$R2, $Out2>($value, $cast, t);
+}
+
 class HybridWorldEventMapper extends SubClassMapperBase<HybridWorldEvent> {
   HybridWorldEventMapper._();
 
diff --git a/api/lib/src/event/process/client.dart b/api/lib/src/event/process/client.dart
index 281ae172..ecee4007 100644
--- a/api/lib/src/event/process/client.dart
+++ b/api/lib/src/event/process/client.dart
@@ -9,6 +9,7 @@ bool isValidClientEvent(
   Channel channel,
   WorldState state, {
   required AssetManager assetManager,
+  ChallengeManager? challengeManager,
 }) =>
     switch (event) {
       TeamJoinRequest() => state.info.teams.containsKey(event.team),
@@ -117,22 +118,38 @@ Set<Channel> _hybridNeedsUpdate(HybridWorldEvent event, WorldState state) =>
       _ => {},
     };
 
-ServerResponse? processClientEvent(
-    WorldEvent? event, Channel channel, WorldState state,
-    {required AssetManager assetManager, bool allowServerEvents = false}) {
+Future<ServerResponse?> processClientEvent(
+  WorldEvent? event,
+  Channel channel,
+  WorldState state, {
+  required AssetManager assetManager,
+  bool allowServerEvents = false,
+  ChallengeManager? challengeManager,
+  UserManager? userManager,
+}) async {
+  buildInitialize() => WorldInitialized(
+        table: state.protectTable(channel),
+        info: state.info,
+        id: channel,
+        packsSignature: assetManager
+            .createSignature(state.info.packs.toSet())
+            .values
+            .toList(),
+        teamMembers: state.teamMembers,
+      );
+
   if (event == null) {
-    return ServerResponse.builder(
-        WorldInitialized(
-          table: state.protectTable(channel),
-          info: state.info,
-          id: channel,
-          packsSignature: assetManager
-              .createSignature(state.info.packs.toSet())
-              .values
-              .toList(),
-          teamMembers: state.teamMembers,
-        ),
-        channel);
+    if (challengeManager != null) {
+      final challenge = challengeManager.getChallenge(channel);
+      return ServerResponse.builder(
+          AuthenticatedRequested(
+            challenge,
+            isRequired: true,
+          ),
+          channel);
+    }
+    userManager?.addUser(channel);
+    return ServerResponse.builder(buildInitialize(), channel);
   }
   if (!isValidClientEvent(event, channel, state, assetManager: assetManager)) {
     return null;
@@ -279,5 +296,15 @@ ServerResponse? processClientEvent(
           : assetManager.getPack(location.namespace)?.getMode(location.id);
       return ServerResponse.builder(
           WorldInitialized.fromMode(mode, state), channel);
+    case AuthenticateRequest():
+      final challenge = challengeManager?.getChallenge(channel);
+      if (challenge == null) return null;
+      final verified = await event.verify(challenge);
+      if (!verified) {
+        return ServerResponse.builder(
+            AuthenticatedRequested(challenge, isRequired: true), channel);
+      }
+      userManager?.addUser(channel, event.publicKey);
+      return ServerResponse.builder(buildInitialize(), channel);
   }
 }
diff --git a/api/lib/src/event/process/server.dart b/api/lib/src/event/process/server.dart
index 884afbf7..1ae4db6d 100644
--- a/api/lib/src/event/process/server.dart
+++ b/api/lib/src/event/process/server.dart
@@ -103,6 +103,8 @@ ServerProcessed processServerEvent(
         info: event.info ?? state.info,
         dialogs: event.clearUserInterface ? [] : state.dialogs,
         images: event.clearUserInterface ? {} : state.images,
+        gameState: GameState.play,
+        authRequest: null,
       ));
     case TeamJoined():
       return ServerProcessed(state.copyWith(
@@ -349,5 +351,9 @@ ServerProcessed processServerEvent(
       return ServerProcessed(state.copyWith(
         serverState: event.state,
       ));
+    case AuthenticatedRequested():
+      return ServerProcessed(state.copyWith(
+        authRequest: event,
+      ));
   }
 }
diff --git a/api/lib/src/event/server.dart b/api/lib/src/event/server.dart
index 2a1f3134..591b0b21 100644
--- a/api/lib/src/event/server.dart
+++ b/api/lib/src/event/server.dart
@@ -187,6 +187,23 @@ final class DialogsClosed extends ServerWorldEvent with DialogsClosedMappable {
   DialogsClosed.all() : ids = null;
 }
 
+class Base64Uint8ListHook extends SimpleMapper<Uint8List> {
+  const Base64Uint8ListHook();
+
+  @override
+  Uint8List decode(Object value) {
+    if (value is String) {
+      return base64Decode(value);
+    }
+    return value as Uint8List;
+  }
+
+  @override
+  Object? encode(Uint8List self) {
+    return base64Encode(self);
+  }
+}
+
 class Base64IdMapHook extends SimpleMapper<Map<String, Uint8List>> {
   const Base64IdMapHook();
 
@@ -224,3 +241,12 @@ final class ServerStateUpdated extends ServerWorldEvent
 
   const ServerStateUpdated(this.state);
 }
+
+@MappableClass(includeCustomMappers: [Base64Uint8ListHook()])
+final class AuthenticatedRequested extends ServerWorldEvent
+    with AuthenticatedRequestedMappable {
+  final Uint8List challenge;
+  final bool isRequired;
+
+  const AuthenticatedRequested(this.challenge, {this.isRequired = true});
+}
diff --git a/api/lib/src/event/state.dart b/api/lib/src/event/state.dart
index 6783edd9..8a4ce56e 100644
--- a/api/lib/src/event/state.dart
+++ b/api/lib/src/event/state.dart
@@ -11,6 +11,7 @@ import '../models/meta.dart';
 import '../models/server.dart';
 import '../models/table.dart';
 import '../models/vector.dart';
+import 'event.dart';
 
 part 'state.mapper.dart';
 
@@ -20,6 +21,12 @@ enum WorldOperationMode {
   boards,
 }
 
+@MappableEnum()
+enum GameState {
+  configuration,
+  play,
+}
+
 @MappableClass()
 final class WorldState with WorldStateMappable {
   final GameTable table;
@@ -34,9 +41,12 @@ final class WorldState with WorldStateMappable {
   final List<GameDialog> dialogs;
   final Map<String, Uint8List> images;
   final ServerState serverState;
+  final GameState gameState;
+  final AuthenticatedRequested? authRequest;
 
   const WorldState({
     this.name,
+    this.gameState = GameState.play,
     this.table = const GameTable(),
     this.tableName = '',
     this.info = const GameInfo(),
@@ -47,6 +57,7 @@ final class WorldState with WorldStateMappable {
     this.dialogs = const [],
     this.images = const {},
     this.serverState = const ServerState(),
+    this.authRequest,
     required this.data,
   });
 
diff --git a/api/lib/src/event/state.mapper.dart b/api/lib/src/event/state.mapper.dart
index 65c4266b..31ef0a8d 100644
--- a/api/lib/src/event/state.mapper.dart
+++ b/api/lib/src/event/state.mapper.dart
@@ -52,6 +52,52 @@ extension WorldOperationModeMapperExtension on WorldOperationMode {
   }
 }
 
+class GameStateMapper extends EnumMapper<GameState> {
+  GameStateMapper._();
+
+  static GameStateMapper? _instance;
+  static GameStateMapper ensureInitialized() {
+    if (_instance == null) {
+      MapperContainer.globals.use(_instance = GameStateMapper._());
+    }
+    return _instance!;
+  }
+
+  static GameState fromValue(dynamic value) {
+    ensureInitialized();
+    return MapperContainer.globals.fromValue(value);
+  }
+
+  @override
+  GameState decode(dynamic value) {
+    switch (value) {
+      case r'configuration':
+        return GameState.configuration;
+      case r'play':
+        return GameState.play;
+      default:
+        throw MapperException.unknownEnumValue(value);
+    }
+  }
+
+  @override
+  dynamic encode(GameState self) {
+    switch (self) {
+      case GameState.configuration:
+        return r'configuration';
+      case GameState.play:
+        return r'play';
+    }
+  }
+}
+
+extension GameStateMapperExtension on GameState {
+  String toValue() {
+    GameStateMapper.ensureInitialized();
+    return MapperContainer.globals.toValue<GameState>(this) as String;
+  }
+}
+
 class WorldStateMapper extends ClassMapperBase<WorldState> {
   WorldStateMapper._();
 
@@ -59,12 +105,14 @@ class WorldStateMapper extends ClassMapperBase<WorldState> {
   static WorldStateMapper ensureInitialized() {
     if (_instance == null) {
       MapperContainer.globals.use(_instance = WorldStateMapper._());
+      GameStateMapper.ensureInitialized();
       GameTableMapper.ensureInitialized();
       GameInfoMapper.ensureInitialized();
       FileMetadataMapper.ensureInitialized();
       ChatMessageMapper.ensureInitialized();
       GameDialogMapper.ensureInitialized();
       ServerStateMapper.ensureInitialized();
+      AuthenticatedRequestedMapper.ensureInitialized();
     }
     return _instance!;
   }
@@ -75,6 +123,9 @@ class WorldStateMapper extends ClassMapperBase<WorldState> {
   static String? _$name(WorldState v) => v.name;
   static const Field<WorldState, String> _f$name =
       Field('name', _$name, opt: true);
+  static GameState _$gameState(WorldState v) => v.gameState;
+  static const Field<WorldState, GameState> _f$gameState =
+      Field('gameState', _$gameState, opt: true, def: GameState.play);
   static GameTable _$table(WorldState v) => v.table;
   static const Field<WorldState, GameTable> _f$table =
       Field('table', _$table, opt: true, def: const GameTable());
@@ -105,12 +156,16 @@ class WorldStateMapper extends ClassMapperBase<WorldState> {
   static ServerState _$serverState(WorldState v) => v.serverState;
   static const Field<WorldState, ServerState> _f$serverState =
       Field('serverState', _$serverState, opt: true, def: const ServerState());
+  static AuthenticatedRequested? _$authRequest(WorldState v) => v.authRequest;
+  static const Field<WorldState, AuthenticatedRequested> _f$authRequest =
+      Field('authRequest', _$authRequest, opt: true);
   static SetonixData _$data(WorldState v) => v.data;
   static const Field<WorldState, SetonixData> _f$data = Field('data', _$data);
 
   @override
   final MappableFields<WorldState> fields = const {
     #name: _f$name,
+    #gameState: _f$gameState,
     #table: _f$table,
     #tableName: _f$tableName,
     #info: _f$info,
@@ -121,12 +176,14 @@ class WorldStateMapper extends ClassMapperBase<WorldState> {
     #dialogs: _f$dialogs,
     #images: _f$images,
     #serverState: _f$serverState,
+    #authRequest: _f$authRequest,
     #data: _f$data,
   };
 
   static WorldState _instantiate(DecodingData data) {
     return WorldState(
         name: data.dec(_f$name),
+        gameState: data.dec(_f$gameState),
         table: data.dec(_f$table),
         tableName: data.dec(_f$tableName),
         info: data.dec(_f$info),
@@ -137,6 +194,7 @@ class WorldStateMapper extends ClassMapperBase<WorldState> {
         dialogs: data.dec(_f$dialogs),
         images: data.dec(_f$images),
         serverState: data.dec(_f$serverState),
+        authRequest: data.dec(_f$authRequest),
         data: data.dec(_f$data));
   }
 
@@ -204,8 +262,11 @@ abstract class WorldStateCopyWith<$R, $In extends WorldState, $Out>
   MapCopyWith<$R, String, Uint8List, ObjectCopyWith<$R, Uint8List, Uint8List>>
       get images;
   ServerStateCopyWith<$R, ServerState, ServerState> get serverState;
+  AuthenticatedRequestedCopyWith<$R, AuthenticatedRequested,
+      AuthenticatedRequested>? get authRequest;
   $R call(
       {String? name,
+      GameState? gameState,
       GameTable? table,
       String? tableName,
       GameInfo? info,
@@ -216,6 +277,7 @@ abstract class WorldStateCopyWith<$R, $In extends WorldState, $Out>
       List<GameDialog>? dialogs,
       Map<String, Uint8List>? images,
       ServerState? serverState,
+      AuthenticatedRequested? authRequest,
       SetonixData? data});
   WorldStateCopyWith<$R2, $In, $Out2> $chain<$R2, $Out2>(Then<$Out2, $R2> t);
 }
@@ -260,8 +322,14 @@ class _WorldStateCopyWithImpl<$R, $Out>
   ServerStateCopyWith<$R, ServerState, ServerState> get serverState =>
       $value.serverState.copyWith.$chain((v) => call(serverState: v));
   @override
+  AuthenticatedRequestedCopyWith<$R, AuthenticatedRequested,
+          AuthenticatedRequested>?
+      get authRequest =>
+          $value.authRequest?.copyWith.$chain((v) => call(authRequest: v));
+  @override
   $R call(
           {Object? name = $none,
+          GameState? gameState,
           GameTable? table,
           String? tableName,
           GameInfo? info,
@@ -272,9 +340,11 @@ class _WorldStateCopyWithImpl<$R, $Out>
           List<GameDialog>? dialogs,
           Map<String, Uint8List>? images,
           ServerState? serverState,
+          Object? authRequest = $none,
           SetonixData? data}) =>
       $apply(FieldCopyWithData({
         if (name != $none) #name: name,
+        if (gameState != null) #gameState: gameState,
         if (table != null) #table: table,
         if (tableName != null) #tableName: tableName,
         if (info != null) #info: info,
@@ -285,11 +355,13 @@ class _WorldStateCopyWithImpl<$R, $Out>
         if (dialogs != null) #dialogs: dialogs,
         if (images != null) #images: images,
         if (serverState != null) #serverState: serverState,
+        if (authRequest != $none) #authRequest: authRequest,
         if (data != null) #data: data
       }));
   @override
   WorldState $make(CopyWithData data) => WorldState(
       name: data.get(#name, or: $value.name),
+      gameState: data.get(#gameState, or: $value.gameState),
       table: data.get(#table, or: $value.table),
       tableName: data.get(#tableName, or: $value.tableName),
       info: data.get(#info, or: $value.info),
@@ -300,6 +372,7 @@ class _WorldStateCopyWithImpl<$R, $Out>
       dialogs: data.get(#dialogs, or: $value.dialogs),
       images: data.get(#images, or: $value.images),
       serverState: data.get(#serverState, or: $value.serverState),
+      authRequest: data.get(#authRequest, or: $value.authRequest),
       data: data.get(#data, or: $value.data));
 
   @override
diff --git a/api/lib/src/helpers/crypto.dart b/api/lib/src/helpers/crypto.dart
new file mode 100644
index 00000000..a1063d21
--- /dev/null
+++ b/api/lib/src/helpers/crypto.dart
@@ -0,0 +1,18 @@
+import 'dart:typed_data';
+
+import 'package:convert/convert.dart';
+import 'package:crypto/crypto.dart';
+
+String generateFingerprint(Uint8List publicKeyBytes, [bool short = false]) {
+  final digest = sha256.convert(publicKeyBytes);
+  var hexString = hex.encode(digest.bytes);
+  if (short) {
+    hexString = hexString.substring(0, 32);
+  }
+  final output = hexString.replaceAllMapped(
+    RegExp(r'.{2}'),
+    (match) => '${match.group(0)!}:',
+  );
+
+  return output.endsWith(':') ? output.substring(0, output.length - 1) : output;
+}
diff --git a/api/lib/src/models/config.dart b/api/lib/src/models/config.dart
index cbfda0ff..b2a08e4b 100644
--- a/api/lib/src/models/config.dart
+++ b/api/lib/src/models/config.dart
@@ -26,6 +26,9 @@ final class SetonixConfig with SetonixConfigMappable {
   final String? description;
   static const String defaultDescription = 'A server for Setonix.';
   static const String envDescription = 'SETONIX_DESCRIPTION';
+  final String? guestPrefix;
+  static const String defaultGuestPrefix = 'Guest ';
+  static const String envGuestPrefix = 'SETONIX_GUEST_PREFIX';
 
   const SetonixConfig({
     this.host,
@@ -35,6 +38,7 @@ final class SetonixConfig with SetonixConfigMappable {
     this.multiWorld,
     this.maxPlayers,
     this.description,
+    this.guestPrefix,
   });
 
   static const defaultConfig = SetonixConfig(
@@ -45,6 +49,7 @@ final class SetonixConfig with SetonixConfigMappable {
     multiWorld: defaultMultiWorld,
     maxPlayers: defaultMaxPlayers,
     description: defaultDescription,
+    guestPrefix: defaultGuestPrefix,
   );
 
   static SetonixConfig fromEnvironment() {
@@ -71,6 +76,10 @@ final class SetonixConfig with SetonixConfigMappable {
           ? String.fromEnvironment(envDescription,
               defaultValue: defaultDescription)
           : null,
+      guestPrefix: bool.hasEnvironment(envGuestPrefix)
+          ? String.fromEnvironment(envGuestPrefix,
+              defaultValue: defaultGuestPrefix)
+          : null,
     );
   }
 
@@ -82,5 +91,6 @@ final class SetonixConfig with SetonixConfigMappable {
         multiWorld: other.multiWorld ?? multiWorld,
         maxPlayers: other.maxPlayers ?? maxPlayers,
         description: other.description ?? description,
+        guestPrefix: other.guestPrefix ?? guestPrefix,
       );
 }
diff --git a/api/lib/src/models/config.mapper.dart b/api/lib/src/models/config.mapper.dart
index c7e10576..567d94f4 100644
--- a/api/lib/src/models/config.mapper.dart
+++ b/api/lib/src/models/config.mapper.dart
@@ -41,6 +41,9 @@ class SetonixConfigMapper extends ClassMapperBase<SetonixConfig> {
   static String? _$description(SetonixConfig v) => v.description;
   static const Field<SetonixConfig, String> _f$description =
       Field('description', _$description, opt: true);
+  static String? _$guestPrefix(SetonixConfig v) => v.guestPrefix;
+  static const Field<SetonixConfig, String> _f$guestPrefix =
+      Field('guestPrefix', _$guestPrefix, opt: true);
 
   @override
   final MappableFields<SetonixConfig> fields = const {
@@ -51,6 +54,7 @@ class SetonixConfigMapper extends ClassMapperBase<SetonixConfig> {
     #multiWorld: _f$multiWorld,
     #maxPlayers: _f$maxPlayers,
     #description: _f$description,
+    #guestPrefix: _f$guestPrefix,
   };
 
   static SetonixConfig _instantiate(DecodingData data) {
@@ -61,7 +65,8 @@ class SetonixConfigMapper extends ClassMapperBase<SetonixConfig> {
         autosave: data.dec(_f$autosave),
         multiWorld: data.dec(_f$multiWorld),
         maxPlayers: data.dec(_f$maxPlayers),
-        description: data.dec(_f$description));
+        description: data.dec(_f$description),
+        guestPrefix: data.dec(_f$guestPrefix));
   }
 
   @override
@@ -124,7 +129,8 @@ abstract class SetonixConfigCopyWith<$R, $In extends SetonixConfig, $Out>
       bool? autosave,
       bool? multiWorld,
       int? maxPlayers,
-      String? description});
+      String? description,
+      String? guestPrefix});
   SetonixConfigCopyWith<$R2, $In, $Out2> $chain<$R2, $Out2>(Then<$Out2, $R2> t);
 }
 
@@ -144,7 +150,8 @@ class _SetonixConfigCopyWithImpl<$R, $Out>
           Object? autosave = $none,
           Object? multiWorld = $none,
           Object? maxPlayers = $none,
-          Object? description = $none}) =>
+          Object? description = $none,
+          Object? guestPrefix = $none}) =>
       $apply(FieldCopyWithData({
         if (host != $none) #host: host,
         if (port != $none) #port: port,
@@ -152,7 +159,8 @@ class _SetonixConfigCopyWithImpl<$R, $Out>
         if (autosave != $none) #autosave: autosave,
         if (multiWorld != $none) #multiWorld: multiWorld,
         if (maxPlayers != $none) #maxPlayers: maxPlayers,
-        if (description != $none) #description: description
+        if (description != $none) #description: description,
+        if (guestPrefix != $none) #guestPrefix: guestPrefix
       }));
   @override
   SetonixConfig $make(CopyWithData data) => SetonixConfig(
@@ -162,7 +170,8 @@ class _SetonixConfigCopyWithImpl<$R, $Out>
       autosave: data.get(#autosave, or: $value.autosave),
       multiWorld: data.get(#multiWorld, or: $value.multiWorld),
       maxPlayers: data.get(#maxPlayers, or: $value.maxPlayers),
-      description: data.get(#description, or: $value.description));
+      description: data.get(#description, or: $value.description),
+      guestPrefix: data.get(#guestPrefix, or: $value.guestPrefix));
 
   @override
   SetonixConfigCopyWith<$R2, SetonixConfig, $Out2> $chain<$R2, $Out2>(
diff --git a/api/lib/src/models/data.dart b/api/lib/src/models/data.dart
index 6e82693e..03bdaa70 100644
--- a/api/lib/src/models/data.dart
+++ b/api/lib/src/models/data.dart
@@ -22,6 +22,7 @@ const kPackTranslationsPath = 'translations';
 const kPackBackgroundsPath = 'backgrounds';
 const kPackScriptsPath = 'scripts';
 const kPackModesPath = 'modes';
+const kPackAccountsPath = 'accounts';
 
 const kGameTablePath = 'tables';
 const kGameTeamPath = 'teams.json';
@@ -312,6 +313,32 @@ class SetonixData extends ArchiveData<SetonixData> {
         if (mode == null) return null;
         return MapEntry(e, mode);
       }).nonNulls);
+
+  SetonixData addAccount(SetonixAccount setonixAccount) {
+    final accountId = setonixAccount.name;
+    return setAsset(
+            '$kPackAccountsPath/$accountId.key', setonixAccount.privateKey)
+        .setAsset(
+            '$kPackAccountsPath/$accountId.pub', setonixAccount.publicKey);
+  }
+
+  Iterable<SetonixAccount> getAccounts() sync* {
+    const kKeySuffix = '.key';
+    final privateKeys = getAssets('$kPackAccountsPath/', true)
+        .where((e) => e.endsWith(kKeySuffix));
+    for (final path in privateKeys) {
+      final name = path.substring(0, path.length - kKeySuffix.length);
+      final privateKey = getAsset(path);
+      if (privateKey == null) continue;
+      final publicKey = getAsset('$kPackAccountsPath/$name.pub');
+      if (publicKey == null) continue;
+      yield SetonixAccount(
+        privateKey: privateKey,
+        publicKey: publicKey,
+        name: name,
+      );
+    }
+  }
 }
 
 class SetonixFile {
diff --git a/api/lib/src/models/meta.dart b/api/lib/src/models/meta.dart
index 4ef78d23..1e701d4d 100644
--- a/api/lib/src/models/meta.dart
+++ b/api/lib/src/models/meta.dart
@@ -1,4 +1,8 @@
+import 'dart:typed_data';
+
+import 'package:cryptography_plus/cryptography_plus.dart';
 import 'package:dart_mappable/dart_mappable.dart';
+import 'package:setonix_api/src/helpers/crypto.dart';
 
 part 'meta.mapper.dart';
 
@@ -9,6 +13,7 @@ enum FileType {
   pack,
   game,
   template,
+  accounts,
 }
 
 @MappableClass()
@@ -65,3 +70,24 @@ final class DataMetadata with DataMetadataMappable {
     return serversLastUsed.values.fold(addedAt, (a, b) => a.isAfter(b) ? a : b);
   }
 }
+
+final class SetonixAccount {
+  final Uint8List privateKey;
+  final Uint8List publicKey;
+  final String name;
+
+  SetonixAccount({
+    required this.privateKey,
+    required this.publicKey,
+    required this.name,
+  });
+
+  KeyPair get keyPair => SimpleKeyPairData(
+        privateKey,
+        publicKey: SimplePublicKey(publicKey, type: KeyPairType.ed25519),
+        type: KeyPairType.ed25519,
+      );
+
+  String getFingerprint([bool short = false]) =>
+      generateFingerprint(publicKey, short);
+}
diff --git a/api/lib/src/models/meta.mapper.dart b/api/lib/src/models/meta.mapper.dart
index b2f71bf8..78540fc0 100644
--- a/api/lib/src/models/meta.mapper.dart
+++ b/api/lib/src/models/meta.mapper.dart
@@ -31,6 +31,8 @@ class FileTypeMapper extends EnumMapper<FileType> {
         return FileType.game;
       case r'template':
         return FileType.template;
+      case r'accounts':
+        return FileType.accounts;
       default:
         throw MapperException.unknownEnumValue(value);
     }
@@ -45,6 +47,8 @@ class FileTypeMapper extends EnumMapper<FileType> {
         return r'game';
       case FileType.template:
         return r'template';
+      case FileType.accounts:
+        return r'accounts';
     }
   }
 }
diff --git a/api/lib/src/models/server.dart b/api/lib/src/models/server.dart
index 042c7716..6d2bab03 100644
--- a/api/lib/src/models/server.dart
+++ b/api/lib/src/models/server.dart
@@ -46,6 +46,17 @@ final class ListGameServer extends GameServer with ListGameServerMappable {
       buildServerAddress(Uri.parse(address), secure, webSockets: webSockets);
 }
 
+@MappableClass()
+final class BrowsedGameServer extends ListGameServer
+    with BrowsedGameServerMappable {
+  BrowsedGameServer({
+    super.name = '',
+    required super.address,
+    super.secure = true,
+    super.highlighted = false,
+  });
+}
+
 Uri buildServerAddress(Uri uri, bool secure, {bool webSockets = true}) {
   // handle plain host without scheme: treat single-segment path as host
   if (uri.host.isEmpty && uri.pathSegments.length == 1) {
@@ -53,10 +64,7 @@ Uri buildServerAddress(Uri uri, bool secure, {bool webSockets = true}) {
         host: uri.pathSegments.first,
         pathSegments: uri.pathSegments.skip(1).toList());
   }
-  if (uri.scheme.isEmpty) {
-    uri =
-        uri.replace(scheme: (webSockets ? 'ws' : 'http') + (secure ? 's' : ''));
-  }
+  uri = uri.replace(scheme: (webSockets ? 'ws' : 'http') + (secure ? 's' : ''));
   if (!uri.hasPort) {
     uri = uri.replace(port: kDefaultPort);
   }
diff --git a/api/lib/src/models/server.mapper.dart b/api/lib/src/models/server.mapper.dart
index 36993da8..b94a99a0 100644
--- a/api/lib/src/models/server.mapper.dart
+++ b/api/lib/src/models/server.mapper.dart
@@ -186,6 +186,7 @@ class ListGameServerMapper extends ClassMapperBase<ListGameServer> {
     if (_instance == null) {
       MapperContainer.globals.use(_instance = ListGameServerMapper._());
       GameServerMapper.ensureInitialized();
+      BrowsedGameServerMapper.ensureInitialized();
     }
     return _instance!;
   }
@@ -311,6 +312,141 @@ class _ListGameServerCopyWithImpl<$R, $Out>
       _ListGameServerCopyWithImpl<$R2, $Out2>($value, $cast, t);
 }
 
+class BrowsedGameServerMapper extends ClassMapperBase<BrowsedGameServer> {
+  BrowsedGameServerMapper._();
+
+  static BrowsedGameServerMapper? _instance;
+  static BrowsedGameServerMapper ensureInitialized() {
+    if (_instance == null) {
+      MapperContainer.globals.use(_instance = BrowsedGameServerMapper._());
+      ListGameServerMapper.ensureInitialized();
+    }
+    return _instance!;
+  }
+
+  @override
+  final String id = 'BrowsedGameServer';
+
+  static String _$name(BrowsedGameServer v) => v.name;
+  static const Field<BrowsedGameServer, String> _f$name =
+      Field('name', _$name, opt: true, def: '');
+  static String _$address(BrowsedGameServer v) => v.address;
+  static const Field<BrowsedGameServer, String> _f$address =
+      Field('address', _$address);
+  static bool _$secure(BrowsedGameServer v) => v.secure;
+  static const Field<BrowsedGameServer, bool> _f$secure =
+      Field('secure', _$secure, opt: true, def: true);
+  static bool _$highlighted(BrowsedGameServer v) => v.highlighted;
+  static const Field<BrowsedGameServer, bool> _f$highlighted =
+      Field('highlighted', _$highlighted, opt: true, def: false);
+
+  @override
+  final MappableFields<BrowsedGameServer> fields = const {
+    #name: _f$name,
+    #address: _f$address,
+    #secure: _f$secure,
+    #highlighted: _f$highlighted,
+  };
+
+  static BrowsedGameServer _instantiate(DecodingData data) {
+    return BrowsedGameServer(
+        name: data.dec(_f$name),
+        address: data.dec(_f$address),
+        secure: data.dec(_f$secure),
+        highlighted: data.dec(_f$highlighted));
+  }
+
+  @override
+  final Function instantiate = _instantiate;
+
+  static BrowsedGameServer fromMap(Map<String, dynamic> map) {
+    return ensureInitialized().decodeMap<BrowsedGameServer>(map);
+  }
+
+  static BrowsedGameServer fromJson(String json) {
+    return ensureInitialized().decodeJson<BrowsedGameServer>(json);
+  }
+}
+
+mixin BrowsedGameServerMappable {
+  String toJson() {
+    return BrowsedGameServerMapper.ensureInitialized()
+        .encodeJson<BrowsedGameServer>(this as BrowsedGameServer);
+  }
+
+  Map<String, dynamic> toMap() {
+    return BrowsedGameServerMapper.ensureInitialized()
+        .encodeMap<BrowsedGameServer>(this as BrowsedGameServer);
+  }
+
+  BrowsedGameServerCopyWith<BrowsedGameServer, BrowsedGameServer,
+          BrowsedGameServer>
+      get copyWith =>
+          _BrowsedGameServerCopyWithImpl<BrowsedGameServer, BrowsedGameServer>(
+              this as BrowsedGameServer, $identity, $identity);
+  @override
+  String toString() {
+    return BrowsedGameServerMapper.ensureInitialized()
+        .stringifyValue(this as BrowsedGameServer);
+  }
+
+  @override
+  bool operator ==(Object other) {
+    return BrowsedGameServerMapper.ensureInitialized()
+        .equalsValue(this as BrowsedGameServer, other);
+  }
+
+  @override
+  int get hashCode {
+    return BrowsedGameServerMapper.ensureInitialized()
+        .hashValue(this as BrowsedGameServer);
+  }
+}
+
+extension BrowsedGameServerValueCopy<$R, $Out>
+    on ObjectCopyWith<$R, BrowsedGameServer, $Out> {
+  BrowsedGameServerCopyWith<$R, BrowsedGameServer, $Out>
+      get $asBrowsedGameServer => $base
+          .as((v, t, t2) => _BrowsedGameServerCopyWithImpl<$R, $Out>(v, t, t2));
+}
+
+abstract class BrowsedGameServerCopyWith<$R, $In extends BrowsedGameServer,
+    $Out> implements ListGameServerCopyWith<$R, $In, $Out> {
+  @override
+  $R call({String? name, String? address, bool? secure, bool? highlighted});
+  BrowsedGameServerCopyWith<$R2, $In, $Out2> $chain<$R2, $Out2>(
+      Then<$Out2, $R2> t);
+}
+
+class _BrowsedGameServerCopyWithImpl<$R, $Out>
+    extends ClassCopyWithBase<$R, BrowsedGameServer, $Out>
+    implements BrowsedGameServerCopyWith<$R, BrowsedGameServer, $Out> {
+  _BrowsedGameServerCopyWithImpl(super.value, super.then, super.then2);
+
+  @override
+  late final ClassMapperBase<BrowsedGameServer> $mapper =
+      BrowsedGameServerMapper.ensureInitialized();
+  @override
+  $R call({String? name, String? address, bool? secure, bool? highlighted}) =>
+      $apply(FieldCopyWithData({
+        if (name != null) #name: name,
+        if (address != null) #address: address,
+        if (secure != null) #secure: secure,
+        if (highlighted != null) #highlighted: highlighted
+      }));
+  @override
+  BrowsedGameServer $make(CopyWithData data) => BrowsedGameServer(
+      name: data.get(#name, or: $value.name),
+      address: data.get(#address, or: $value.address),
+      secure: data.get(#secure, or: $value.secure),
+      highlighted: data.get(#highlighted, or: $value.highlighted));
+
+  @override
+  BrowsedGameServerCopyWith<$R2, BrowsedGameServer, $Out2> $chain<$R2, $Out2>(
+          Then<$Out2, $R2> t) =>
+      _BrowsedGameServerCopyWithImpl<$R2, $Out2>($value, $cast, t);
+}
+
 class GamePropertyMapper extends ClassMapperBase<GameProperty> {
   GamePropertyMapper._();
 
diff --git a/api/lib/src/services/challenge.dart b/api/lib/src/services/challenge.dart
new file mode 100644
index 00000000..9fc790be
--- /dev/null
+++ b/api/lib/src/services/challenge.dart
@@ -0,0 +1,25 @@
+import 'dart:math';
+import 'dart:typed_data';
+
+import 'package:networker/networker.dart';
+
+class ChallengeManager {
+  final Map<Channel, Uint8List> _challenges = {};
+
+  Uint8List getChallenge(Channel channel) {
+    return _challenges[channel] ??= generateChallenge();
+  }
+
+  void removeChallenge(Channel channel) {
+    _challenges.remove(channel);
+  }
+}
+
+Uint8List generateChallenge() {
+  final random = Random.secure();
+  final bytes = Uint8List(32);
+  for (var i = 0; i < bytes.length; i++) {
+    bytes[i] = random.nextInt(256);
+  }
+  return bytes;
+}
diff --git a/api/lib/src/services/user.dart b/api/lib/src/services/user.dart
new file mode 100644
index 00000000..efbf0806
--- /dev/null
+++ b/api/lib/src/services/user.dart
@@ -0,0 +1,64 @@
+import 'dart:typed_data';
+
+import 'package:dart_mappable/dart_mappable.dart';
+import 'package:networker/networker.dart';
+import 'package:setonix_api/event.dart';
+
+part 'user.mapper.dart';
+
+@MappableClass(includeCustomMappers: [Base64Uint8ListHook()])
+final class SetonixUser with SetonixUserMappable {
+  final Uint8List? publicKey;
+  final String name;
+
+  const SetonixUser({
+    this.publicKey,
+    required this.name,
+  });
+}
+
+final class UserManager {
+  final Map<Channel, SetonixUser> _users = {};
+  final String guestPrefix;
+  int _nextGuestId = 1;
+
+  UserManager([this.guestPrefix = SetonixConfig.defaultGuestPrefix]);
+
+  bool containsUserName(String name) =>
+      _users.values.any((u) => u.name == name);
+
+  void removeUser(Channel channel) {
+    _users.remove(channel);
+  }
+
+  /// Retrieves the user associated with the channel.
+  SetonixUser? getUser(Channel channel) => _users[channel];
+
+  /// Retrieves a user by name.
+  SetonixUser? getUserByName(String name) {
+    for (var user in _users.values) {
+      if (user.name == name) {
+        return user;
+      }
+    }
+    return null;
+  }
+
+  String _generateGuestName() {
+    String name;
+    do {
+      name = '$guestPrefix$_nextGuestId';
+      _nextGuestId++;
+    } while (containsUserName(name));
+    return name;
+  }
+
+  bool addUser(Channel channel, [Uint8List? publicKey, String? name]) {
+    name ??= _generateGuestName();
+    if (containsUserName(name)) {
+      return false;
+    }
+    _users[channel] = SetonixUser(publicKey: publicKey, name: name);
+    return true;
+  }
+}
diff --git a/api/lib/src/services/user.mapper.dart b/api/lib/src/services/user.mapper.dart
new file mode 100644
index 00000000..d7d8b2e3
--- /dev/null
+++ b/api/lib/src/services/user.mapper.dart
@@ -0,0 +1,120 @@
+// coverage:ignore-file
+// GENERATED CODE - DO NOT MODIFY BY HAND
+// ignore_for_file: type=lint
+// ignore_for_file: unused_element, unnecessary_cast, override_on_non_overriding_member
+// ignore_for_file: strict_raw_type, inference_failure_on_untyped_parameter
+
+part of 'user.dart';
+
+class SetonixUserMapper extends ClassMapperBase<SetonixUser> {
+  SetonixUserMapper._();
+
+  static SetonixUserMapper? _instance;
+  static SetonixUserMapper ensureInitialized() {
+    if (_instance == null) {
+      MapperContainer.globals.use(_instance = SetonixUserMapper._());
+      MapperContainer.globals.useAll([Base64Uint8ListHook()]);
+    }
+    return _instance!;
+  }
+
+  @override
+  final String id = 'SetonixUser';
+
+  static Uint8List? _$publicKey(SetonixUser v) => v.publicKey;
+  static const Field<SetonixUser, Uint8List> _f$publicKey =
+      Field('publicKey', _$publicKey, opt: true);
+  static String _$name(SetonixUser v) => v.name;
+  static const Field<SetonixUser, String> _f$name = Field('name', _$name);
+
+  @override
+  final MappableFields<SetonixUser> fields = const {
+    #publicKey: _f$publicKey,
+    #name: _f$name,
+  };
+
+  static SetonixUser _instantiate(DecodingData data) {
+    return SetonixUser(
+        publicKey: data.dec(_f$publicKey), name: data.dec(_f$name));
+  }
+
+  @override
+  final Function instantiate = _instantiate;
+
+  static SetonixUser fromMap(Map<String, dynamic> map) {
+    return ensureInitialized().decodeMap<SetonixUser>(map);
+  }
+
+  static SetonixUser fromJson(String json) {
+    return ensureInitialized().decodeJson<SetonixUser>(json);
+  }
+}
+
+mixin SetonixUserMappable {
+  String toJson() {
+    return SetonixUserMapper.ensureInitialized()
+        .encodeJson<SetonixUser>(this as SetonixUser);
+  }
+
+  Map<String, dynamic> toMap() {
+    return SetonixUserMapper.ensureInitialized()
+        .encodeMap<SetonixUser>(this as SetonixUser);
+  }
+
+  SetonixUserCopyWith<SetonixUser, SetonixUser, SetonixUser> get copyWith =>
+      _SetonixUserCopyWithImpl<SetonixUser, SetonixUser>(
+          this as SetonixUser, $identity, $identity);
+  @override
+  String toString() {
+    return SetonixUserMapper.ensureInitialized()
+        .stringifyValue(this as SetonixUser);
+  }
+
+  @override
+  bool operator ==(Object other) {
+    return SetonixUserMapper.ensureInitialized()
+        .equalsValue(this as SetonixUser, other);
+  }
+
+  @override
+  int get hashCode {
+    return SetonixUserMapper.ensureInitialized().hashValue(this as SetonixUser);
+  }
+}
+
+extension SetonixUserValueCopy<$R, $Out>
+    on ObjectCopyWith<$R, SetonixUser, $Out> {
+  SetonixUserCopyWith<$R, SetonixUser, $Out> get $asSetonixUser =>
+      $base.as((v, t, t2) => _SetonixUserCopyWithImpl<$R, $Out>(v, t, t2));
+}
+
+abstract class SetonixUserCopyWith<$R, $In extends SetonixUser, $Out>
+    implements ClassCopyWith<$R, $In, $Out> {
+  $R call({Uint8List? publicKey, String? name});
+  SetonixUserCopyWith<$R2, $In, $Out2> $chain<$R2, $Out2>(Then<$Out2, $R2> t);
+}
+
+class _SetonixUserCopyWithImpl<$R, $Out>
+    extends ClassCopyWithBase<$R, SetonixUser, $Out>
+    implements SetonixUserCopyWith<$R, SetonixUser, $Out> {
+  _SetonixUserCopyWithImpl(super.value, super.then, super.then2);
+
+  @override
+  late final ClassMapperBase<SetonixUser> $mapper =
+      SetonixUserMapper.ensureInitialized();
+  @override
+  $R call({Object? publicKey = $none, String? name}) =>
+      $apply(FieldCopyWithData({
+        if (publicKey != $none) #publicKey: publicKey,
+        if (name != null) #name: name
+      }));
+  @override
+  SetonixUser $make(CopyWithData data) => SetonixUser(
+      publicKey: data.get(#publicKey, or: $value.publicKey),
+      name: data.get(#name, or: $value.name));
+
+  @override
+  SetonixUserCopyWith<$R2, SetonixUser, $Out2> $chain<$R2, $Out2>(
+          Then<$Out2, $R2> t) =>
+      _SetonixUserCopyWithImpl<$R2, $Out2>($value, $cast, t);
+}
diff --git a/api/pubspec.lock b/api/pubspec.lock
index db6ef648..2763daf2 100644
--- a/api/pubspec.lock
+++ b/api/pubspec.lock
@@ -146,7 +146,7 @@ packages:
     source: hosted
     version: "1.19.1"
   convert:
-    dependency: transitive
+    dependency: "direct main"
     description:
       name: convert
       sha256: b30acd5944035672bc15c6b7a8b47d773e41e2f17de064350988c5d02adb1c68
@@ -161,6 +161,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.0.6"
+  cryptography_plus:
+    dependency: "direct main"
+    description:
+      name: cryptography_plus
+      sha256: "34db787df4f4740a39474b6fb0a610aa6dc13a5b5b68754b4787a79939ac0454"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.7.1"
   dart_leap:
     dependency: "direct main"
     description:
diff --git a/api/pubspec.yaml b/api/pubspec.yaml
index a8702958..9f58782d 100644
--- a/api/pubspec.yaml
+++ b/api/pubspec.yaml
@@ -28,6 +28,8 @@ dependencies:
       ref: b7787191b0705ff0a22149409b1b360468d9e06d
   crypto: ^3.0.5
   collection: ^1.18.0
+  convert: ^3.1.2
+  cryptography_plus: ^2.7.1
   # path: ^1.8.0
 
 dev_dependencies:
diff --git a/app/lib/api/open.dart b/app/lib/api/open.dart
index 8d45eeb9..591fe19d 100644
--- a/app/lib/api/open.dart
+++ b/app/lib/api/open.dart
@@ -93,29 +93,31 @@ Future<void> importFileData(BuildContext context, SetonixFileSystem fileSystem,
   final data = file.load();
   final metadata = data.getMetadataOrDefault();
   final type = metadata.type;
+  final loc = AppLocalizations.of(context);
   final result = await showDialog<bool>(
     context: context,
     builder: (context) => AlertDialog(
       title: Text(switch (type) {
-        FileType.pack => AppLocalizations.of(context).importPack,
-        FileType.game => AppLocalizations.of(context).importGame,
-        FileType.template => AppLocalizations.of(context).importTemplate,
+        FileType.pack => loc.importPack,
+        FileType.game => loc.importGame,
+        FileType.template => loc.importTemplate,
+        FileType.accounts => loc.importAccounts,
       }),
       content: Text(switch (type) {
-        FileType.pack => AppLocalizations.of(context).importPackDescription,
-        FileType.game => AppLocalizations.of(context).importGameDescription,
-        FileType.template =>
-          AppLocalizations.of(context).importTemplateDescription,
+        FileType.pack => loc.importPackDescription,
+        FileType.game => loc.importGameDescription,
+        FileType.template => loc.importTemplateDescription,
+        FileType.accounts => loc.importAccountsDescription,
       }),
       actions: [
         TextButton.icon(
           onPressed: () => Navigator.of(context).pop(false),
-          label: Text(AppLocalizations.of(context).cancel),
+          label: Text(loc.cancel),
           icon: Icon(PhosphorIconsLight.prohibit),
         ),
         ElevatedButton.icon(
           onPressed: () => Navigator.of(context).pop(true),
-          label: Text(AppLocalizations.of(context).import),
+          label: Text(loc.import),
           icon: Icon(PhosphorIconsLight.boxArrowDown),
         ),
       ],
@@ -130,5 +132,7 @@ Future<void> importFileData(BuildContext context, SetonixFileSystem fileSystem,
       await fileSystem.templateSystem.createFile(metadata.name, data);
     case FileType.game:
       await fileSystem.worldSystem.createFile(metadata.name, data);
+    case FileType.accounts:
+      await fileSystem.importAccountsFromData(data);
   }
 }
diff --git a/app/lib/api/settings.dart b/app/lib/api/settings.dart
index e6e5454d..02120016 100644
--- a/app/lib/api/settings.dart
+++ b/app/lib/api/settings.dart
@@ -4,18 +4,26 @@ import 'package:flutter/material.dart';
 
 import '../pages/settings/home.dart';
 
-Future<void> openSettings(BuildContext context) => showGeneralDialog<void>(
+Future<void> openSettings(
+  BuildContext context, {
+  SettingsView view = SettingsView.general,
+}) =>
+    showGeneralDialog<void>(
       context: context,
       pageBuilder: (context, animation, secondaryAnimation) =>
           ScaffoldMessenger(
         child: BackdropFilter(
           filter: ImageFilter.blur(sigmaX: 5, sigmaY: 5),
           child: Dialog(
-              clipBehavior: Clip.antiAlias,
-              child: ConstrainedBox(
-                  constraints:
-                      const BoxConstraints(maxHeight: 800, maxWidth: 1000),
-                  child: const SettingsPage(isDialog: true))),
+            clipBehavior: Clip.antiAlias,
+            child: ConstrainedBox(
+              constraints: const BoxConstraints(maxHeight: 800, maxWidth: 1000),
+              child: SettingsPage(
+                isDialog: true,
+                view: view,
+              ),
+            ),
+          ),
         ),
       ),
       barrierDismissible: true,
diff --git a/app/lib/bloc/multiplayer.dart b/app/lib/bloc/multiplayer.dart
index a6b32f79..59f4e153 100644
--- a/app/lib/bloc/multiplayer.dart
+++ b/app/lib/bloc/multiplayer.dart
@@ -33,6 +33,8 @@ sealed class MultiplayerState with MultiplayerStateMappable {
   bool get isConnected => this is MultiplayerConnectedState;
   bool get isClient => false;
   bool get isServer => false;
+
+  UserManager? get userManager => null;
 }
 
 @MappableClass()
@@ -62,6 +64,8 @@ final class MultiplayerConnectedState extends MultiplayerState
     with MultiplayerConnectedStateMappable {
   final NetworkerBase networker;
   final SimpleNetworkerPipe<WorldEvent> pipe;
+  @override
+  final UserManager userManager = UserManager();
 
   MultiplayerConnectedState(this.networker, this.pipe);
 
@@ -136,7 +140,8 @@ class MultiplayerCubit extends Cubit<MultiplayerState> {
     if (base is NetworkerClient) {
       transformer.connect(pipe);
     } else if (base is NetworkerServer) {
-      base.clientConnect.listen(_initController.add);
+      base.clientConnect.listen(_onJoin);
+      base.clientDisconnect.listen(_onLeft);
       transformer.connect(SimpleNetworkerPipe()
         ..read.listen(_onClientEvent)
         ..write.listen((e) => _onClientEvent(e, true))
@@ -309,4 +314,15 @@ class MultiplayerCubit extends Cubit<MultiplayerState> {
     _fatalError = e;
     disconnect();
   }
+
+  void _onLeft((Channel, ConnectionInfo) event) {
+    state.userManager?.removeUser(event.$1);
+  }
+
+  void _onJoin((Channel, ConnectionInfo) event) {
+    _initController.add(event);
+    state.userManager?.addUser(
+      event.$1,
+    );
+  }
 }
diff --git a/app/lib/bloc/multiplayer.mapper.dart b/app/lib/bloc/multiplayer.mapper.dart
index 3908cbcd..c80fa04c 100644
--- a/app/lib/bloc/multiplayer.mapper.dart
+++ b/app/lib/bloc/multiplayer.mapper.dart
@@ -445,11 +445,16 @@ class MultiplayerConnectedStateMapper
       v.pipe;
   static const Field<MultiplayerConnectedState, SimpleNetworkerPipe<WorldEvent>>
       _f$pipe = Field('pipe', _$pipe);
+  static UserManager _$userManager(MultiplayerConnectedState v) =>
+      v.userManager;
+  static const Field<MultiplayerConnectedState, UserManager> _f$userManager =
+      Field('userManager', _$userManager, mode: FieldMode.member);
 
   @override
   final MappableFields<MultiplayerConnectedState> fields = const {
     #networker: _f$networker,
     #pipe: _f$pipe,
+    #userManager: _f$userManager,
   };
 
   static MultiplayerConnectedState _instantiate(DecodingData data) {
diff --git a/app/lib/bloc/settings.dart b/app/lib/bloc/settings.dart
index 5b3c3d57..858ac182 100644
--- a/app/lib/bloc/settings.dart
+++ b/app/lib/bloc/settings.dart
@@ -31,6 +31,14 @@ enum ThemeDensity {
       };
 }
 
+List<String> getDefaultServerList() {
+  final env = String.fromEnvironment('server_list', defaultValue: '');
+  if (env.isNotEmpty) {
+    return env.split(',').map((e) => e.trim()).toList();
+  }
+  return ['https://servers.setonix.linwood.dev/data.json'];
+}
+
 final class ThemeModeMapper extends SimpleMapper<ThemeMode> {
   const ThemeModeMapper();
 
@@ -55,7 +63,7 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
   @override
   final bool nativeTitleBar;
   final bool stackedCards;
-  final bool showConnectYour, showConnectNetwork;
+  final bool showConnectYour, showConnectBrowse;
   final GameProperty gameProperty;
   final List<ListGameServer> servers;
   final double zoom;
@@ -63,6 +71,8 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
   final List<String> swamps;
   final double scrollSensitivity;
   final ThemeDensity density;
+  final List<String> serverList;
+  final bool showIntro;
 
   const SetonixSettings({
     this.localeTag = '',
@@ -71,7 +81,7 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
     this.dataDirectory = '',
     this.nativeTitleBar = false,
     this.showConnectYour = true,
-    this.showConnectNetwork = true,
+    this.showConnectBrowse = false,
     this.lastVersion,
     this.gameProperty = const GameProperty(),
     this.servers = const [],
@@ -81,6 +91,8 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
     this.swamps = const [],
     this.density = ThemeDensity.system,
     this.scrollSensitivity = 1,
+    this.serverList = const [],
+    this.showIntro = true,
   });
 
   Locale? get locale {
@@ -100,7 +112,7 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
         nativeTitleBar: prefs.getBool('nativeTitleBar') ?? false,
         localeTag: prefs.getString('locale') ?? '',
         showConnectYour: prefs.getBool('showConnectYour') ?? true,
-        showConnectNetwork: prefs.getBool('showConnectNetwork') ?? true,
+        showConnectBrowse: prefs.getBool('showConnectBrowse') ?? false,
         lastVersion: prefs.getString('lastVersion'),
         gameProperty: prefs.containsKey('gameProperty')
             ? GamePropertyMapper.fromJson(prefs.getString('gameProperty')!)
@@ -118,6 +130,8 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
         density: ThemeDensity.values.byName(
           prefs.getString('density') ?? ThemeDensity.system.name,
         ),
+        serverList: prefs.getStringList('serverList') ?? [],
+        showIntro: prefs.getBool('showIntro') ?? true,
       );
 
   Future<void> save() async {
@@ -128,7 +142,7 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
     await prefs.setBool('nativeTitleBar', nativeTitleBar);
     await prefs.setString('locale', localeTag);
     await prefs.setBool('showConnectYour', showConnectYour);
-    await prefs.setBool('showConnectNetwork', showConnectNetwork);
+    await prefs.setBool('showConnectBrowse', showConnectBrowse);
     if (lastVersion == null) {
       if (prefs.containsKey('last_version')) {
         await prefs.remove('last_version');
@@ -145,6 +159,8 @@ class SetonixSettings with SetonixSettingsMappable implements LeapSettings {
     await prefs.setStringList('swamps', swamps);
     await prefs.setDouble('scrollSensitivity', scrollSensitivity);
     await prefs.setString('density', density.name);
+    await prefs.setStringList('serverList', serverList);
+    await prefs.setBool('showIntro', showIntro);
   }
 }
 
@@ -183,8 +199,8 @@ class SettingsCubit extends Cubit<SetonixSettings>
     return save();
   }
 
-  Future<void> changeShowConnectNetwork(bool value) {
-    emit(state.copyWith(showConnectNetwork: value));
+  Future<void> changeShowConnectBrowse(bool value) {
+    emit(state.copyWith(showConnectBrowse: value));
     return save();
   }
 
@@ -269,6 +285,25 @@ class SettingsCubit extends Cubit<SetonixSettings>
     return save();
   }
 
+  Future<void> addServersToList(List<String> server, [bool reset = false]) {
+    final newList = {if (!reset) ...state.serverList, ...server}.toList();
+    emit(state.copyWith(serverList: newList));
+    return save();
+  }
+
+  Future<void> addServerToList(String server) => addServersToList([server]);
+
+  Future<void> removeServerFromList(String server) {
+    final newList = state.serverList.where((s) => s != server).toList();
+    emit(state.copyWith(serverList: newList));
+    return save();
+  }
+
+  Future<void> changeShowIntro(bool value) {
+    emit(state.copyWith(showIntro: value));
+    return save();
+  }
+
   Future<void> importSettings(String data) {
     final settings = SetonixSettingsMapper.fromJson(data);
     emit(settings);
diff --git a/app/lib/bloc/settings.mapper.dart b/app/lib/bloc/settings.mapper.dart
index ace703d4..33f36fdc 100644
--- a/app/lib/bloc/settings.mapper.dart
+++ b/app/lib/bloc/settings.mapper.dart
@@ -104,9 +104,9 @@ class SetonixSettingsMapper extends ClassMapperBase<SetonixSettings> {
   static bool _$showConnectYour(SetonixSettings v) => v.showConnectYour;
   static const Field<SetonixSettings, bool> _f$showConnectYour =
       Field('showConnectYour', _$showConnectYour, opt: true, def: true);
-  static bool _$showConnectNetwork(SetonixSettings v) => v.showConnectNetwork;
-  static const Field<SetonixSettings, bool> _f$showConnectNetwork =
-      Field('showConnectNetwork', _$showConnectNetwork, opt: true, def: true);
+  static bool _$showConnectBrowse(SetonixSettings v) => v.showConnectBrowse;
+  static const Field<SetonixSettings, bool> _f$showConnectBrowse =
+      Field('showConnectBrowse', _$showConnectBrowse, opt: true, def: false);
   static String? _$lastVersion(SetonixSettings v) => v.lastVersion;
   static const Field<SetonixSettings, String> _f$lastVersion =
       Field('lastVersion', _$lastVersion, opt: true);
@@ -135,6 +135,12 @@ class SetonixSettingsMapper extends ClassMapperBase<SetonixSettings> {
   static double _$scrollSensitivity(SetonixSettings v) => v.scrollSensitivity;
   static const Field<SetonixSettings, double> _f$scrollSensitivity =
       Field('scrollSensitivity', _$scrollSensitivity, opt: true, def: 1);
+  static List<String> _$serverList(SetonixSettings v) => v.serverList;
+  static const Field<SetonixSettings, List<String>> _f$serverList =
+      Field('serverList', _$serverList, opt: true, def: const []);
+  static bool _$showIntro(SetonixSettings v) => v.showIntro;
+  static const Field<SetonixSettings, bool> _f$showIntro =
+      Field('showIntro', _$showIntro, opt: true, def: true);
 
   @override
   final MappableFields<SetonixSettings> fields = const {
@@ -144,7 +150,7 @@ class SetonixSettingsMapper extends ClassMapperBase<SetonixSettings> {
     #dataDirectory: _f$dataDirectory,
     #nativeTitleBar: _f$nativeTitleBar,
     #showConnectYour: _f$showConnectYour,
-    #showConnectNetwork: _f$showConnectNetwork,
+    #showConnectBrowse: _f$showConnectBrowse,
     #lastVersion: _f$lastVersion,
     #gameProperty: _f$gameProperty,
     #servers: _f$servers,
@@ -154,6 +160,8 @@ class SetonixSettingsMapper extends ClassMapperBase<SetonixSettings> {
     #swamps: _f$swamps,
     #density: _f$density,
     #scrollSensitivity: _f$scrollSensitivity,
+    #serverList: _f$serverList,
+    #showIntro: _f$showIntro,
   };
 
   static SetonixSettings _instantiate(DecodingData data) {
@@ -164,7 +172,7 @@ class SetonixSettingsMapper extends ClassMapperBase<SetonixSettings> {
         dataDirectory: data.dec(_f$dataDirectory),
         nativeTitleBar: data.dec(_f$nativeTitleBar),
         showConnectYour: data.dec(_f$showConnectYour),
-        showConnectNetwork: data.dec(_f$showConnectNetwork),
+        showConnectBrowse: data.dec(_f$showConnectBrowse),
         lastVersion: data.dec(_f$lastVersion),
         gameProperty: data.dec(_f$gameProperty),
         servers: data.dec(_f$servers),
@@ -173,7 +181,9 @@ class SetonixSettingsMapper extends ClassMapperBase<SetonixSettings> {
         zoom: data.dec(_f$zoom),
         swamps: data.dec(_f$swamps),
         density: data.dec(_f$density),
-        scrollSensitivity: data.dec(_f$scrollSensitivity));
+        scrollSensitivity: data.dec(_f$scrollSensitivity),
+        serverList: data.dec(_f$serverList),
+        showIntro: data.dec(_f$showIntro));
   }
 
   @override
@@ -234,6 +244,7 @@ abstract class SetonixSettingsCopyWith<$R, $In extends SetonixSettings, $Out>
   ListCopyWith<$R, ListGameServer,
       ListGameServerCopyWith<$R, ListGameServer, ListGameServer>> get servers;
   ListCopyWith<$R, String, ObjectCopyWith<$R, String, String>> get swamps;
+  ListCopyWith<$R, String, ObjectCopyWith<$R, String, String>> get serverList;
   $R call(
       {String? localeTag,
       ThemeMode? theme,
@@ -241,7 +252,7 @@ abstract class SetonixSettingsCopyWith<$R, $In extends SetonixSettings, $Out>
       String? dataDirectory,
       bool? nativeTitleBar,
       bool? showConnectYour,
-      bool? showConnectNetwork,
+      bool? showConnectBrowse,
       String? lastVersion,
       GameProperty? gameProperty,
       List<ListGameServer>? servers,
@@ -250,7 +261,9 @@ abstract class SetonixSettingsCopyWith<$R, $In extends SetonixSettings, $Out>
       double? zoom,
       List<String>? swamps,
       ThemeDensity? density,
-      double? scrollSensitivity});
+      double? scrollSensitivity,
+      List<String>? serverList,
+      bool? showIntro});
   SetonixSettingsCopyWith<$R2, $In, $Out2> $chain<$R2, $Out2>(
       Then<$Out2, $R2> t);
 }
@@ -276,6 +289,10 @@ class _SetonixSettingsCopyWithImpl<$R, $Out>
       ListCopyWith($value.swamps, (v, t) => ObjectCopyWith(v, $identity, t),
           (v) => call(swamps: v));
   @override
+  ListCopyWith<$R, String, ObjectCopyWith<$R, String, String>> get serverList =>
+      ListCopyWith($value.serverList, (v, t) => ObjectCopyWith(v, $identity, t),
+          (v) => call(serverList: v));
+  @override
   $R call(
           {String? localeTag,
           ThemeMode? theme,
@@ -283,7 +300,7 @@ class _SetonixSettingsCopyWithImpl<$R, $Out>
           String? dataDirectory,
           bool? nativeTitleBar,
           bool? showConnectYour,
-          bool? showConnectNetwork,
+          bool? showConnectBrowse,
           Object? lastVersion = $none,
           GameProperty? gameProperty,
           List<ListGameServer>? servers,
@@ -292,7 +309,9 @@ class _SetonixSettingsCopyWithImpl<$R, $Out>
           double? zoom,
           List<String>? swamps,
           ThemeDensity? density,
-          double? scrollSensitivity}) =>
+          double? scrollSensitivity,
+          List<String>? serverList,
+          bool? showIntro}) =>
       $apply(FieldCopyWithData({
         if (localeTag != null) #localeTag: localeTag,
         if (theme != null) #theme: theme,
@@ -300,7 +319,7 @@ class _SetonixSettingsCopyWithImpl<$R, $Out>
         if (dataDirectory != null) #dataDirectory: dataDirectory,
         if (nativeTitleBar != null) #nativeTitleBar: nativeTitleBar,
         if (showConnectYour != null) #showConnectYour: showConnectYour,
-        if (showConnectNetwork != null) #showConnectNetwork: showConnectNetwork,
+        if (showConnectBrowse != null) #showConnectBrowse: showConnectBrowse,
         if (lastVersion != $none) #lastVersion: lastVersion,
         if (gameProperty != null) #gameProperty: gameProperty,
         if (servers != null) #servers: servers,
@@ -309,7 +328,9 @@ class _SetonixSettingsCopyWithImpl<$R, $Out>
         if (zoom != null) #zoom: zoom,
         if (swamps != null) #swamps: swamps,
         if (density != null) #density: density,
-        if (scrollSensitivity != null) #scrollSensitivity: scrollSensitivity
+        if (scrollSensitivity != null) #scrollSensitivity: scrollSensitivity,
+        if (serverList != null) #serverList: serverList,
+        if (showIntro != null) #showIntro: showIntro
       }));
   @override
   SetonixSettings $make(CopyWithData data) => SetonixSettings(
@@ -319,8 +340,8 @@ class _SetonixSettingsCopyWithImpl<$R, $Out>
       dataDirectory: data.get(#dataDirectory, or: $value.dataDirectory),
       nativeTitleBar: data.get(#nativeTitleBar, or: $value.nativeTitleBar),
       showConnectYour: data.get(#showConnectYour, or: $value.showConnectYour),
-      showConnectNetwork:
-          data.get(#showConnectNetwork, or: $value.showConnectNetwork),
+      showConnectBrowse:
+          data.get(#showConnectBrowse, or: $value.showConnectBrowse),
       lastVersion: data.get(#lastVersion, or: $value.lastVersion),
       gameProperty: data.get(#gameProperty, or: $value.gameProperty),
       servers: data.get(#servers, or: $value.servers),
@@ -330,7 +351,9 @@ class _SetonixSettingsCopyWithImpl<$R, $Out>
       swamps: data.get(#swamps, or: $value.swamps),
       density: data.get(#density, or: $value.density),
       scrollSensitivity:
-          data.get(#scrollSensitivity, or: $value.scrollSensitivity));
+          data.get(#scrollSensitivity, or: $value.scrollSensitivity),
+      serverList: data.get(#serverList, or: $value.serverList),
+      showIntro: data.get(#showIntro, or: $value.showIntro));
 
   @override
   SetonixSettingsCopyWith<$R2, SetonixSettings, $Out2> $chain<$R2, $Out2>(
diff --git a/app/lib/bloc/world/bloc.dart b/app/lib/bloc/world/bloc.dart
index 4db97c8b..9c3fe216 100644
--- a/app/lib/bloc/world/bloc.dart
+++ b/app/lib/bloc/world/bloc.dart
@@ -50,6 +50,7 @@ class WorldBloc extends Bloc<PlayableWorldEvent, ClientWorldState> {
     String? name,
     SetonixData? data,
     GameTable? table,
+    GameState gameState = GameState.play,
   }) : super(ClientWorldState(
           assetManager: GameAssetManager(
             fileSystem: fileSystem,
@@ -62,6 +63,7 @@ class WorldBloc extends Bloc<PlayableWorldEvent, ClientWorldState> {
             table: table ?? data?.getTable() ?? const GameTable(),
             metadata: data?.getMetadata() ?? const FileMetadata(),
             info: data?.getInfo() ?? const GameInfo(),
+            gameState: gameState,
           ),
         )) {
     pluginSystem = PluginSystem(server: _WorldServerInterfaceImpl(this));
@@ -151,9 +153,14 @@ class WorldBloc extends Bloc<PlayableWorldEvent, ClientWorldState> {
     return state.fileSystem.worldSystem.updateFile(name, data);
   }
 
-  void _processEvent(NetworkerPacket<WorldEvent?> data) {
-    final value = processClientEvent(data.data, data.channel, state.world,
-        assetManager: state.assetManager);
+  Future<void> _processEvent(NetworkerPacket<WorldEvent?> data) async {
+    final value = await processClientEvent(
+      data.data,
+      data.channel,
+      state.world,
+      assetManager: state.assetManager,
+      userManager: state.multiplayer.state.userManager,
+    );
     if (value == null) return;
     state.multiplayer.sendServerPackets(
         value.buildPackets(state.world, state.multiplayer.clients));
@@ -167,7 +174,7 @@ class WorldBloc extends Bloc<PlayableWorldEvent, ClientWorldState> {
     }
   }
 
-  void process(WorldEvent event) {
+  Future<void> process(WorldEvent event) async {
     switch (event) {
       case LocalWorldEvent e:
         add(e);
@@ -176,7 +183,8 @@ class WorldBloc extends Bloc<PlayableWorldEvent, ClientWorldState> {
         if (multiplayer.isConnected) {
           multiplayer.send(e);
         } else {
-          final event = processClientEvent(e, kAuthorityChannel, state.world,
+          final event = await processClientEvent(
+              e, kAuthorityChannel, state.world,
               assetManager: state.assetManager, allowServerEvents: true);
           if (event != null) {
             add(event.main.data);
diff --git a/app/lib/l10n/app_en.arb b/app/lib/l10n/app_en.arb
index 4fe34fc2..f6eeffdc 100644
--- a/app/lib/l10n/app_en.arb
+++ b/app/lib/l10n/app_en.arb
@@ -250,5 +250,24 @@
   "compact": "Compact",
   "standard": "Standard",
   "comfortable": "Comfortable",
-  "stackedCards": "Stacked cards"
+  "stackedCards": "Stacked cards",
+  "accounts": "Accounts",
+  "create": "Create",
+  "configuringGame": "Configuring game...",
+  "authenticate": "Authenticate",
+  "authenticateDescription": "The server requested authentication. Select the account you want to use to authenticate.",
+  "backupKey": "Backup key",
+  "importAccounts": "Import accounts",
+  "importAccountsDescription": "Are you sure you want to import the accounts?",
+  "backupAllKeys": "Backup all keys",
+  "noAccount": "There are no accounts available",
+  "authenticateRequired": "Authentication is required to connect to the server",
+  "authenticateLoading": "Authenticating...",
+  "loadDefaultServerList": "Load default server list",
+  "loadDefaultServerListDescription": "This will load the default server list from the Setonix website when opening the servers dialog.",
+  "serverLists": "Server lists",
+  "reset": "Reset",
+  "confirm": "Confirm",
+  "showIntro": "Show intro",
+  "highlighted": "Highlighted"
 }
diff --git a/app/lib/main.dart b/app/lib/main.dart
index 9272179b..870edb5d 100644
--- a/app/lib/main.dart
+++ b/app/lib/main.dart
@@ -4,16 +4,18 @@ import 'package:flutter/foundation.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:go_router/go_router.dart';
+import 'package:setonix/pages/settings/accounts.dart';
+import 'package:setonix/pages/settings/data.dart';
+import 'package:setonix/pages/settings/general.dart';
 import 'package:setonix/pages/settings/input.dart';
+import 'package:setonix/pages/settings/personalization.dart';
+import 'package:setonix/pages/settings/servers.dart';
 import 'package:setonix/src/generated/i18n/app_localizations.dart';
 import 'package:flutter_web_plugins/url_strategy.dart';
 import 'package:material_leap/material_leap.dart';
 import 'package:setonix/pages/editor/shell.dart';
 import 'package:setonix/pages/game/page.dart';
 import 'package:setonix/pages/home/page.dart';
-import 'package:setonix/pages/settings/data.dart';
-import 'package:setonix/pages/settings/general.dart';
-import 'package:setonix/pages/settings/personalization.dart';
 import 'package:setonix/services/file_system.dart';
 import 'package:setonix/services/network.dart';
 import 'package:setonix/theme.dart';
@@ -176,6 +178,14 @@ class SetonixApp extends StatelessWidget {
                 path: 'inputs',
                 builder: (context, state) => const InputsSettingsPage(),
               ),
+              GoRoute(
+                path: 'accounts',
+                builder: (context, state) => const AccountsSettingsPage(),
+              ),
+              GoRoute(
+                path: 'serverlist',
+                builder: (context, state) => const ServersSettingsPage(),
+              ),
             ],
           ),
         ],
diff --git a/app/lib/pages/game/auth.dart b/app/lib/pages/game/auth.dart
new file mode 100644
index 00000000..f94a9895
--- /dev/null
+++ b/app/lib/pages/game/auth.dart
@@ -0,0 +1,166 @@
+import 'dart:ui';
+
+import 'package:flutter/material.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:material_leap/material_leap.dart';
+import 'package:phosphor_flutter/phosphor_flutter.dart';
+import 'package:setonix/api/settings.dart';
+import 'package:setonix/bloc/world/bloc.dart';
+import 'package:setonix/bloc/world/state.dart';
+import 'package:setonix/pages/settings/home.dart';
+import 'package:setonix/services/file_system.dart';
+import 'package:setonix/src/generated/i18n/app_localizations.dart';
+import 'package:setonix_api/setonix_api.dart';
+
+class AuthGameView extends StatefulWidget {
+  const AuthGameView({super.key});
+
+  @override
+  State<AuthGameView> createState() => _AuthGameViewState();
+}
+
+class _AuthGameViewState extends State<AuthGameView> {
+  late final SetonixFileSystem _fileSystem;
+  Future<List<SetonixAccount>>? _keysFuture;
+
+  @override
+  void initState() {
+    super.initState();
+    _fileSystem = context.read<SetonixFileSystem>();
+    _buildKeysFuture();
+  }
+
+  void _buildKeysFuture() {
+    _keysFuture = _fileSystem.getAccounts();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return BlocBuilder<WorldBloc, ClientWorldState>(
+        buildWhen: (previous, current) =>
+            previous.world.authRequest != current.world.authRequest,
+        builder: (context, state) {
+          final authRequest = state.world.authRequest;
+          if (authRequest == null) {
+            return const SizedBox.shrink();
+          }
+          bool isLoading = false;
+          return StatefulBuilder(
+              builder: (context, setInnerState) => Stack(
+                    alignment: Alignment.center,
+                    children: [
+                      BackdropFilter(
+                        filter: ImageFilter.blur(sigmaX: 5, sigmaY: 5),
+                        child: Container(
+                          color: Colors.black.withValues(alpha: 0.5),
+                        ),
+                      ),
+                      ResponsiveAlertDialog(
+                        title: Text(AppLocalizations.of(context).authenticate),
+                        constraints: BoxConstraints(
+                          maxWidth: LeapBreakpoints.compact,
+                        ),
+                        headerActions: [
+                          IconButton(
+                            icon: const Icon(PhosphorIconsLight.gear),
+                            onPressed: () async {
+                              await openSettings(context,
+                                  view: SettingsView.accounts);
+                              setState(() {
+                                _buildKeysFuture();
+                              });
+                            },
+                          ),
+                        ],
+                        content: isLoading
+                            ? Column(
+                                mainAxisSize: MainAxisSize.min,
+                                children: [
+                                  CircularProgressIndicator(),
+                                  const SizedBox(height: 16.0),
+                                  Text(AppLocalizations.of(context)
+                                      .authenticateLoading),
+                                ],
+                              )
+                            : Column(
+                                mainAxisSize: MainAxisSize.min,
+                                children: [
+                                  Text(AppLocalizations.of(context)
+                                      .authenticateDescription),
+                                  if (authRequest.isRequired)
+                                    Text(
+                                      AppLocalizations.of(context)
+                                          .authenticateRequired,
+                                      style: Theme.of(context)
+                                          .textTheme
+                                          .bodyMedium
+                                          ?.copyWith(
+                                            color: Colors.red,
+                                          ),
+                                    ),
+                                  const SizedBox(height: 16.0),
+                                  Flexible(
+                                    child: FutureBuilder<List<SetonixAccount>>(
+                                      future: _keysFuture,
+                                      builder: (context, snapshot) {
+                                        if (snapshot.connectionState ==
+                                            ConnectionState.waiting) {
+                                          return const Padding(
+                                            padding: EdgeInsets.all(16.0),
+                                            child: CircularProgressIndicator(),
+                                          );
+                                        } else if (snapshot.hasError) {
+                                          return Padding(
+                                            padding: const EdgeInsets.all(16.0),
+                                            child: Text(
+                                              AppLocalizations.of(context)
+                                                  .error,
+                                            ),
+                                          );
+                                        } else if (!snapshot.hasData ||
+                                            snapshot.data!.isEmpty) {
+                                          return Padding(
+                                            padding: const EdgeInsets.all(16.0),
+                                            child: Text(
+                                                AppLocalizations.of(context)
+                                                    .noAccount),
+                                          );
+                                        } else {
+                                          final accounts = snapshot.data!;
+                                          return ListView.builder(
+                                            shrinkWrap: true,
+                                            itemCount: accounts.length,
+                                            itemBuilder: (context, index) {
+                                              final account = accounts[index];
+                                              return ListTile(
+                                                title: Text(
+                                                    account.name.substring(1)),
+                                                subtitle: Text(account
+                                                    .getFingerprint(true)),
+                                                onTap: () async {
+                                                  final bloc =
+                                                      context.read<WorldBloc>();
+                                                  final event =
+                                                      await AuthenticateRequest
+                                                          .build(authRequest,
+                                                              account);
+                                                  bloc.process(event);
+                                                  setInnerState(() {
+                                                    isLoading = true;
+                                                  });
+                                                },
+                                              );
+                                            },
+                                          );
+                                        }
+                                      },
+                                    ),
+                                  ),
+                                ],
+                              ),
+                      )
+                    ],
+                  ));
+        });
+  }
+}
diff --git a/app/lib/pages/game/page.dart b/app/lib/pages/game/page.dart
index 9da267b0..1600a315 100644
--- a/app/lib/pages/game/page.dart
+++ b/app/lib/pages/game/page.dart
@@ -2,6 +2,7 @@ import 'package:flame/game.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:setonix/api/open.dart';
+import 'package:setonix/pages/game/auth.dart';
 import 'package:setonix/pages/game/dialog.dart';
 import 'package:setonix/src/generated/i18n/app_localizations.dart';
 import 'package:material_leap/material_leap.dart';
@@ -65,6 +66,7 @@ class _GamePageState extends State<GamePage> {
       name: widget.name,
       data: data,
       colorScheme: Theme.of(context).colorScheme,
+      gameState: address == null ? GameState.play : GameState.configuration,
     );
     await world.state.assetManager.loadPacks();
     if (address != null) {
@@ -183,7 +185,7 @@ class _GamePageState extends State<GamePage> {
                           DrawerView.notes => const GameNotesDrawer(),
                         },
                       ),
-                      body: BlocListener<WorldBloc, ClientWorldState>(
+                      body: BlocConsumer<WorldBloc, ClientWorldState>(
                         listenWhen: (previous, current) =>
                             previous.messages.length != current.messages.length,
                         listener: (context, state) {
@@ -224,20 +226,53 @@ class _GamePageState extends State<GamePage> {
                             ),
                           );
                         },
-                        child: GameWidget(
-                          game: BoardGame(
-                            bloc: context.read<WorldBloc>(),
-                            settingsCubit: context.read<SettingsCubit>(),
-                            contextMenuController: _contextMenuController,
-                            onEscape: () => Scaffold.of(context).openDrawer(),
-                          ),
-                          focusNode: _focusNode,
-                          initialActiveOverlays: ['dialogs', 'filter'],
-                          overlayBuilderMap: {
-                            'dialogs': (context, game) => GameDialogOverlay(),
-                            'filter': (context, game) => GameFilterView(),
-                          },
-                        ),
+                        buildWhen: (previous, current) =>
+                            previous.world.gameState != current.world.gameState,
+                        builder: (context, state) {
+                          return Center(
+                            child:
+                                Stack(alignment: Alignment.center, children: [
+                              if (state.world.gameState ==
+                                  GameState.configuration)
+                                Column(
+                                  crossAxisAlignment: CrossAxisAlignment.center,
+                                  mainAxisAlignment: MainAxisAlignment.center,
+                                  children: [
+                                    CircularProgressIndicator(),
+                                    const SizedBox(height: 16),
+                                    Text(
+                                      AppLocalizations.of(context)
+                                          .configuringGame,
+                                      style: Theme.of(context)
+                                          .textTheme
+                                          .bodyMedium,
+                                    ),
+                                  ],
+                                )
+                              else
+                                GameWidget(
+                                  game: BoardGame(
+                                    bloc: context.read<WorldBloc>(),
+                                    settingsCubit:
+                                        context.read<SettingsCubit>(),
+                                    contextMenuController:
+                                        _contextMenuController,
+                                    onEscape: () =>
+                                        Scaffold.of(context).openDrawer(),
+                                  ),
+                                  focusNode: _focusNode,
+                                  initialActiveOverlays: ['dialogs', 'filter'],
+                                  overlayBuilderMap: {
+                                    'dialogs': (context, game) =>
+                                        GameDialogOverlay(),
+                                    'filter': (context, game) =>
+                                        GameFilterView(),
+                                  },
+                                ),
+                              AuthGameView(),
+                            ]),
+                          );
+                        },
                       ),
                     );
                   },
diff --git a/app/lib/pages/game/team.dart b/app/lib/pages/game/team.dart
index a626defb..72dae490 100644
--- a/app/lib/pages/game/team.dart
+++ b/app/lib/pages/game/team.dart
@@ -1,5 +1,6 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:phosphor_flutter/phosphor_flutter.dart';
 import 'package:setonix/src/generated/i18n/app_localizations.dart';
 import 'package:material_leap/material_leap.dart';
 import 'package:setonix/bloc/world/bloc.dart';
@@ -90,9 +91,10 @@ class _TeamDialogState extends State<TeamDialog> {
         ),
       ),
       actions: [
-        TextButton(
+        TextButton.icon(
           onPressed: () => Navigator.of(context).pop(),
-          child: Text(AppLocalizations.of(context).cancel),
+          icon: const Icon(PhosphorIconsLight.prohibit),
+          label: Text(AppLocalizations.of(context).cancel),
         ),
         BlocBuilder<WorldBloc, ClientWorldState>(
           bloc: _bloc,
@@ -102,7 +104,7 @@ class _TeamDialogState extends State<TeamDialog> {
             listenable: _nameController,
             builder: (context, child) {
               final text = _nameController.text;
-              return ElevatedButton(
+              return ElevatedButton.icon(
                 onPressed: text.isEmpty ||
                         (state.info.teams.containsKey(text) &&
                             text != widget.team)
@@ -120,7 +122,8 @@ class _TeamDialogState extends State<TeamDialog> {
                                 team));
                         Navigator.of(context).pop();
                       },
-                child: Text(_isCreate()
+                icon: const Icon(PhosphorIconsLight.check),
+                label: Text(_isCreate()
                     ? LeapLocalizations.of(context).create
                     : AppLocalizations.of(context).edit),
               );
diff --git a/app/lib/pages/home/connect.dart b/app/lib/pages/home/connect.dart
index baf0f1a8..62bd9486 100644
--- a/app/lib/pages/home/connect.dart
+++ b/app/lib/pages/home/connect.dart
@@ -34,6 +34,7 @@ class ConnectEditDialog extends StatelessWidget {
     String address = initialValue?.address ?? '';
     String name = initialValue?.name ?? '';
     bool secure = initialValue?.secure ?? true;
+    bool highlighted = initialValue?.highlighted ?? true;
 
     final secureSwitchEnabled = !kIsWeb || Uri.base.isScheme('HTTP');
 
@@ -74,6 +75,13 @@ class ConnectEditDialog extends StatelessWidget {
             onFieldSubmitted: index == null ? (_) => connect() : null,
           ),
           const SizedBox(height: 8),
+          StatefulBuilder(
+            builder: (context, setState) => SwitchListTile(
+              title: Text(AppLocalizations.of(context).highlighted),
+              value: highlighted,
+              onChanged: (value) => setState(() => highlighted = value),
+            ),
+          ),
           if (secureSwitchEnabled)
             StatefulBuilder(
               builder: (context, setState) => SwitchListTile(
@@ -93,6 +101,7 @@ class ConnectEditDialog extends StatelessWidget {
               address: address,
               secure: secure,
               name: name,
+              highlighted: highlighted,
             );
             if (index != null) {
               cubit.updateServer(index!, updated);
@@ -123,7 +132,7 @@ class ServersDialog extends StatefulWidget {
 }
 
 class _ServersDialogState extends State<ServersDialog> {
-  late final Stream<Map<GameServer, GameProperty?>> _servers;
+  Stream<Map<GameServer, GameProperty?>>? _servers;
 
   bool _isMobileOpen = false;
   (GameServer, int)? _selected;
@@ -132,13 +141,56 @@ class _ServersDialogState extends State<ServersDialog> {
   @override
   void initState() {
     super.initState();
-    _servers = ValueConnectableStream(
-            context.read<NetworkService>().fetchServersWithProperties())
+    _buildServersStream();
+  }
+
+  void _buildServersStream([SetonixSettings? settings]) {
+    settings ??= context.read<SettingsCubit>().state;
+    _servers = ValueConnectableStream(context
+            .read<NetworkService>()
+            .fetchServersWithProperties(
+                browsable: settings.showConnectBrowse,
+                local: settings.showConnectYour))
         .autoConnect();
   }
 
-  Text _buildDetails(BuildContext context, GameProperty property) =>
-      Text('${property.currentPlayers}/${property.maxPlayers ?? '?'}');
+  void _refreshServers(SetonixSettings settings) {
+    setState(() {
+      _buildServersStream(settings);
+    });
+  }
+
+  Widget _buildTitle(BuildContext context, GameServer server) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.stretch,
+      mainAxisAlignment: MainAxisAlignment.center,
+      children: [
+        Text(
+          server.display,
+          style: Theme.of(context).textTheme.titleLarge,
+        ),
+        if (server is ListGameServer && server.name.isNotEmpty)
+          Text(
+            server.address,
+            style: Theme.of(context).textTheme.titleMedium,
+          ),
+      ],
+    );
+  }
+
+  Widget _buildDetails(
+      BuildContext context, bool secure, GameProperty property) {
+    return Row(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Icon(secure
+            ? PhosphorIconsLight.shieldCheck
+            : PhosphorIconsLight.shieldSlash),
+        const SizedBox(width: 8),
+        Text('${property.currentPlayers}/${property.maxPlayers ?? '?'}'),
+      ],
+    );
+  }
 
   List<ListTile> _buildDetailsChildren(GameProperty server) => [
         ListTile(
@@ -148,12 +200,17 @@ class _ServersDialogState extends State<ServersDialog> {
       ];
   @override
   Widget build(BuildContext context) {
-    return BlocBuilder<SettingsCubit, SetonixSettings>(
+    return BlocConsumer<SettingsCubit, SetonixSettings>(
+      listenWhen: (previous, current) =>
+          previous.serverList != current.serverList ||
+          previous.showConnectYour != current.showConnectYour ||
+          previous.showConnectBrowse != current.showConnectBrowse,
       buildWhen: (previous, current) =>
           previous.showConnectYour != current.showConnectYour ||
-          previous.showConnectNetwork != current.showConnectNetwork,
+          previous.showConnectBrowse != current.showConnectBrowse,
+      listener: (context, state) => _refreshServers(state),
       builder: (context, settings) => ResponsiveAlertDialog(
-        title: Text(AppLocalizations.of(context).connect),
+        title: Text(AppLocalizations.of(context).servers),
         leading: IconButton.outlined(
           icon: const Icon(PhosphorIconsLight.x),
           onPressed: () => Navigator.of(context).pop(),
@@ -275,12 +332,41 @@ class _ServersDialogState extends State<ServersDialog> {
                             itemBuilder: (context, index) {
                               final entry = servers[index];
                               final current = entry.key;
+                              final primaryColor =
+                                  ColorScheme.of(context).primary;
+                              final defaultColor = IconTheme.of(context).color;
+                              final highlighted = current is ListGameServer &&
+                                  current.highlighted;
                               return ListTile(
-                                title: Text(current.display),
-                                leading: switch (current) {
+                                title: Text(current.display,
+                                    style: TextStyle(
+                                      fontWeight: highlighted
+                                          ? FontWeight.w800
+                                          : FontWeight.normal,
+                                    )),
+                                trailing: switch (current) {
                                   LanGameServer() =>
-                                    const Icon(PhosphorIconsLight.globe),
-                                  _ => null,
+                                    const Icon(PhosphorIconsLight.mapPin),
+                                  BrowsedGameServer() => Icon(
+                                      PhosphorIcons.globe(
+                                        highlighted
+                                            ? PhosphorIconsStyle.fill
+                                            : PhosphorIconsStyle.light,
+                                      ),
+                                      color: highlighted
+                                          ? primaryColor
+                                          : defaultColor,
+                                    ),
+                                  ListGameServer() => Icon(
+                                      PhosphorIcons.puzzlePiece(
+                                        highlighted
+                                            ? PhosphorIconsStyle.fill
+                                            : PhosphorIconsStyle.light,
+                                      ),
+                                      color: highlighted
+                                          ? primaryColor
+                                          : defaultColor,
+                                    ),
                                 },
                                 onTap: () {
                                   setState(() {
@@ -291,7 +377,7 @@ class _ServersDialogState extends State<ServersDialog> {
                                     showLeapBottomSheet(
                                       context: context,
                                       titleBuilder: (context) =>
-                                          Text(server.display),
+                                          _buildTitle(context, current),
                                       actionsBuilder: (context) => [
                                         if (property != null) ...[
                                           DefaultTextStyle(
@@ -299,8 +385,8 @@ class _ServersDialogState extends State<ServersDialog> {
                                                     .textTheme
                                                     .headlineSmall ??
                                                 const TextStyle(fontSize: 20),
-                                            child: _buildDetails(
-                                                context, property),
+                                            child: _buildDetails(context,
+                                                current.secure, property),
                                           ),
                                           const SizedBox(width: 8),
                                         ],
@@ -347,26 +433,26 @@ class _ServersDialogState extends State<ServersDialog> {
                       onSearchChanged: (value) => setState(() {
                             _search = value;
                           }),
-                      children: const [
-                        /*  InputChip(
-                        label: Text(AppLocalizations.of(context).yourServers),
-                        avatar: const Icon(PhosphorIconsLight.puzzlePiece),
-                        showCheckmark: false,
-                        selected: settings.showConnectYour,
-                        onPressed: () => context
-                            .read<SettingsCubit>()
-                            .changeShowConnectYour(!settings.showConnectYour),
-                      ),
-                      InputChip(
-                        label: Text(AppLocalizations.of(context).inNetwork),
-                        avatar: const Icon(PhosphorIconsLight.globe),
-                        showCheckmark: false,
-                        selected: settings.showConnectNetwork,
-                        onPressed: () => context
-                            .read<SettingsCubit>()
-                            .changeShowConnectNetwork(
-                                !settings.showConnectNetwork),
-                      ), */
+                      children: [
+                        InputChip(
+                          label: Text(AppLocalizations.of(context).yourServers),
+                          avatar: const Icon(PhosphorIconsLight.puzzlePiece),
+                          showCheckmark: false,
+                          selected: settings.showConnectYour,
+                          onPressed: () => context
+                              .read<SettingsCubit>()
+                              .changeShowConnectYour(!settings.showConnectYour),
+                        ),
+                        InputChip(
+                          label: Text(AppLocalizations.of(context).browse),
+                          avatar: const Icon(PhosphorIconsLight.globe),
+                          showCheckmark: false,
+                          selected: settings.showConnectBrowse,
+                          onPressed: () => context
+                              .read<SettingsCubit>()
+                              .changeShowConnectBrowse(
+                                  !settings.showConnectBrowse),
+                        ),
                       ]),
                   const SizedBox(height: 8),
                   Expanded(
@@ -393,18 +479,16 @@ class _ServersDialogState extends State<ServersDialog> {
                                                     .titleLarge ??
                                                 const TextStyle(),
                                             child: Row(
+                                              crossAxisAlignment:
+                                                  CrossAxisAlignment.start,
                                               children: [
                                                 Expanded(
-                                                  child: Text(
-                                                    server.display,
-                                                    style: Theme.of(context)
-                                                        .textTheme
-                                                        .titleLarge,
-                                                  ),
+                                                  child: _buildTitle(
+                                                      context, server),
                                                 ),
                                                 const SizedBox(width: 8),
-                                                _buildDetails(
-                                                    context, property),
+                                                _buildDetails(context,
+                                                    server.secure, property),
                                               ],
                                             ),
                                           ),
diff --git a/app/lib/pages/home/page.dart b/app/lib/pages/home/page.dart
index 542ab94b..c49b18df 100644
--- a/app/lib/pages/home/page.dart
+++ b/app/lib/pages/home/page.dart
@@ -1,4 +1,6 @@
 import 'package:flutter/material.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:setonix/pages/settings/intro.dart';
 import 'package:setonix/src/generated/i18n/app_localizations.dart';
 import 'package:material_leap/material_leap.dart';
 import 'package:phosphor_flutter/phosphor_flutter.dart';
@@ -12,10 +14,33 @@ import 'package:setonix/pages/home/play.dart';
 
 import '../../api/settings.dart';
 
-class HomePage extends StatelessWidget {
+class HomePage extends StatefulWidget {
+  const HomePage({super.key});
+
+  @override
+  State<HomePage> createState() => _HomePageState();
+}
+
+class _HomePageState extends State<HomePage> {
   final ScrollController _scrollController = ScrollController();
 
-  HomePage({super.key});
+  @override
+  void initState() {
+    super.initState();
+    WidgetsBinding.instance.addPostFrameCallback((_) => _showIntro());
+  }
+
+  void _showIntro() {
+    if (context.read<SettingsCubit>().state.showIntro) {
+      showDialog(context: context, builder: (context) => IntroDialog());
+    }
+  }
+
+  @override
+  void dispose() {
+    _scrollController.dispose();
+    super.dispose();
+  }
 
   List<(String, IconData, VoidCallback, Widget?, bool)> _getItems(
           BuildContext context) =>
diff --git a/app/lib/pages/settings/accounts.dart b/app/lib/pages/settings/accounts.dart
new file mode 100644
index 00000000..a3f838c8
--- /dev/null
+++ b/app/lib/pages/settings/accounts.dart
@@ -0,0 +1,157 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:lw_file_system/lw_file_system.dart';
+import 'package:setonix/api/open.dart';
+import 'package:setonix/api/save.dart';
+import 'package:setonix/src/generated/i18n/app_localizations.dart';
+import 'package:material_leap/material_leap.dart';
+import 'package:phosphor_flutter/phosphor_flutter.dart';
+import 'package:setonix/services/file_system.dart';
+import 'package:setonix_api/setonix_api.dart';
+
+import '../../bloc/settings.dart';
+
+class AccountsSettingsPage extends StatefulWidget {
+  final bool inView;
+  const AccountsSettingsPage({super.key, this.inView = false});
+
+  @override
+  State<AccountsSettingsPage> createState() => _AccountsSettingsPageState();
+}
+
+class _AccountsSettingsPageState extends State<AccountsSettingsPage> {
+  late final KeyFileSystem _privateKeyFileSystem, _publicKeyFileSystem;
+  Future<List<SetonixAccount>>? _keysFuture;
+  late final SetonixFileSystem _fileSystem;
+
+  @override
+  void initState() {
+    super.initState();
+    _fileSystem = context.read<SetonixFileSystem>();
+    _privateKeyFileSystem = _fileSystem.privateKeySystem;
+    _publicKeyFileSystem = _fileSystem.publicKeySystem;
+    _buildKeysFuture();
+  }
+
+  void _buildKeysFuture() {
+    _keysFuture = _fileSystem.getAccounts();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      backgroundColor: widget.inView ? Colors.transparent : null,
+      appBar: WindowTitleBar<SettingsCubit, SetonixSettings>(
+        inView: widget.inView,
+        backgroundColor: widget.inView ? Colors.transparent : null,
+        title: Text(AppLocalizations.of(context).accounts),
+        actions: [
+          IconButton(
+            icon: const PhosphorIcon(PhosphorIconsLight.arrowSquareIn),
+            tooltip: AppLocalizations.of(context).import,
+            onPressed: () async {
+              await importFile(
+                context,
+                _fileSystem,
+              );
+              setState(() {
+                _buildKeysFuture();
+              });
+            },
+          ),
+          IconButton(
+            icon: const PhosphorIcon(PhosphorIconsLight.export),
+            tooltip: AppLocalizations.of(context).backupAllKeys,
+            onPressed: () async {
+              final data = await _fileSystem.exportAccounts();
+              if (!context.mounted) return;
+              exportData(context, data, 'accounts');
+            },
+          ),
+        ],
+      ),
+      body: FutureBuilder<List<SetonixAccount>>(
+        future: _keysFuture,
+        builder: (context, state) {
+          if (state.connectionState == ConnectionState.waiting) {
+            return const Center(child: CircularProgressIndicator());
+          }
+          if (state.hasError) {
+            return Center(
+              child: Text(
+                AppLocalizations.of(context).error,
+                style: Theme.of(context).textTheme.bodyLarge,
+              ),
+            );
+          }
+          final accounts = state.data ?? <SetonixAccount>[];
+          if (accounts.isEmpty) {
+            return Center(
+              child: Text(
+                AppLocalizations.of(context).noAccount,
+                style: Theme.of(context).textTheme.bodyLarge,
+              ),
+            );
+          }
+          return ListView.builder(
+            itemCount: accounts.length,
+            itemBuilder: (context, index) {
+              final account = accounts[index];
+              final key = account.name;
+              final fingerprint = account.getFingerprint(true);
+              void deleteKey() {
+                _privateKeyFileSystem.deleteFile(key);
+                _publicKeyFileSystem.deleteFile(key);
+                setState(() {
+                  accounts.removeAt(index);
+                });
+              }
+
+              return Dismissible(
+                key: Key(key),
+                child: ContextRegion(
+                  builder: (context, button, controller) => ListTile(
+                    title: Text(key.substring(1)),
+                    subtitle: Text(fingerprint),
+                    trailing: button,
+                  ),
+                  menuChildren: [
+                    MenuItemButton(
+                      leadingIcon:
+                          const PhosphorIcon(PhosphorIconsLight.export),
+                      onPressed: () async {
+                        final data = await _fileSystem.exportAccounts([key]);
+                        if (!context.mounted) return;
+                        exportData(context, data, key);
+                      },
+                      child: Text(AppLocalizations.of(context).backupKey),
+                    ),
+                    MenuItemButton(
+                      leadingIcon: const PhosphorIcon(PhosphorIconsLight.trash),
+                      onPressed: deleteKey,
+                      child: Text(AppLocalizations.of(context).delete),
+                    ),
+                  ],
+                ),
+                onDismissed: (direction) => deleteKey(),
+              );
+            },
+          );
+        },
+      ),
+      floatingActionButton: FloatingActionButton.extended(
+        onPressed: () async {
+          final name = await showDialog(
+              context: context, builder: (context) => NameDialog());
+          if (name == null) return;
+          await _fileSystem.generateKey(name);
+          setState(() {
+            _buildKeysFuture();
+          });
+        },
+        label: Text(AppLocalizations.of(context).add),
+        icon: const PhosphorIcon(PhosphorIconsLight.plus),
+      ),
+    );
+  }
+}
diff --git a/app/lib/pages/settings/general.dart b/app/lib/pages/settings/general.dart
index 0a90755e..e33d0c5a 100644
--- a/app/lib/pages/settings/general.dart
+++ b/app/lib/pages/settings/general.dart
@@ -6,6 +6,7 @@ import 'package:flutter/material.dart';
 import 'package:material_leap/material_leap.dart';
 import 'package:package_info_plus/package_info_plus.dart';
 import 'package:phosphor_flutter/phosphor_flutter.dart';
+import 'package:setonix/pages/settings/intro.dart';
 import 'package:setonix/src/generated/i18n/app_localizations.dart';
 import 'package:setonix/bloc/settings.dart';
 import 'package:setonix/theme.dart';
@@ -184,6 +185,14 @@ class _GeneralSettingsPageState extends State<GeneralSettingsPage> {
                 child: Column(
                     crossAxisAlignment: CrossAxisAlignment.stretch,
                     children: [
+                      ListTile(
+                        leading: const PhosphorIcon(PhosphorIconsLight.info),
+                        title: Text(AppLocalizations.of(context).showIntro),
+                        onTap: () => showDialog(
+                          context: context,
+                          builder: (context) => IntroDialog(),
+                        ),
+                      ),
                       ListTile(
                           leading:
                               const PhosphorIcon(PhosphorIconsLight.article),
diff --git a/app/lib/pages/settings/home.dart b/app/lib/pages/settings/home.dart
index 17083857..38c51087 100644
--- a/app/lib/pages/settings/home.dart
+++ b/app/lib/pages/settings/home.dart
@@ -1,5 +1,7 @@
 import 'package:flutter/material.dart';
+import 'package:setonix/pages/settings/accounts.dart';
 import 'package:setonix/pages/settings/input.dart';
+import 'package:setonix/pages/settings/servers.dart';
 import 'package:setonix/src/generated/i18n/app_localizations.dart';
 import 'package:go_router/go_router.dart';
 import 'package:material_leap/material_leap.dart';
@@ -13,7 +15,9 @@ enum SettingsView {
   general,
   data,
   personalization,
-  inputs;
+  accounts,
+  inputs,
+  servers;
 
   bool get isEnabled => true;
 
@@ -22,16 +26,30 @@ enum SettingsView {
         SettingsView.data => AppLocalizations.of(context).data,
         SettingsView.personalization =>
           AppLocalizations.of(context).personalization,
+        SettingsView.accounts => AppLocalizations.of(context).accounts,
         SettingsView.inputs => AppLocalizations.of(context).inputs,
+        SettingsView.servers => AppLocalizations.of(context).serverLists,
       };
 
   IconGetter get icon => switch (this) {
         SettingsView.general => PhosphorIcons.gear,
         SettingsView.data => PhosphorIcons.database,
         SettingsView.personalization => PhosphorIcons.monitor,
+        SettingsView.accounts => PhosphorIcons.user,
         SettingsView.inputs => PhosphorIcons.keyboard,
+        SettingsView.servers => PhosphorIcons.list,
       };
   String get path => '/settings/$name';
+
+  Widget buildContent({bool inView = false}) => switch (this) {
+        SettingsView.general => GeneralSettingsPage(inView: inView),
+        SettingsView.data => DataSettingsPage(inView: inView),
+        SettingsView.personalization =>
+          PersonalizationSettingsPage(inView: inView),
+        SettingsView.accounts => AccountsSettingsPage(inView: inView),
+        SettingsView.inputs => InputsSettingsPage(inView: inView),
+        SettingsView.servers => ServersSettingsPage(inView: inView),
+      };
 }
 
 class SettingsPage extends StatefulWidget {
@@ -118,13 +136,7 @@ class _SettingsPageState extends State<SettingsPage> {
           if (isMobile) {
             return navigation;
           }
-          final content = switch (_view) {
-            SettingsView.general => const GeneralSettingsPage(inView: true),
-            SettingsView.data => const DataSettingsPage(inView: true),
-            SettingsView.personalization =>
-              const PersonalizationSettingsPage(inView: true),
-            SettingsView.inputs => const InputsSettingsPage(inView: true),
-          };
+          final content = _view.buildContent(inView: true);
           return Row(crossAxisAlignment: CrossAxisAlignment.stretch, children: [
             SizedBox(width: 300, child: navigation),
             Expanded(child: content),
diff --git a/app/lib/pages/settings/intro.dart b/app/lib/pages/settings/intro.dart
new file mode 100644
index 00000000..da05f444
--- /dev/null
+++ b/app/lib/pages/settings/intro.dart
@@ -0,0 +1,73 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:material_leap/material_leap.dart';
+import 'package:phosphor_flutter/phosphor_flutter.dart';
+import 'package:setonix/bloc/settings.dart';
+import 'package:setonix/src/generated/i18n/app_localizations.dart';
+
+class IntroDialog extends StatefulWidget {
+  const IntroDialog({super.key});
+
+  @override
+  State<IntroDialog> createState() => _IntroDialogState();
+}
+
+class _IntroDialogState extends State<IntroDialog> {
+  bool _loadDefaultServers = true;
+  late final SettingsCubit _settingsCubit;
+
+  @override
+  void initState() {
+    super.initState();
+    _settingsCubit = context.read<SettingsCubit>();
+  }
+
+  @override
+  void dispose() async {
+    super.dispose();
+    await _settingsCubit.changeShowIntro(false);
+    if (_loadDefaultServers) {
+      await _settingsCubit.addServersToList(getDefaultServerList(), true);
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return ResponsiveAlertDialog(
+      title: Text(AppLocalizations.of(context).welcome),
+      constraints: const BoxConstraints(maxWidth: LeapBreakpoints.compact),
+      content: ListView(
+        shrinkWrap: true,
+        children: [
+          Image.asset(
+            'images/logo.png',
+            width: 100,
+            height: 100,
+          ),
+          Text(
+            AppLocalizations.of(context).welcomeContent,
+            style: Theme.of(context).textTheme.bodyLarge,
+            textAlign: TextAlign.center,
+          ),
+          const SizedBox(height: 16),
+          const Divider(),
+          SwitchListTile(
+            value: _loadDefaultServers,
+            onChanged: (e) => setState(() => _loadDefaultServers = e),
+            title: Text(AppLocalizations.of(context).loadDefaultServerList),
+            subtitle: Text(
+                AppLocalizations.of(context).loadDefaultServerListDescription),
+          ),
+          const SizedBox(height: 16),
+          FilledButton.icon(
+            onPressed: () {
+              Navigator.of(context).pop();
+            },
+            icon: const PhosphorIcon(PhosphorIconsLight.check),
+            label: Text(AppLocalizations.of(context).confirm),
+          ),
+        ],
+      ),
+    );
+  }
+}
diff --git a/app/lib/pages/settings/servers.dart b/app/lib/pages/settings/servers.dart
new file mode 100644
index 00000000..4bd6795d
--- /dev/null
+++ b/app/lib/pages/settings/servers.dart
@@ -0,0 +1,121 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:setonix/src/generated/i18n/app_localizations.dart';
+import 'package:material_leap/material_leap.dart';
+import 'package:phosphor_flutter/phosphor_flutter.dart';
+
+import '../../bloc/settings.dart';
+
+class ServersSettingsPage extends StatelessWidget {
+  final bool inView;
+  const ServersSettingsPage({super.key, this.inView = false});
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      backgroundColor: inView ? Colors.transparent : null,
+      appBar: WindowTitleBar<SettingsCubit, SetonixSettings>(
+        inView: inView,
+        backgroundColor: inView ? Colors.transparent : null,
+        title: Text(AppLocalizations.of(context).servers),
+        actions: [
+          IconButton(
+            icon: const PhosphorIcon(PhosphorIconsLight.clockCounterClockwise),
+            tooltip: AppLocalizations.of(context).loadDefaultServerList,
+            onPressed: () async {
+              final settingsCubit = context.read<SettingsCubit>();
+              showDialog<bool>(
+                context: context,
+                builder: (context) => AlertDialog(
+                  title:
+                      Text(AppLocalizations.of(context).loadDefaultServerList),
+                  content: Text(AppLocalizations.of(context)
+                      .loadDefaultServerListDescription),
+                  actions: [
+                    TextButton(
+                      onPressed: () => Navigator.of(context).pop(false),
+                      child: Text(AppLocalizations.of(context).cancel),
+                    ),
+                    OutlinedButton(
+                      onPressed: () {
+                        settingsCubit.addServersToList(
+                            getDefaultServerList(), true);
+                        Navigator.of(context).pop(true);
+                      },
+                      child: Text(AppLocalizations.of(context).reset),
+                    ),
+                    ElevatedButton(
+                      onPressed: () {
+                        settingsCubit.addServersToList(getDefaultServerList());
+                        Navigator.of(context).pop(true);
+                      },
+                      child: Text(AppLocalizations.of(context).confirm),
+                    ),
+                  ],
+                ),
+              );
+            },
+          ),
+        ],
+      ),
+      body: BlocBuilder<SettingsCubit, SetonixSettings>(
+        buildWhen: (previous, current) =>
+            previous.serverList != current.serverList,
+        builder: (context, state) {
+          final servers = state.serverList;
+          if (servers.isEmpty) {
+            return Center(
+              child: Text(
+                AppLocalizations.of(context).noServers,
+                style: Theme.of(context).textTheme.bodyLarge,
+              ),
+            );
+          }
+          return ListView.builder(
+            itemCount: servers.length,
+            itemBuilder: (context, index) {
+              final server = servers[index];
+
+              void deleteServer() =>
+                  context.read<SettingsCubit>().removeServerFromList(server);
+
+              return Dismissible(
+                key: Key(server),
+                child: ContextRegion(
+                  builder: (context, button, controller) => ListTile(
+                    title: Text(server),
+                    trailing: button,
+                  ),
+                  menuChildren: [
+                    MenuItemButton(
+                      leadingIcon: const PhosphorIcon(PhosphorIconsLight.trash),
+                      onPressed: deleteServer,
+                      child: Text(AppLocalizations.of(context).delete),
+                    ),
+                  ],
+                ),
+                onDismissed: (direction) => deleteServer(),
+              );
+            },
+          );
+        },
+      ),
+      floatingActionButton: FloatingActionButton.extended(
+        onPressed: () async {
+          final settingsCubit = context.read<SettingsCubit>();
+          final name = await showDialog(
+              context: context, builder: (context) => NameDialog());
+          if (name == null) return;
+          var uri = Uri.tryParse(name);
+          if (uri == null) return;
+          if (!uri.hasScheme) {
+            uri = uri.replace(scheme: 'https');
+          }
+          settingsCubit.addServerToList(name);
+        },
+        label: Text(AppLocalizations.of(context).add),
+        icon: const PhosphorIcon(PhosphorIconsLight.plus),
+      ),
+    );
+  }
+}
diff --git a/app/lib/services/file_system.dart b/app/lib/services/file_system.dart
index 5d43a310..434a5869 100644
--- a/app/lib/services/file_system.dart
+++ b/app/lib/services/file_system.dart
@@ -2,6 +2,7 @@ import 'dart:collection';
 import 'dart:convert';
 import 'dart:typed_data';
 
+import 'package:cryptography_plus/cryptography_plus.dart';
 import 'package:file_selector/file_selector.dart' as fs;
 import 'package:http/http.dart' as http;
 import 'package:idb_shim/idb.dart';
@@ -34,12 +35,16 @@ class SetonixFileSystem {
       worldSystem,
       editorSystem;
   final TypedKeyFileSystem<DataMetadata> dataInfoSystem;
+  final KeyFileSystem privateKeySystem, publicKeySystem;
 
   static Future<void> _onDatabaseUpgrade(VersionChangeEvent event) async {
     await initStores(event, ['packs', 'templates', 'worlds']);
     if (event.oldVersion < 2) {
       event.database.createObjectStore('packs-data');
     }
+    if (event.oldVersion < 3) {
+      event.database.createObjectStore('accounts');
+    }
   }
 
   static const kDatabaseVersion = 2;
@@ -116,6 +121,30 @@ class SetonixFileSystem {
           ),
           onDecode: SetonixData.fromData,
           onEncode: (data) => data.exportAsBytes(),
+        ),
+        privateKeySystem = KeyFileSystem.fromPlatform(
+          FileSystemConfig(
+            passwordStorage: SecureStoragePasswordStorage(),
+            storeName: 'accounts',
+            getDirectory: (storage) async =>
+                '${await getSetonixDirectory()}/Accounts',
+            database: 'setonix.db',
+            databaseVersion: kDatabaseVersion,
+            keySuffix: '.key',
+            onDatabaseUpgrade: _onDatabaseUpgrade,
+          ),
+        ),
+        publicKeySystem = KeyFileSystem.fromPlatform(
+          FileSystemConfig(
+            passwordStorage: SecureStoragePasswordStorage(),
+            storeName: 'accounts',
+            getDirectory: (storage) async =>
+                '${await getSetonixDirectory()}/Accounts',
+            database: 'setonix.db',
+            databaseVersion: kDatabaseVersion,
+            keySuffix: '.pub',
+            onDatabaseUpgrade: _onDatabaseUpgrade,
+          ),
         );
 
   Future<SetonixFile> fetchCorePack() async =>
@@ -197,4 +226,85 @@ class SetonixFileSystem {
       await updateServerLastUsed(pack, serverAddress);
     }
   }
+
+  Future<void> generateKey(String name) async {
+    final generator = Ed25519();
+    final keyPair = await generator.newKeyPair();
+    final privateKey = await keyPair.extractPrivateKeyBytes();
+    final publicKey = await keyPair.extractPublicKey();
+    await privateKeySystem.createFileWithName(Uint8List.fromList(privateKey),
+        name: name);
+    await publicKeySystem
+        .createFileWithName(Uint8List.fromList(publicKey.bytes), name: name);
+  }
+
+  Future<SetonixAccount?> getAccount(String name) async {
+    final privateKey = await privateKeySystem.getFile(name);
+    if (privateKey == null) return null;
+    final publicKey = await publicKeySystem.getFile(name);
+    if (publicKey == null) return null;
+    return SetonixAccount(
+      privateKey: privateKey,
+      publicKey: publicKey,
+      name: name,
+    );
+  }
+
+  Future<void> deleteAccount(String name) async {
+    await privateKeySystem.deleteFile(name);
+    await publicKeySystem.deleteFile(name);
+  }
+
+  Future<void> importAccountsFromData(SetonixData data) =>
+      importAccounts(data.getAccounts().toList());
+
+  Future<void> importAccounts(List<SetonixAccount> accounts) async {
+    for (final account in accounts) {
+      final name = await privateKeySystem.createFileWithName(
+        account.privateKey,
+        name: account.name,
+      );
+      await publicKeySystem.updateFile(
+        name,
+        account.publicKey,
+      );
+    }
+  }
+
+  Future<List<SetonixAccount>> getAccounts([List<String>? names]) async {
+    await privateKeySystem.initialize();
+    names ??= await privateKeySystem.getKeys();
+    return Future.wait(
+      names.map((name) => getAccount(name)),
+    ).then((accounts) => accounts.nonNulls.toList());
+  }
+
+  Future<SetonixData> exportAccounts(
+      [List<String>? names, List<SetonixAccount>? accounts]) async {
+    var data = SetonixData.empty().setMetadata(FileMetadata(
+      type: FileType.accounts,
+    ));
+    final allAccounts = accounts ?? await getAccounts(names);
+    for (final account in allAccounts) {
+      final privateKey = account.privateKey;
+      final publicKey = account.publicKey;
+      if (privateKey.isEmpty || publicKey.isEmpty) continue;
+      data = data.addAccount(
+        SetonixAccount(
+          privateKey: privateKey,
+          publicKey: publicKey,
+          name: account.name,
+        ),
+      );
+    }
+    return data;
+  }
+
+  Future<String> getFingerprint(String key, [bool short = false]) async {
+    final publicKey = await publicKeySystem.getFile(key);
+    if (publicKey == null) {
+      return '';
+    }
+    return generateFingerprint(publicKey, short);
+  }
 }
diff --git a/app/lib/services/network.dart b/app/lib/services/network.dart
index 23badedd..f18e3287 100644
--- a/app/lib/services/network.dart
+++ b/app/lib/services/network.dart
@@ -1,4 +1,5 @@
 import 'dart:async';
+import 'dart:convert';
 import 'dart:io';
 
 import 'package:flutter/foundation.dart';
@@ -129,45 +130,109 @@ class NetworkService {
     }
   }
 
+  Future<GameProperty?> _fetchServer(
+    GameServer server,
+    LanProperty? property, {
+    Map<GameServer, Future<GameProperty?>> cached = const {},
+  }) async {
+    property ??= const LanProperty();
+    return cached[server] ??
+        switch (server) {
+          LanGameServer() =>
+            Future.value(GameProperty(description: property.description)),
+          ListGameServer() => cached[server] =
+              fetchInfo(server.buildAddress(webSockets: false))
+                  .onError((_, __) => null),
+        };
+  }
+
+  Stream<Map<GameServer, GameProperty?>> _fetchBrowsableServersWithProperties({
+    Map<GameServer, Future<GameProperty?>>? cached,
+    required Map<GameServer, GameProperty?> returned,
+  }) {
+    final lists = settingsCubit.state.serverList;
+    Future<List<GameServer>> fetchList(String address) async {
+      try {
+        final response = await http.get(Uri.parse(address),
+            headers: {HttpHeaders.contentTypeHeader: 'application/json'});
+        if (response.statusCode != HttpStatus.ok) return [];
+        final result = jsonDecode(response.body) as Map;
+        return result['servers']
+            .map<GameServer>((e) => BrowsedGameServerMapper.fromMap(e))
+            .toList();
+      } catch (_) {
+        return [];
+      }
+    }
+
+    final currentCached = cached ?? <GameServer, Future<GameProperty?>>{};
+    Stream<Map<GameServer, GameProperty?>> fetchServers(String address) async* {
+      final servers = await fetchList(address);
+      for (final server in servers) {
+        returned.putIfAbsent(
+          server,
+          () => const GameProperty(),
+        );
+      }
+      yield returned;
+      for (final server in servers) {
+        try {
+          returned[server] =
+              await _fetchServer(server, null, cached: currentCached);
+        } catch (_) {
+          returned[server] = null;
+        }
+        yield returned;
+      }
+    }
+
+    final streams = lists.map((e) => fetchServers(e));
+    return Rx.merge(streams);
+  }
+
   Stream<Map<GameServer, GameProperty?>> fetchServersWithProperties({
-    bool list = true,
+    bool browsable = true,
+    bool local = true,
   }) async* {
     Map<GameServer, Future<GameProperty?>> cached = {};
-    Future<GameProperty?> fetch(
-        GameServer server, LanProperty? property) async {
-      property ??= const LanProperty();
-      return cached[server] ??
-          switch (server) {
-            LanGameServer() =>
-              Future.value(GameProperty(description: property.description)),
-            ListGameServer() => cached[server] =
-                fetchInfo(server.buildAddress(webSockets: false))
-                    .onError((_, __) => null),
-          };
-    }
-
     final returned = <GameServer, GameProperty?>{};
     yield returned;
+    fetchLocal() async* {
+      await for (final event in _servers) {
+        returned.removeWhere((key, value) => !event.any((e) => e.$1 == key));
+        for (final (server, _) in event) {
+          returned[server] = const GameProperty();
+        }
+        yield returned;
 
-    await for (final event in _servers) {
-      returned.removeWhere((key, value) => !event.any((e) => e.$1 == key));
-      for (final (server, _) in event) {
-        returned[server] = const GameProperty();
-      }
-      yield returned;
+        if (event.isEmpty) {
+          continue;
+        }
 
-      if (event.isEmpty) {
-        continue;
+        for (final e in event) {
+          try {
+            returned[e.$1] = await _fetchServer(e.$1, e.$2, cached: cached);
+          } catch (_) {
+            returned[e.$1] = null;
+          }
+          yield returned;
+        }
       }
+    }
 
-      for (final e in event) {
-        try {
-          returned[e.$1] = await fetch(e.$1, e.$2);
-        } catch (_) {
-          returned[e.$1] = null;
-        }
-        yield returned;
+    if (browsable) {
+      if (!local) {
+        yield* _fetchBrowsableServersWithProperties(
+            cached: cached, returned: returned);
+      } else {
+        yield* Rx.merge([
+          fetchLocal(),
+          _fetchBrowsableServersWithProperties(
+              cached: cached, returned: returned),
+        ]);
       }
+    } else if (local) {
+      yield* fetchLocal();
     }
   }
 }
diff --git a/docs/public/favicon.svg b/docs/public/favicon.svg
deleted file mode 100644
index cba5ac14..00000000
--- a/docs/public/favicon.svg
+++ /dev/null
@@ -1 +0,0 @@
-<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 128 128"><path fill-rule="evenodd" d="M81 36 64 0 47 36l-1 2-9-10a6 6 0 0 0-9 9l10 10h-2L0 64l36 17h2L28 91a6 6 0 1 0 9 9l9-10 1 2 17 36 17-36v-2l9 10a6 6 0 1 0 9-9l-9-9 2-1 36-17-36-17-2-1 9-9a6 6 0 1 0-9-9l-9 10v-2Zm-17 2-2 5c-4 8-11 15-19 19l-5 2 5 2c8 4 15 11 19 19l2 5 2-5c4-8 11-15 19-19l5-2-5-2c-8-4-15-11-19-19l-2-5Z" clip-rule="evenodd"/><path d="M118 19a6 6 0 0 0-9-9l-3 3a6 6 0 1 0 9 9l3-3Zm-96 4c-2 2-6 2-9 0l-3-3a6 6 0 1 1 9-9l3 3c3 2 3 6 0 9Zm0 82c-2-2-6-2-9 0l-3 3a6 6 0 1 0 9 9l3-3c3-2 3-6 0-9Zm96 4a6 6 0 0 1-9 9l-3-3a6 6 0 1 1 9-9l3 3Z"/><style>path{fill:#000}@media (prefers-color-scheme:dark){path{fill:#fff}}</style></svg>
\ No newline at end of file
diff --git a/plugin/pubspec.lock b/plugin/pubspec.lock
index 90c7d267..305eb77b 100644
--- a/plugin/pubspec.lock
+++ b/plugin/pubspec.lock
@@ -177,6 +177,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.0.6"
+  cryptography_plus:
+    dependency: transitive
+    description:
+      name: cryptography_plus
+      sha256: "34db787df4f4740a39474b6fb0a610aa6dc13a5b5b68754b4787a79939ac0454"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.7.1"
   dart_leap:
     dependency: transitive
     description:
diff --git a/plugin/rust/Cargo.lock b/plugin/rust/Cargo.lock
index ce0f13a4..43707683 100644
--- a/plugin/rust/Cargo.lock
+++ b/plugin/rust/Cargo.lock
@@ -124,15 +124,15 @@ checksum = "832133bbabbbaa9fbdba793456a2827627a7d2b8fb96032fa1e7666d7895832b"
 
 [[package]]
 name = "bumpalo"
-version = "3.18.1"
+version = "3.17.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "793db76d6187cd04dff33004d8e6c9cc4e05cd330500379d2394209271b4aeee"
+checksum = "1628fb46dfa0b37568d12e5edd512553eccf6a22a78e8bde00bb4aed84d5bdbf"
 
 [[package]]
 name = "bytemuck"
-version = "1.23.1"
+version = "1.23.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5c76a5792e44e4abe34d3abf15636779261d45a7450612059293d1d2cfc63422"
+checksum = "9134a6ef01ce4b366b50689c94f82c14bc72bc5d0386829828a2e2752ef7958c"
 
 [[package]]
 name = "byteorder"
@@ -142,9 +142,9 @@ checksum = "1fd0f2584146f6f2ef48085050886acf353beff7305ebd1ae69500e27c67f64b"
 
 [[package]]
 name = "cc"
-version = "1.2.26"
+version = "1.2.23"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "956a5e21988b87f372569b66183b78babf23ebc2e744b733e4350a752c4dafac"
+checksum = "5f4ac86a9e5bc1e2b3449ab9d7d3a6a405e3d1bb28d7b9be8614f55846ae3766"
 dependencies = [
  "shlex",
 ]
@@ -396,9 +396,9 @@ checksum = "2304e00983f87ffb38b55b444b5e3b60a884b5d30c0fca7d82fe33449bbe55ea"
 
 [[package]]
 name = "hermit-abi"
-version = "0.5.1"
+version = "0.3.9"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f154ce46856750ed433c8649605bf7ed2de3bc35fd9d2a9f30cddd873c80cb08"
+checksum = "d231dfb89cfffdbc30e7fc41579ed6066ad03abda9e567ccafae602b97ec5024"
 
 [[package]]
 name = "hex"
@@ -436,9 +436,9 @@ checksum = "d750af042f7ef4f724306de029d18836c26c1765a54a6a3f094cbd23a7267ffa"
 
 [[package]]
 name = "libloading"
-version = "0.8.8"
+version = "0.8.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "07033963ba89ebaf1584d767badaa2e8fcec21aedea6b8c0346d487d49c28667"
+checksum = "6a793df0d7afeac54f95b471d3af7f0d4fb975699f972341a4b76988d49cdf0c"
 dependencies = [
  "cfg-if",
  "windows-targets 0.53.0",
@@ -446,9 +446,9 @@ dependencies = [
 
 [[package]]
 name = "lock_api"
-version = "0.4.13"
+version = "0.4.12"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "96936507f153605bddfcda068dd804796c84324ed2510809e5b2a624c81da765"
+checksum = "07af8b9cdd281b7915f413fa73f29ebd5d55d0d3f0155584dade1ff18cea1b17"
 dependencies = [
  "autocfg",
  "scopeguard",
@@ -496,9 +496,9 @@ dependencies = [
 
 [[package]]
 name = "mlua"
-version = "0.10.5"
+version = "0.10.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "c1f5f8fbebc7db5f671671134b9321c4b9aa9adeafccfd9a8c020ae45c6a35d0"
+checksum = "d3f763c1041eff92ffb5d7169968a327e1ed2ebfe425dac0ee5a35f29082534b"
 dependencies = [
  "anyhow",
  "bstr",
@@ -510,16 +510,15 @@ dependencies = [
  "num-traits",
  "parking_lot",
  "rustc-hash",
- "rustversion",
  "serde",
  "serde-value",
 ]
 
 [[package]]
 name = "mlua-sys"
-version = "0.6.8"
+version = "0.6.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "380c1f7e2099cafcf40e51d3a9f20a346977587aa4d012eae1f043149a728a93"
+checksum = "1901c1a635a22fe9250ffcc4fcc937c16b47c2e9e71adba8784af8bca1f69594"
 dependencies = [
  "cc",
  "cfg-if",
@@ -538,9 +537,9 @@ dependencies = [
 
 [[package]]
 name = "num_cpus"
-version = "1.17.0"
+version = "1.16.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "91df4bbde75afed763b708b7eee1e8e7651e02d97f6d5dd763e89367e957b23b"
+checksum = "4161fcb6d602d4d2081af7c3a45852d875a03dd337a6bfdd6e06407b61342a43"
 dependencies = [
  "hermit-abi",
  "libc",
@@ -583,9 +582,9 @@ dependencies = [
 
 [[package]]
 name = "parking_lot"
-version = "0.12.4"
+version = "0.12.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "70d58bf43669b5795d1576d0641cfb6fbb2057bf629506267a92807158584a13"
+checksum = "f1bf18183cf54e8d6059647fc3063646a1801cf30896933ec2311622cc4b9a27"
 dependencies = [
  "lock_api",
  "parking_lot_core",
@@ -593,9 +592,9 @@ dependencies = [
 
 [[package]]
 name = "parking_lot_core"
-version = "0.9.11"
+version = "0.9.10"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "bc838d2a56b5b1a6c25f55575dfc605fabb63bb2365f6c2353ef9159aa69e4a5"
+checksum = "1e401f977ab385c9e4e3ab30627d6f26d00e2c73eef317493c4ec6d468726cf8"
 dependencies = [
  "cfg-if",
  "libc",
@@ -624,9 +623,9 @@ checksum = "7edddbd0b52d732b21ad9a5fab5c704c14cd949e5e9a1ec5929a24fded1b904c"
 
 [[package]]
 name = "portable-atomic"
-version = "1.11.1"
+version = "1.11.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f84267b20a16ea918e43c6a88433c2d54fa145c92a811b5b047ccbe153674483"
+checksum = "350e9b48cbc6b0e028b0473b114454c6316e57336ee184ceab6e53f72c178b3e"
 
 [[package]]
 name = "proc-macro2"
@@ -698,9 +697,9 @@ checksum = "357703d41365b4b27c590e3ed91eabb1b663f07c4c084095e60cbed4362dff0d"
 
 [[package]]
 name = "rustversion"
-version = "1.0.21"
+version = "1.0.20"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8a0d197bd2c9dc6e53b84da9556a69ba4cdfab8619eb41a8bd1cc2027a0f6b1d"
+checksum = "eded382c5f5f786b989652c49544c4877d9f015cc22e145a5ea8ea66c2921cd2"
 
 [[package]]
 name = "ryu"
@@ -786,9 +785,9 @@ dependencies = [
 
 [[package]]
 name = "smallvec"
-version = "1.15.1"
+version = "1.15.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "67b1b7a3b5fe4f1376887184045fcf45c69e92af734b7aaddc05fb777b6fbd03"
+checksum = "8917285742e9f3e1683f0a9c4e6b57960b7314d0b08d30d1ecd426713ee2eee9"
 
 [[package]]
 name = "strum"
@@ -834,9 +833,9 @@ dependencies = [
 
 [[package]]
 name = "tokio"
-version = "1.45.1"
+version = "1.45.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "75ef51a33ef1da925cea3e4eb122833cb377c61439ca401b770f54902b806779"
+checksum = "2513ca694ef9ede0fb23fe71a4ee4107cb102b9dc1930f6d0fd77aae068ae165"
 dependencies = [
  "backtrace",
  "pin-project-lite",
diff --git a/server/lib/src/asset.mapper.dart b/server/lib/src/asset.mapper.dart
index 40f7a854..29f32ce9 100644
--- a/server/lib/src/asset.mapper.dart
+++ b/server/lib/src/asset.mapper.dart
@@ -58,8 +58,8 @@ mixin ServerDataMetadataMappable {
 
   ServerDataMetadataCopyWith<ServerDataMetadata, ServerDataMetadata,
           ServerDataMetadata>
-      get copyWith => _ServerDataMetadataCopyWithImpl(
-          this as ServerDataMetadata, $identity, $identity);
+      get copyWith => _ServerDataMetadataCopyWithImpl<ServerDataMetadata,
+          ServerDataMetadata>(this as ServerDataMetadata, $identity, $identity);
   @override
   String toString() {
     return ServerDataMetadataMapper.ensureInitialized()
@@ -82,8 +82,8 @@ mixin ServerDataMetadataMappable {
 extension ServerDataMetadataValueCopy<$R, $Out>
     on ObjectCopyWith<$R, ServerDataMetadata, $Out> {
   ServerDataMetadataCopyWith<$R, ServerDataMetadata, $Out>
-      get $asServerDataMetadata =>
-          $base.as((v, t, t2) => _ServerDataMetadataCopyWithImpl(v, t, t2));
+      get $asServerDataMetadata => $base.as(
+          (v, t, t2) => _ServerDataMetadataCopyWithImpl<$R, $Out>(v, t, t2));
 }
 
 abstract class ServerDataMetadataCopyWith<$R, $In extends ServerDataMetadata,
@@ -118,5 +118,5 @@ class _ServerDataMetadataCopyWithImpl<$R, $Out>
   @override
   ServerDataMetadataCopyWith<$R2, ServerDataMetadata, $Out2> $chain<$R2, $Out2>(
           Then<$Out2, $R2> t) =>
-      _ServerDataMetadataCopyWithImpl($value, $cast, t);
+      _ServerDataMetadataCopyWithImpl<$R2, $Out2>($value, $cast, t);
 }
diff --git a/server/lib/src/bloc.dart b/server/lib/src/bloc.dart
index 84dcc372..231a7056 100644
--- a/server/lib/src/bloc.dart
+++ b/server/lib/src/bloc.dart
@@ -6,10 +6,16 @@ import 'package:bloc_concurrency/bloc_concurrency.dart';
 import 'package:consoler/consoler.dart';
 import 'package:setonix_server/setonix_server.dart';
 
-Future<ServerProcessed> _computeEvent(ServerWorldEvent event, WorldState state,
-    List<SignatureMetadata> signature) {
-  return Isolate.run(
-      () => processServerEvent(event, state, signature: signature));
+Future<ServerProcessed> _computeEvent(
+  ServerWorldEvent event,
+  WorldState state, {
+  required List<SignatureMetadata> signature,
+}) {
+  return Isolate.run(() => processServerEvent(
+        event,
+        state,
+        signature: signature,
+      ));
 }
 
 class WorldBloc extends Bloc<PlayableWorldEvent, WorldState>
@@ -40,8 +46,11 @@ class WorldBloc extends Bloc<PlayableWorldEvent, WorldState>
     _serverPlugin = _pluginSystem.registerPlugin('', SetonixPlugin.new);
     on<ServerWorldEvent>((event, emit) async {
       final signature = assetManager.createSignature();
-      final processed =
-          await _computeEvent(event, state, signature.values.toList());
+      final processed = await _computeEvent(
+        event,
+        state,
+        signature: signature.values.toList(),
+      );
       final newState = processed.state;
       processed.responses.forEach(process);
       if (event is WorldInitialized) {
@@ -62,7 +71,7 @@ class WorldBloc extends Bloc<PlayableWorldEvent, WorldState>
   Future<void> _loadScript(String? script) async {
     try {
       if (script == null) return;
-      server.pluginSystem.loadLuaPlugin(assetManager, script);
+      pluginSystem.loadLuaPlugin(assetManager, script);
     } catch (e) {
       server.log('Error loading script: $e', level: LogLevel.error);
     }
@@ -89,17 +98,19 @@ class WorldBloc extends Bloc<PlayableWorldEvent, WorldState>
     await file.writeAsBytes(bytes);
   }
 
-  void onClientEvent(NetworkerPacket<WorldEvent> packet,
+  Future<void> onClientEvent(NetworkerPacket<WorldEvent> packet,
       {bool force = false}) async {
     final data = packet.data;
     ServerResponse? process;
     try {
-      process = processClientEvent(
+      process = await processClientEvent(
         data is UserJoined ? null : data,
         packet.channel,
         state,
         assetManager: assetManager,
         allowServerEvents: packet.isServer,
+        challengeManager: server.challengeManager,
+        userManager: server.userManager,
       );
     } catch (e) {
       server.log('Error processing event: $e', level: LogLevel.error);
diff --git a/server/lib/src/config.dart b/server/lib/src/config.dart
index d3b34f13..5383c9f7 100644
--- a/server/lib/src/config.dart
+++ b/server/lib/src/config.dart
@@ -31,8 +31,8 @@ class ConfigManager {
       _mergedConfig = _mergeConfig();
     } else {
       _config = SetonixConfig.defaultConfig;
-      await file.writeAsString(
-          JsonEncoder.withIndent('  ').convert(_config.toJson()));
+      await file
+          .writeAsString(JsonEncoder.withIndent('  ').convert(_config.toMap()));
     }
   }
 
@@ -53,4 +53,7 @@ class ConfigManager {
 
   String get worldFile =>
       _mergedConfig.worldFile ?? SetonixConfig.defaultWorldName;
+
+  String get guestPrefix =>
+      _mergedConfig.guestPrefix ?? SetonixConfig.defaultGuestPrefix;
 }
diff --git a/server/lib/src/server.dart b/server/lib/src/server.dart
index 355dae16..413ee6d1 100644
--- a/server/lib/src/server.dart
+++ b/server/lib/src/server.dart
@@ -26,11 +26,12 @@ String limitOutput(Object? value, [int limit = 500]) {
 
 final class SetonixServer {
   final Consoler consoler;
-  final ConfigManager configManager = ConfigManager();
+  final ConfigManager configManager;
   final ServerAssetManager assetManager;
+  final UserManager userManager;
+  final ChallengeManager? challengeManager;
   final Map<String, WorldBloc> _worlds = {};
   final Map<Channel, String> _userWorlds = {};
-  late final PluginSystem pluginSystem;
 
   NetworkerSocketServer? _server;
   NetworkerPipe<dynamic, WorldEvent>? _pipe;
@@ -67,7 +68,13 @@ final class SetonixServer {
   WorldState? getUserWorldState(Channel channel) =>
       getUserWorld(channel)?.state;
 
-  SetonixServer._(this.consoler, this.assetManager);
+  SetonixServer._(
+    this.consoler,
+    this.assetManager,
+    this.configManager,
+    this.userManager,
+    this.challengeManager,
+  );
 
   static Future<SetonixServer> load({
     String? worldFile,
@@ -80,7 +87,11 @@ final class SetonixServer {
     );
     await _runStaticLogZone(
         consoler, () => assetManager.init(console: consoler));
-    return SetonixServer._(consoler, assetManager);
+    final configManager = ConfigManager();
+    final userManager = UserManager(configManager.guestPrefix);
+    final challengeManager = ChallengeManager();
+    return SetonixServer._(
+        consoler, assetManager, configManager, userManager, challengeManager);
   }
 
   void log(Object? message, {LogLevel? level}) =>
@@ -205,6 +216,10 @@ final class SetonixServer {
     final (user, info) = event;
     log('${info.address} ($user) left the game', level: LogLevel.info);
     getUserWorld(user)?.eventSystem.runLeaveCallback(event.$1, event.$2);
+
+    _userWorlds.remove(user);
+    userManager.removeUser(user);
+    challengeManager?.removeChallenge(user);
   }
 
   Future<void> saveAll({bool force = false}) async {
diff --git a/server/pubspec.lock b/server/pubspec.lock
index 8b890933..5a81376c 100644
--- a/server/pubspec.lock
+++ b/server/pubspec.lock
@@ -210,6 +210,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.0.6"
+  cryptography_plus:
+    dependency: transitive
+    description:
+      name: cryptography_plus
+      sha256: "34db787df4f4740a39474b6fb0a610aa6dc13a5b5b68754b4787a79939ac0454"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.7.1"
   dart_leap:
     dependency: transitive
     description:
diff --git a/servers/.gitignore b/servers/.gitignore
new file mode 100644
index 00000000..016b59ea
--- /dev/null
+++ b/servers/.gitignore
@@ -0,0 +1,24 @@
+# build output
+dist/
+
+# generated types
+.astro/
+
+# dependencies
+node_modules/
+
+# logs
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+pnpm-debug.log*
+
+# environment variables
+.env
+.env.production
+
+# macOS-specific files
+.DS_Store
+
+# jetbrains setting folder
+.idea/
diff --git a/servers/README.md b/servers/README.md
new file mode 100644
index 00000000..a64188fd
--- /dev/null
+++ b/servers/README.md
@@ -0,0 +1,48 @@
+# Astro Starter Kit: Basics
+
+```sh
+pnpm create astro@latest -- --template basics
+```
+
+[![Open in StackBlitz](https://developer.stackblitz.com/img/open_in_stackblitz.svg)](https://stackblitz.com/github/withastro/astro/tree/latest/examples/basics)
+[![Open with CodeSandbox](https://assets.codesandbox.io/github/button-edit-lime.svg)](https://codesandbox.io/p/sandbox/github/withastro/astro/tree/latest/examples/basics)
+[![Open in GitHub Codespaces](https://github.com/codespaces/badge.svg)](https://codespaces.new/withastro/astro?devcontainer_path=.devcontainer/basics/devcontainer.json)
+
+> 🧑‍🚀 **Seasoned astronaut?** Delete this file. Have fun!
+
+![just-the-basics](https://github.com/withastro/astro/assets/2244813/a0a5533c-a856-4198-8470-2d67b1d7c554)
+
+## 🚀 Project Structure
+
+Inside of your Astro project, you'll see the following folders and files:
+
+```text
+/
+├── public/
+│   └── favicon.svg
+├── src/
+│   ├── layouts/
+│   │   └── Layout.astro
+│   └── pages/
+│       └── index.astro
+└── package.json
+```
+
+To learn more about the folder structure of an Astro project, refer to [our guide on project structure](https://docs.astro.build/en/basics/project-structure/).
+
+## 🧞 Commands
+
+All commands are run from the root of the project, from a terminal:
+
+| Command                   | Action                                           |
+| :------------------------ | :----------------------------------------------- |
+| `pnpm install`             | Installs dependencies                            |
+| `pnpm dev`             | Starts local dev server at `localhost:4321`      |
+| `pnpm build`           | Build your production site to `./dist/`          |
+| `pnpm preview`         | Preview your build locally, before deploying     |
+| `pnpm astro ...`       | Run CLI commands like `astro add`, `astro check` |
+| `pnpm astro -- --help` | Get help using the Astro CLI                     |
+
+## 👀 Want to learn more?
+
+Feel free to check [our documentation](https://docs.astro.build) or jump into our [Discord server](https://astro.build/chat).
diff --git a/servers/astro.config.mjs b/servers/astro.config.mjs
new file mode 100644
index 00000000..4639bb97
--- /dev/null
+++ b/servers/astro.config.mjs
@@ -0,0 +1,28 @@
+// @ts-check
+import { defineConfig, envField } from "astro/config";
+
+import node from "@astrojs/node";
+
+// https://astro.build/config
+export default defineConfig({
+  output: "server",
+
+  env: {
+    schema: {
+      REMOTE_URLS: envField.string({
+        context: "server",
+        access: "secret",
+        optional: true,
+      }),
+      USE_REMOTE_URLS_STATUS: envField.boolean({
+        context: "server",
+        access: "secret",
+        default: true,
+      }),
+    },
+  },
+
+  adapter: node({
+    mode: "standalone",
+  }),
+});
\ No newline at end of file
diff --git a/servers/package.json b/servers/package.json
new file mode 100644
index 00000000..252f2fde
--- /dev/null
+++ b/servers/package.json
@@ -0,0 +1,18 @@
+{
+  "name": "servers",
+  "type": "module",
+  "version": "0.0.1",
+  "scripts": {
+    "dev": "astro dev",
+    "build": "astro build",
+    "preview": "astro preview",
+    "astro": "astro"
+  },
+  "packageManager": "pnpm@10.12.1",
+  "dependencies": {
+    "@astrojs/node": "^9.2.2",
+    "@cacheable/node-cache": "^1.5.6",
+    "@linwooddev/style": "^0.4.2",
+    "astro": "^5.9.3"
+  }
+}
\ No newline at end of file
diff --git a/servers/pnpm-lock.yaml b/servers/pnpm-lock.yaml
new file mode 100644
index 00000000..1857865f
--- /dev/null
+++ b/servers/pnpm-lock.yaml
@@ -0,0 +1,3303 @@
+lockfileVersion: '9.0'
+
+settings:
+  autoInstallPeers: true
+  excludeLinksFromLockfile: false
+
+importers:
+
+  .:
+    dependencies:
+      '@astrojs/node':
+        specifier: ^9.2.2
+        version: 9.2.2(astro@5.9.3(@types/node@24.0.1)(rollup@4.43.0)(typescript@5.8.3))
+      '@cacheable/node-cache':
+        specifier: ^1.5.6
+        version: 1.5.6
+      '@linwooddev/style':
+        specifier: ^0.4.2
+        version: 0.4.2
+      astro:
+        specifier: ^5.9.3
+        version: 5.9.3(@types/node@24.0.1)(rollup@4.43.0)(typescript@5.8.3)
+
+packages:
+
+  '@astrojs/compiler@2.12.2':
+    resolution: {integrity: sha512-w2zfvhjNCkNMmMMOn5b0J8+OmUaBL1o40ipMvqcG6NRpdC+lKxmTi48DT8Xw0SzJ3AfmeFLB45zXZXtmbsjcgw==}
+
+  '@astrojs/internal-helpers@0.6.1':
+    resolution: {integrity: sha512-l5Pqf6uZu31aG+3Lv8nl/3s4DbUzdlxTWDof4pEpto6GUJNhhCbelVi9dEyurOVyqaelwmS9oSyOWOENSfgo9A==}
+
+  '@astrojs/markdown-remark@6.3.2':
+    resolution: {integrity: sha512-bO35JbWpVvyKRl7cmSJD822e8YA8ThR/YbUsciWNA7yTcqpIAL2hJDToWP5KcZBWxGT6IOdOkHSXARSNZc4l/Q==}
+
+  '@astrojs/node@9.2.2':
+    resolution: {integrity: sha512-PtLPuuojmcl9O3CEvXqL/D+wB4x5DlbrGOvP0MeTAh/VfKFprYAzgw1+45xsnTO+QvPWb26l1cT+ZQvvohmvMw==}
+    peerDependencies:
+      astro: ^5.3.0
+
+  '@astrojs/prism@3.3.0':
+    resolution: {integrity: sha512-q8VwfU/fDZNoDOf+r7jUnMC2//H2l0TuQ6FkGJL8vD8nw/q5KiL3DS1KKBI3QhI9UQhpJ5dc7AtqfbXWuOgLCQ==}
+    engines: {node: 18.20.8 || ^20.3.0 || >=22.0.0}
+
+  '@astrojs/telemetry@3.3.0':
+    resolution: {integrity: sha512-UFBgfeldP06qu6khs/yY+q1cDAaArM2/7AEIqQ9Cuvf7B1hNLq0xDrZkct+QoIGyjq56y8IaE2I3CTvG99mlhQ==}
+    engines: {node: 18.20.8 || ^20.3.0 || >=22.0.0}
+
+  '@babel/helper-string-parser@7.27.1':
+    resolution: {integrity: sha512-qMlSxKbpRlAridDExk92nSobyDdpPijUq2DW6oDnUqd0iOGxmQjyqhMIihI9+zv4LPyZdRje2cavWPbCbWm3eA==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-validator-identifier@7.27.1':
+    resolution: {integrity: sha512-D2hP9eA+Sqx1kBZgzxZh0y1trbuU+JoDkiEwqhQ36nodYqJwyEIhPSdMNd7lOm/4io72luTPWH20Yda0xOuUow==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/parser@7.27.5':
+    resolution: {integrity: sha512-OsQd175SxWkGlzbny8J3K8TnnDD0N3lrIUtB92xwyRpzaenGZhxDvxN/JgU00U3CDZNj9tPuDJ5H0WS4Nt3vKg==}
+    engines: {node: '>=6.0.0'}
+    hasBin: true
+
+  '@babel/types@7.27.6':
+    resolution: {integrity: sha512-ETyHEk2VHHvl9b9jZP5IHPavHYk57EhanlRRuae9XCpb/j5bDCbPPMOBfCWhnl/7EDJz0jEMCi/RhccCE8r1+Q==}
+    engines: {node: '>=6.9.0'}
+
+  '@cacheable/node-cache@1.5.6':
+    resolution: {integrity: sha512-1sLMrvrWoxrqiVKW1BFDjYrBGSG32miOJfNyPUaWwisvbsu+V2wgYqPyLiw0qpprxtjVZT02omsGgQut+DKw8Q==}
+
+  '@capsizecss/unpack@2.4.0':
+    resolution: {integrity: sha512-GrSU71meACqcmIUxPYOJvGKF0yryjN/L1aCuE9DViCTJI7bfkjgYDPD1zbNDcINJwSSP6UaBZY9GAbYDO7re0Q==}
+
+  '@emnapi/runtime@1.4.3':
+    resolution: {integrity: sha512-pBPWdu6MLKROBX05wSNKcNb++m5Er+KQ9QkB+WVM+pW2Kx9hoSrVTnu3BdkI5eBLZoKu/J6mW/B6i6bJB2ytXQ==}
+
+  '@esbuild/aix-ppc64@0.25.5':
+    resolution: {integrity: sha512-9o3TMmpmftaCMepOdA5k/yDw8SfInyzWWTjYTFCX3kPSDJMROQTb8jg+h9Cnwnmm1vOzvxN7gIfB5V2ewpjtGA==}
+    engines: {node: '>=18'}
+    cpu: [ppc64]
+    os: [aix]
+
+  '@esbuild/android-arm64@0.25.5':
+    resolution: {integrity: sha512-VGzGhj4lJO+TVGV1v8ntCZWJktV7SGCs3Pn1GRWI1SBFtRALoomm8k5E9Pmwg3HOAal2VDc2F9+PM/rEY6oIDg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [android]
+
+  '@esbuild/android-arm@0.25.5':
+    resolution: {integrity: sha512-AdJKSPeEHgi7/ZhuIPtcQKr5RQdo6OO2IL87JkianiMYMPbCtot9fxPbrMiBADOWWm3T2si9stAiVsGbTQFkbA==}
+    engines: {node: '>=18'}
+    cpu: [arm]
+    os: [android]
+
+  '@esbuild/android-x64@0.25.5':
+    resolution: {integrity: sha512-D2GyJT1kjvO//drbRT3Hib9XPwQeWd9vZoBJn+bu/lVsOZ13cqNdDeqIF/xQ5/VmWvMduP6AmXvylO/PIc2isw==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [android]
+
+  '@esbuild/darwin-arm64@0.25.5':
+    resolution: {integrity: sha512-GtaBgammVvdF7aPIgH2jxMDdivezgFu6iKpmT+48+F8Hhg5J/sfnDieg0aeG/jfSvkYQU2/pceFPDKlqZzwnfQ==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@esbuild/darwin-x64@0.25.5':
+    resolution: {integrity: sha512-1iT4FVL0dJ76/q1wd7XDsXrSW+oLoquptvh4CLR4kITDtqi2e/xwXwdCVH8hVHU43wgJdsq7Gxuzcs6Iq/7bxQ==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [darwin]
+
+  '@esbuild/freebsd-arm64@0.25.5':
+    resolution: {integrity: sha512-nk4tGP3JThz4La38Uy/gzyXtpkPW8zSAmoUhK9xKKXdBCzKODMc2adkB2+8om9BDYugz+uGV7sLmpTYzvmz6Sw==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [freebsd]
+
+  '@esbuild/freebsd-x64@0.25.5':
+    resolution: {integrity: sha512-PrikaNjiXdR2laW6OIjlbeuCPrPaAl0IwPIaRv+SMV8CiM8i2LqVUHFC1+8eORgWyY7yhQY+2U2fA55mBzReaw==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@esbuild/linux-arm64@0.25.5':
+    resolution: {integrity: sha512-Z9kfb1v6ZlGbWj8EJk9T6czVEjjq2ntSYLY2cw6pAZl4oKtfgQuS4HOq41M/BcoLPzrUbNd+R4BXFyH//nHxVg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [linux]
+
+  '@esbuild/linux-arm@0.25.5':
+    resolution: {integrity: sha512-cPzojwW2okgh7ZlRpcBEtsX7WBuqbLrNXqLU89GxWbNt6uIg78ET82qifUy3W6OVww6ZWobWub5oqZOVtwolfw==}
+    engines: {node: '>=18'}
+    cpu: [arm]
+    os: [linux]
+
+  '@esbuild/linux-ia32@0.25.5':
+    resolution: {integrity: sha512-sQ7l00M8bSv36GLV95BVAdhJ2QsIbCuCjh/uYrWiMQSUuV+LpXwIqhgJDcvMTj+VsQmqAHL2yYaasENvJ7CDKA==}
+    engines: {node: '>=18'}
+    cpu: [ia32]
+    os: [linux]
+
+  '@esbuild/linux-loong64@0.25.5':
+    resolution: {integrity: sha512-0ur7ae16hDUC4OL5iEnDb0tZHDxYmuQyhKhsPBV8f99f6Z9KQM02g33f93rNH5A30agMS46u2HP6qTdEt6Q1kg==}
+    engines: {node: '>=18'}
+    cpu: [loong64]
+    os: [linux]
+
+  '@esbuild/linux-mips64el@0.25.5':
+    resolution: {integrity: sha512-kB/66P1OsHO5zLz0i6X0RxlQ+3cu0mkxS3TKFvkb5lin6uwZ/ttOkP3Z8lfR9mJOBk14ZwZ9182SIIWFGNmqmg==}
+    engines: {node: '>=18'}
+    cpu: [mips64el]
+    os: [linux]
+
+  '@esbuild/linux-ppc64@0.25.5':
+    resolution: {integrity: sha512-UZCmJ7r9X2fe2D6jBmkLBMQetXPXIsZjQJCjgwpVDz+YMcS6oFR27alkgGv3Oqkv07bxdvw7fyB71/olceJhkQ==}
+    engines: {node: '>=18'}
+    cpu: [ppc64]
+    os: [linux]
+
+  '@esbuild/linux-riscv64@0.25.5':
+    resolution: {integrity: sha512-kTxwu4mLyeOlsVIFPfQo+fQJAV9mh24xL+y+Bm6ej067sYANjyEw1dNHmvoqxJUCMnkBdKpvOn0Ahql6+4VyeA==}
+    engines: {node: '>=18'}
+    cpu: [riscv64]
+    os: [linux]
+
+  '@esbuild/linux-s390x@0.25.5':
+    resolution: {integrity: sha512-K2dSKTKfmdh78uJ3NcWFiqyRrimfdinS5ErLSn3vluHNeHVnBAFWC8a4X5N+7FgVE1EjXS1QDZbpqZBjfrqMTQ==}
+    engines: {node: '>=18'}
+    cpu: [s390x]
+    os: [linux]
+
+  '@esbuild/linux-x64@0.25.5':
+    resolution: {integrity: sha512-uhj8N2obKTE6pSZ+aMUbqq+1nXxNjZIIjCjGLfsWvVpy7gKCOL6rsY1MhRh9zLtUtAI7vpgLMK6DxjO8Qm9lJw==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [linux]
+
+  '@esbuild/netbsd-arm64@0.25.5':
+    resolution: {integrity: sha512-pwHtMP9viAy1oHPvgxtOv+OkduK5ugofNTVDilIzBLpoWAM16r7b/mxBvfpuQDpRQFMfuVr5aLcn4yveGvBZvw==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [netbsd]
+
+  '@esbuild/netbsd-x64@0.25.5':
+    resolution: {integrity: sha512-WOb5fKrvVTRMfWFNCroYWWklbnXH0Q5rZppjq0vQIdlsQKuw6mdSihwSo4RV/YdQ5UCKKvBy7/0ZZYLBZKIbwQ==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [netbsd]
+
+  '@esbuild/openbsd-arm64@0.25.5':
+    resolution: {integrity: sha512-7A208+uQKgTxHd0G0uqZO8UjK2R0DDb4fDmERtARjSHWxqMTye4Erz4zZafx7Di9Cv+lNHYuncAkiGFySoD+Mw==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [openbsd]
+
+  '@esbuild/openbsd-x64@0.25.5':
+    resolution: {integrity: sha512-G4hE405ErTWraiZ8UiSoesH8DaCsMm0Cay4fsFWOOUcz8b8rC6uCvnagr+gnioEjWn0wC+o1/TAHt+It+MpIMg==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [openbsd]
+
+  '@esbuild/sunos-x64@0.25.5':
+    resolution: {integrity: sha512-l+azKShMy7FxzY0Rj4RCt5VD/q8mG/e+mDivgspo+yL8zW7qEwctQ6YqKX34DTEleFAvCIUviCFX1SDZRSyMQA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [sunos]
+
+  '@esbuild/win32-arm64@0.25.5':
+    resolution: {integrity: sha512-O2S7SNZzdcFG7eFKgvwUEZ2VG9D/sn/eIiz8XRZ1Q/DO5a3s76Xv0mdBzVM5j5R639lXQmPmSo0iRpHqUUrsxw==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [win32]
+
+  '@esbuild/win32-ia32@0.25.5':
+    resolution: {integrity: sha512-onOJ02pqs9h1iMJ1PQphR+VZv8qBMQ77Klcsqv9CNW2w6yLqoURLcgERAIurY6QE63bbLuqgP9ATqajFLK5AMQ==}
+    engines: {node: '>=18'}
+    cpu: [ia32]
+    os: [win32]
+
+  '@esbuild/win32-x64@0.25.5':
+    resolution: {integrity: sha512-TXv6YnJ8ZMVdX+SXWVBo/0p8LTcrUYngpWjvm91TMjjBQii7Oz11Lw5lbDV5Y0TzuhSJHwiH4hEtC1I42mMS0g==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [win32]
+
+  '@img/sharp-darwin-arm64@0.33.5':
+    resolution: {integrity: sha512-UT4p+iz/2H4twwAoLCqfA9UH5pI6DggwKEGuaPy7nCVQ8ZsiY5PIcrRvD1DzuY3qYL07NtIQcWnBSY/heikIFQ==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@img/sharp-darwin-x64@0.33.5':
+    resolution: {integrity: sha512-fyHac4jIc1ANYGRDxtiqelIbdWkIuQaI84Mv45KvGRRxSAa7o7d1ZKAOBaYbnepLC1WqxfpimdeWfvqqSGwR2Q==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [darwin]
+
+  '@img/sharp-libvips-darwin-arm64@1.0.4':
+    resolution: {integrity: sha512-XblONe153h0O2zuFfTAbQYAX2JhYmDHeWikp1LM9Hul9gVPjFY427k6dFEcOL72O01QxQsWi761svJ/ev9xEDg==}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@img/sharp-libvips-darwin-x64@1.0.4':
+    resolution: {integrity: sha512-xnGR8YuZYfJGmWPvmlunFaWJsb9T/AO2ykoP3Fz/0X5XV2aoYBPkX6xqCQvUTKKiLddarLaxpzNe+b1hjeWHAQ==}
+    cpu: [x64]
+    os: [darwin]
+
+  '@img/sharp-libvips-linux-arm64@1.0.4':
+    resolution: {integrity: sha512-9B+taZ8DlyyqzZQnoeIvDVR/2F4EbMepXMc/NdVbkzsJbzkUjhXv/70GQJ7tdLA4YJgNP25zukcxpX2/SueNrA==}
+    cpu: [arm64]
+    os: [linux]
+
+  '@img/sharp-libvips-linux-arm@1.0.5':
+    resolution: {integrity: sha512-gvcC4ACAOPRNATg/ov8/MnbxFDJqf/pDePbBnuBDcjsI8PssmjoKMAz4LtLaVi+OnSb5FK/yIOamqDwGmXW32g==}
+    cpu: [arm]
+    os: [linux]
+
+  '@img/sharp-libvips-linux-s390x@1.0.4':
+    resolution: {integrity: sha512-u7Wz6ntiSSgGSGcjZ55im6uvTrOxSIS8/dgoVMoiGE9I6JAfU50yH5BoDlYA1tcuGS7g/QNtetJnxA6QEsCVTA==}
+    cpu: [s390x]
+    os: [linux]
+
+  '@img/sharp-libvips-linux-x64@1.0.4':
+    resolution: {integrity: sha512-MmWmQ3iPFZr0Iev+BAgVMb3ZyC4KeFc3jFxnNbEPas60e1cIfevbtuyf9nDGIzOaW9PdnDciJm+wFFaTlj5xYw==}
+    cpu: [x64]
+    os: [linux]
+
+  '@img/sharp-libvips-linuxmusl-arm64@1.0.4':
+    resolution: {integrity: sha512-9Ti+BbTYDcsbp4wfYib8Ctm1ilkugkA/uscUn6UXK1ldpC1JjiXbLfFZtRlBhjPZ5o1NCLiDbg8fhUPKStHoTA==}
+    cpu: [arm64]
+    os: [linux]
+
+  '@img/sharp-libvips-linuxmusl-x64@1.0.4':
+    resolution: {integrity: sha512-viYN1KX9m+/hGkJtvYYp+CCLgnJXwiQB39damAO7WMdKWlIhmYTfHjwSbQeUK/20vY154mwezd9HflVFM1wVSw==}
+    cpu: [x64]
+    os: [linux]
+
+  '@img/sharp-linux-arm64@0.33.5':
+    resolution: {integrity: sha512-JMVv+AMRyGOHtO1RFBiJy/MBsgz0x4AWrT6QoEVVTyh1E39TrCUpTRI7mx9VksGX4awWASxqCYLCV4wBZHAYxA==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm64]
+    os: [linux]
+
+  '@img/sharp-linux-arm@0.33.5':
+    resolution: {integrity: sha512-JTS1eldqZbJxjvKaAkxhZmBqPRGmxgu+qFKSInv8moZ2AmT5Yib3EQ1c6gp493HvrvV8QgdOXdyaIBrhvFhBMQ==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm]
+    os: [linux]
+
+  '@img/sharp-linux-s390x@0.33.5':
+    resolution: {integrity: sha512-y/5PCd+mP4CA/sPDKl2961b+C9d+vPAveS33s6Z3zfASk2j5upL6fXVPZi7ztePZ5CuH+1kW8JtvxgbuXHRa4Q==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [s390x]
+    os: [linux]
+
+  '@img/sharp-linux-x64@0.33.5':
+    resolution: {integrity: sha512-opC+Ok5pRNAzuvq1AG0ar+1owsu842/Ab+4qvU879ippJBHvyY5n2mxF1izXqkPYlGuP/M556uh53jRLJmzTWA==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [linux]
+
+  '@img/sharp-linuxmusl-arm64@0.33.5':
+    resolution: {integrity: sha512-XrHMZwGQGvJg2V/oRSUfSAfjfPxO+4DkiRh6p2AFjLQztWUuY/o8Mq0eMQVIY7HJ1CDQUJlxGGZRw1a5bqmd1g==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm64]
+    os: [linux]
+
+  '@img/sharp-linuxmusl-x64@0.33.5':
+    resolution: {integrity: sha512-WT+d/cgqKkkKySYmqoZ8y3pxx7lx9vVejxW/W4DOFMYVSkErR+w7mf2u8m/y4+xHe7yY9DAXQMWQhpnMuFfScw==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [linux]
+
+  '@img/sharp-wasm32@0.33.5':
+    resolution: {integrity: sha512-ykUW4LVGaMcU9lu9thv85CbRMAwfeadCJHRsg2GmeRa/cJxsVY9Rbd57JcMxBkKHag5U/x7TSBpScF4U8ElVzg==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [wasm32]
+
+  '@img/sharp-win32-ia32@0.33.5':
+    resolution: {integrity: sha512-T36PblLaTwuVJ/zw/LaH0PdZkRz5rd3SmMHX8GSmR7vtNSP5Z6bQkExdSK7xGWyxLw4sUknBuugTelgw2faBbQ==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [ia32]
+    os: [win32]
+
+  '@img/sharp-win32-x64@0.33.5':
+    resolution: {integrity: sha512-MpY/o8/8kj+EcnxwvrP4aTJSWw/aZ7JIGR4aBeZkZw5B7/Jn+tY9/VNwtcoGmdT7GfggGIU4kygOMSbYnOrAbg==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [win32]
+
+  '@jridgewell/sourcemap-codec@1.5.0':
+    resolution: {integrity: sha512-gv3ZRaISU3fjPAgNsriBRqGWQL6quFx04YMPW/zD8XMLsU32mhCCbfbO6KZFLjvYpCZ8zyDEgqsgf+PwPaM7GQ==}
+
+  '@keyv/serialize@1.0.3':
+    resolution: {integrity: sha512-qnEovoOp5Np2JDGonIDL6Ayihw0RhnRh6vxPuHo4RDn1UOzwEo4AeIfpL6UGIrsceWrCMiVPgwRjbHu4vYFc3g==}
+
+  '@linwooddev/style@0.4.2':
+    resolution: {integrity: sha512-ZYDdLnl7D8ttJ9lA3BdZtBw7pCkfwF3EEJ3bCmTibP/10ESQl+RPEUbmKbihudYA+6bX65bZIr4Yaimyh7i15w==}
+
+  '@oslojs/encoding@1.1.0':
+    resolution: {integrity: sha512-70wQhgYmndg4GCPxPPxPGevRKqTIJ2Nh4OkiMWmDAVYsTQ+Ta7Sq+rPevXyXGdzr30/qZBnyOalCszoMxlyldQ==}
+
+  '@rollup/pluginutils@5.1.4':
+    resolution: {integrity: sha512-USm05zrsFxYLPdWWq+K3STlWiT/3ELn3RcV5hJMghpeAIhxfsUIg6mt12CBJBInWMV4VneoV7SfGv8xIwo2qNQ==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^1.20.0||^2.0.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/rollup-android-arm-eabi@4.43.0':
+    resolution: {integrity: sha512-Krjy9awJl6rKbruhQDgivNbD1WuLb8xAclM4IR4cN5pHGAs2oIMMQJEiC3IC/9TZJ+QZkmZhlMO/6MBGxPidpw==}
+    cpu: [arm]
+    os: [android]
+
+  '@rollup/rollup-android-arm64@4.43.0':
+    resolution: {integrity: sha512-ss4YJwRt5I63454Rpj+mXCXicakdFmKnUNxr1dLK+5rv5FJgAxnN7s31a5VchRYxCFWdmnDWKd0wbAdTr0J5EA==}
+    cpu: [arm64]
+    os: [android]
+
+  '@rollup/rollup-darwin-arm64@4.43.0':
+    resolution: {integrity: sha512-eKoL8ykZ7zz8MjgBenEF2OoTNFAPFz1/lyJ5UmmFSz5jW+7XbH1+MAgCVHy72aG59rbuQLcJeiMrP8qP5d/N0A==}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@rollup/rollup-darwin-x64@4.43.0':
+    resolution: {integrity: sha512-SYwXJgaBYW33Wi/q4ubN+ldWC4DzQY62S4Ll2dgfr/dbPoF50dlQwEaEHSKrQdSjC6oIe1WgzosoaNoHCdNuMg==}
+    cpu: [x64]
+    os: [darwin]
+
+  '@rollup/rollup-freebsd-arm64@4.43.0':
+    resolution: {integrity: sha512-SV+U5sSo0yujrjzBF7/YidieK2iF6E7MdF6EbYxNz94lA+R0wKl3SiixGyG/9Klab6uNBIqsN7j4Y/Fya7wAjQ==}
+    cpu: [arm64]
+    os: [freebsd]
+
+  '@rollup/rollup-freebsd-x64@4.43.0':
+    resolution: {integrity: sha512-J7uCsiV13L/VOeHJBo5SjasKiGxJ0g+nQTrBkAsmQBIdil3KhPnSE9GnRon4ejX1XDdsmK/l30IYLiAaQEO0Cg==}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@rollup/rollup-linux-arm-gnueabihf@4.43.0':
+    resolution: {integrity: sha512-gTJ/JnnjCMc15uwB10TTATBEhK9meBIY+gXP4s0sHD1zHOaIh4Dmy1X9wup18IiY9tTNk5gJc4yx9ctj/fjrIw==}
+    cpu: [arm]
+    os: [linux]
+
+  '@rollup/rollup-linux-arm-musleabihf@4.43.0':
+    resolution: {integrity: sha512-ZJ3gZynL1LDSIvRfz0qXtTNs56n5DI2Mq+WACWZ7yGHFUEirHBRt7fyIk0NsCKhmRhn7WAcjgSkSVVxKlPNFFw==}
+    cpu: [arm]
+    os: [linux]
+
+  '@rollup/rollup-linux-arm64-gnu@4.43.0':
+    resolution: {integrity: sha512-8FnkipasmOOSSlfucGYEu58U8cxEdhziKjPD2FIa0ONVMxvl/hmONtX/7y4vGjdUhjcTHlKlDhw3H9t98fPvyA==}
+    cpu: [arm64]
+    os: [linux]
+
+  '@rollup/rollup-linux-arm64-musl@4.43.0':
+    resolution: {integrity: sha512-KPPyAdlcIZ6S9C3S2cndXDkV0Bb1OSMsX0Eelr2Bay4EsF9yi9u9uzc9RniK3mcUGCLhWY9oLr6er80P5DE6XA==}
+    cpu: [arm64]
+    os: [linux]
+
+  '@rollup/rollup-linux-loongarch64-gnu@4.43.0':
+    resolution: {integrity: sha512-HPGDIH0/ZzAZjvtlXj6g+KDQ9ZMHfSP553za7o2Odegb/BEfwJcR0Sw0RLNpQ9nC6Gy8s+3mSS9xjZ0n3rhcYg==}
+    cpu: [loong64]
+    os: [linux]
+
+  '@rollup/rollup-linux-powerpc64le-gnu@4.43.0':
+    resolution: {integrity: sha512-gEmwbOws4U4GLAJDhhtSPWPXUzDfMRedT3hFMyRAvM9Mrnj+dJIFIeL7otsv2WF3D7GrV0GIewW0y28dOYWkmw==}
+    cpu: [ppc64]
+    os: [linux]
+
+  '@rollup/rollup-linux-riscv64-gnu@4.43.0':
+    resolution: {integrity: sha512-XXKvo2e+wFtXZF/9xoWohHg+MuRnvO29TI5Hqe9xwN5uN8NKUYy7tXUG3EZAlfchufNCTHNGjEx7uN78KsBo0g==}
+    cpu: [riscv64]
+    os: [linux]
+
+  '@rollup/rollup-linux-riscv64-musl@4.43.0':
+    resolution: {integrity: sha512-ruf3hPWhjw6uDFsOAzmbNIvlXFXlBQ4nk57Sec8E8rUxs/AI4HD6xmiiasOOx/3QxS2f5eQMKTAwk7KHwpzr/Q==}
+    cpu: [riscv64]
+    os: [linux]
+
+  '@rollup/rollup-linux-s390x-gnu@4.43.0':
+    resolution: {integrity: sha512-QmNIAqDiEMEvFV15rsSnjoSmO0+eJLoKRD9EAa9rrYNwO/XRCtOGM3A5A0X+wmG+XRrw9Fxdsw+LnyYiZWWcVw==}
+    cpu: [s390x]
+    os: [linux]
+
+  '@rollup/rollup-linux-x64-gnu@4.43.0':
+    resolution: {integrity: sha512-jAHr/S0iiBtFyzjhOkAics/2SrXE092qyqEg96e90L3t9Op8OTzS6+IX0Fy5wCt2+KqeHAkti+eitV0wvblEoQ==}
+    cpu: [x64]
+    os: [linux]
+
+  '@rollup/rollup-linux-x64-musl@4.43.0':
+    resolution: {integrity: sha512-3yATWgdeXyuHtBhrLt98w+5fKurdqvs8B53LaoKD7P7H7FKOONLsBVMNl9ghPQZQuYcceV5CDyPfyfGpMWD9mQ==}
+    cpu: [x64]
+    os: [linux]
+
+  '@rollup/rollup-win32-arm64-msvc@4.43.0':
+    resolution: {integrity: sha512-wVzXp2qDSCOpcBCT5WRWLmpJRIzv23valvcTwMHEobkjippNf+C3ys/+wf07poPkeNix0paTNemB2XrHr2TnGw==}
+    cpu: [arm64]
+    os: [win32]
+
+  '@rollup/rollup-win32-ia32-msvc@4.43.0':
+    resolution: {integrity: sha512-fYCTEyzf8d+7diCw8b+asvWDCLMjsCEA8alvtAutqJOJp/wL5hs1rWSqJ1vkjgW0L2NB4bsYJrpKkiIPRR9dvw==}
+    cpu: [ia32]
+    os: [win32]
+
+  '@rollup/rollup-win32-x64-msvc@4.43.0':
+    resolution: {integrity: sha512-SnGhLiE5rlK0ofq8kzuDkM0g7FN1s5VYY+YSMTibP7CqShxCQvqtNxTARS4xX4PFJfHjG0ZQYX9iGzI3FQh5Aw==}
+    cpu: [x64]
+    os: [win32]
+
+  '@shikijs/core@3.6.0':
+    resolution: {integrity: sha512-9By7Xb3olEX0o6UeJyPLI1PE1scC4d3wcVepvtv2xbuN9/IThYN4Wcwh24rcFeASzPam11MCq8yQpwwzCgSBRw==}
+
+  '@shikijs/engine-javascript@3.6.0':
+    resolution: {integrity: sha512-7YnLhZG/TU05IHMG14QaLvTW/9WiK8SEYafceccHUSXs2Qr5vJibUwsDfXDLmRi0zHdzsxrGKpSX6hnqe0k8nA==}
+
+  '@shikijs/engine-oniguruma@3.6.0':
+    resolution: {integrity: sha512-nmOhIZ9yT3Grd+2plmW/d8+vZ2pcQmo/UnVwXMUXAKTXdi+LK0S08Ancrz5tQQPkxvjBalpMW2aKvwXfelauvA==}
+
+  '@shikijs/langs@3.6.0':
+    resolution: {integrity: sha512-IdZkQJaLBu1LCYCwkr30hNuSDfllOT8RWYVZK1tD2J03DkiagYKRxj/pDSl8Didml3xxuyzUjgtioInwEQM/TA==}
+
+  '@shikijs/themes@3.6.0':
+    resolution: {integrity: sha512-Fq2j4nWr1DF4drvmhqKq8x5vVQ27VncF8XZMBuHuQMZvUSS3NBgpqfwz/FoGe36+W6PvniZ1yDlg2d4kmYDU6w==}
+
+  '@shikijs/types@3.6.0':
+    resolution: {integrity: sha512-cLWFiToxYu0aAzJqhXTQsFiJRTFDAGl93IrMSBNaGSzs7ixkLfdG6pH11HipuWFGW5vyx4X47W8HDQ7eSrmBUg==}
+
+  '@shikijs/vscode-textmate@10.0.2':
+    resolution: {integrity: sha512-83yeghZ2xxin3Nj8z1NMd/NCuca+gsYXswywDy5bHvwlWL8tpTQmzGeUuHd9FC3E/SBEMvzJRwWEOz5gGes9Qg==}
+
+  '@swc/helpers@0.5.17':
+    resolution: {integrity: sha512-5IKx/Y13RsYd+sauPb2x+U/xZikHjolzfuDgTAl/Tdf3Q8rslRvC19NKDLgAJQ6wsqADk10ntlv08nPFw/gO/A==}
+
+  '@types/debug@4.1.12':
+    resolution: {integrity: sha512-vIChWdVG3LG1SMxEvI/AK+FWJthlrqlTu7fbrlywTkkaONwk/UAGaULXRlf8vkzFBLVm0zkMdCquhL5aOjhXPQ==}
+
+  '@types/estree@1.0.7':
+    resolution: {integrity: sha512-w28IoSUCJpidD/TGviZwwMJckNESJZXFu7NBZ5YJ4mEUnNraUn9Pm8HSZm/jDF1pDWYKspWE7oVphigUPRakIQ==}
+
+  '@types/estree@1.0.8':
+    resolution: {integrity: sha512-dWHzHa2WqEXI/O1E9OjrocMTKJl2mSrEolh1Iomrv6U+JuNwaHXsXx9bLu5gG7BUWFIN0skIQJQ/L1rIex4X6w==}
+
+  '@types/fontkit@2.0.8':
+    resolution: {integrity: sha512-wN+8bYxIpJf+5oZdrdtaX04qUuWHcKxcDEgRS9Qm9ZClSHjzEn13SxUC+5eRM+4yXIeTYk8mTzLAWGF64847ew==}
+
+  '@types/hast@3.0.4':
+    resolution: {integrity: sha512-WPs+bbQw5aCj+x6laNGWLH3wviHtoCv/P3+otBhbOhJgG8qtpdAMlTCxLtsTWA7LH1Oh/bFCHsBn0TPS5m30EQ==}
+
+  '@types/mdast@4.0.4':
+    resolution: {integrity: sha512-kGaNbPh1k7AFzgpud/gMdvIm5xuECykRR+JnWKQno9TAXVa6WIVCGTPvYGekIDL4uwCZQSYbUxNBSb1aUo79oA==}
+
+  '@types/ms@2.1.0':
+    resolution: {integrity: sha512-GsCCIZDE/p3i96vtEqx+7dBUGXrc7zeSK3wwPHIaRThS+9OhWIXRqzs4d6k1SVU8g91DrNRWxWUGhp5KXQb2VA==}
+
+  '@types/nlcst@2.0.3':
+    resolution: {integrity: sha512-vSYNSDe6Ix3q+6Z7ri9lyWqgGhJTmzRjZRqyq15N0Z/1/UnVsno9G/N40NBijoYx2seFDIl0+B2mgAb9mezUCA==}
+
+  '@types/node@24.0.1':
+    resolution: {integrity: sha512-MX4Zioh39chHlDJbKmEgydJDS3tspMP/lnQC67G3SWsTnb9NeYVWOjkxpOSy4oMfPs4StcWHwBrvUb4ybfnuaw==}
+
+  '@types/unist@3.0.3':
+    resolution: {integrity: sha512-ko/gIFJRv177XgZsZcBwnqJN5x/Gien8qNOn0D5bQU/zAzVf9Zt3BlcUiLqhV9y4ARk0GbT3tnUiPNgnTXzc/Q==}
+
+  '@ungap/structured-clone@1.3.0':
+    resolution: {integrity: sha512-WmoN8qaIAo7WTYWbAZuG8PYEhn5fkz7dZrqTBZ7dtt//lL2Gwms1IcnQ5yHqjDfX8Ft5j4YzDM23f87zBfDe9g==}
+
+  acorn@8.15.0:
+    resolution: {integrity: sha512-NZyJarBfL7nWwIq+FDL6Zp/yHEhePMNnnJ0y3qfieCrmNvYct8uvtiV41UvlSe6apAfk0fY1FbWx+NwfmpvtTg==}
+    engines: {node: '>=0.4.0'}
+    hasBin: true
+
+  ansi-align@3.0.1:
+    resolution: {integrity: sha512-IOfwwBF5iczOjp/WeY4YxyjqAFMQoZufdQWDd19SEExbVLNXqvpzSJ/M7Za4/sCPmQ0+GRquoA7bGcINcxew6w==}
+
+  ansi-regex@5.0.1:
+    resolution: {integrity: sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==}
+    engines: {node: '>=8'}
+
+  ansi-regex@6.1.0:
+    resolution: {integrity: sha512-7HSX4QQb4CspciLpVFwyRe79O3xsIZDDLER21kERQ71oaPodF8jL725AgJMFAYbooIqolJoRLuM81SpeUkpkvA==}
+    engines: {node: '>=12'}
+
+  ansi-styles@6.2.1:
+    resolution: {integrity: sha512-bN798gFfQX+viw3R7yrGWRqnrN2oRkEkUjjl4JNn4E8GxxbjtG3FbrEIIY3l8/hrwUwIeCZvi4QuOTP4MErVug==}
+    engines: {node: '>=12'}
+
+  anymatch@3.1.3:
+    resolution: {integrity: sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==}
+    engines: {node: '>= 8'}
+
+  argparse@2.0.1:
+    resolution: {integrity: sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==}
+
+  aria-query@5.3.2:
+    resolution: {integrity: sha512-COROpnaoap1E2F000S62r6A60uHZnmlvomhfyT2DlTcrY1OrBKn2UhH7qn5wTC9zMvD0AY7csdPSNwKP+7WiQw==}
+    engines: {node: '>= 0.4'}
+
+  array-iterate@2.0.1:
+    resolution: {integrity: sha512-I1jXZMjAgCMmxT4qxXfPXa6SthSoE8h6gkSI9BGGNv8mP8G/v0blc+qFnZu6K42vTOiuME596QaLO0TP3Lk0xg==}
+
+  astro@5.9.3:
+    resolution: {integrity: sha512-VReZrpUa/3rfeiVvsQ1A2M3ujDPI+pDGIYOMtXPEZwut8tZoEyealXXLjitgCsJ+3dunKGZbg4Eak6i+r0vniw==}
+    engines: {node: 18.20.8 || ^20.3.0 || >=22.0.0, npm: '>=9.6.5', pnpm: '>=7.1.0'}
+    hasBin: true
+
+  axobject-query@4.1.0:
+    resolution: {integrity: sha512-qIj0G9wZbMGNLjLmg1PT6v2mE9AH2zlnADJD/2tC6E00hgmhUOfEB6greHPAfLRSufHqROIUTkw6E+M3lH0PTQ==}
+    engines: {node: '>= 0.4'}
+
+  bail@2.0.2:
+    resolution: {integrity: sha512-0xO6mYd7JB2YesxDKplafRpsiOzPt9V02ddPCLbY1xYGPOX24NTyN50qnUxgCPcSoYMhKpAuBTjQoRZCAkUDRw==}
+
+  base-64@1.0.0:
+    resolution: {integrity: sha512-kwDPIFCGx0NZHog36dj+tHiwP4QMzsZ3AgMViUBKI0+V5n4U0ufTCUMhnQ04diaRI8EX/QcPfql7zlhZ7j4zgg==}
+
+  base64-js@1.5.1:
+    resolution: {integrity: sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==}
+
+  blob-to-buffer@1.2.9:
+    resolution: {integrity: sha512-BF033y5fN6OCofD3vgHmNtwZWRcq9NLyyxyILx9hfMy1sXYy4ojFl765hJ2lP0YaN2fuxPaLO2Vzzoxy0FLFFA==}
+
+  boxen@8.0.1:
+    resolution: {integrity: sha512-F3PH5k5juxom4xktynS7MoFY+NUWH5LC4CnH11YB8NPew+HLpmBLCybSAEyb2F+4pRXhuhWqFesoQd6DAyc2hw==}
+    engines: {node: '>=18'}
+
+  brotli@1.3.3:
+    resolution: {integrity: sha512-oTKjJdShmDuGW94SyyaoQvAjf30dZaHnjJ8uAF+u2/vGJkJbJPJAT1gDiOJP5v1Zb6f9KEyW/1HpuaWIXtGHPg==}
+
+  buffer@6.0.3:
+    resolution: {integrity: sha512-FTiCpNxtwiZZHEZbcbTIcZjERVICn9yq/pDFkTl95/AxzD1naBctN7YO68riM/gLSDY7sdrMby8hofADYuuqOA==}
+
+  cacheable@1.10.0:
+    resolution: {integrity: sha512-SSgQTAnhd7WlJXnGlIi4jJJOiHzgnM5wRMEPaXAU4kECTAMpBoYKoZ9i5zHmclIEZbxcu3j7yY/CF8DTmwIsHg==}
+
+  camelcase@8.0.0:
+    resolution: {integrity: sha512-8WB3Jcas3swSvjIeA2yvCJ+Miyz5l1ZmB6HFb9R1317dt9LCQoswg/BGrmAmkWVEszSrrg4RwmO46qIm2OEnSA==}
+    engines: {node: '>=16'}
+
+  ccount@2.0.1:
+    resolution: {integrity: sha512-eyrF0jiFpY+3drT6383f1qhkbGsLSifNAjA61IUjZjmLCWjItY6LB9ft9YhoDgwfmclB2zhu51Lc7+95b8NRAg==}
+
+  chalk@5.4.1:
+    resolution: {integrity: sha512-zgVZuo2WcZgfUEmsn6eO3kINexW8RAE4maiQ8QNs8CtpPCSyMiYsULR3HQYkm3w8FIA3SberyMJMSldGsW+U3w==}
+    engines: {node: ^12.17.0 || ^14.13 || >=16.0.0}
+
+  character-entities-html4@2.1.0:
+    resolution: {integrity: sha512-1v7fgQRj6hnSwFpq1Eu0ynr/CDEw0rXo2B61qXrLNdHZmPKgb7fqS1a2JwF0rISo9q77jDI8VMEHoApn8qDoZA==}
+
+  character-entities-legacy@3.0.0:
+    resolution: {integrity: sha512-RpPp0asT/6ufRm//AJVwpViZbGM/MkjQFxJccQRHmISF/22NBtsHqAWmL+/pmkPWoIUJdWyeVleTl1wydHATVQ==}
+
+  character-entities@2.0.2:
+    resolution: {integrity: sha512-shx7oQ0Awen/BRIdkjkvz54PnEEI/EjwXDSIZp86/KKdbafHh1Df/RYGBhn4hbe2+uKC9FnT5UCEdyPz3ai9hQ==}
+
+  chokidar@4.0.3:
+    resolution: {integrity: sha512-Qgzu8kfBvo+cA4962jnP1KkS6Dop5NS6g7R5LFYJr4b8Ub94PPQXUksCw9PvXoeXPRRddRNC5C1JQUR2SMGtnA==}
+    engines: {node: '>= 14.16.0'}
+
+  ci-info@4.2.0:
+    resolution: {integrity: sha512-cYY9mypksY8NRqgDB1XD1RiJL338v/551niynFTGkZOO2LHuB2OmOYxDIe/ttN9AHwrqdum1360G3ald0W9kCg==}
+    engines: {node: '>=8'}
+
+  cli-boxes@3.0.0:
+    resolution: {integrity: sha512-/lzGpEWL/8PfI0BmBOPRwp0c/wFNX1RdUML3jK/RcSBA9T8mZDdQpqYBKtCFTOfQbwPqWEOpjqW+Fnayc0969g==}
+    engines: {node: '>=10'}
+
+  clone@2.1.2:
+    resolution: {integrity: sha512-3Pe/CF1Nn94hyhIYpjtiLhdCoEoz0DqQ+988E9gmeEdQZlojxnOb74wctFyuwWQHzqyf9X7C7MG8juUpqBJT8w==}
+    engines: {node: '>=0.8'}
+
+  clsx@2.1.1:
+    resolution: {integrity: sha512-eYm0QWBtUrBWZWG0d386OGAw16Z995PiOVo2B7bjWSbHedGl5e0ZWaq65kOGgUSNesEIDkB9ISbTg/JK9dhCZA==}
+    engines: {node: '>=6'}
+
+  color-convert@2.0.1:
+    resolution: {integrity: sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==}
+    engines: {node: '>=7.0.0'}
+
+  color-name@1.1.4:
+    resolution: {integrity: sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==}
+
+  color-string@1.9.1:
+    resolution: {integrity: sha512-shrVawQFojnZv6xM40anx4CkoDP+fZsw/ZerEMsW/pyzsRbElpsL/DBVW7q3ExxwusdNXI3lXpuhEZkzs8p5Eg==}
+
+  color@4.2.3:
+    resolution: {integrity: sha512-1rXeuUUiGGrykh+CeBdu5Ie7OJwinCgQY0bc7GCRxy5xVHy+moaqkpL/jqQq0MtQOeYcrqEz4abc5f0KtU7W4A==}
+    engines: {node: '>=12.5.0'}
+
+  comma-separated-tokens@2.0.3:
+    resolution: {integrity: sha512-Fu4hJdvzeylCfQPp9SGWidpzrMs7tTrlu6Vb8XGaRGck8QSNZJJp538Wrb60Lax4fPwR64ViY468OIUTbRlGZg==}
+
+  common-ancestor-path@1.0.1:
+    resolution: {integrity: sha512-L3sHRo1pXXEqX8VU28kfgUY+YGsk09hPqZiZmLacNib6XNTCM8ubYeT7ryXQw8asB1sKgcU5lkB7ONug08aB8w==}
+
+  cookie-es@1.2.2:
+    resolution: {integrity: sha512-+W7VmiVINB+ywl1HGXJXmrqkOhpKrIiVZV6tQuV54ZyQC7MMuBt81Vc336GMLoHBq5hV/F9eXgt5Mnx0Rha5Fg==}
+
+  cookie@1.0.2:
+    resolution: {integrity: sha512-9Kr/j4O16ISv8zBBhJoi4bXOYNTkFLOqSL3UDB0njXxCXNezjeyVrJyGOWtgfs/q2km1gwBcfH8q1yEGoMYunA==}
+    engines: {node: '>=18'}
+
+  cross-fetch@3.2.0:
+    resolution: {integrity: sha512-Q+xVJLoGOeIMXZmbUK4HYk+69cQH6LudR0Vu/pRm2YlU/hDV9CiS0gKUMaWY5f2NeUH9C1nV3bsTlCo0FsTV1Q==}
+
+  crossws@0.3.5:
+    resolution: {integrity: sha512-ojKiDvcmByhwa8YYqbQI/hg7MEU0NC03+pSdEq4ZUnZR9xXpwk7E43SMNGkn+JxJGPFtNvQ48+vV2p+P1ml5PA==}
+
+  css-tree@3.1.0:
+    resolution: {integrity: sha512-0eW44TGN5SQXU1mWSkKwFstI/22X2bG1nYzZTYMAWjylYURhse752YgbE4Cx46AC+bAvI+/dYTPRk1LqSUnu6w==}
+    engines: {node: ^10 || ^12.20.0 || ^14.13.0 || >=15.0.0}
+
+  cssesc@3.0.0:
+    resolution: {integrity: sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==}
+    engines: {node: '>=4'}
+    hasBin: true
+
+  debug@4.4.1:
+    resolution: {integrity: sha512-KcKCqiftBJcZr++7ykoDIEwSa3XWowTfNPo92BYxjXiyYEVrUQh2aLyhxBCwww+heortUFxEJYcRzosstTEBYQ==}
+    engines: {node: '>=6.0'}
+    peerDependencies:
+      supports-color: '*'
+    peerDependenciesMeta:
+      supports-color:
+        optional: true
+
+  decode-named-character-reference@1.2.0:
+    resolution: {integrity: sha512-c6fcElNV6ShtZXmsgNgFFV5tVX2PaV4g+MOAkb8eXHvn6sryJBrZa9r0zV6+dtTyoCKxtDy5tyQ5ZwQuidtd+Q==}
+
+  defu@6.1.4:
+    resolution: {integrity: sha512-mEQCMmwJu317oSz8CwdIOdwf3xMif1ttiM8LTufzc3g6kR+9Pe236twL8j3IYT1F7GfRgGcW6MWxzZjLIkuHIg==}
+
+  depd@2.0.0:
+    resolution: {integrity: sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==}
+    engines: {node: '>= 0.8'}
+
+  dequal@2.0.3:
+    resolution: {integrity: sha512-0je+qPKHEMohvfRTCEo3CrPG6cAzAYgmzKyxRiYSSDkS6eGJdyVJm7WaYA5ECaAD9wLB2T4EEeymA5aFVcYXCA==}
+    engines: {node: '>=6'}
+
+  destr@2.0.5:
+    resolution: {integrity: sha512-ugFTXCtDZunbzasqBxrK93Ik/DRYsO6S/fedkWEMKqt04xZ4csmnmwGDBAb07QWNaGMAmnTIemsYZCksjATwsA==}
+
+  detect-libc@2.0.4:
+    resolution: {integrity: sha512-3UDv+G9CsCKO1WKMGw9fwq/SWJYbI0c5Y7LU1AXYoDdbhE2AHQ6N6Nb34sG8Fj7T5APy8qXDCKuuIHd1BR0tVA==}
+    engines: {node: '>=8'}
+
+  deterministic-object-hash@2.0.2:
+    resolution: {integrity: sha512-KxektNH63SrbfUyDiwXqRb1rLwKt33AmMv+5Nhsw1kqZ13SJBRTgZHtGbE+hH3a1mVW1cz+4pqSWVPAtLVXTzQ==}
+    engines: {node: '>=18'}
+
+  devalue@5.1.1:
+    resolution: {integrity: sha512-maua5KUiapvEwiEAe+XnlZ3Rh0GD+qI1J/nb9vrJc3muPXvcF/8gXYTWF76+5DAqHyDUtOIImEuo0YKE9mshVw==}
+
+  devlop@1.1.0:
+    resolution: {integrity: sha512-RWmIqhcFf1lRYBvNmr7qTNuyCt/7/ns2jbpp1+PalgE/rDQcBT0fioSMUpJ93irlUhC5hrg4cYqe6U+0ImW0rA==}
+
+  dfa@1.2.0:
+    resolution: {integrity: sha512-ED3jP8saaweFTjeGX8HQPjeC1YYyZs98jGNZx6IiBvxW7JG5v492kamAQB3m2wop07CvU/RQmzcKr6bgcC5D/Q==}
+
+  diff@5.2.0:
+    resolution: {integrity: sha512-uIFDxqpRZGZ6ThOk84hEfqWoHx2devRFvpTZcTHur85vImfaxUbTW9Ryh4CpCuDnToOP1CEtXKIgytHBPVff5A==}
+    engines: {node: '>=0.3.1'}
+
+  dlv@1.1.3:
+    resolution: {integrity: sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA==}
+
+  dset@3.1.4:
+    resolution: {integrity: sha512-2QF/g9/zTaPDc3BjNcVTGoBbXBgYfMTTceLaYcFJ/W9kggFUkhxD/hMEeuLKbugyef9SqAx8cpgwlIP/jinUTA==}
+    engines: {node: '>=4'}
+
+  ee-first@1.1.1:
+    resolution: {integrity: sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==}
+
+  emoji-regex@10.4.0:
+    resolution: {integrity: sha512-EC+0oUMY1Rqm4O6LLrgjtYDvcVYTy7chDnM4Q7030tP4Kwj3u/pR6gP9ygnp2CJMK5Gq+9Q2oqmrFJAz01DXjw==}
+
+  emoji-regex@8.0.0:
+    resolution: {integrity: sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==}
+
+  encodeurl@2.0.0:
+    resolution: {integrity: sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==}
+    engines: {node: '>= 0.8'}
+
+  entities@6.0.1:
+    resolution: {integrity: sha512-aN97NXWF6AWBTahfVOIrB/NShkzi5H7F9r1s9mD3cDj4Ko5f2qhhVoYMibXF7GlLveb/D2ioWay8lxI97Ven3g==}
+    engines: {node: '>=0.12'}
+
+  es-module-lexer@1.7.0:
+    resolution: {integrity: sha512-jEQoCwk8hyb2AZziIOLhDqpm5+2ww5uIE6lkO/6jcOCusfk6LhMHpXXfBLXTZ7Ydyt0j4VoUQv6uGNYbdW+kBA==}
+
+  esbuild@0.25.5:
+    resolution: {integrity: sha512-P8OtKZRv/5J5hhz0cUAdu/cLuPIKXpQl1R9pZtvmHWQvrAUVd0UNIPT4IB4W3rNOqVO0rlqHmCIbSwxh/c9yUQ==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  escape-html@1.0.3:
+    resolution: {integrity: sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==}
+
+  escape-string-regexp@5.0.0:
+    resolution: {integrity: sha512-/veY75JbMK4j1yjvuUxuVsiS/hr/4iHs9FTT6cgTexxdE0Ly/glccBAkloH/DofkjRbZU3bnoj38mOmhkZ0lHw==}
+    engines: {node: '>=12'}
+
+  estree-walker@2.0.2:
+    resolution: {integrity: sha512-Rfkk/Mp/DL7JVje3u18FxFujQlTNR2q6QfMSMB7AvCBx91NGj/ba3kCfza0f6dVDbw7YlRf/nDrn7pQrCCyQ/w==}
+
+  estree-walker@3.0.3:
+    resolution: {integrity: sha512-7RUKfXgSMMkzt6ZuXmqapOurLGPPfgj6l9uRZ7lRGolvk0y2yocc35LdcxKC5PQZdn2DMqioAQ2NoWcrTKmm6g==}
+
+  etag@1.8.1:
+    resolution: {integrity: sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==}
+    engines: {node: '>= 0.6'}
+
+  eventemitter3@5.0.1:
+    resolution: {integrity: sha512-GWkBvjiSZK87ELrYOSESUYeVIc9mvLLf/nXalMOS5dYrgZq9o5OVkbZAVM06CVxYsCwH9BDZFPlQTlPA1j4ahA==}
+
+  extend@3.0.2:
+    resolution: {integrity: sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==}
+
+  fast-deep-equal@3.1.3:
+    resolution: {integrity: sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==}
+
+  fdir@6.4.6:
+    resolution: {integrity: sha512-hiFoqpyZcfNm1yc4u8oWCf9A2c4D3QjCrks3zmoVKVxpQRzmPNar1hUJcBG2RQHvEVGDN+Jm81ZheVLAQMK6+w==}
+    peerDependencies:
+      picomatch: ^3 || ^4
+    peerDependenciesMeta:
+      picomatch:
+        optional: true
+
+  flattie@1.1.1:
+    resolution: {integrity: sha512-9UbaD6XdAL97+k/n+N7JwX46K/M6Zc6KcFYskrYL8wbBV/Uyk0CTAMY0VT+qiK5PM7AIc9aTWYtq65U7T+aCNQ==}
+    engines: {node: '>=8'}
+
+  fontace@0.3.0:
+    resolution: {integrity: sha512-czoqATrcnxgWb/nAkfyIrRp6Q8biYj7nGnL6zfhTcX+JKKpWHFBnb8uNMw/kZr7u++3Y3wYSYoZgHkCcsuBpBg==}
+
+  fontkit@2.0.4:
+    resolution: {integrity: sha512-syetQadaUEDNdxdugga9CpEYVaQIxOwk7GlwZWWZ19//qW4zE5bknOKeMBDYAASwnpaSHKJITRLMF9m1fp3s6g==}
+
+  fresh@2.0.0:
+    resolution: {integrity: sha512-Rx/WycZ60HOaqLKAi6cHRKKI7zxWbJ31MhntmtwMoaTeF7XFH9hhBp8vITaMidfljRQ6eYWCKkaTK+ykVJHP2A==}
+    engines: {node: '>= 0.8'}
+
+  fsevents@2.3.3:
+    resolution: {integrity: sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==}
+    engines: {node: ^8.16.0 || ^10.6.0 || >=11.0.0}
+    os: [darwin]
+
+  get-east-asian-width@1.3.0:
+    resolution: {integrity: sha512-vpeMIQKxczTD/0s2CdEWHcb0eeJe6TFjxb+J5xgX7hScxqrGuyjmv4c1D4A/gelKfyox0gJJwIHF+fLjeaM8kQ==}
+    engines: {node: '>=18'}
+
+  github-slugger@2.0.0:
+    resolution: {integrity: sha512-IaOQ9puYtjrkq7Y0Ygl9KDZnrf/aiUJYUpVf89y8kyaxbRG7Y1SrX/jaumrv81vc61+kiMempujsM3Yw7w5qcw==}
+
+  h3@1.15.3:
+    resolution: {integrity: sha512-z6GknHqyX0h9aQaTx22VZDf6QyZn+0Nh+Ym8O/u0SGSkyF5cuTJYKlc8MkzW3Nzf9LE1ivcpmYC3FUGpywhuUQ==}
+
+  hast-util-from-html@2.0.3:
+    resolution: {integrity: sha512-CUSRHXyKjzHov8yKsQjGOElXy/3EKpyX56ELnkHH34vDVw1N1XSQ1ZcAvTyAPtGqLTuKP/uxM+aLkSPqF/EtMw==}
+
+  hast-util-from-parse5@8.0.3:
+    resolution: {integrity: sha512-3kxEVkEKt0zvcZ3hCRYI8rqrgwtlIOFMWkbclACvjlDw8Li9S2hk/d51OI0nr/gIpdMHNepwgOKqZ/sy0Clpyg==}
+
+  hast-util-is-element@3.0.0:
+    resolution: {integrity: sha512-Val9mnv2IWpLbNPqc/pUem+a7Ipj2aHacCwgNfTiK0vJKl0LF+4Ba4+v1oPHFpf3bLYmreq0/l3Gud9S5OH42g==}
+
+  hast-util-parse-selector@4.0.0:
+    resolution: {integrity: sha512-wkQCkSYoOGCRKERFWcxMVMOcYE2K1AaNLU8DXS9arxnLOUEWbOXKXiJUNzEpqZ3JOKpnha3jkFrumEjVliDe7A==}
+
+  hast-util-raw@9.1.0:
+    resolution: {integrity: sha512-Y8/SBAHkZGoNkpzqqfCldijcuUKh7/su31kEBp67cFY09Wy0mTRgtsLYsiIxMJxlu0f6AA5SUTbDR8K0rxnbUw==}
+
+  hast-util-to-html@9.0.5:
+    resolution: {integrity: sha512-OguPdidb+fbHQSU4Q4ZiLKnzWo8Wwsf5bZfbvu7//a9oTYoqD/fWpe96NuHkoS9h0ccGOTe0C4NGXdtS0iObOw==}
+
+  hast-util-to-parse5@8.0.0:
+    resolution: {integrity: sha512-3KKrV5ZVI8if87DVSi1vDeByYrkGzg4mEfeu4alwgmmIeARiBLKCZS2uw5Gb6nU9x9Yufyj3iudm6i7nl52PFw==}
+
+  hast-util-to-text@4.0.2:
+    resolution: {integrity: sha512-KK6y/BN8lbaq654j7JgBydev7wuNMcID54lkRav1P0CaE1e47P72AWWPiGKXTJU271ooYzcvTAn/Zt0REnvc7A==}
+
+  hast-util-whitespace@3.0.0:
+    resolution: {integrity: sha512-88JUN06ipLwsnv+dVn+OIYOvAuvBMy/Qoi6O7mQHxdPXpjy+Cd6xRkWwux7DKO+4sYILtLBRIKgsdpS2gQc7qw==}
+
+  hastscript@9.0.1:
+    resolution: {integrity: sha512-g7df9rMFX/SPi34tyGCyUBREQoKkapwdY/T04Qn9TDWfHhAYt4/I0gMVirzK5wEzeUqIjEB+LXC/ypb7Aqno5w==}
+
+  hookified@1.9.1:
+    resolution: {integrity: sha512-u3pxtGhKjcSXnGm1CX6aXS9xew535j3lkOCegbA6jdyh0BaAjTbXI4aslKstCr6zUNtoCxFGFKwjbSHdGrMB8g==}
+
+  html-escaper@3.0.3:
+    resolution: {integrity: sha512-RuMffC89BOWQoY0WKGpIhn5gX3iI54O6nRA0yC124NYVtzjmFWBIiFd8M0x+ZdX0P9R4lADg1mgP8C7PxGOWuQ==}
+
+  html-void-elements@3.0.0:
+    resolution: {integrity: sha512-bEqo66MRXsUGxWHV5IP0PUiAWwoEjba4VCzg0LjFJBpchPaTfyfCKTG6bc5F8ucKec3q5y6qOdGyYTSBEvhCrg==}
+
+  http-cache-semantics@4.2.0:
+    resolution: {integrity: sha512-dTxcvPXqPvXBQpq5dUr6mEMJX4oIEFv6bwom3FDwKRDsuIjjJGANqhBuoAn9c1RQJIdAKav33ED65E2ys+87QQ==}
+
+  http-errors@2.0.0:
+    resolution: {integrity: sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==}
+    engines: {node: '>= 0.8'}
+
+  ieee754@1.2.1:
+    resolution: {integrity: sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==}
+
+  import-meta-resolve@4.1.0:
+    resolution: {integrity: sha512-I6fiaX09Xivtk+THaMfAwnA3MVA5Big1WHF1Dfx9hFuvNIWpXnorlkzhcQf6ehrqQiiZECRt1poOAkPmer3ruw==}
+
+  inherits@2.0.4:
+    resolution: {integrity: sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==}
+
+  iron-webcrypto@1.2.1:
+    resolution: {integrity: sha512-feOM6FaSr6rEABp/eDfVseKyTMDt+KGpeB35SkVn9Tyn0CqvVsY3EwI0v5i8nMHyJnzCIQf7nsy3p41TPkJZhg==}
+
+  is-arrayish@0.3.2:
+    resolution: {integrity: sha512-eVRqCvVlZbuw3GrM63ovNSNAeA1K16kaR/LRY/92w0zxQ5/1YzwblUX652i4Xs9RwAGjW9d9y6X88t8OaAJfWQ==}
+
+  is-docker@3.0.0:
+    resolution: {integrity: sha512-eljcgEDlEns/7AXFosB5K/2nCM4P7FQPkGc/DWLy5rmFEWvZayGrik1d9/QIY5nJ4f9YsVvBkA6kJpHn9rISdQ==}
+    engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0}
+    hasBin: true
+
+  is-fullwidth-code-point@3.0.0:
+    resolution: {integrity: sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==}
+    engines: {node: '>=8'}
+
+  is-inside-container@1.0.0:
+    resolution: {integrity: sha512-KIYLCCJghfHZxqjYBE7rEy0OBuTd5xCHS7tHVgvCLkx7StIoaxwNW3hCALgEUjFfeRk+MG/Qxmp/vtETEF3tRA==}
+    engines: {node: '>=14.16'}
+    hasBin: true
+
+  is-plain-obj@4.1.0:
+    resolution: {integrity: sha512-+Pgi+vMuUNkJyExiMBt5IlFoMyKnr5zhJ4Uspz58WOhBF5QoIZkFyNHIbBAtHwzVAgk5RtndVNsDRN61/mmDqg==}
+    engines: {node: '>=12'}
+
+  is-wsl@3.1.0:
+    resolution: {integrity: sha512-UcVfVfaK4Sc4m7X3dUSoHoozQGBEFeDC+zVo06t98xe8CzHSZZBekNXH+tu0NalHolcJ/QAGqS46Hef7QXBIMw==}
+    engines: {node: '>=16'}
+
+  js-yaml@4.1.0:
+    resolution: {integrity: sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==}
+    hasBin: true
+
+  keyv@5.3.4:
+    resolution: {integrity: sha512-ypEvQvInNpUe+u+w8BIcPkQvEqXquyyibWE/1NB5T2BTzIpS5cGEV1LZskDzPSTvNAaT4+5FutvzlvnkxOSKlw==}
+
+  kleur@3.0.3:
+    resolution: {integrity: sha512-eTIzlVOSUR+JxdDFepEYcBMtZ9Qqdef+rnzWdRZuMbOywu5tO2w2N7rqjoANZ5k9vywhL6Br1VRjUIgTQx4E8w==}
+    engines: {node: '>=6'}
+
+  kleur@4.1.5:
+    resolution: {integrity: sha512-o+NO+8WrRiQEE4/7nwRJhN1HWpVmJm511pBHUxPLtp0BUISzlBplORYSmTclCnJvQq2tKu/sgl3xVpkc7ZWuQQ==}
+    engines: {node: '>=6'}
+
+  longest-streak@3.1.0:
+    resolution: {integrity: sha512-9Ri+o0JYgehTaVBBDoMqIl8GXtbWg711O3srftcHhZ0dqnETqLaoIK0x17fUw9rFSlK/0NlsKe0Ahhyl5pXE2g==}
+
+  lru-cache@10.4.3:
+    resolution: {integrity: sha512-JNAzZcXrCt42VGLuYz0zfAzDfAvJWW6AfYlDBQyDV5DClI2m5sAmK+OIO7s59XfsRsWHp02jAJrRadPRGTt6SQ==}
+
+  magic-string@0.30.17:
+    resolution: {integrity: sha512-sNPKHvyjVf7gyjwS4xGTaW/mCnF8wnjtifKBEhxfZ7E/S8tQ0rssrwGNn6q8JH/ohItJfSQp9mBtQYuTlH5QnA==}
+
+  magicast@0.3.5:
+    resolution: {integrity: sha512-L0WhttDl+2BOsybvEOLK7fW3UA0OQ0IQ2d6Zl2x/a6vVRs3bAY0ECOSHHeL5jD+SbOpOCUEi0y1DgHEn9Qn1AQ==}
+
+  markdown-table@3.0.4:
+    resolution: {integrity: sha512-wiYz4+JrLyb/DqW2hkFJxP7Vd7JuTDm77fvbM8VfEQdmSMqcImWeeRbHwZjBjIFki/VaMK2BhFi7oUUZeM5bqw==}
+
+  mdast-util-definitions@6.0.0:
+    resolution: {integrity: sha512-scTllyX6pnYNZH/AIp/0ePz6s4cZtARxImwoPJ7kS42n+MnVsI4XbnG6d4ibehRIldYMWM2LD7ImQblVhUejVQ==}
+
+  mdast-util-find-and-replace@3.0.2:
+    resolution: {integrity: sha512-Tmd1Vg/m3Xz43afeNxDIhWRtFZgM2VLyaf4vSTYwudTyeuTneoL3qtWMA5jeLyz/O1vDJmmV4QuScFCA2tBPwg==}
+
+  mdast-util-from-markdown@2.0.2:
+    resolution: {integrity: sha512-uZhTV/8NBuw0WHkPTrCqDOl0zVe1BIng5ZtHoDk49ME1qqcjYmmLmOf0gELgcRMxN4w2iuIeVso5/6QymSrgmA==}
+
+  mdast-util-gfm-autolink-literal@2.0.1:
+    resolution: {integrity: sha512-5HVP2MKaP6L+G6YaxPNjuL0BPrq9orG3TsrZ9YXbA3vDw/ACI4MEsnoDpn6ZNm7GnZgtAcONJyPhOP8tNJQavQ==}
+
+  mdast-util-gfm-footnote@2.1.0:
+    resolution: {integrity: sha512-sqpDWlsHn7Ac9GNZQMeUzPQSMzR6Wv0WKRNvQRg0KqHh02fpTz69Qc1QSseNX29bhz1ROIyNyxExfawVKTm1GQ==}
+
+  mdast-util-gfm-strikethrough@2.0.0:
+    resolution: {integrity: sha512-mKKb915TF+OC5ptj5bJ7WFRPdYtuHv0yTRxK2tJvi+BDqbkiG7h7u/9SI89nRAYcmap2xHQL9D+QG/6wSrTtXg==}
+
+  mdast-util-gfm-table@2.0.0:
+    resolution: {integrity: sha512-78UEvebzz/rJIxLvE7ZtDd/vIQ0RHv+3Mh5DR96p7cS7HsBhYIICDBCu8csTNWNO6tBWfqXPWekRuj2FNOGOZg==}
+
+  mdast-util-gfm-task-list-item@2.0.0:
+    resolution: {integrity: sha512-IrtvNvjxC1o06taBAVJznEnkiHxLFTzgonUdy8hzFVeDun0uTjxxrRGVaNFqkU1wJR3RBPEfsxmU6jDWPofrTQ==}
+
+  mdast-util-gfm@3.1.0:
+    resolution: {integrity: sha512-0ulfdQOM3ysHhCJ1p06l0b0VKlhU0wuQs3thxZQagjcjPrlFRqY215uZGHHJan9GEAXd9MbfPjFJz+qMkVR6zQ==}
+
+  mdast-util-phrasing@4.1.0:
+    resolution: {integrity: sha512-TqICwyvJJpBwvGAMZjj4J2n0X8QWp21b9l0o7eXyVJ25YNWYbJDVIyD1bZXE6WtV6RmKJVYmQAKWa0zWOABz2w==}
+
+  mdast-util-to-hast@13.2.0:
+    resolution: {integrity: sha512-QGYKEuUsYT9ykKBCMOEDLsU5JRObWQusAolFMeko/tYPufNkRffBAQjIE+99jbA87xv6FgmjLtwjh9wBWajwAA==}
+
+  mdast-util-to-markdown@2.1.2:
+    resolution: {integrity: sha512-xj68wMTvGXVOKonmog6LwyJKrYXZPvlwabaryTjLh9LuvovB/KAH+kvi8Gjj+7rJjsFi23nkUxRQv1KqSroMqA==}
+
+  mdast-util-to-string@4.0.0:
+    resolution: {integrity: sha512-0H44vDimn51F0YwvxSJSm0eCDOJTRlmN0R1yBh4HLj9wiV1Dn0QoXGbvFAWj2hSItVTlCmBF1hqKlIyUBVFLPg==}
+
+  mdn-data@2.12.2:
+    resolution: {integrity: sha512-IEn+pegP1aManZuckezWCO+XZQDplx1366JoVhTpMpBB1sPey/SbveZQUosKiKiGYjg1wH4pMlNgXbCiYgihQA==}
+
+  micromark-core-commonmark@2.0.3:
+    resolution: {integrity: sha512-RDBrHEMSxVFLg6xvnXmb1Ayr2WzLAWjeSATAoxwKYJV94TeNavgoIdA0a9ytzDSVzBy2YKFK+emCPOEibLeCrg==}
+
+  micromark-extension-gfm-autolink-literal@2.1.0:
+    resolution: {integrity: sha512-oOg7knzhicgQ3t4QCjCWgTmfNhvQbDDnJeVu9v81r7NltNCVmhPy1fJRX27pISafdjL+SVc4d3l48Gb6pbRypw==}
+
+  micromark-extension-gfm-footnote@2.1.0:
+    resolution: {integrity: sha512-/yPhxI1ntnDNsiHtzLKYnE3vf9JZ6cAisqVDauhp4CEHxlb4uoOTxOCJ+9s51bIB8U1N1FJ1RXOKTIlD5B/gqw==}
+
+  micromark-extension-gfm-strikethrough@2.1.0:
+    resolution: {integrity: sha512-ADVjpOOkjz1hhkZLlBiYA9cR2Anf8F4HqZUO6e5eDcPQd0Txw5fxLzzxnEkSkfnD0wziSGiv7sYhk/ktvbf1uw==}
+
+  micromark-extension-gfm-table@2.1.1:
+    resolution: {integrity: sha512-t2OU/dXXioARrC6yWfJ4hqB7rct14e8f7m0cbI5hUmDyyIlwv5vEtooptH8INkbLzOatzKuVbQmAYcbWoyz6Dg==}
+
+  micromark-extension-gfm-tagfilter@2.0.0:
+    resolution: {integrity: sha512-xHlTOmuCSotIA8TW1mDIM6X2O1SiX5P9IuDtqGonFhEK0qgRI4yeC6vMxEV2dgyr2TiD+2PQ10o+cOhdVAcwfg==}
+
+  micromark-extension-gfm-task-list-item@2.1.0:
+    resolution: {integrity: sha512-qIBZhqxqI6fjLDYFTBIa4eivDMnP+OZqsNwmQ3xNLE4Cxwc+zfQEfbs6tzAo2Hjq+bh6q5F+Z8/cksrLFYWQQw==}
+
+  micromark-extension-gfm@3.0.0:
+    resolution: {integrity: sha512-vsKArQsicm7t0z2GugkCKtZehqUm31oeGBV/KVSorWSy8ZlNAv7ytjFhvaryUiCUJYqs+NoE6AFhpQvBTM6Q4w==}
+
+  micromark-factory-destination@2.0.1:
+    resolution: {integrity: sha512-Xe6rDdJlkmbFRExpTOmRj9N3MaWmbAgdpSrBQvCFqhezUn4AHqJHbaEnfbVYYiexVSs//tqOdY/DxhjdCiJnIA==}
+
+  micromark-factory-label@2.0.1:
+    resolution: {integrity: sha512-VFMekyQExqIW7xIChcXn4ok29YE3rnuyveW3wZQWWqF4Nv9Wk5rgJ99KzPvHjkmPXF93FXIbBp6YdW3t71/7Vg==}
+
+  micromark-factory-space@2.0.1:
+    resolution: {integrity: sha512-zRkxjtBxxLd2Sc0d+fbnEunsTj46SWXgXciZmHq0kDYGnck/ZSGj9/wULTV95uoeYiK5hRXP2mJ98Uo4cq/LQg==}
+
+  micromark-factory-title@2.0.1:
+    resolution: {integrity: sha512-5bZ+3CjhAd9eChYTHsjy6TGxpOFSKgKKJPJxr293jTbfry2KDoWkhBb6TcPVB4NmzaPhMs1Frm9AZH7OD4Cjzw==}
+
+  micromark-factory-whitespace@2.0.1:
+    resolution: {integrity: sha512-Ob0nuZ3PKt/n0hORHyvoD9uZhr+Za8sFoP+OnMcnWK5lngSzALgQYKMr9RJVOWLqQYuyn6ulqGWSXdwf6F80lQ==}
+
+  micromark-util-character@2.1.1:
+    resolution: {integrity: sha512-wv8tdUTJ3thSFFFJKtpYKOYiGP2+v96Hvk4Tu8KpCAsTMs6yi+nVmGh1syvSCsaxz45J6Jbw+9DD6g97+NV67Q==}
+
+  micromark-util-chunked@2.0.1:
+    resolution: {integrity: sha512-QUNFEOPELfmvv+4xiNg2sRYeS/P84pTW0TCgP5zc9FpXetHY0ab7SxKyAQCNCc1eK0459uoLI1y5oO5Vc1dbhA==}
+
+  micromark-util-classify-character@2.0.1:
+    resolution: {integrity: sha512-K0kHzM6afW/MbeWYWLjoHQv1sgg2Q9EccHEDzSkxiP/EaagNzCm7T/WMKZ3rjMbvIpvBiZgwR3dKMygtA4mG1Q==}
+
+  micromark-util-combine-extensions@2.0.1:
+    resolution: {integrity: sha512-OnAnH8Ujmy59JcyZw8JSbK9cGpdVY44NKgSM7E9Eh7DiLS2E9RNQf0dONaGDzEG9yjEl5hcqeIsj4hfRkLH/Bg==}
+
+  micromark-util-decode-numeric-character-reference@2.0.2:
+    resolution: {integrity: sha512-ccUbYk6CwVdkmCQMyr64dXz42EfHGkPQlBj5p7YVGzq8I7CtjXZJrubAYezf7Rp+bjPseiROqe7G6foFd+lEuw==}
+
+  micromark-util-decode-string@2.0.1:
+    resolution: {integrity: sha512-nDV/77Fj6eH1ynwscYTOsbK7rR//Uj0bZXBwJZRfaLEJ1iGBR6kIfNmlNqaqJf649EP0F3NWNdeJi03elllNUQ==}
+
+  micromark-util-encode@2.0.1:
+    resolution: {integrity: sha512-c3cVx2y4KqUnwopcO9b/SCdo2O67LwJJ/UyqGfbigahfegL9myoEFoDYZgkT7f36T0bLrM9hZTAaAyH+PCAXjw==}
+
+  micromark-util-html-tag-name@2.0.1:
+    resolution: {integrity: sha512-2cNEiYDhCWKI+Gs9T0Tiysk136SnR13hhO8yW6BGNyhOC4qYFnwF1nKfD3HFAIXA5c45RrIG1ub11GiXeYd1xA==}
+
+  micromark-util-normalize-identifier@2.0.1:
+    resolution: {integrity: sha512-sxPqmo70LyARJs0w2UclACPUUEqltCkJ6PhKdMIDuJ3gSf/Q+/GIe3WKl0Ijb/GyH9lOpUkRAO2wp0GVkLvS9Q==}
+
+  micromark-util-resolve-all@2.0.1:
+    resolution: {integrity: sha512-VdQyxFWFT2/FGJgwQnJYbe1jjQoNTS4RjglmSjTUlpUMa95Htx9NHeYW4rGDJzbjvCsl9eLjMQwGeElsqmzcHg==}
+
+  micromark-util-sanitize-uri@2.0.1:
+    resolution: {integrity: sha512-9N9IomZ/YuGGZZmQec1MbgxtlgougxTodVwDzzEouPKo3qFWvymFHWcnDi2vzV1ff6kas9ucW+o3yzJK9YB1AQ==}
+
+  micromark-util-subtokenize@2.1.0:
+    resolution: {integrity: sha512-XQLu552iSctvnEcgXw6+Sx75GflAPNED1qx7eBJ+wydBb2KCbRZe+NwvIEEMM83uml1+2WSXpBAcp9IUCgCYWA==}
+
+  micromark-util-symbol@2.0.1:
+    resolution: {integrity: sha512-vs5t8Apaud9N28kgCrRUdEed4UJ+wWNvicHLPxCa9ENlYuAY31M0ETy5y1vA33YoNPDFTghEbnh6efaE8h4x0Q==}
+
+  micromark-util-types@2.0.2:
+    resolution: {integrity: sha512-Yw0ECSpJoViF1qTU4DC6NwtC4aWGt1EkzaQB8KPPyCRR8z9TWeV0HbEFGTO+ZY1wB22zmxnJqhPyTpOVCpeHTA==}
+
+  micromark@4.0.2:
+    resolution: {integrity: sha512-zpe98Q6kvavpCr1NPVSCMebCKfD7CA2NqZ+rykeNhONIJBpc1tFKt9hucLGwha3jNTNI8lHpctWJWoimVF4PfA==}
+
+  mime-db@1.54.0:
+    resolution: {integrity: sha512-aU5EJuIN2WDemCcAp2vFBfp/m4EAhWJnUNSSw0ixs7/kXbd6Pg64EmwJkNdFhB8aWt1sH2CTXrLxo/iAGV3oPQ==}
+    engines: {node: '>= 0.6'}
+
+  mime-types@3.0.1:
+    resolution: {integrity: sha512-xRc4oEhT6eaBpU1XF7AjpOFD+xQmXNB5OVKwp4tqCuBpHLS/ZbBDrc07mYTDqVMg6PfxUjjNp85O6Cd2Z/5HWA==}
+    engines: {node: '>= 0.6'}
+
+  mrmime@2.0.1:
+    resolution: {integrity: sha512-Y3wQdFg2Va6etvQ5I82yUhGdsKrcYox6p7FfL1LbK2J4V01F9TGlepTIhnK24t7koZibmg82KGglhA1XK5IsLQ==}
+    engines: {node: '>=10'}
+
+  ms@2.1.3:
+    resolution: {integrity: sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==}
+
+  nanoid@3.3.11:
+    resolution: {integrity: sha512-N8SpfPUnUp1bK+PMYW8qSWdl9U+wwNWI4QKxOYDy9JAro3WMX7p2OeVRF9v+347pnakNevPmiHhNmZ2HbFA76w==}
+    engines: {node: ^10 || ^12 || ^13.7 || ^14 || >=15.0.1}
+    hasBin: true
+
+  neotraverse@0.6.18:
+    resolution: {integrity: sha512-Z4SmBUweYa09+o6pG+eASabEpP6QkQ70yHj351pQoEXIs8uHbaU2DWVmzBANKgflPa47A50PtB2+NgRpQvr7vA==}
+    engines: {node: '>= 10'}
+
+  nlcst-to-string@4.0.0:
+    resolution: {integrity: sha512-YKLBCcUYKAg0FNlOBT6aI91qFmSiFKiluk655WzPF+DDMA02qIyy8uiRqI8QXtcFpEvll12LpL5MXqEmAZ+dcA==}
+
+  node-fetch-native@1.6.6:
+    resolution: {integrity: sha512-8Mc2HhqPdlIfedsuZoc3yioPuzp6b+L5jRCRY1QzuWZh2EGJVQrGppC6V6cF0bLdbW0+O2YpqCA25aF/1lvipQ==}
+
+  node-fetch@2.7.0:
+    resolution: {integrity: sha512-c4FRfUm/dbcWZ7U+1Wq0AwCyFL+3nt2bEw05wfxSz+DWpWsitgmSgYmy2dQdWyKC1694ELPqMs/YzUSNozLt8A==}
+    engines: {node: 4.x || >=6.0.0}
+    peerDependencies:
+      encoding: ^0.1.0
+    peerDependenciesMeta:
+      encoding:
+        optional: true
+
+  node-mock-http@1.0.0:
+    resolution: {integrity: sha512-0uGYQ1WQL1M5kKvGRXWQ3uZCHtLTO8hln3oBjIusM75WoesZ909uQJs/Hb946i2SS+Gsrhkaa6iAO17jRIv6DQ==}
+
+  normalize-path@3.0.0:
+    resolution: {integrity: sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==}
+    engines: {node: '>=0.10.0'}
+
+  ofetch@1.4.1:
+    resolution: {integrity: sha512-QZj2DfGplQAr2oj9KzceK9Hwz6Whxazmn85yYeVuS3u9XTMOGMRx0kO95MQ+vLsj/S/NwBDMMLU5hpxvI6Tklw==}
+
+  ohash@2.0.11:
+    resolution: {integrity: sha512-RdR9FQrFwNBNXAr4GixM8YaRZRJ5PUWbKYbE5eOsrwAjJW0q2REGcf79oYPsLyskQCZG1PLN+S/K1V00joZAoQ==}
+
+  on-finished@2.4.1:
+    resolution: {integrity: sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==}
+    engines: {node: '>= 0.8'}
+
+  oniguruma-parser@0.12.1:
+    resolution: {integrity: sha512-8Unqkvk1RYc6yq2WBYRj4hdnsAxVze8i7iPfQr8e4uSP3tRv0rpZcbGUDvxfQQcdwHt/e9PrMvGCsa8OqG9X3w==}
+
+  oniguruma-to-es@4.3.3:
+    resolution: {integrity: sha512-rPiZhzC3wXwE59YQMRDodUwwT9FZ9nNBwQQfsd1wfdtlKEyCdRV0avrTcSZ5xlIvGRVPd/cx6ZN45ECmS39xvg==}
+
+  p-limit@6.2.0:
+    resolution: {integrity: sha512-kuUqqHNUqoIWp/c467RI4X6mmyuojY5jGutNU0wVTmEOOfcuwLqyMVoAi9MKi2Ak+5i9+nhmrK4ufZE8069kHA==}
+    engines: {node: '>=18'}
+
+  p-queue@8.1.0:
+    resolution: {integrity: sha512-mxLDbbGIBEXTJL0zEx8JIylaj3xQ7Z/7eEVjcF9fJX4DBiH9oqe+oahYnlKKxm0Ci9TlWTyhSHgygxMxjIB2jw==}
+    engines: {node: '>=18'}
+
+  p-timeout@6.1.4:
+    resolution: {integrity: sha512-MyIV3ZA/PmyBN/ud8vV9XzwTrNtR4jFrObymZYnZqMmW0zA8Z17vnT0rBgFE/TlohB+YCHqXMgZzb3Csp49vqg==}
+    engines: {node: '>=14.16'}
+
+  package-manager-detector@1.3.0:
+    resolution: {integrity: sha512-ZsEbbZORsyHuO00lY1kV3/t72yp6Ysay6Pd17ZAlNGuGwmWDLCJxFpRs0IzfXfj1o4icJOkUEioexFHzyPurSQ==}
+
+  pako@0.2.9:
+    resolution: {integrity: sha512-NUcwaKxUxWrZLpDG+z/xZaCgQITkA/Dv4V/T6bw7VON6l1Xz/VnrBqrYjZQ12TamKHzITTfOEIYUj48y2KXImA==}
+
+  parse-latin@7.0.0:
+    resolution: {integrity: sha512-mhHgobPPua5kZ98EF4HWiH167JWBfl4pvAIXXdbaVohtK7a6YBOy56kvhCqduqyo/f3yrHFWmqmiMg/BkBkYYQ==}
+
+  parse5@7.3.0:
+    resolution: {integrity: sha512-IInvU7fabl34qmi9gY8XOVxhYyMyuH2xUNpb2q8/Y+7552KlejkRvqvD19nMoUW/uQGGbqNpA6Tufu5FL5BZgw==}
+
+  picocolors@1.1.1:
+    resolution: {integrity: sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==}
+
+  picomatch@2.3.1:
+    resolution: {integrity: sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==}
+    engines: {node: '>=8.6'}
+
+  picomatch@4.0.2:
+    resolution: {integrity: sha512-M7BAV6Rlcy5u+m6oPhAPFgJTzAioX/6B0DxyvDlo9l8+T3nLKbrczg2WLUyzd45L8RqfUMyGPzekbMvX2Ldkwg==}
+    engines: {node: '>=12'}
+
+  postcss@8.5.5:
+    resolution: {integrity: sha512-d/jtm+rdNT8tpXuHY5MMtcbJFBkhXE6593XVR9UoGCH8jSFGci7jGvMGH5RYd5PBJW+00NZQt6gf7CbagJCrhg==}
+    engines: {node: ^10 || ^12 || >=14}
+
+  prismjs@1.30.0:
+    resolution: {integrity: sha512-DEvV2ZF2r2/63V+tK8hQvrR2ZGn10srHbXviTlcv7Kpzw8jWiNTqbVgjO3IY8RxrrOUF8VPMQQFysYYYv0YZxw==}
+    engines: {node: '>=6'}
+
+  prompts@2.4.2:
+    resolution: {integrity: sha512-NxNv/kLguCA7p3jE8oL2aEBsrJWgAakBpgmgK6lpPWV+WuOmY6r2/zbAVnP+T8bQlA0nzHXSJSJW0Hq7ylaD2Q==}
+    engines: {node: '>= 6'}
+
+  property-information@6.5.0:
+    resolution: {integrity: sha512-PgTgs/BlvHxOu8QuEN7wi5A0OmXaBcHpmCSTehcs6Uuu9IkDIEo13Hy7n898RHfrQ49vKCoGeWZSaAK01nwVig==}
+
+  property-information@7.1.0:
+    resolution: {integrity: sha512-TwEZ+X+yCJmYfL7TPUOcvBZ4QfoT5YenQiJuX//0th53DE6w0xxLEtfK3iyryQFddXuvkIk51EEgrJQ0WJkOmQ==}
+
+  radix3@1.1.2:
+    resolution: {integrity: sha512-b484I/7b8rDEdSDKckSSBA8knMpcdsXudlE/LNL639wFoHKwLbEkQFZHWEYwDC0wa0FKUcCY+GAF73Z7wxNVFA==}
+
+  range-parser@1.2.1:
+    resolution: {integrity: sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==}
+    engines: {node: '>= 0.6'}
+
+  readdirp@4.1.2:
+    resolution: {integrity: sha512-GDhwkLfywWL2s6vEjyhri+eXmfH6j1L7JE27WhqLeYzoh/A3DBaYGEj2H/HFZCn/kMfim73FXxEJTw06WtxQwg==}
+    engines: {node: '>= 14.18.0'}
+
+  regex-recursion@6.0.2:
+    resolution: {integrity: sha512-0YCaSCq2VRIebiaUviZNs0cBz1kg5kVS2UKUfNIx8YVs1cN3AV7NTctO5FOKBA+UT2BPJIWZauYHPqJODG50cg==}
+
+  regex-utilities@2.3.0:
+    resolution: {integrity: sha512-8VhliFJAWRaUiVvREIiW2NXXTmHs4vMNnSzuJVhscgmGav3g9VDxLrQndI3dZZVVdp0ZO/5v0xmX516/7M9cng==}
+
+  regex@6.0.1:
+    resolution: {integrity: sha512-uorlqlzAKjKQZ5P+kTJr3eeJGSVroLKoHmquUj4zHWuR+hEyNqlXsSKlYYF5F4NI6nl7tWCs0apKJ0lmfsXAPA==}
+
+  rehype-parse@9.0.1:
+    resolution: {integrity: sha512-ksCzCD0Fgfh7trPDxr2rSylbwq9iYDkSn8TCDmEJ49ljEUBxDVCzCHv7QNzZOfODanX4+bWQ4WZqLCRWYLfhag==}
+
+  rehype-raw@7.0.0:
+    resolution: {integrity: sha512-/aE8hCfKlQeA8LmyeyQvQF3eBiLRGNlfBJEvWH7ivp9sBqs7TNqBL5X3v157rM4IFETqDnIOO+z5M/biZbo9Ww==}
+
+  rehype-stringify@10.0.1:
+    resolution: {integrity: sha512-k9ecfXHmIPuFVI61B9DeLPN0qFHfawM6RsuX48hoqlaKSF61RskNjSm1lI8PhBEM0MRdLxVVm4WmTqJQccH9mA==}
+
+  rehype@13.0.2:
+    resolution: {integrity: sha512-j31mdaRFrwFRUIlxGeuPXXKWQxet52RBQRvCmzl5eCefn/KGbomK5GMHNMsOJf55fgo3qw5tST5neDuarDYR2A==}
+
+  remark-gfm@4.0.1:
+    resolution: {integrity: sha512-1quofZ2RQ9EWdeN34S79+KExV1764+wCUGop5CPL1WGdD0ocPpu91lzPGbwWMECpEpd42kJGQwzRfyov9j4yNg==}
+
+  remark-parse@11.0.0:
+    resolution: {integrity: sha512-FCxlKLNGknS5ba/1lmpYijMUzX2esxW5xQqjWxw2eHFfS2MSdaHVINFmhjo+qN1WhZhNimq0dZATN9pH0IDrpA==}
+
+  remark-rehype@11.1.2:
+    resolution: {integrity: sha512-Dh7l57ianaEoIpzbp0PC9UKAdCSVklD8E5Rpw7ETfbTl3FqcOOgq5q2LVDhgGCkaBv7p24JXikPdvhhmHvKMsw==}
+
+  remark-smartypants@3.0.2:
+    resolution: {integrity: sha512-ILTWeOriIluwEvPjv67v7Blgrcx+LZOkAUVtKI3putuhlZm84FnqDORNXPPm+HY3NdZOMhyDwZ1E+eZB/Df5dA==}
+    engines: {node: '>=16.0.0'}
+
+  remark-stringify@11.0.0:
+    resolution: {integrity: sha512-1OSmLd3awB/t8qdoEOMazZkNsfVTeY4fTsgzcQFdXNq8ToTN4ZGwrMnlda4K6smTFKD+GRV6O48i6Z4iKgPPpw==}
+
+  restructure@3.0.2:
+    resolution: {integrity: sha512-gSfoiOEA0VPE6Tukkrr7I0RBdE0s7H1eFCDBk05l1KIQT1UIKNc5JZy6jdyW6eYH3aR3g5b3PuL77rq0hvwtAw==}
+
+  retext-latin@4.0.0:
+    resolution: {integrity: sha512-hv9woG7Fy0M9IlRQloq/N6atV82NxLGveq+3H2WOi79dtIYWN8OaxogDm77f8YnVXJL2VD3bbqowu5E3EMhBYA==}
+
+  retext-smartypants@6.2.0:
+    resolution: {integrity: sha512-kk0jOU7+zGv//kfjXEBjdIryL1Acl4i9XNkHxtM7Tm5lFiCog576fjNC9hjoR7LTKQ0DsPWy09JummSsH1uqfQ==}
+
+  retext-stringify@4.0.0:
+    resolution: {integrity: sha512-rtfN/0o8kL1e+78+uxPTqu1Klt0yPzKuQ2BfWwwfgIUSayyzxpM1PJzkKt4V8803uB9qSy32MvI7Xep9khTpiA==}
+
+  retext@9.0.0:
+    resolution: {integrity: sha512-sbMDcpHCNjvlheSgMfEcVrZko3cDzdbe1x/e7G66dFp0Ff7Mldvi2uv6JkJQzdRcvLYE8CA8Oe8siQx8ZOgTcA==}
+
+  rollup@4.43.0:
+    resolution: {integrity: sha512-wdN2Kd3Twh8MAEOEJZsuxuLKCsBEo4PVNLK6tQWAn10VhsVewQLzcucMgLolRlhFybGxfclbPeEYBaP6RvUFGg==}
+    engines: {node: '>=18.0.0', npm: '>=8.0.0'}
+    hasBin: true
+
+  semver@7.7.2:
+    resolution: {integrity: sha512-RF0Fw+rO5AMf9MAyaRXI4AV0Ulj5lMHqVxxdSgiVbixSCXoEmmX/jk0CuJw4+3SqroYO9VoUh+HcuJivvtJemA==}
+    engines: {node: '>=10'}
+    hasBin: true
+
+  send@1.2.0:
+    resolution: {integrity: sha512-uaW0WwXKpL9blXE2o0bRhoL2EGXIrZxQ2ZQ4mgcfoBxdFmQold+qWsD2jLrfZ0trjKL6vOw0j//eAwcALFjKSw==}
+    engines: {node: '>= 18'}
+
+  server-destroy@1.0.1:
+    resolution: {integrity: sha512-rb+9B5YBIEzYcD6x2VKidaa+cqYBJQKnU4oe4E3ANwRRN56yk/ua1YCJT1n21NTS8w6CcOclAKNP3PhdCXKYtQ==}
+
+  setprototypeof@1.2.0:
+    resolution: {integrity: sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==}
+
+  sharp@0.33.5:
+    resolution: {integrity: sha512-haPVm1EkS9pgvHrQ/F3Xy+hgcuMV0Wm9vfIBSiwZ05k+xgb0PkBQpGsAA/oWdDobNaZTH5ppvHtzCFbnSEwHVw==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+
+  shiki@3.6.0:
+    resolution: {integrity: sha512-tKn/Y0MGBTffQoklaATXmTqDU02zx8NYBGQ+F6gy87/YjKbizcLd+Cybh/0ZtOBX9r1NEnAy/GTRDKtOsc1L9w==}
+
+  simple-swizzle@0.2.2:
+    resolution: {integrity: sha512-JA//kQgZtbuY83m+xT+tXJkmJncGMTFT+C+g2h2R9uxkYIrE2yy9sgmcLhCnw57/WSD+Eh3J97FPEDFnbXnDUg==}
+
+  sisteransi@1.0.5:
+    resolution: {integrity: sha512-bLGGlR1QxBcynn2d5YmDX4MGjlZvy2MRBDRNHLJ8VI6l6+9FUiyTFNJ0IveOSP0bcXgVDPRcfGqA0pjaqUpfVg==}
+
+  smol-toml@1.3.4:
+    resolution: {integrity: sha512-UOPtVuYkzYGee0Bd2Szz8d2G3RfMfJ2t3qVdZUAozZyAk+a0Sxa+QKix0YCwjL/A1RR0ar44nCxaoN9FxdJGwA==}
+    engines: {node: '>= 18'}
+
+  source-map-js@1.2.1:
+    resolution: {integrity: sha512-UXWMKhLOwVKb728IUtQPXxfYU+usdybtUrK/8uGE8CQMvrhOpwvzDBwj0QhSL7MQc7vIsISBG8VQ8+IDQxpfQA==}
+    engines: {node: '>=0.10.0'}
+
+  space-separated-tokens@2.0.2:
+    resolution: {integrity: sha512-PEGlAwrG8yXGXRjW32fGbg66JAlOAwbObuqVoJpv/mRgoWDQfgH1wDPvtzWyUSNAXBGSk8h755YDbbcEy3SH2Q==}
+
+  statuses@2.0.1:
+    resolution: {integrity: sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==}
+    engines: {node: '>= 0.8'}
+
+  statuses@2.0.2:
+    resolution: {integrity: sha512-DvEy55V3DB7uknRo+4iOGT5fP1slR8wQohVdknigZPMpMstaKJQWhwiYBACJE3Ul2pTnATihhBYnRhZQHGBiRw==}
+    engines: {node: '>= 0.8'}
+
+  string-width@4.2.3:
+    resolution: {integrity: sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==}
+    engines: {node: '>=8'}
+
+  string-width@7.2.0:
+    resolution: {integrity: sha512-tsaTIkKW9b4N+AEj+SVA+WhJzV7/zMhcSu78mLKWSk7cXMOSHsBKFWUs0fWwq8QyK3MgJBQRX6Gbi4kYbdvGkQ==}
+    engines: {node: '>=18'}
+
+  stringify-entities@4.0.4:
+    resolution: {integrity: sha512-IwfBptatlO+QCJUo19AqvrPNqlVMpW9YEL2LIVY+Rpv2qsjCGxaDLNRgeGsQWJhfItebuJhsGSLjaBbNSQ+ieg==}
+
+  strip-ansi@6.0.1:
+    resolution: {integrity: sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==}
+    engines: {node: '>=8'}
+
+  strip-ansi@7.1.0:
+    resolution: {integrity: sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==}
+    engines: {node: '>=12'}
+
+  tiny-inflate@1.0.3:
+    resolution: {integrity: sha512-pkY1fj1cKHb2seWDy0B16HeWyczlJA9/WW3u3c4z/NiWDsO3DOU5D7nhTLE9CF0yXv/QZFY7sEJmj24dK+Rrqw==}
+
+  tinyexec@0.3.2:
+    resolution: {integrity: sha512-KQQR9yN7R5+OSwaK0XQoj22pwHoTlgYqmUscPYoknOoWCWfj/5/ABTMRi69FrKU5ffPVh5QcFikpWJI/P1ocHA==}
+
+  tinyglobby@0.2.14:
+    resolution: {integrity: sha512-tX5e7OM1HnYr2+a2C/4V0htOcSQcoSTH9KgJnVvNm5zm/cyEWKJ7j7YutsH9CxMdtOkkLFy2AHrMci9IM8IPZQ==}
+    engines: {node: '>=12.0.0'}
+
+  toidentifier@1.0.1:
+    resolution: {integrity: sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==}
+    engines: {node: '>=0.6'}
+
+  tr46@0.0.3:
+    resolution: {integrity: sha512-N3WMsuqV66lT30CrXNbEjx4GEwlow3v6rr4mCcv6prnfwhS01rkgyFdjPNBYd9br7LpXV1+Emh01fHnq2Gdgrw==}
+
+  trim-lines@3.0.1:
+    resolution: {integrity: sha512-kRj8B+YHZCc9kQYdWfJB2/oUl9rA99qbowYYBtr4ui4mZyAQ2JpvVBd/6U2YloATfqBhBTSMhTpgBHtU0Mf3Rg==}
+
+  trough@2.2.0:
+    resolution: {integrity: sha512-tmMpK00BjZiUyVyvrBK7knerNgmgvcV/KLVyuma/SC+TQN167GrMRciANTz09+k3zW8L8t60jWO1GpfkZdjTaw==}
+
+  tsconfck@3.1.6:
+    resolution: {integrity: sha512-ks6Vjr/jEw0P1gmOVwutM3B7fWxoWBL2KRDb1JfqGVawBmO5UsvmWOQFGHBPl5yxYz4eERr19E6L7NMv+Fej4w==}
+    engines: {node: ^18 || >=20}
+    hasBin: true
+    peerDependencies:
+      typescript: ^5.0.0
+    peerDependenciesMeta:
+      typescript:
+        optional: true
+
+  tslib@2.8.1:
+    resolution: {integrity: sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w==}
+
+  type-fest@4.41.0:
+    resolution: {integrity: sha512-TeTSQ6H5YHvpqVwBRcnLDCBnDOHWYu7IvGbHT6N8AOymcr9PJGjc1GTtiWZTYg0NCgYwvnYWEkVChQAr9bjfwA==}
+    engines: {node: '>=16'}
+
+  typescript@5.8.3:
+    resolution: {integrity: sha512-p1diW6TqL9L07nNxvRMM7hMMw4c5XOo/1ibL4aAIGmSAt9slTE1Xgw5KWuof2uTOvCg9BY7ZRi+GaF+7sfgPeQ==}
+    engines: {node: '>=14.17'}
+    hasBin: true
+
+  ufo@1.6.1:
+    resolution: {integrity: sha512-9a4/uxlTWJ4+a5i0ooc1rU7C7YOw3wT+UGqdeNNHWnOF9qcMBgLRS+4IYUqbczewFx4mLEig6gawh7X6mFlEkA==}
+
+  ultrahtml@1.6.0:
+    resolution: {integrity: sha512-R9fBn90VTJrqqLDwyMph+HGne8eqY1iPfYhPzZrvKpIfwkWZbcYlfpsb8B9dTvBfpy1/hqAD7Wi8EKfP9e8zdw==}
+
+  uncrypto@0.1.3:
+    resolution: {integrity: sha512-Ql87qFHB3s/De2ClA9e0gsnS6zXG27SkTiSJwjCc9MebbfapQfuPzumMIUMi38ezPZVNFcHI9sUIepeQfw8J8Q==}
+
+  undici-types@7.8.0:
+    resolution: {integrity: sha512-9UJ2xGDvQ43tYyVMpuHlsgApydB8ZKfVYTsLDhXkFL/6gfkp+U8xTGdh8pMJv1SpZna0zxG1DwsKZsreLbXBxw==}
+
+  unicode-properties@1.4.1:
+    resolution: {integrity: sha512-CLjCCLQ6UuMxWnbIylkisbRj31qxHPAurvena/0iwSVbQ2G1VY5/HjV0IRabOEbDHlzZlRdCrD4NhB0JtU40Pg==}
+
+  unicode-trie@2.0.0:
+    resolution: {integrity: sha512-x7bc76x0bm4prf1VLg79uhAzKw8DVboClSN5VxJuQ+LKDOVEW9CdH+VY7SP+vX7xCYQqzzgQpFqz15zeLvAtZQ==}
+
+  unified@11.0.5:
+    resolution: {integrity: sha512-xKvGhPWw3k84Qjh8bI3ZeJjqnyadK+GEFtazSfZv/rKeTkTjOJho6mFqh2SM96iIcZokxiOpg78GazTSg8+KHA==}
+
+  unifont@0.5.0:
+    resolution: {integrity: sha512-4DueXMP5Hy4n607sh+vJ+rajoLu778aU3GzqeTCqsD/EaUcvqZT9wPC8kgK6Vjh22ZskrxyRCR71FwNOaYn6jA==}
+
+  unist-util-find-after@5.0.0:
+    resolution: {integrity: sha512-amQa0Ep2m6hE2g72AugUItjbuM8X8cGQnFoHk0pGfrFeT9GZhzN5SW8nRsiGKK7Aif4CrACPENkA6P/Lw6fHGQ==}
+
+  unist-util-is@6.0.0:
+    resolution: {integrity: sha512-2qCTHimwdxLfz+YzdGfkqNlH0tLi9xjTnHddPmJwtIG9MGsdbutfTc4P+haPD7l7Cjxf/WZj+we5qfVPvvxfYw==}
+
+  unist-util-modify-children@4.0.0:
+    resolution: {integrity: sha512-+tdN5fGNddvsQdIzUF3Xx82CU9sMM+fA0dLgR9vOmT0oPT2jH+P1nd5lSqfCfXAw+93NhcXNY2qqvTUtE4cQkw==}
+
+  unist-util-position@5.0.0:
+    resolution: {integrity: sha512-fucsC7HjXvkB5R3kTCO7kUjRdrS0BJt3M/FPxmHMBOm8JQi2BsHAHFsy27E0EolP8rp0NzXsJ+jNPyDWvOJZPA==}
+
+  unist-util-remove-position@5.0.0:
+    resolution: {integrity: sha512-Hp5Kh3wLxv0PHj9m2yZhhLt58KzPtEYKQQ4yxfYFEO7EvHwzyDYnduhHnY1mDxoqr7VUwVuHXk9RXKIiYS1N8Q==}
+
+  unist-util-stringify-position@4.0.0:
+    resolution: {integrity: sha512-0ASV06AAoKCDkS2+xw5RXJywruurpbC4JZSm7nr7MOt1ojAzvyyaO+UxZf18j8FCF6kmzCZKcAgN/yu2gm2XgQ==}
+
+  unist-util-visit-children@3.0.0:
+    resolution: {integrity: sha512-RgmdTfSBOg04sdPcpTSD1jzoNBjt9a80/ZCzp5cI9n1qPzLZWF9YdvWGN2zmTumP1HWhXKdUWexjy/Wy/lJ7tA==}
+
+  unist-util-visit-parents@6.0.1:
+    resolution: {integrity: sha512-L/PqWzfTP9lzzEa6CKs0k2nARxTdZduw3zyh8d2NVBnsyvHjSX4TWse388YrrQKbvI8w20fGjGlhgT96WwKykw==}
+
+  unist-util-visit@5.0.0:
+    resolution: {integrity: sha512-MR04uvD+07cwl/yhVuVWAtw+3GOR/knlL55Nd/wAdblk27GCVt3lqpTivy/tkJcZoNPzTwS1Y+KMojlLDhoTzg==}
+
+  unstorage@1.16.0:
+    resolution: {integrity: sha512-WQ37/H5A7LcRPWfYOrDa1Ys02xAbpPJq6q5GkO88FBXVSQzHd7+BjEwfRqyaSWCv9MbsJy058GWjjPjcJ16GGA==}
+    peerDependencies:
+      '@azure/app-configuration': ^1.8.0
+      '@azure/cosmos': ^4.2.0
+      '@azure/data-tables': ^13.3.0
+      '@azure/identity': ^4.6.0
+      '@azure/keyvault-secrets': ^4.9.0
+      '@azure/storage-blob': ^12.26.0
+      '@capacitor/preferences': ^6.0.3 || ^7.0.0
+      '@deno/kv': '>=0.9.0'
+      '@netlify/blobs': ^6.5.0 || ^7.0.0 || ^8.1.0
+      '@planetscale/database': ^1.19.0
+      '@upstash/redis': ^1.34.3
+      '@vercel/blob': '>=0.27.1'
+      '@vercel/kv': ^1.0.1
+      aws4fetch: ^1.0.20
+      db0: '>=0.2.1'
+      idb-keyval: ^6.2.1
+      ioredis: ^5.4.2
+      uploadthing: ^7.4.4
+    peerDependenciesMeta:
+      '@azure/app-configuration':
+        optional: true
+      '@azure/cosmos':
+        optional: true
+      '@azure/data-tables':
+        optional: true
+      '@azure/identity':
+        optional: true
+      '@azure/keyvault-secrets':
+        optional: true
+      '@azure/storage-blob':
+        optional: true
+      '@capacitor/preferences':
+        optional: true
+      '@deno/kv':
+        optional: true
+      '@netlify/blobs':
+        optional: true
+      '@planetscale/database':
+        optional: true
+      '@upstash/redis':
+        optional: true
+      '@vercel/blob':
+        optional: true
+      '@vercel/kv':
+        optional: true
+      aws4fetch:
+        optional: true
+      db0:
+        optional: true
+      idb-keyval:
+        optional: true
+      ioredis:
+        optional: true
+      uploadthing:
+        optional: true
+
+  vfile-location@5.0.3:
+    resolution: {integrity: sha512-5yXvWDEgqeiYiBe1lbxYF7UMAIm/IcopxMHrMQDq3nvKcjPKIhZklUKL+AE7J7uApI4kwe2snsK+eI6UTj9EHg==}
+
+  vfile-message@4.0.2:
+    resolution: {integrity: sha512-jRDZ1IMLttGj41KcZvlrYAaI3CfqpLpfpf+Mfig13viT6NKvRzWZ+lXz0Y5D60w6uJIBAOGq9mSHf0gktF0duw==}
+
+  vfile@6.0.3:
+    resolution: {integrity: sha512-KzIbH/9tXat2u30jf+smMwFCsno4wHVdNmzFyL+T/L3UGqqk6JKfVqOFOZEpZSHADH1k40ab6NUIXZq422ov3Q==}
+
+  vite@6.3.5:
+    resolution: {integrity: sha512-cZn6NDFE7wdTpINgs++ZJ4N49W2vRp8LCKrn3Ob1kYNtOo21vfDoaV5GzBfLU4MovSAB8uNRm4jgzVQZ+mBzPQ==}
+    engines: {node: ^18.0.0 || ^20.0.0 || >=22.0.0}
+    hasBin: true
+    peerDependencies:
+      '@types/node': ^18.0.0 || ^20.0.0 || >=22.0.0
+      jiti: '>=1.21.0'
+      less: '*'
+      lightningcss: ^1.21.0
+      sass: '*'
+      sass-embedded: '*'
+      stylus: '*'
+      sugarss: '*'
+      terser: ^5.16.0
+      tsx: ^4.8.1
+      yaml: ^2.4.2
+    peerDependenciesMeta:
+      '@types/node':
+        optional: true
+      jiti:
+        optional: true
+      less:
+        optional: true
+      lightningcss:
+        optional: true
+      sass:
+        optional: true
+      sass-embedded:
+        optional: true
+      stylus:
+        optional: true
+      sugarss:
+        optional: true
+      terser:
+        optional: true
+      tsx:
+        optional: true
+      yaml:
+        optional: true
+
+  vitefu@1.0.6:
+    resolution: {integrity: sha512-+Rex1GlappUyNN6UfwbVZne/9cYC4+R2XDk9xkNXBKMw6HQagdX9PgZ8V2v1WUSK1wfBLp7qbI1+XSNIlB1xmA==}
+    peerDependencies:
+      vite: ^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0
+    peerDependenciesMeta:
+      vite:
+        optional: true
+
+  web-namespaces@2.0.1:
+    resolution: {integrity: sha512-bKr1DkiNa2krS7qxNtdrtHAmzuYGFQLiQ13TsorsdT6ULTkPLKuu5+GsFpDlg6JFjUTwX2DyhMPG2be8uPrqsQ==}
+
+  webidl-conversions@3.0.1:
+    resolution: {integrity: sha512-2JAn3z8AR6rjK8Sm8orRC0h/bcl/DqL7tRPdGZ4I1CjdF+EaMLmYxBHyXuKL849eucPFhvBoxMsflfOb8kxaeQ==}
+
+  whatwg-url@5.0.0:
+    resolution: {integrity: sha512-saE57nupxk6v3HY35+jzBwYa0rKSy0XR8JSxZPwgLr7ys0IBzhGviA1/TUGJLmSVqs8pb9AnvICXEuOHLprYTw==}
+
+  which-pm-runs@1.1.0:
+    resolution: {integrity: sha512-n1brCuqClxfFfq/Rb0ICg9giSZqCS+pLtccdag6C2HyufBrh3fBOiy9nb6ggRMvWOVH5GrdJskj5iGTZNxd7SA==}
+    engines: {node: '>=4'}
+
+  widest-line@5.0.0:
+    resolution: {integrity: sha512-c9bZp7b5YtRj2wOe6dlj32MK+Bx/M/d+9VB2SHM1OtsUHR0aV0tdP6DWh/iMt0kWi1t5g1Iudu6hQRNd1A4PVA==}
+    engines: {node: '>=18'}
+
+  wrap-ansi@9.0.0:
+    resolution: {integrity: sha512-G8ura3S+3Z2G+mkgNRq8dqaFZAuxfsxpBB8OCTGRTCtp+l/v9nbFNmCUP1BZMts3G1142MsZfn6eeUKrr4PD1Q==}
+    engines: {node: '>=18'}
+
+  xxhash-wasm@1.1.0:
+    resolution: {integrity: sha512-147y/6YNh+tlp6nd/2pWq38i9h6mz/EuQ6njIrmW8D1BS5nCqs0P6DG+m6zTGnNz5I+uhZ0SHxBs9BsPrwcKDA==}
+
+  yargs-parser@21.1.1:
+    resolution: {integrity: sha512-tVpsJW7DdjecAiFpbIB1e3qxIQsE6NoPc5/eTdrbbIC4h0LVsWhnoa3g+m2HclBIujHzsxZ4VJVA+GUuc2/LBw==}
+    engines: {node: '>=12'}
+
+  yocto-queue@1.2.1:
+    resolution: {integrity: sha512-AyeEbWOu/TAXdxlV9wmGcR0+yh2j3vYPGOECcIj2S7MkrLyC7ne+oye2BKTItt0ii2PHk4cDy+95+LshzbXnGg==}
+    engines: {node: '>=12.20'}
+
+  yocto-spinner@0.2.3:
+    resolution: {integrity: sha512-sqBChb33loEnkoXte1bLg45bEBsOP9N1kzQh5JZNKj/0rik4zAPTNSAVPj3uQAdc6slYJ0Ksc403G2XgxsJQFQ==}
+    engines: {node: '>=18.19'}
+
+  yoctocolors@2.1.1:
+    resolution: {integrity: sha512-GQHQqAopRhwU8Kt1DDM8NjibDXHC8eoh1erhGAJPEyveY9qqVeXvVikNKrDz69sHowPMorbPUrH/mx8c50eiBQ==}
+    engines: {node: '>=18'}
+
+  zod-to-json-schema@3.24.5:
+    resolution: {integrity: sha512-/AuWwMP+YqiPbsJx5D6TfgRTc4kTLjsh5SOcd4bLsfUg2RcEXrFMJl1DGgdHy2aCfsIA/cr/1JM0xcB2GZji8g==}
+    peerDependencies:
+      zod: ^3.24.1
+
+  zod-to-ts@1.2.0:
+    resolution: {integrity: sha512-x30XE43V+InwGpvTySRNz9kB7qFU8DlyEy7BsSTCHPH1R0QasMmHWZDCzYm6bVXtj/9NNJAZF3jW8rzFvH5OFA==}
+    peerDependencies:
+      typescript: ^4.9.4 || ^5.0.2
+      zod: ^3
+
+  zod@3.25.64:
+    resolution: {integrity: sha512-hbP9FpSZf7pkS7hRVUrOjhwKJNyampPgtXKc3AN6DsWtoHsg2Sb4SQaS4Tcay380zSwd2VPo9G9180emBACp5g==}
+
+  zwitch@2.0.4:
+    resolution: {integrity: sha512-bXE4cR/kVZhKZX/RjPEflHaKVhUVl85noU3v6b8apfQEc1x4A+zBxjZ4lN8LqGd6WZ3dl98pY4o717VFmoPp+A==}
+
+snapshots:
+
+  '@astrojs/compiler@2.12.2': {}
+
+  '@astrojs/internal-helpers@0.6.1': {}
+
+  '@astrojs/markdown-remark@6.3.2':
+    dependencies:
+      '@astrojs/internal-helpers': 0.6.1
+      '@astrojs/prism': 3.3.0
+      github-slugger: 2.0.0
+      hast-util-from-html: 2.0.3
+      hast-util-to-text: 4.0.2
+      import-meta-resolve: 4.1.0
+      js-yaml: 4.1.0
+      mdast-util-definitions: 6.0.0
+      rehype-raw: 7.0.0
+      rehype-stringify: 10.0.1
+      remark-gfm: 4.0.1
+      remark-parse: 11.0.0
+      remark-rehype: 11.1.2
+      remark-smartypants: 3.0.2
+      shiki: 3.6.0
+      smol-toml: 1.3.4
+      unified: 11.0.5
+      unist-util-remove-position: 5.0.0
+      unist-util-visit: 5.0.0
+      unist-util-visit-parents: 6.0.1
+      vfile: 6.0.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@astrojs/node@9.2.2(astro@5.9.3(@types/node@24.0.1)(rollup@4.43.0)(typescript@5.8.3))':
+    dependencies:
+      '@astrojs/internal-helpers': 0.6.1
+      astro: 5.9.3(@types/node@24.0.1)(rollup@4.43.0)(typescript@5.8.3)
+      send: 1.2.0
+      server-destroy: 1.0.1
+    transitivePeerDependencies:
+      - supports-color
+
+  '@astrojs/prism@3.3.0':
+    dependencies:
+      prismjs: 1.30.0
+
+  '@astrojs/telemetry@3.3.0':
+    dependencies:
+      ci-info: 4.2.0
+      debug: 4.4.1
+      dlv: 1.1.3
+      dset: 3.1.4
+      is-docker: 3.0.0
+      is-wsl: 3.1.0
+      which-pm-runs: 1.1.0
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/helper-string-parser@7.27.1': {}
+
+  '@babel/helper-validator-identifier@7.27.1': {}
+
+  '@babel/parser@7.27.5':
+    dependencies:
+      '@babel/types': 7.27.6
+
+  '@babel/types@7.27.6':
+    dependencies:
+      '@babel/helper-string-parser': 7.27.1
+      '@babel/helper-validator-identifier': 7.27.1
+
+  '@cacheable/node-cache@1.5.6':
+    dependencies:
+      cacheable: 1.10.0
+      hookified: 1.9.1
+      keyv: 5.3.4
+
+  '@capsizecss/unpack@2.4.0':
+    dependencies:
+      blob-to-buffer: 1.2.9
+      cross-fetch: 3.2.0
+      fontkit: 2.0.4
+    transitivePeerDependencies:
+      - encoding
+
+  '@emnapi/runtime@1.4.3':
+    dependencies:
+      tslib: 2.8.1
+    optional: true
+
+  '@esbuild/aix-ppc64@0.25.5':
+    optional: true
+
+  '@esbuild/android-arm64@0.25.5':
+    optional: true
+
+  '@esbuild/android-arm@0.25.5':
+    optional: true
+
+  '@esbuild/android-x64@0.25.5':
+    optional: true
+
+  '@esbuild/darwin-arm64@0.25.5':
+    optional: true
+
+  '@esbuild/darwin-x64@0.25.5':
+    optional: true
+
+  '@esbuild/freebsd-arm64@0.25.5':
+    optional: true
+
+  '@esbuild/freebsd-x64@0.25.5':
+    optional: true
+
+  '@esbuild/linux-arm64@0.25.5':
+    optional: true
+
+  '@esbuild/linux-arm@0.25.5':
+    optional: true
+
+  '@esbuild/linux-ia32@0.25.5':
+    optional: true
+
+  '@esbuild/linux-loong64@0.25.5':
+    optional: true
+
+  '@esbuild/linux-mips64el@0.25.5':
+    optional: true
+
+  '@esbuild/linux-ppc64@0.25.5':
+    optional: true
+
+  '@esbuild/linux-riscv64@0.25.5':
+    optional: true
+
+  '@esbuild/linux-s390x@0.25.5':
+    optional: true
+
+  '@esbuild/linux-x64@0.25.5':
+    optional: true
+
+  '@esbuild/netbsd-arm64@0.25.5':
+    optional: true
+
+  '@esbuild/netbsd-x64@0.25.5':
+    optional: true
+
+  '@esbuild/openbsd-arm64@0.25.5':
+    optional: true
+
+  '@esbuild/openbsd-x64@0.25.5':
+    optional: true
+
+  '@esbuild/sunos-x64@0.25.5':
+    optional: true
+
+  '@esbuild/win32-arm64@0.25.5':
+    optional: true
+
+  '@esbuild/win32-ia32@0.25.5':
+    optional: true
+
+  '@esbuild/win32-x64@0.25.5':
+    optional: true
+
+  '@img/sharp-darwin-arm64@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-darwin-arm64': 1.0.4
+    optional: true
+
+  '@img/sharp-darwin-x64@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-darwin-x64': 1.0.4
+    optional: true
+
+  '@img/sharp-libvips-darwin-arm64@1.0.4':
+    optional: true
+
+  '@img/sharp-libvips-darwin-x64@1.0.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-arm64@1.0.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-arm@1.0.5':
+    optional: true
+
+  '@img/sharp-libvips-linux-s390x@1.0.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-x64@1.0.4':
+    optional: true
+
+  '@img/sharp-libvips-linuxmusl-arm64@1.0.4':
+    optional: true
+
+  '@img/sharp-libvips-linuxmusl-x64@1.0.4':
+    optional: true
+
+  '@img/sharp-linux-arm64@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-arm64': 1.0.4
+    optional: true
+
+  '@img/sharp-linux-arm@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-arm': 1.0.5
+    optional: true
+
+  '@img/sharp-linux-s390x@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-s390x': 1.0.4
+    optional: true
+
+  '@img/sharp-linux-x64@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-x64': 1.0.4
+    optional: true
+
+  '@img/sharp-linuxmusl-arm64@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linuxmusl-arm64': 1.0.4
+    optional: true
+
+  '@img/sharp-linuxmusl-x64@0.33.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linuxmusl-x64': 1.0.4
+    optional: true
+
+  '@img/sharp-wasm32@0.33.5':
+    dependencies:
+      '@emnapi/runtime': 1.4.3
+    optional: true
+
+  '@img/sharp-win32-ia32@0.33.5':
+    optional: true
+
+  '@img/sharp-win32-x64@0.33.5':
+    optional: true
+
+  '@jridgewell/sourcemap-codec@1.5.0': {}
+
+  '@keyv/serialize@1.0.3':
+    dependencies:
+      buffer: 6.0.3
+
+  '@linwooddev/style@0.4.2': {}
+
+  '@oslojs/encoding@1.1.0': {}
+
+  '@rollup/pluginutils@5.1.4(rollup@4.43.0)':
+    dependencies:
+      '@types/estree': 1.0.8
+      estree-walker: 2.0.2
+      picomatch: 4.0.2
+    optionalDependencies:
+      rollup: 4.43.0
+
+  '@rollup/rollup-android-arm-eabi@4.43.0':
+    optional: true
+
+  '@rollup/rollup-android-arm64@4.43.0':
+    optional: true
+
+  '@rollup/rollup-darwin-arm64@4.43.0':
+    optional: true
+
+  '@rollup/rollup-darwin-x64@4.43.0':
+    optional: true
+
+  '@rollup/rollup-freebsd-arm64@4.43.0':
+    optional: true
+
+  '@rollup/rollup-freebsd-x64@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-arm-gnueabihf@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-arm-musleabihf@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-arm64-gnu@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-arm64-musl@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-loongarch64-gnu@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-powerpc64le-gnu@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-riscv64-gnu@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-riscv64-musl@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-s390x-gnu@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-x64-gnu@4.43.0':
+    optional: true
+
+  '@rollup/rollup-linux-x64-musl@4.43.0':
+    optional: true
+
+  '@rollup/rollup-win32-arm64-msvc@4.43.0':
+    optional: true
+
+  '@rollup/rollup-win32-ia32-msvc@4.43.0':
+    optional: true
+
+  '@rollup/rollup-win32-x64-msvc@4.43.0':
+    optional: true
+
+  '@shikijs/core@3.6.0':
+    dependencies:
+      '@shikijs/types': 3.6.0
+      '@shikijs/vscode-textmate': 10.0.2
+      '@types/hast': 3.0.4
+      hast-util-to-html: 9.0.5
+
+  '@shikijs/engine-javascript@3.6.0':
+    dependencies:
+      '@shikijs/types': 3.6.0
+      '@shikijs/vscode-textmate': 10.0.2
+      oniguruma-to-es: 4.3.3
+
+  '@shikijs/engine-oniguruma@3.6.0':
+    dependencies:
+      '@shikijs/types': 3.6.0
+      '@shikijs/vscode-textmate': 10.0.2
+
+  '@shikijs/langs@3.6.0':
+    dependencies:
+      '@shikijs/types': 3.6.0
+
+  '@shikijs/themes@3.6.0':
+    dependencies:
+      '@shikijs/types': 3.6.0
+
+  '@shikijs/types@3.6.0':
+    dependencies:
+      '@shikijs/vscode-textmate': 10.0.2
+      '@types/hast': 3.0.4
+
+  '@shikijs/vscode-textmate@10.0.2': {}
+
+  '@swc/helpers@0.5.17':
+    dependencies:
+      tslib: 2.8.1
+
+  '@types/debug@4.1.12':
+    dependencies:
+      '@types/ms': 2.1.0
+
+  '@types/estree@1.0.7': {}
+
+  '@types/estree@1.0.8': {}
+
+  '@types/fontkit@2.0.8':
+    dependencies:
+      '@types/node': 24.0.1
+
+  '@types/hast@3.0.4':
+    dependencies:
+      '@types/unist': 3.0.3
+
+  '@types/mdast@4.0.4':
+    dependencies:
+      '@types/unist': 3.0.3
+
+  '@types/ms@2.1.0': {}
+
+  '@types/nlcst@2.0.3':
+    dependencies:
+      '@types/unist': 3.0.3
+
+  '@types/node@24.0.1':
+    dependencies:
+      undici-types: 7.8.0
+
+  '@types/unist@3.0.3': {}
+
+  '@ungap/structured-clone@1.3.0': {}
+
+  acorn@8.15.0: {}
+
+  ansi-align@3.0.1:
+    dependencies:
+      string-width: 4.2.3
+
+  ansi-regex@5.0.1: {}
+
+  ansi-regex@6.1.0: {}
+
+  ansi-styles@6.2.1: {}
+
+  anymatch@3.1.3:
+    dependencies:
+      normalize-path: 3.0.0
+      picomatch: 2.3.1
+
+  argparse@2.0.1: {}
+
+  aria-query@5.3.2: {}
+
+  array-iterate@2.0.1: {}
+
+  astro@5.9.3(@types/node@24.0.1)(rollup@4.43.0)(typescript@5.8.3):
+    dependencies:
+      '@astrojs/compiler': 2.12.2
+      '@astrojs/internal-helpers': 0.6.1
+      '@astrojs/markdown-remark': 6.3.2
+      '@astrojs/telemetry': 3.3.0
+      '@capsizecss/unpack': 2.4.0
+      '@oslojs/encoding': 1.1.0
+      '@rollup/pluginutils': 5.1.4(rollup@4.43.0)
+      acorn: 8.15.0
+      aria-query: 5.3.2
+      axobject-query: 4.1.0
+      boxen: 8.0.1
+      ci-info: 4.2.0
+      clsx: 2.1.1
+      common-ancestor-path: 1.0.1
+      cookie: 1.0.2
+      cssesc: 3.0.0
+      debug: 4.4.1
+      deterministic-object-hash: 2.0.2
+      devalue: 5.1.1
+      diff: 5.2.0
+      dlv: 1.1.3
+      dset: 3.1.4
+      es-module-lexer: 1.7.0
+      esbuild: 0.25.5
+      estree-walker: 3.0.3
+      flattie: 1.1.1
+      fontace: 0.3.0
+      github-slugger: 2.0.0
+      html-escaper: 3.0.3
+      http-cache-semantics: 4.2.0
+      import-meta-resolve: 4.1.0
+      js-yaml: 4.1.0
+      kleur: 4.1.5
+      magic-string: 0.30.17
+      magicast: 0.3.5
+      mrmime: 2.0.1
+      neotraverse: 0.6.18
+      p-limit: 6.2.0
+      p-queue: 8.1.0
+      package-manager-detector: 1.3.0
+      picomatch: 4.0.2
+      prompts: 2.4.2
+      rehype: 13.0.2
+      semver: 7.7.2
+      shiki: 3.6.0
+      tinyexec: 0.3.2
+      tinyglobby: 0.2.14
+      tsconfck: 3.1.6(typescript@5.8.3)
+      ultrahtml: 1.6.0
+      unifont: 0.5.0
+      unist-util-visit: 5.0.0
+      unstorage: 1.16.0
+      vfile: 6.0.3
+      vite: 6.3.5(@types/node@24.0.1)
+      vitefu: 1.0.6(vite@6.3.5(@types/node@24.0.1))
+      xxhash-wasm: 1.1.0
+      yargs-parser: 21.1.1
+      yocto-spinner: 0.2.3
+      zod: 3.25.64
+      zod-to-json-schema: 3.24.5(zod@3.25.64)
+      zod-to-ts: 1.2.0(typescript@5.8.3)(zod@3.25.64)
+    optionalDependencies:
+      sharp: 0.33.5
+    transitivePeerDependencies:
+      - '@azure/app-configuration'
+      - '@azure/cosmos'
+      - '@azure/data-tables'
+      - '@azure/identity'
+      - '@azure/keyvault-secrets'
+      - '@azure/storage-blob'
+      - '@capacitor/preferences'
+      - '@deno/kv'
+      - '@netlify/blobs'
+      - '@planetscale/database'
+      - '@types/node'
+      - '@upstash/redis'
+      - '@vercel/blob'
+      - '@vercel/kv'
+      - aws4fetch
+      - db0
+      - encoding
+      - idb-keyval
+      - ioredis
+      - jiti
+      - less
+      - lightningcss
+      - rollup
+      - sass
+      - sass-embedded
+      - stylus
+      - sugarss
+      - supports-color
+      - terser
+      - tsx
+      - typescript
+      - uploadthing
+      - yaml
+
+  axobject-query@4.1.0: {}
+
+  bail@2.0.2: {}
+
+  base-64@1.0.0: {}
+
+  base64-js@1.5.1: {}
+
+  blob-to-buffer@1.2.9: {}
+
+  boxen@8.0.1:
+    dependencies:
+      ansi-align: 3.0.1
+      camelcase: 8.0.0
+      chalk: 5.4.1
+      cli-boxes: 3.0.0
+      string-width: 7.2.0
+      type-fest: 4.41.0
+      widest-line: 5.0.0
+      wrap-ansi: 9.0.0
+
+  brotli@1.3.3:
+    dependencies:
+      base64-js: 1.5.1
+
+  buffer@6.0.3:
+    dependencies:
+      base64-js: 1.5.1
+      ieee754: 1.2.1
+
+  cacheable@1.10.0:
+    dependencies:
+      hookified: 1.9.1
+      keyv: 5.3.4
+
+  camelcase@8.0.0: {}
+
+  ccount@2.0.1: {}
+
+  chalk@5.4.1: {}
+
+  character-entities-html4@2.1.0: {}
+
+  character-entities-legacy@3.0.0: {}
+
+  character-entities@2.0.2: {}
+
+  chokidar@4.0.3:
+    dependencies:
+      readdirp: 4.1.2
+
+  ci-info@4.2.0: {}
+
+  cli-boxes@3.0.0: {}
+
+  clone@2.1.2: {}
+
+  clsx@2.1.1: {}
+
+  color-convert@2.0.1:
+    dependencies:
+      color-name: 1.1.4
+    optional: true
+
+  color-name@1.1.4:
+    optional: true
+
+  color-string@1.9.1:
+    dependencies:
+      color-name: 1.1.4
+      simple-swizzle: 0.2.2
+    optional: true
+
+  color@4.2.3:
+    dependencies:
+      color-convert: 2.0.1
+      color-string: 1.9.1
+    optional: true
+
+  comma-separated-tokens@2.0.3: {}
+
+  common-ancestor-path@1.0.1: {}
+
+  cookie-es@1.2.2: {}
+
+  cookie@1.0.2: {}
+
+  cross-fetch@3.2.0:
+    dependencies:
+      node-fetch: 2.7.0
+    transitivePeerDependencies:
+      - encoding
+
+  crossws@0.3.5:
+    dependencies:
+      uncrypto: 0.1.3
+
+  css-tree@3.1.0:
+    dependencies:
+      mdn-data: 2.12.2
+      source-map-js: 1.2.1
+
+  cssesc@3.0.0: {}
+
+  debug@4.4.1:
+    dependencies:
+      ms: 2.1.3
+
+  decode-named-character-reference@1.2.0:
+    dependencies:
+      character-entities: 2.0.2
+
+  defu@6.1.4: {}
+
+  depd@2.0.0: {}
+
+  dequal@2.0.3: {}
+
+  destr@2.0.5: {}
+
+  detect-libc@2.0.4:
+    optional: true
+
+  deterministic-object-hash@2.0.2:
+    dependencies:
+      base-64: 1.0.0
+
+  devalue@5.1.1: {}
+
+  devlop@1.1.0:
+    dependencies:
+      dequal: 2.0.3
+
+  dfa@1.2.0: {}
+
+  diff@5.2.0: {}
+
+  dlv@1.1.3: {}
+
+  dset@3.1.4: {}
+
+  ee-first@1.1.1: {}
+
+  emoji-regex@10.4.0: {}
+
+  emoji-regex@8.0.0: {}
+
+  encodeurl@2.0.0: {}
+
+  entities@6.0.1: {}
+
+  es-module-lexer@1.7.0: {}
+
+  esbuild@0.25.5:
+    optionalDependencies:
+      '@esbuild/aix-ppc64': 0.25.5
+      '@esbuild/android-arm': 0.25.5
+      '@esbuild/android-arm64': 0.25.5
+      '@esbuild/android-x64': 0.25.5
+      '@esbuild/darwin-arm64': 0.25.5
+      '@esbuild/darwin-x64': 0.25.5
+      '@esbuild/freebsd-arm64': 0.25.5
+      '@esbuild/freebsd-x64': 0.25.5
+      '@esbuild/linux-arm': 0.25.5
+      '@esbuild/linux-arm64': 0.25.5
+      '@esbuild/linux-ia32': 0.25.5
+      '@esbuild/linux-loong64': 0.25.5
+      '@esbuild/linux-mips64el': 0.25.5
+      '@esbuild/linux-ppc64': 0.25.5
+      '@esbuild/linux-riscv64': 0.25.5
+      '@esbuild/linux-s390x': 0.25.5
+      '@esbuild/linux-x64': 0.25.5
+      '@esbuild/netbsd-arm64': 0.25.5
+      '@esbuild/netbsd-x64': 0.25.5
+      '@esbuild/openbsd-arm64': 0.25.5
+      '@esbuild/openbsd-x64': 0.25.5
+      '@esbuild/sunos-x64': 0.25.5
+      '@esbuild/win32-arm64': 0.25.5
+      '@esbuild/win32-ia32': 0.25.5
+      '@esbuild/win32-x64': 0.25.5
+
+  escape-html@1.0.3: {}
+
+  escape-string-regexp@5.0.0: {}
+
+  estree-walker@2.0.2: {}
+
+  estree-walker@3.0.3:
+    dependencies:
+      '@types/estree': 1.0.8
+
+  etag@1.8.1: {}
+
+  eventemitter3@5.0.1: {}
+
+  extend@3.0.2: {}
+
+  fast-deep-equal@3.1.3: {}
+
+  fdir@6.4.6(picomatch@4.0.2):
+    optionalDependencies:
+      picomatch: 4.0.2
+
+  flattie@1.1.1: {}
+
+  fontace@0.3.0:
+    dependencies:
+      '@types/fontkit': 2.0.8
+      fontkit: 2.0.4
+
+  fontkit@2.0.4:
+    dependencies:
+      '@swc/helpers': 0.5.17
+      brotli: 1.3.3
+      clone: 2.1.2
+      dfa: 1.2.0
+      fast-deep-equal: 3.1.3
+      restructure: 3.0.2
+      tiny-inflate: 1.0.3
+      unicode-properties: 1.4.1
+      unicode-trie: 2.0.0
+
+  fresh@2.0.0: {}
+
+  fsevents@2.3.3:
+    optional: true
+
+  get-east-asian-width@1.3.0: {}
+
+  github-slugger@2.0.0: {}
+
+  h3@1.15.3:
+    dependencies:
+      cookie-es: 1.2.2
+      crossws: 0.3.5
+      defu: 6.1.4
+      destr: 2.0.5
+      iron-webcrypto: 1.2.1
+      node-mock-http: 1.0.0
+      radix3: 1.1.2
+      ufo: 1.6.1
+      uncrypto: 0.1.3
+
+  hast-util-from-html@2.0.3:
+    dependencies:
+      '@types/hast': 3.0.4
+      devlop: 1.1.0
+      hast-util-from-parse5: 8.0.3
+      parse5: 7.3.0
+      vfile: 6.0.3
+      vfile-message: 4.0.2
+
+  hast-util-from-parse5@8.0.3:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/unist': 3.0.3
+      devlop: 1.1.0
+      hastscript: 9.0.1
+      property-information: 7.1.0
+      vfile: 6.0.3
+      vfile-location: 5.0.3
+      web-namespaces: 2.0.1
+
+  hast-util-is-element@3.0.0:
+    dependencies:
+      '@types/hast': 3.0.4
+
+  hast-util-parse-selector@4.0.0:
+    dependencies:
+      '@types/hast': 3.0.4
+
+  hast-util-raw@9.1.0:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/unist': 3.0.3
+      '@ungap/structured-clone': 1.3.0
+      hast-util-from-parse5: 8.0.3
+      hast-util-to-parse5: 8.0.0
+      html-void-elements: 3.0.0
+      mdast-util-to-hast: 13.2.0
+      parse5: 7.3.0
+      unist-util-position: 5.0.0
+      unist-util-visit: 5.0.0
+      vfile: 6.0.3
+      web-namespaces: 2.0.1
+      zwitch: 2.0.4
+
+  hast-util-to-html@9.0.5:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/unist': 3.0.3
+      ccount: 2.0.1
+      comma-separated-tokens: 2.0.3
+      hast-util-whitespace: 3.0.0
+      html-void-elements: 3.0.0
+      mdast-util-to-hast: 13.2.0
+      property-information: 7.1.0
+      space-separated-tokens: 2.0.2
+      stringify-entities: 4.0.4
+      zwitch: 2.0.4
+
+  hast-util-to-parse5@8.0.0:
+    dependencies:
+      '@types/hast': 3.0.4
+      comma-separated-tokens: 2.0.3
+      devlop: 1.1.0
+      property-information: 6.5.0
+      space-separated-tokens: 2.0.2
+      web-namespaces: 2.0.1
+      zwitch: 2.0.4
+
+  hast-util-to-text@4.0.2:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/unist': 3.0.3
+      hast-util-is-element: 3.0.0
+      unist-util-find-after: 5.0.0
+
+  hast-util-whitespace@3.0.0:
+    dependencies:
+      '@types/hast': 3.0.4
+
+  hastscript@9.0.1:
+    dependencies:
+      '@types/hast': 3.0.4
+      comma-separated-tokens: 2.0.3
+      hast-util-parse-selector: 4.0.0
+      property-information: 7.1.0
+      space-separated-tokens: 2.0.2
+
+  hookified@1.9.1: {}
+
+  html-escaper@3.0.3: {}
+
+  html-void-elements@3.0.0: {}
+
+  http-cache-semantics@4.2.0: {}
+
+  http-errors@2.0.0:
+    dependencies:
+      depd: 2.0.0
+      inherits: 2.0.4
+      setprototypeof: 1.2.0
+      statuses: 2.0.1
+      toidentifier: 1.0.1
+
+  ieee754@1.2.1: {}
+
+  import-meta-resolve@4.1.0: {}
+
+  inherits@2.0.4: {}
+
+  iron-webcrypto@1.2.1: {}
+
+  is-arrayish@0.3.2:
+    optional: true
+
+  is-docker@3.0.0: {}
+
+  is-fullwidth-code-point@3.0.0: {}
+
+  is-inside-container@1.0.0:
+    dependencies:
+      is-docker: 3.0.0
+
+  is-plain-obj@4.1.0: {}
+
+  is-wsl@3.1.0:
+    dependencies:
+      is-inside-container: 1.0.0
+
+  js-yaml@4.1.0:
+    dependencies:
+      argparse: 2.0.1
+
+  keyv@5.3.4:
+    dependencies:
+      '@keyv/serialize': 1.0.3
+
+  kleur@3.0.3: {}
+
+  kleur@4.1.5: {}
+
+  longest-streak@3.1.0: {}
+
+  lru-cache@10.4.3: {}
+
+  magic-string@0.30.17:
+    dependencies:
+      '@jridgewell/sourcemap-codec': 1.5.0
+
+  magicast@0.3.5:
+    dependencies:
+      '@babel/parser': 7.27.5
+      '@babel/types': 7.27.6
+      source-map-js: 1.2.1
+
+  markdown-table@3.0.4: {}
+
+  mdast-util-definitions@6.0.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      '@types/unist': 3.0.3
+      unist-util-visit: 5.0.0
+
+  mdast-util-find-and-replace@3.0.2:
+    dependencies:
+      '@types/mdast': 4.0.4
+      escape-string-regexp: 5.0.0
+      unist-util-is: 6.0.0
+      unist-util-visit-parents: 6.0.1
+
+  mdast-util-from-markdown@2.0.2:
+    dependencies:
+      '@types/mdast': 4.0.4
+      '@types/unist': 3.0.3
+      decode-named-character-reference: 1.2.0
+      devlop: 1.1.0
+      mdast-util-to-string: 4.0.0
+      micromark: 4.0.2
+      micromark-util-decode-numeric-character-reference: 2.0.2
+      micromark-util-decode-string: 2.0.1
+      micromark-util-normalize-identifier: 2.0.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+      unist-util-stringify-position: 4.0.0
+    transitivePeerDependencies:
+      - supports-color
+
+  mdast-util-gfm-autolink-literal@2.0.1:
+    dependencies:
+      '@types/mdast': 4.0.4
+      ccount: 2.0.1
+      devlop: 1.1.0
+      mdast-util-find-and-replace: 3.0.2
+      micromark-util-character: 2.1.1
+
+  mdast-util-gfm-footnote@2.1.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      devlop: 1.1.0
+      mdast-util-from-markdown: 2.0.2
+      mdast-util-to-markdown: 2.1.2
+      micromark-util-normalize-identifier: 2.0.1
+    transitivePeerDependencies:
+      - supports-color
+
+  mdast-util-gfm-strikethrough@2.0.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      mdast-util-from-markdown: 2.0.2
+      mdast-util-to-markdown: 2.1.2
+    transitivePeerDependencies:
+      - supports-color
+
+  mdast-util-gfm-table@2.0.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      devlop: 1.1.0
+      markdown-table: 3.0.4
+      mdast-util-from-markdown: 2.0.2
+      mdast-util-to-markdown: 2.1.2
+    transitivePeerDependencies:
+      - supports-color
+
+  mdast-util-gfm-task-list-item@2.0.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      devlop: 1.1.0
+      mdast-util-from-markdown: 2.0.2
+      mdast-util-to-markdown: 2.1.2
+    transitivePeerDependencies:
+      - supports-color
+
+  mdast-util-gfm@3.1.0:
+    dependencies:
+      mdast-util-from-markdown: 2.0.2
+      mdast-util-gfm-autolink-literal: 2.0.1
+      mdast-util-gfm-footnote: 2.1.0
+      mdast-util-gfm-strikethrough: 2.0.0
+      mdast-util-gfm-table: 2.0.0
+      mdast-util-gfm-task-list-item: 2.0.0
+      mdast-util-to-markdown: 2.1.2
+    transitivePeerDependencies:
+      - supports-color
+
+  mdast-util-phrasing@4.1.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      unist-util-is: 6.0.0
+
+  mdast-util-to-hast@13.2.0:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/mdast': 4.0.4
+      '@ungap/structured-clone': 1.3.0
+      devlop: 1.1.0
+      micromark-util-sanitize-uri: 2.0.1
+      trim-lines: 3.0.1
+      unist-util-position: 5.0.0
+      unist-util-visit: 5.0.0
+      vfile: 6.0.3
+
+  mdast-util-to-markdown@2.1.2:
+    dependencies:
+      '@types/mdast': 4.0.4
+      '@types/unist': 3.0.3
+      longest-streak: 3.1.0
+      mdast-util-phrasing: 4.1.0
+      mdast-util-to-string: 4.0.0
+      micromark-util-classify-character: 2.0.1
+      micromark-util-decode-string: 2.0.1
+      unist-util-visit: 5.0.0
+      zwitch: 2.0.4
+
+  mdast-util-to-string@4.0.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+
+  mdn-data@2.12.2: {}
+
+  micromark-core-commonmark@2.0.3:
+    dependencies:
+      decode-named-character-reference: 1.2.0
+      devlop: 1.1.0
+      micromark-factory-destination: 2.0.1
+      micromark-factory-label: 2.0.1
+      micromark-factory-space: 2.0.1
+      micromark-factory-title: 2.0.1
+      micromark-factory-whitespace: 2.0.1
+      micromark-util-character: 2.1.1
+      micromark-util-chunked: 2.0.1
+      micromark-util-classify-character: 2.0.1
+      micromark-util-html-tag-name: 2.0.1
+      micromark-util-normalize-identifier: 2.0.1
+      micromark-util-resolve-all: 2.0.1
+      micromark-util-subtokenize: 2.1.0
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-extension-gfm-autolink-literal@2.1.0:
+    dependencies:
+      micromark-util-character: 2.1.1
+      micromark-util-sanitize-uri: 2.0.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-extension-gfm-footnote@2.1.0:
+    dependencies:
+      devlop: 1.1.0
+      micromark-core-commonmark: 2.0.3
+      micromark-factory-space: 2.0.1
+      micromark-util-character: 2.1.1
+      micromark-util-normalize-identifier: 2.0.1
+      micromark-util-sanitize-uri: 2.0.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-extension-gfm-strikethrough@2.1.0:
+    dependencies:
+      devlop: 1.1.0
+      micromark-util-chunked: 2.0.1
+      micromark-util-classify-character: 2.0.1
+      micromark-util-resolve-all: 2.0.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-extension-gfm-table@2.1.1:
+    dependencies:
+      devlop: 1.1.0
+      micromark-factory-space: 2.0.1
+      micromark-util-character: 2.1.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-extension-gfm-tagfilter@2.0.0:
+    dependencies:
+      micromark-util-types: 2.0.2
+
+  micromark-extension-gfm-task-list-item@2.1.0:
+    dependencies:
+      devlop: 1.1.0
+      micromark-factory-space: 2.0.1
+      micromark-util-character: 2.1.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-extension-gfm@3.0.0:
+    dependencies:
+      micromark-extension-gfm-autolink-literal: 2.1.0
+      micromark-extension-gfm-footnote: 2.1.0
+      micromark-extension-gfm-strikethrough: 2.1.0
+      micromark-extension-gfm-table: 2.1.1
+      micromark-extension-gfm-tagfilter: 2.0.0
+      micromark-extension-gfm-task-list-item: 2.1.0
+      micromark-util-combine-extensions: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-factory-destination@2.0.1:
+    dependencies:
+      micromark-util-character: 2.1.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-factory-label@2.0.1:
+    dependencies:
+      devlop: 1.1.0
+      micromark-util-character: 2.1.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-factory-space@2.0.1:
+    dependencies:
+      micromark-util-character: 2.1.1
+      micromark-util-types: 2.0.2
+
+  micromark-factory-title@2.0.1:
+    dependencies:
+      micromark-factory-space: 2.0.1
+      micromark-util-character: 2.1.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-factory-whitespace@2.0.1:
+    dependencies:
+      micromark-factory-space: 2.0.1
+      micromark-util-character: 2.1.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-util-character@2.1.1:
+    dependencies:
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-util-chunked@2.0.1:
+    dependencies:
+      micromark-util-symbol: 2.0.1
+
+  micromark-util-classify-character@2.0.1:
+    dependencies:
+      micromark-util-character: 2.1.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-util-combine-extensions@2.0.1:
+    dependencies:
+      micromark-util-chunked: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-util-decode-numeric-character-reference@2.0.2:
+    dependencies:
+      micromark-util-symbol: 2.0.1
+
+  micromark-util-decode-string@2.0.1:
+    dependencies:
+      decode-named-character-reference: 1.2.0
+      micromark-util-character: 2.1.1
+      micromark-util-decode-numeric-character-reference: 2.0.2
+      micromark-util-symbol: 2.0.1
+
+  micromark-util-encode@2.0.1: {}
+
+  micromark-util-html-tag-name@2.0.1: {}
+
+  micromark-util-normalize-identifier@2.0.1:
+    dependencies:
+      micromark-util-symbol: 2.0.1
+
+  micromark-util-resolve-all@2.0.1:
+    dependencies:
+      micromark-util-types: 2.0.2
+
+  micromark-util-sanitize-uri@2.0.1:
+    dependencies:
+      micromark-util-character: 2.1.1
+      micromark-util-encode: 2.0.1
+      micromark-util-symbol: 2.0.1
+
+  micromark-util-subtokenize@2.1.0:
+    dependencies:
+      devlop: 1.1.0
+      micromark-util-chunked: 2.0.1
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-util-symbol@2.0.1: {}
+
+  micromark-util-types@2.0.2: {}
+
+  micromark@4.0.2:
+    dependencies:
+      '@types/debug': 4.1.12
+      debug: 4.4.1
+      decode-named-character-reference: 1.2.0
+      devlop: 1.1.0
+      micromark-core-commonmark: 2.0.3
+      micromark-factory-space: 2.0.1
+      micromark-util-character: 2.1.1
+      micromark-util-chunked: 2.0.1
+      micromark-util-combine-extensions: 2.0.1
+      micromark-util-decode-numeric-character-reference: 2.0.2
+      micromark-util-encode: 2.0.1
+      micromark-util-normalize-identifier: 2.0.1
+      micromark-util-resolve-all: 2.0.1
+      micromark-util-sanitize-uri: 2.0.1
+      micromark-util-subtokenize: 2.1.0
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+    transitivePeerDependencies:
+      - supports-color
+
+  mime-db@1.54.0: {}
+
+  mime-types@3.0.1:
+    dependencies:
+      mime-db: 1.54.0
+
+  mrmime@2.0.1: {}
+
+  ms@2.1.3: {}
+
+  nanoid@3.3.11: {}
+
+  neotraverse@0.6.18: {}
+
+  nlcst-to-string@4.0.0:
+    dependencies:
+      '@types/nlcst': 2.0.3
+
+  node-fetch-native@1.6.6: {}
+
+  node-fetch@2.7.0:
+    dependencies:
+      whatwg-url: 5.0.0
+
+  node-mock-http@1.0.0: {}
+
+  normalize-path@3.0.0: {}
+
+  ofetch@1.4.1:
+    dependencies:
+      destr: 2.0.5
+      node-fetch-native: 1.6.6
+      ufo: 1.6.1
+
+  ohash@2.0.11: {}
+
+  on-finished@2.4.1:
+    dependencies:
+      ee-first: 1.1.1
+
+  oniguruma-parser@0.12.1: {}
+
+  oniguruma-to-es@4.3.3:
+    dependencies:
+      oniguruma-parser: 0.12.1
+      regex: 6.0.1
+      regex-recursion: 6.0.2
+
+  p-limit@6.2.0:
+    dependencies:
+      yocto-queue: 1.2.1
+
+  p-queue@8.1.0:
+    dependencies:
+      eventemitter3: 5.0.1
+      p-timeout: 6.1.4
+
+  p-timeout@6.1.4: {}
+
+  package-manager-detector@1.3.0: {}
+
+  pako@0.2.9: {}
+
+  parse-latin@7.0.0:
+    dependencies:
+      '@types/nlcst': 2.0.3
+      '@types/unist': 3.0.3
+      nlcst-to-string: 4.0.0
+      unist-util-modify-children: 4.0.0
+      unist-util-visit-children: 3.0.0
+      vfile: 6.0.3
+
+  parse5@7.3.0:
+    dependencies:
+      entities: 6.0.1
+
+  picocolors@1.1.1: {}
+
+  picomatch@2.3.1: {}
+
+  picomatch@4.0.2: {}
+
+  postcss@8.5.5:
+    dependencies:
+      nanoid: 3.3.11
+      picocolors: 1.1.1
+      source-map-js: 1.2.1
+
+  prismjs@1.30.0: {}
+
+  prompts@2.4.2:
+    dependencies:
+      kleur: 3.0.3
+      sisteransi: 1.0.5
+
+  property-information@6.5.0: {}
+
+  property-information@7.1.0: {}
+
+  radix3@1.1.2: {}
+
+  range-parser@1.2.1: {}
+
+  readdirp@4.1.2: {}
+
+  regex-recursion@6.0.2:
+    dependencies:
+      regex-utilities: 2.3.0
+
+  regex-utilities@2.3.0: {}
+
+  regex@6.0.1:
+    dependencies:
+      regex-utilities: 2.3.0
+
+  rehype-parse@9.0.1:
+    dependencies:
+      '@types/hast': 3.0.4
+      hast-util-from-html: 2.0.3
+      unified: 11.0.5
+
+  rehype-raw@7.0.0:
+    dependencies:
+      '@types/hast': 3.0.4
+      hast-util-raw: 9.1.0
+      vfile: 6.0.3
+
+  rehype-stringify@10.0.1:
+    dependencies:
+      '@types/hast': 3.0.4
+      hast-util-to-html: 9.0.5
+      unified: 11.0.5
+
+  rehype@13.0.2:
+    dependencies:
+      '@types/hast': 3.0.4
+      rehype-parse: 9.0.1
+      rehype-stringify: 10.0.1
+      unified: 11.0.5
+
+  remark-gfm@4.0.1:
+    dependencies:
+      '@types/mdast': 4.0.4
+      mdast-util-gfm: 3.1.0
+      micromark-extension-gfm: 3.0.0
+      remark-parse: 11.0.0
+      remark-stringify: 11.0.0
+      unified: 11.0.5
+    transitivePeerDependencies:
+      - supports-color
+
+  remark-parse@11.0.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      mdast-util-from-markdown: 2.0.2
+      micromark-util-types: 2.0.2
+      unified: 11.0.5
+    transitivePeerDependencies:
+      - supports-color
+
+  remark-rehype@11.1.2:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/mdast': 4.0.4
+      mdast-util-to-hast: 13.2.0
+      unified: 11.0.5
+      vfile: 6.0.3
+
+  remark-smartypants@3.0.2:
+    dependencies:
+      retext: 9.0.0
+      retext-smartypants: 6.2.0
+      unified: 11.0.5
+      unist-util-visit: 5.0.0
+
+  remark-stringify@11.0.0:
+    dependencies:
+      '@types/mdast': 4.0.4
+      mdast-util-to-markdown: 2.1.2
+      unified: 11.0.5
+
+  restructure@3.0.2: {}
+
+  retext-latin@4.0.0:
+    dependencies:
+      '@types/nlcst': 2.0.3
+      parse-latin: 7.0.0
+      unified: 11.0.5
+
+  retext-smartypants@6.2.0:
+    dependencies:
+      '@types/nlcst': 2.0.3
+      nlcst-to-string: 4.0.0
+      unist-util-visit: 5.0.0
+
+  retext-stringify@4.0.0:
+    dependencies:
+      '@types/nlcst': 2.0.3
+      nlcst-to-string: 4.0.0
+      unified: 11.0.5
+
+  retext@9.0.0:
+    dependencies:
+      '@types/nlcst': 2.0.3
+      retext-latin: 4.0.0
+      retext-stringify: 4.0.0
+      unified: 11.0.5
+
+  rollup@4.43.0:
+    dependencies:
+      '@types/estree': 1.0.7
+    optionalDependencies:
+      '@rollup/rollup-android-arm-eabi': 4.43.0
+      '@rollup/rollup-android-arm64': 4.43.0
+      '@rollup/rollup-darwin-arm64': 4.43.0
+      '@rollup/rollup-darwin-x64': 4.43.0
+      '@rollup/rollup-freebsd-arm64': 4.43.0
+      '@rollup/rollup-freebsd-x64': 4.43.0
+      '@rollup/rollup-linux-arm-gnueabihf': 4.43.0
+      '@rollup/rollup-linux-arm-musleabihf': 4.43.0
+      '@rollup/rollup-linux-arm64-gnu': 4.43.0
+      '@rollup/rollup-linux-arm64-musl': 4.43.0
+      '@rollup/rollup-linux-loongarch64-gnu': 4.43.0
+      '@rollup/rollup-linux-powerpc64le-gnu': 4.43.0
+      '@rollup/rollup-linux-riscv64-gnu': 4.43.0
+      '@rollup/rollup-linux-riscv64-musl': 4.43.0
+      '@rollup/rollup-linux-s390x-gnu': 4.43.0
+      '@rollup/rollup-linux-x64-gnu': 4.43.0
+      '@rollup/rollup-linux-x64-musl': 4.43.0
+      '@rollup/rollup-win32-arm64-msvc': 4.43.0
+      '@rollup/rollup-win32-ia32-msvc': 4.43.0
+      '@rollup/rollup-win32-x64-msvc': 4.43.0
+      fsevents: 2.3.3
+
+  semver@7.7.2: {}
+
+  send@1.2.0:
+    dependencies:
+      debug: 4.4.1
+      encodeurl: 2.0.0
+      escape-html: 1.0.3
+      etag: 1.8.1
+      fresh: 2.0.0
+      http-errors: 2.0.0
+      mime-types: 3.0.1
+      ms: 2.1.3
+      on-finished: 2.4.1
+      range-parser: 1.2.1
+      statuses: 2.0.2
+    transitivePeerDependencies:
+      - supports-color
+
+  server-destroy@1.0.1: {}
+
+  setprototypeof@1.2.0: {}
+
+  sharp@0.33.5:
+    dependencies:
+      color: 4.2.3
+      detect-libc: 2.0.4
+      semver: 7.7.2
+    optionalDependencies:
+      '@img/sharp-darwin-arm64': 0.33.5
+      '@img/sharp-darwin-x64': 0.33.5
+      '@img/sharp-libvips-darwin-arm64': 1.0.4
+      '@img/sharp-libvips-darwin-x64': 1.0.4
+      '@img/sharp-libvips-linux-arm': 1.0.5
+      '@img/sharp-libvips-linux-arm64': 1.0.4
+      '@img/sharp-libvips-linux-s390x': 1.0.4
+      '@img/sharp-libvips-linux-x64': 1.0.4
+      '@img/sharp-libvips-linuxmusl-arm64': 1.0.4
+      '@img/sharp-libvips-linuxmusl-x64': 1.0.4
+      '@img/sharp-linux-arm': 0.33.5
+      '@img/sharp-linux-arm64': 0.33.5
+      '@img/sharp-linux-s390x': 0.33.5
+      '@img/sharp-linux-x64': 0.33.5
+      '@img/sharp-linuxmusl-arm64': 0.33.5
+      '@img/sharp-linuxmusl-x64': 0.33.5
+      '@img/sharp-wasm32': 0.33.5
+      '@img/sharp-win32-ia32': 0.33.5
+      '@img/sharp-win32-x64': 0.33.5
+    optional: true
+
+  shiki@3.6.0:
+    dependencies:
+      '@shikijs/core': 3.6.0
+      '@shikijs/engine-javascript': 3.6.0
+      '@shikijs/engine-oniguruma': 3.6.0
+      '@shikijs/langs': 3.6.0
+      '@shikijs/themes': 3.6.0
+      '@shikijs/types': 3.6.0
+      '@shikijs/vscode-textmate': 10.0.2
+      '@types/hast': 3.0.4
+
+  simple-swizzle@0.2.2:
+    dependencies:
+      is-arrayish: 0.3.2
+    optional: true
+
+  sisteransi@1.0.5: {}
+
+  smol-toml@1.3.4: {}
+
+  source-map-js@1.2.1: {}
+
+  space-separated-tokens@2.0.2: {}
+
+  statuses@2.0.1: {}
+
+  statuses@2.0.2: {}
+
+  string-width@4.2.3:
+    dependencies:
+      emoji-regex: 8.0.0
+      is-fullwidth-code-point: 3.0.0
+      strip-ansi: 6.0.1
+
+  string-width@7.2.0:
+    dependencies:
+      emoji-regex: 10.4.0
+      get-east-asian-width: 1.3.0
+      strip-ansi: 7.1.0
+
+  stringify-entities@4.0.4:
+    dependencies:
+      character-entities-html4: 2.1.0
+      character-entities-legacy: 3.0.0
+
+  strip-ansi@6.0.1:
+    dependencies:
+      ansi-regex: 5.0.1
+
+  strip-ansi@7.1.0:
+    dependencies:
+      ansi-regex: 6.1.0
+
+  tiny-inflate@1.0.3: {}
+
+  tinyexec@0.3.2: {}
+
+  tinyglobby@0.2.14:
+    dependencies:
+      fdir: 6.4.6(picomatch@4.0.2)
+      picomatch: 4.0.2
+
+  toidentifier@1.0.1: {}
+
+  tr46@0.0.3: {}
+
+  trim-lines@3.0.1: {}
+
+  trough@2.2.0: {}
+
+  tsconfck@3.1.6(typescript@5.8.3):
+    optionalDependencies:
+      typescript: 5.8.3
+
+  tslib@2.8.1: {}
+
+  type-fest@4.41.0: {}
+
+  typescript@5.8.3: {}
+
+  ufo@1.6.1: {}
+
+  ultrahtml@1.6.0: {}
+
+  uncrypto@0.1.3: {}
+
+  undici-types@7.8.0: {}
+
+  unicode-properties@1.4.1:
+    dependencies:
+      base64-js: 1.5.1
+      unicode-trie: 2.0.0
+
+  unicode-trie@2.0.0:
+    dependencies:
+      pako: 0.2.9
+      tiny-inflate: 1.0.3
+
+  unified@11.0.5:
+    dependencies:
+      '@types/unist': 3.0.3
+      bail: 2.0.2
+      devlop: 1.1.0
+      extend: 3.0.2
+      is-plain-obj: 4.1.0
+      trough: 2.2.0
+      vfile: 6.0.3
+
+  unifont@0.5.0:
+    dependencies:
+      css-tree: 3.1.0
+      ohash: 2.0.11
+
+  unist-util-find-after@5.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-is: 6.0.0
+
+  unist-util-is@6.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+
+  unist-util-modify-children@4.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+      array-iterate: 2.0.1
+
+  unist-util-position@5.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+
+  unist-util-remove-position@5.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-visit: 5.0.0
+
+  unist-util-stringify-position@4.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+
+  unist-util-visit-children@3.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+
+  unist-util-visit-parents@6.0.1:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-is: 6.0.0
+
+  unist-util-visit@5.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-is: 6.0.0
+      unist-util-visit-parents: 6.0.1
+
+  unstorage@1.16.0:
+    dependencies:
+      anymatch: 3.1.3
+      chokidar: 4.0.3
+      destr: 2.0.5
+      h3: 1.15.3
+      lru-cache: 10.4.3
+      node-fetch-native: 1.6.6
+      ofetch: 1.4.1
+      ufo: 1.6.1
+
+  vfile-location@5.0.3:
+    dependencies:
+      '@types/unist': 3.0.3
+      vfile: 6.0.3
+
+  vfile-message@4.0.2:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-stringify-position: 4.0.0
+
+  vfile@6.0.3:
+    dependencies:
+      '@types/unist': 3.0.3
+      vfile-message: 4.0.2
+
+  vite@6.3.5(@types/node@24.0.1):
+    dependencies:
+      esbuild: 0.25.5
+      fdir: 6.4.6(picomatch@4.0.2)
+      picomatch: 4.0.2
+      postcss: 8.5.5
+      rollup: 4.43.0
+      tinyglobby: 0.2.14
+    optionalDependencies:
+      '@types/node': 24.0.1
+      fsevents: 2.3.3
+
+  vitefu@1.0.6(vite@6.3.5(@types/node@24.0.1)):
+    optionalDependencies:
+      vite: 6.3.5(@types/node@24.0.1)
+
+  web-namespaces@2.0.1: {}
+
+  webidl-conversions@3.0.1: {}
+
+  whatwg-url@5.0.0:
+    dependencies:
+      tr46: 0.0.3
+      webidl-conversions: 3.0.1
+
+  which-pm-runs@1.1.0: {}
+
+  widest-line@5.0.0:
+    dependencies:
+      string-width: 7.2.0
+
+  wrap-ansi@9.0.0:
+    dependencies:
+      ansi-styles: 6.2.1
+      string-width: 7.2.0
+      strip-ansi: 7.1.0
+
+  xxhash-wasm@1.1.0: {}
+
+  yargs-parser@21.1.1: {}
+
+  yocto-queue@1.2.1: {}
+
+  yocto-spinner@0.2.3:
+    dependencies:
+      yoctocolors: 2.1.1
+
+  yoctocolors@2.1.1: {}
+
+  zod-to-json-schema@3.24.5(zod@3.25.64):
+    dependencies:
+      zod: 3.25.64
+
+  zod-to-ts@1.2.0(typescript@5.8.3)(zod@3.25.64):
+    dependencies:
+      typescript: 5.8.3
+      zod: 3.25.64
+
+  zod@3.25.64: {}
+
+  zwitch@2.0.4: {}
diff --git a/servers/public/favicon.svg b/servers/public/favicon.svg
new file mode 100644
index 00000000..fbf392b3
--- /dev/null
+++ b/servers/public/favicon.svg
@@ -0,0 +1,92 @@
+<svg width="64" height="64" viewBox="0 0 64 64" fill="none" xmlns="http://www.w3.org/2000/svg">
+<g filter="url(#filter0_d_1761_6)">
+<circle cx="18.5" cy="17.5" r="4.5" fill="#844623"/>
+</g>
+<g filter="url(#filter1_d_1761_6)">
+<circle cx="45.5" cy="17.5" r="4.5" fill="#844623"/>
+</g>
+<path d="M14.7919 25.9345C15.7831 20.7497 20.3176 17 25.5963 17H38.4037C43.6824 17 48.2169 20.7497 49.2081 25.9345L51.5022 37.9345C52.7985 44.7151 47.6013 51 40.6978 51H23.3022C16.3987 51 11.2015 44.7151 12.4978 37.9345L14.7919 25.9345Z" fill="#B46B43"/>
+<g filter="url(#filter2_d_1761_6)">
+<path d="M15.192 23.7818C16.2446 18.6689 20.7459 15 25.966 15H38.034C43.2541 15 47.7554 18.6689 48.808 23.7818L51.2786 35.7818C52.6835 42.6056 47.4715 49 40.5046 49H23.4954C16.5285 49 11.3165 42.6056 12.7214 35.7818L15.192 23.7818Z" fill="#844623"/>
+</g>
+<g filter="url(#filter3_d_1761_6)">
+<circle cx="21" cy="25" r="3" fill="white"/>
+</g>
+<circle cx="32" cy="36" r="9" fill="#8B5334"/>
+<g filter="url(#filter4_d_1761_6)">
+<circle cx="21" cy="25" r="2" fill="black"/>
+</g>
+<g filter="url(#filter5_d_1761_6)">
+<circle cx="43" cy="25" r="3" fill="white"/>
+</g>
+<g filter="url(#filter6_d_1761_6)">
+<circle cx="43" cy="25" r="2" fill="black"/>
+</g>
+<path d="M36 34C36 35.1046 34 36 31.9996 36C30 36 28 35.1046 28 34C28 32.8954 30.895 32 31.9996 32C33.1042 32 36 32.8954 36 34Z" fill="black"/>
+<path d="M32 35C32 35 32 35.0948 32 39M32 39C32 39 29.9162 40 29 40C27.2781 40 26 39 26 39M32 39C32 39 33.7371 40 35 40C36.5139 40 38 39 38 39" stroke="black" stroke-width="0.5"/>
+<defs>
+<filter id="filter0_d_1761_6" x="10" y="13" width="17" height="17" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow_1761_6"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow_1761_6" result="shape"/>
+</filter>
+<filter id="filter1_d_1761_6" x="37" y="13" width="17" height="17" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow_1761_6"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow_1761_6" result="shape"/>
+</filter>
+<filter id="filter2_d_1761_6" x="8.49121" y="15" width="47.0176" height="42" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow_1761_6"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow_1761_6" result="shape"/>
+</filter>
+<filter id="filter3_d_1761_6" x="14" y="22" width="14" height="14" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow_1761_6"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow_1761_6" result="shape"/>
+</filter>
+<filter id="filter4_d_1761_6" x="15" y="23" width="12" height="12" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow_1761_6"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow_1761_6" result="shape"/>
+</filter>
+<filter id="filter5_d_1761_6" x="36" y="22" width="14" height="14" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow_1761_6"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow_1761_6" result="shape"/>
+</filter>
+<filter id="filter6_d_1761_6" x="37" y="23" width="12" height="12" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow_1761_6"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow_1761_6" result="shape"/>
+</filter>
+</defs>
+</svg>
diff --git a/servers/src/assets/astro.svg b/servers/src/assets/astro.svg
new file mode 100644
index 00000000..8cf8fb0c
--- /dev/null
+++ b/servers/src/assets/astro.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" fill="none" width="115" height="48"><path fill="#17191E" d="M7.77 36.35C6.4 35.11 6 32.51 6.57 30.62c.99 1.2 2.35 1.57 3.75 1.78 2.18.33 4.31.2 6.33-.78.23-.12.44-.27.7-.42.18.55.23 1.1.17 1.67a4.56 4.56 0 0 1-1.94 3.23c-.43.32-.9.61-1.34.91-1.38.94-1.76 2.03-1.24 3.62l.05.17a3.63 3.63 0 0 1-1.6-1.38 3.87 3.87 0 0 1-.63-2.1c0-.37 0-.74-.05-1.1-.13-.9-.55-1.3-1.33-1.32a1.56 1.56 0 0 0-1.63 1.26c0 .06-.03.12-.05.2Z"/><path fill="url(#a)" d="M7.77 36.35C6.4 35.11 6 32.51 6.57 30.62c.99 1.2 2.35 1.57 3.75 1.78 2.18.33 4.31.2 6.33-.78.23-.12.44-.27.7-.42.18.55.23 1.1.17 1.67a4.56 4.56 0 0 1-1.94 3.23c-.43.32-.9.61-1.34.91-1.38.94-1.76 2.03-1.24 3.62l.05.17a3.63 3.63 0 0 1-1.6-1.38 3.87 3.87 0 0 1-.63-2.1c0-.37 0-.74-.05-1.1-.13-.9-.55-1.3-1.33-1.32a1.56 1.56 0 0 0-1.63 1.26c0 .06-.03.12-.05.2Z"/><path fill="#17191E" d="M.02 30.31s4.02-1.95 8.05-1.95l3.04-9.4c.11-.45.44-.76.82-.76.37 0 .7.31.82.76l3.04 9.4c4.77 0 8.05 1.95 8.05 1.95L17 11.71c-.2-.56-.53-.91-.98-.91H7.83c-.44 0-.76.35-.97.9L.02 30.31Zm42.37-5.97c0 1.64-2.05 2.62-4.88 2.62-1.85 0-2.5-.45-2.5-1.41 0-1 .8-1.49 2.65-1.49 1.67 0 3.09.03 4.73.23v.05Zm.03-2.04a21.37 21.37 0 0 0-4.37-.36c-5.32 0-7.82 1.25-7.82 4.18 0 3.04 1.71 4.2 5.68 4.2 3.35 0 5.63-.84 6.46-2.92h.14c-.03.5-.05 1-.05 1.4 0 1.07.18 1.16 1.06 1.16h4.15a16.9 16.9 0 0 1-.36-4c0-1.67.06-2.93.06-4.62 0-3.45-2.07-5.64-8.56-5.64-2.8 0-5.9.48-8.26 1.19.22.93.54 2.83.7 4.06 2.04-.96 4.95-1.37 7.2-1.37 3.11 0 3.97.71 3.97 2.15v.57Zm11.37 3c-.56.07-1.33.07-2.12.07-.83 0-1.6-.03-2.12-.1l-.02.58c0 2.85 1.87 4.52 8.45 4.52 6.2 0 8.2-1.64 8.2-4.55 0-2.74-1.33-4.09-7.2-4.39-4.58-.2-4.99-.7-4.99-1.28 0-.66.59-1 3.65-1 3.18 0 4.03.43 4.03 1.35v.2a46.13 46.13 0 0 1 4.24.03l.02-.55c0-3.36-2.8-4.46-8.2-4.46-6.08 0-8.13 1.49-8.13 4.39 0 2.6 1.64 4.23 7.48 4.48 4.3.14 4.77.62 4.77 1.28 0 .7-.7 1.03-3.71 1.03-3.47 0-4.35-.48-4.35-1.47v-.13Zm19.82-12.05a17.5 17.5 0 0 1-6.24 3.48c.03.84.03 2.4.03 3.24l1.5.02c-.02 1.63-.04 3.6-.04 4.9 0 3.04 1.6 5.32 6.58 5.32 2.1 0 3.5-.23 5.23-.6a43.77 43.77 0 0 1-.46-4.13c-1.03.34-2.34.53-3.78.53-2 0-2.82-.55-2.82-2.13 0-1.37 0-2.65.03-3.84 2.57.02 5.13.07 6.64.11-.02-1.18.03-2.9.1-4.04-2.2.04-4.65.07-6.68.07l.07-2.93h-.16Zm13.46 6.04a767.33 767.33 0 0 1 .07-3.18H82.6c.07 1.96.07 3.98.07 6.92 0 2.95-.03 4.99-.07 6.93h5.18c-.09-1.37-.11-3.68-.11-5.65 0-3.1 1.26-4 4.12-4 1.33 0 2.28.16 3.1.46.03-1.16.26-3.43.4-4.43-.86-.25-1.81-.41-2.96-.41-2.46-.03-4.26.98-5.1 3.38l-.17-.02Zm22.55 3.65c0 2.5-1.8 3.66-4.64 3.66-2.81 0-4.61-1.1-4.61-3.66s1.82-3.52 4.61-3.52c2.82 0 4.64 1.03 4.64 3.52Zm4.71-.11c0-4.96-3.87-7.18-9.35-7.18-5.5 0-9.23 2.22-9.23 7.18 0 4.94 3.49 7.59 9.21 7.59 5.77 0 9.37-2.65 9.37-7.6Z"/><defs><linearGradient id="a" x1="6.33" x2="19.43" y1="40.8" y2="34.6" gradientUnits="userSpaceOnUse"><stop stop-color="#D83333"/><stop offset="1" stop-color="#F041FF"/></linearGradient></defs></svg>
diff --git a/servers/src/assets/background.svg b/servers/src/assets/background.svg
new file mode 100644
index 00000000..4b2be0ac
--- /dev/null
+++ b/servers/src/assets/background.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" width="1440" height="1024" fill="none"><path fill="url(#a)" fill-rule="evenodd" d="M-217.58 475.75c91.82-72.02 225.52-29.38 341.2-44.74C240 415.56 372.33 315.14 466.77 384.9c102.9 76.02 44.74 246.76 90.31 366.31 29.83 78.24 90.48 136.14 129.48 210.23 57.92 109.99 169.67 208.23 155.9 331.77-13.52 121.26-103.42 264.33-224.23 281.37-141.96 20.03-232.72-220.96-374.06-196.99-151.7 25.73-172.68 330.24-325.85 315.72-128.6-12.2-110.9-230.73-128.15-358.76-12.16-90.14 65.87-176.25 44.1-264.57-26.42-107.2-167.12-163.46-176.72-273.45-10.15-116.29 33.01-248.75 124.87-320.79Z" clip-rule="evenodd" style="opacity:.154"/><path fill="url(#b)" fill-rule="evenodd" d="M1103.43 115.43c146.42-19.45 275.33-155.84 413.5-103.59 188.09 71.13 409 212.64 407.06 413.88-1.94 201.25-259.28 278.6-414.96 405.96-130 106.35-240.24 294.39-405.6 265.3-163.7-28.8-161.93-274.12-284.34-386.66-134.95-124.06-436-101.46-445.82-284.6-9.68-180.38 247.41-246.3 413.54-316.9 101.01-42.93 207.83 21.06 316.62 6.61Z" clip-rule="evenodd" style="opacity:.154"/><defs><linearGradient id="b" x1="373" x2="1995.44" y1="1100" y2="118.03" gradientUnits="userSpaceOnUse"><stop stop-color="#D83333"/><stop offset="1" stop-color="#F041FF"/></linearGradient><linearGradient id="a" x1="107.37" x2="1130.66" y1="1993.35" y2="1026.31" gradientUnits="userSpaceOnUse"><stop stop-color="#3245FF"/><stop offset="1" stop-color="#BC52EE"/></linearGradient></defs></svg>
diff --git a/servers/src/components/LoadingServerEntry.astro b/servers/src/components/LoadingServerEntry.astro
new file mode 100644
index 00000000..0a2fe6dd
--- /dev/null
+++ b/servers/src/components/LoadingServerEntry.astro
@@ -0,0 +1,16 @@
+---
+import { fetchServerStatus } from "../scripts/servers/info";
+import type { Server } from "../scripts/servers/utils";
+import ServerEntry from "./ServerEntry.astro";
+
+
+interface Props {
+  server: Server;
+}
+
+const { server } = Astro.props;
+---
+
+<ServerEntry serverStatus={true} server={server} server:defer>
+  <ServerEntry slot="fallback" server={server} />
+</ServerEntry>
diff --git a/servers/src/components/ServerEntry.astro b/servers/src/components/ServerEntry.astro
new file mode 100644
index 00000000..f5455e57
--- /dev/null
+++ b/servers/src/components/ServerEntry.astro
@@ -0,0 +1,63 @@
+---
+import { fetchServerStatus, type ServerStatus } from "../scripts/servers/info";
+import type { Server } from "../scripts/servers/utils";
+
+interface Props {
+  server: Server;
+  serverStatus?: boolean;
+}
+
+const { server } = Astro.props;
+let serverStatus: ServerStatus | undefined | null = undefined;
+if (Astro.props.serverStatus) {
+  serverStatus = await fetchServerStatus(server);
+}
+
+function buildJoinURL(): string {
+  return `https://launch.setonix.linwood.dev/connect?address=${encodeURIComponent(server.address)}&secure=${encodeURIComponent(server.secure ?? 'true')}`;
+}
+
+const secureLabel = server.secure ? "Secure server" : "Unsecure server";
+const playerText = serverStatus == null
+  ? "Offline"
+  : serverStatus.currentPlayers +
+    (serverStatus.maxPlayers == null ? "" : `/${serverStatus.maxPlayers}`);
+---
+
+<li role="listitem">
+  <a
+    class:list={[
+      "card",
+      server.highlighted ? "primary" : "secondary",
+      "gap-xs",
+    ]}
+    href={buildJoinURL()}
+    target="_blank"
+    rel="noopener"
+    aria-label={`Connect to ${server.address} (${secureLabel})`}
+  >
+    <div class="row gap-xs justify-between align-start">
+      <p class="h3">{server.address}</p>
+      <div class="row gap-xs align-center" aria-live="polite">
+        {serverStatus !== undefined && (
+          <p class="bold m-none">
+            {playerText}
+          </p>
+        )}
+        <span
+          role="img"
+          aria-label={secureLabel}
+          title={secureLabel}
+        >
+          {server.secure ? "🔒" : "🔓"}
+        </span>
+      </div>
+    </div>
+
+    <p class="text">
+      {serverStatus === undefined
+        ? "Loading…"
+        : serverStatus?.description || "No description available."}
+    </p>
+  </a>
+</li>
diff --git a/servers/src/data/servers.json b/servers/src/data/servers.json
new file mode 100644
index 00000000..421ad1ad
--- /dev/null
+++ b/servers/src/data/servers.json
@@ -0,0 +1,3 @@
+[
+  {"address": "127.0.0.1", "secure": false}
+]
\ No newline at end of file
diff --git a/servers/src/layouts/Layout.astro b/servers/src/layouts/Layout.astro
new file mode 100644
index 00000000..6fd6384e
--- /dev/null
+++ b/servers/src/layouts/Layout.astro
@@ -0,0 +1,24 @@
+---
+import '@linwooddev/style/css/main.css';
+---
+<!doctype html>
+<html lang="en">
+	<head>
+		<meta charset="UTF-8" />
+		<meta name="viewport" content="width=device-width" />
+		<link rel="icon" type="image/svg+xml" href="/favicon.svg" />
+		<title>Setonix Serverlist</title>
+	</head>
+	<body>
+		<slot />
+	</body>
+</html>
+
+<style>
+	html,
+	body {
+		margin: 0;
+		width: 100%;
+		height: 100%;
+	}
+</style>
diff --git a/servers/src/pages/data.json.ts b/servers/src/pages/data.json.ts
new file mode 100644
index 00000000..b6d3212e
--- /dev/null
+++ b/servers/src/pages/data.json.ts
@@ -0,0 +1,10 @@
+import type { APIRoute } from 'astro';
+import { loadServersFromConfig } from '../scripts/servers/list';
+
+export async function GET() {
+  const servers = await loadServersFromConfig();
+  return new Response(JSON.stringify({servers}), {
+    status: 200,
+    headers: { 'Content-Type': 'application/json' },
+  });
+};
\ No newline at end of file
diff --git a/servers/src/pages/index.astro b/servers/src/pages/index.astro
new file mode 100644
index 00000000..ff13cfac
--- /dev/null
+++ b/servers/src/pages/index.astro
@@ -0,0 +1,35 @@
+---
+import Layout from "../layouts/Layout.astro";
+import { loadServersFromConfig } from "../scripts/servers/list";
+import ServerEntry from "../components/ServerEntry.astro";
+import LoadingServerEntry from "../components/LoadingServerEntry.astro";
+
+const servers = await loadServersFromConfig();
+---
+
+<Layout>
+  <header class="navbar-lg sticky">
+    <span class="navbar-title">Setonix Servers</span>
+    <nav class="navbar-items">
+      <a class="btn secondary" href="https://setonix.linwood.dev">Docs</a>
+      <div class="h-divider"></div>
+      <a class="btn secondary" href="https://github.com/LinwoodDev/Setonix"
+        >GitHub</a
+      >
+    </nav>
+  </header>
+  <div class="container-lg">
+    <div class="big-section">
+      <h2>Server List</h2>
+    </div>
+    <div class="big-section">
+      <ul class="col justify-center wrap gap-sm">
+        {
+          servers.map((e) => (
+            <LoadingServerEntry server={e} />
+          ))
+        }
+      </ul>
+    </div>
+  </div>
+</Layout>
diff --git a/servers/src/scripts/servers/info.ts b/servers/src/scripts/servers/info.ts
new file mode 100644
index 00000000..bcc00c21
--- /dev/null
+++ b/servers/src/scripts/servers/info.ts
@@ -0,0 +1,56 @@
+import NodeCache from "@cacheable/node-cache";
+import { buildServerURL, type Server } from "./utils";
+import { getRemoteServerStatus } from "./list";
+import { USE_REMOTE_URLS_STATUS } from "astro:env/server";
+
+const cache = new NodeCache({ stdTTL: 60 * 10 });
+const failedTTL = 60 * 5; // 5 minutes for failed requests
+
+export type ServerStatus = {
+  description: string;
+  maxPlayers?: number;
+  currentPlayers: number;
+  packsSignature: Record<string, unknown>;
+};
+
+export async function fetchServerStatus(
+  server: Server,
+): Promise<ServerStatus | null> {
+  if (server.remote && USE_REMOTE_URLS_STATUS) {
+    return getRemoteServerStatus(server);
+  }
+  const cacheKey = `server-status:${server.address}`;
+  const cached = cache.get(cacheKey);
+  if (cached) {
+    return Promise.resolve(cached as ServerStatus);
+  }
+  const url = buildServerURL(server);
+  const response = (await fetch(url, {
+    method: "GET",
+    headers: {
+      "Content-Type": "application/json",
+      "X-Setonix-Method": "info",
+    },
+  })
+    .then((res) => {
+      if (!res.ok) {
+        throw new Error(
+          `Server ${server.address} returned status ${res.status}`
+        );
+      }
+      return res.json();
+    })
+    .catch((error) => {
+      console.error(
+        `Error fetching status for server ${server.address}:`,
+        error
+      );
+      return null;
+    })) as ServerStatus | null;
+  cache.set(cacheKey, response, response ? undefined : failedTTL);
+  if (!response) {
+    console.warn(`Invalid response from server ${server.address}:`, response);
+    return null;
+  }
+  return response;
+}
diff --git a/servers/src/scripts/servers/list.ts b/servers/src/scripts/servers/list.ts
new file mode 100644
index 00000000..b37ca56d
--- /dev/null
+++ b/servers/src/scripts/servers/list.ts
@@ -0,0 +1,66 @@
+import { NodeCache } from "@cacheable/node-cache";
+import { promises as fs } from "fs";
+import type { Server } from "./utils";
+import { REMOTE_URLS, USE_REMOTE_URLS_STATUS } from "astro:env/server";
+import type { ServerStatus } from "./info";
+
+// Cache with 5 minutes TTL
+const cache = new NodeCache({ stdTTL: 60 * 10 });
+// Cache for local servers list
+let localCache: Server[] | null = null;
+
+export async function getRemoteServerStatus(server: Server) {
+  return ((server as any)["status"] as ServerStatus) || null;
+}
+
+/**
+ * Loads the local servers.json and merges it with all remote lists.
+ */
+export async function loadServers(
+  localPath: string,
+  remoteUrls: string[] = []
+): Promise<Server[]> {
+  if (!localCache) {
+    const localData = await fs.readFile(localPath, "utf-8");
+    localCache = JSON.parse(localData);
+  }
+  const local = localCache!;
+
+  async function fetchRemote(url: string): Promise<Server[]> {
+    const cacheKey = `servers:${url}`;
+    const cached = cache.get<Server[]>(cacheKey);
+    if (cached) return cached;
+
+    const res = await fetch(url);
+    console.log(`Fetching remote servers from ${url}`);
+    if (!res.ok) {
+      console.warn(`Fetch from ${url} failed: ${res.status}`);
+      return [];
+    }
+
+    const data = await res.json();
+    if (!("servers" in data)) {
+      console.warn(`Invalid data format from ${url}:`, data);
+      return [];
+    }
+    const servers = data["servers"].map((e: any) => ({
+      remote: true,
+      ...e,
+    })) as Server[];
+    cache.set(cacheKey, servers);
+    return servers;
+  }
+
+  const remoteLists = await Promise.all(remoteUrls.map(fetchRemote));
+
+  return [...local, ...remoteLists.flat()];
+}
+
+export async function loadServersFromConfig() {
+  const localPath = "src/data/servers.json";
+  const remotes = REMOTE_URLS?.split(",");
+  return await loadServers(
+    localPath,
+    remotes?.filter((url) => url.trim() !== "") || []
+  );
+}
diff --git a/servers/src/scripts/servers/utils.ts b/servers/src/scripts/servers/utils.ts
new file mode 100644
index 00000000..630f03b2
--- /dev/null
+++ b/servers/src/scripts/servers/utils.ts
@@ -0,0 +1,18 @@
+import { z } from "astro:content";
+
+export const ServerObject = z.object({
+  address: z.string().url(),
+  secure: z.boolean().optional(),
+  highlighted: z.boolean().optional(),
+  remote: z.boolean().optional(),
+});
+
+export type Server = z.infer<typeof ServerObject>;
+
+export function buildServerURL(server: Server, webSocket?: boolean): string {
+  const protocol = (webSocket ? "ws": "http") + (server.secure ? "s" : "");
+  const [hostPort, ...segments] = server.address.split("/");
+  const path = segments.length ? `/${segments.join("/")}` : "";
+  const hostWithPort = hostPort.includes(":") ? hostPort : `${hostPort}:28006`;
+  return `${protocol}://${hostWithPort}${path}`;
+}
diff --git a/servers/tsconfig.json b/servers/tsconfig.json
new file mode 100644
index 00000000..8bf91d3b
--- /dev/null
+++ b/servers/tsconfig.json
@@ -0,0 +1,5 @@
+{
+  "extends": "astro/tsconfigs/strict",
+  "include": [".astro/types.d.ts", "**/*"],
+  "exclude": ["dist"]
+}